DE2834059A1 - Lichtempfindliches kopiermaterial und verfahren zu seiner herstellung - Google Patents
Lichtempfindliches kopiermaterial und verfahren zu seiner herstellungInfo
- Publication number
- DE2834059A1 DE2834059A1 DE19782834059 DE2834059A DE2834059A1 DE 2834059 A1 DE2834059 A1 DE 2834059A1 DE 19782834059 DE19782834059 DE 19782834059 DE 2834059 A DE2834059 A DE 2834059A DE 2834059 A1 DE2834059 A1 DE 2834059A1
- Authority
- DE
- Germany
- Prior art keywords
- water
- layer
- hoechst
- copying material
- weight
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000000463 material Substances 0.000 title claims abstract description 39
- 238000004519 manufacturing process Methods 0.000 title claims abstract description 12
- 238000000034 method Methods 0.000 title claims abstract description 8
- 239000007859 condensation product Substances 0.000 claims abstract description 27
- 239000011248 coating agent Substances 0.000 claims abstract description 23
- 238000000576 coating method Methods 0.000 claims abstract description 23
- 239000006185 dispersion Substances 0.000 claims abstract description 23
- 239000012954 diazonium Substances 0.000 claims abstract description 21
- -1 aromatic diazonium salt Chemical class 0.000 claims abstract description 16
- 229920003176 water-insoluble polymer Polymers 0.000 claims abstract description 15
- 229920000642 polymer Polymers 0.000 claims abstract description 14
- 238000001035 drying Methods 0.000 claims abstract description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 32
- 239000000203 mixture Substances 0.000 claims description 19
- 150000001989 diazonium salts Chemical class 0.000 claims description 12
- 230000001681 protective effect Effects 0.000 claims description 9
- 125000000129 anionic group Chemical group 0.000 claims description 8
- 239000004094 surface-active agent Substances 0.000 claims description 7
- 239000000084 colloidal system Substances 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 229920001577 copolymer Polymers 0.000 claims description 5
- JBSLOWBPDRZSMB-FPLPWBNLSA-N dibutyl (z)-but-2-enedioate Chemical compound CCCCOC(=O)\C=C/C(=O)OCCCC JBSLOWBPDRZSMB-FPLPWBNLSA-N 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 3
- 230000006641 stabilisation Effects 0.000 claims description 2
- 238000011105 stabilization Methods 0.000 claims description 2
- 125000005250 alkyl acrylate group Chemical group 0.000 claims 1
- 239000003945 anionic surfactant Substances 0.000 claims 1
- 238000010790 dilution Methods 0.000 claims 1
- 239000012895 dilution Substances 0.000 claims 1
- 239000002736 nonionic surfactant Substances 0.000 claims 1
- 229920001567 vinyl ester resin Polymers 0.000 claims 1
- 238000007639 printing Methods 0.000 description 20
- 239000003795 chemical substances by application Substances 0.000 description 18
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 12
- 229910052782 aluminium Inorganic materials 0.000 description 12
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 12
- 239000002253 acid Substances 0.000 description 10
- 239000000243 solution Substances 0.000 description 8
- 239000000975 dye Substances 0.000 description 7
- 239000000839 emulsion Substances 0.000 description 7
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 6
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 6
- 238000007645 offset printing Methods 0.000 description 6
- 239000008399 tap water Substances 0.000 description 6
- 235000020679 tap water Nutrition 0.000 description 6
- 238000007792 addition Methods 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- 239000002245 particle Substances 0.000 description 5
- 238000009833 condensation Methods 0.000 description 4
- 230000005494 condensation Effects 0.000 description 4
- FDZZZRQASAIRJF-UHFFFAOYSA-M malachite green Chemical compound [Cl-].C1=CC(N(C)C)=CC=C1C(C=1C=CC=CC=1)=C1C=CC(=[N+](C)C)C=C1 FDZZZRQASAIRJF-UHFFFAOYSA-M 0.000 description 4
- 229940107698 malachite green Drugs 0.000 description 4
- 229920002554 vinyl polymer Polymers 0.000 description 4
- 239000000080 wetting agent Substances 0.000 description 4
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 239000002202 Polyethylene glycol Substances 0.000 description 3
- 239000004372 Polyvinyl alcohol Substances 0.000 description 3
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 125000002091 cationic group Chemical group 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 238000011161 development Methods 0.000 description 3
- 229920001223 polyethylene glycol Polymers 0.000 description 3
- 229920002451 polyvinyl alcohol Polymers 0.000 description 3
- 229940068984 polyvinyl alcohol Drugs 0.000 description 3
- 235000019422 polyvinyl alcohol Nutrition 0.000 description 3
- 238000005507 spraying Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- AXDJCCTWPBKUKL-UHFFFAOYSA-N 4-[(4-aminophenyl)-(4-imino-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]aniline;hydron;chloride Chemical compound Cl.C1=CC(=N)C(C)=CC1=C(C=1C=CC(N)=CC=1)C1=CC=C(N)C=C1 AXDJCCTWPBKUKL-UHFFFAOYSA-N 0.000 description 2
- 229910001369 Brass Inorganic materials 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 2
- 229920002125 Sokalan® Polymers 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 150000008052 alkyl sulfonates Chemical class 0.000 description 2
- 239000012874 anionic emulsifier Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000010951 brass Substances 0.000 description 2
- 239000012876 carrier material Substances 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- ZXJXZNDDNMQXFV-UHFFFAOYSA-M crystal violet Chemical compound [Cl-].C1=CC(N(C)C)=CC=C1[C+](C=1C=CC(=CC=1)N(C)C)C1=CC=C(N(C)C)C=C1 ZXJXZNDDNMQXFV-UHFFFAOYSA-M 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000011888 foil Substances 0.000 description 2
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 239000003973 paint Substances 0.000 description 2
- 239000000123 paper Substances 0.000 description 2
- 239000000049 pigment Substances 0.000 description 2
- 239000004584 polyacrylic acid Substances 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 238000007650 screen-printing Methods 0.000 description 2
- 229920003169 water-soluble polymer Polymers 0.000 description 2
- ITYXXSSJBOAGAR-UHFFFAOYSA-N 1-(methylamino)-4-(4-methylanilino)anthracene-9,10-dione Chemical compound C1=2C(=O)C3=CC=CC=C3C(=O)C=2C(NC)=CC=C1NC1=CC=C(C)C=C1 ITYXXSSJBOAGAR-UHFFFAOYSA-N 0.000 description 1
- OZCMOJQQLBXBKI-UHFFFAOYSA-N 1-ethenoxy-2-methylpropane Chemical compound CC(C)COC=C OZCMOJQQLBXBKI-UHFFFAOYSA-N 0.000 description 1
- JJULABXIXFRDCQ-UHFFFAOYSA-N 2,3,4-tritert-butylphenol Chemical compound CC(C)(C)C1=CC=C(O)C(C(C)(C)C)=C1C(C)(C)C JJULABXIXFRDCQ-UHFFFAOYSA-N 0.000 description 1
- LXFQSRIDYRFTJW-UHFFFAOYSA-M 2,4,6-trimethylbenzenesulfonate Chemical compound CC1=CC(C)=C(S([O-])(=O)=O)C(C)=C1 LXFQSRIDYRFTJW-UHFFFAOYSA-M 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- CBECDWUDYQOTSW-UHFFFAOYSA-N 2-ethylbut-3-enal Chemical compound CCC(C=C)C=O CBECDWUDYQOTSW-UHFFFAOYSA-N 0.000 description 1
- IGFHQQFPSIBGKE-UHFFFAOYSA-N 4-nonylphenol Chemical compound CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 1
- XZOYHFBNQHPJRQ-UHFFFAOYSA-N 7-methyloctanoic acid Chemical compound CC(C)CCCCCC(O)=O XZOYHFBNQHPJRQ-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 1
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 1
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- CNCOEDDPFOAUMB-UHFFFAOYSA-N N-Methylolacrylamide Chemical compound OCNC(=O)C=C CNCOEDDPFOAUMB-UHFFFAOYSA-N 0.000 description 1
- 206010034972 Photosensitivity reaction Diseases 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 241000978776 Senegalia senegal Species 0.000 description 1
- 206010070834 Sensitisation Diseases 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 239000004141 Sodium laurylsulphate Substances 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- ULUAUXLGCMPNKK-UHFFFAOYSA-N Sulfobutanedioic acid Chemical compound OC(=O)CC(C(O)=O)S(O)(=O)=O ULUAUXLGCMPNKK-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 150000001346 alkyl aryl ethers Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000010407 anodic oxide Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- XKRFYHLGVUSROY-UHFFFAOYSA-N argon Substances [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 125000006615 aromatic heterocyclic group Chemical group 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 230000001680 brushing effect Effects 0.000 description 1
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 235000010980 cellulose Nutrition 0.000 description 1
- 239000008199 coating composition Substances 0.000 description 1
- 239000013065 commercial product Substances 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 150000008049 diazo compounds Chemical class 0.000 description 1
- 125000001752 diazonium salt group Chemical group 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000004815 dispersion polymer Substances 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- YQGOJNYOYNNSMM-UHFFFAOYSA-N eosin Chemical compound [Na+].OC(=O)C1=CC=CC=C1C1=C2C=C(Br)C(=O)C(Br)=C2OC2=C(Br)C(O)=C(Br)C=C21 YQGOJNYOYNNSMM-UHFFFAOYSA-N 0.000 description 1
- 238000005530 etching Methods 0.000 description 1
- 125000005670 ethenylalkyl group Chemical group 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 238000007646 gravure printing Methods 0.000 description 1
- RBTKNAXYKSUFRK-UHFFFAOYSA-N heliogen blue Chemical compound [Cu].[N-]1C2=C(C=CC=C3)C3=C1N=C([N-]1)C3=CC=CC=C3C1=NC([N-]1)=C(C=CC=C3)C3=C1N=C([N-]1)C3=CC=CC=C3C1=N2 RBTKNAXYKSUFRK-UHFFFAOYSA-N 0.000 description 1
- 229910052734 helium Inorganic materials 0.000 description 1
- 239000001307 helium Substances 0.000 description 1
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 229960004592 isopropanol Drugs 0.000 description 1
- 229910052743 krypton Inorganic materials 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000005397 methacrylic acid ester group Chemical group 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- CXKWCBBOMKCUKX-UHFFFAOYSA-M methylene blue Chemical compound [Cl-].C1=CC(N(C)C)=CC2=[S+]C3=CC(N(C)C)=CC=C3N=C21 CXKWCBBOMKCUKX-UHFFFAOYSA-M 0.000 description 1
- 229960000907 methylthioninium chloride Drugs 0.000 description 1
- JTHNLKXLWOXOQK-UHFFFAOYSA-N n-propyl vinyl ketone Natural products CCCC(=O)C=C JTHNLKXLWOXOQK-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000008379 phenol ethers Chemical class 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- 230000036211 photosensitivity Effects 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920000191 poly(N-vinyl pyrrolidone) Polymers 0.000 description 1
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- 239000004926 polymethyl methacrylate Substances 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229920003009 polyurethane dispersion Polymers 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- PYWVYCXTNDRMGF-UHFFFAOYSA-N rhodamine B Chemical compound [Cl-].C=12C=CC(=[N+](CC)CC)C=C2OC2=CC(N(CC)CC)=CC=C2C=1C1=CC=CC=C1C(O)=O PYWVYCXTNDRMGF-UHFFFAOYSA-N 0.000 description 1
- 230000008313 sensitization Effects 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- PYODKQIVQIVELM-UHFFFAOYSA-M sodium;2,3-bis(2-methylpropyl)naphthalene-1-sulfonate Chemical compound [Na+].C1=CC=C2C(S([O-])(=O)=O)=C(CC(C)C)C(CC(C)C)=CC2=C1 PYODKQIVQIVELM-UHFFFAOYSA-M 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 239000012798 spherical particle Substances 0.000 description 1
- 238000004528 spin coating Methods 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- AAAQKTZKLRYKHR-UHFFFAOYSA-N triphenylmethane Chemical compound C1=CC=CC=C1C(C=1C=CC=CC=1)C1=CC=CC=C1 AAAQKTZKLRYKHR-UHFFFAOYSA-N 0.000 description 1
- ROVRRJSRRSGUOL-UHFFFAOYSA-N victoria blue bo Chemical compound [Cl-].C12=CC=CC=C2C(NCC)=CC=C1C(C=1C=CC(=CC=1)N(CC)CC)=C1C=CC(=[N+](CC)CC)C=C1 ROVRRJSRRSGUOL-UHFFFAOYSA-N 0.000 description 1
- ZTWTYVWXUKTLCP-UHFFFAOYSA-N vinylphosphonic acid Chemical compound OP(O)(=O)C=C ZTWTYVWXUKTLCP-UHFFFAOYSA-N 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03F—PHOTOMECHANICAL PRODUCTION OF TEXTURED OR PATTERNED SURFACES, e.g. FOR PRINTING, FOR PROCESSING OF SEMICONDUCTOR DEVICES; MATERIALS THEREFOR; ORIGINALS THEREFOR; APPARATUS SPECIALLY ADAPTED THEREFOR
- G03F7/00—Photomechanical, e.g. photolithographic, production of textured or patterned surfaces, e.g. printing surfaces; Materials therefor, e.g. comprising photoresists; Apparatus specially adapted therefor
- G03F7/004—Photosensitive materials
- G03F7/016—Diazonium salts or compounds
- G03F7/021—Macromolecular diazonium compounds; Macromolecular additives, e.g. binders
- G03F7/0212—Macromolecular diazonium compounds; Macromolecular additives, e.g. binders characterised by the polymeric binder or the macromolecular additives other than the diazo resins or the polymeric diazonium compounds
Landscapes
- Physics & Mathematics (AREA)
- Spectroscopy & Molecular Physics (AREA)
- General Physics & Mathematics (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
- Photosensitive Polymer And Photoresist Processing (AREA)
- Printing Plates And Materials Therefor (AREA)
- Heat Sensitive Colour Forming Recording (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (14)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782834059 DE2834059A1 (de) | 1978-08-03 | 1978-08-03 | Lichtempfindliches kopiermaterial und verfahren zu seiner herstellung |
| DE7979102631T DE2965434D1 (en) | 1978-08-03 | 1979-07-25 | Process for the preparation of a light-sensitive copying material based on condensation products of diazonium salts |
| AT79102631T ATE3475T1 (de) | 1978-08-03 | 1979-07-25 | Verfahren zur herstellung eines lichtempfindlichen kopiermaterials auf basis von diazoniumsalz-kondensationsprodukten. |
| EP79102631A EP0008038B1 (de) | 1978-08-03 | 1979-07-25 | Verfahren zur Herstellung eines lichtempfindlichen Kopiermaterials auf Basis von Diazoniumsalz-Kondensationsprodukten |
| US06/062,026 US4288520A (en) | 1978-08-03 | 1979-07-30 | Process of manufacturing light-sensitive copying material based on diazonium salt condensation products |
| CA000332942A CA1149217A (en) | 1978-08-03 | 1979-07-31 | Process for manufacture of a negative-working; presensitized planographic printing plate containing a condensation product of an aromatic diazonium salt |
| FI792391A FI792391A7 (fi) | 1978-08-03 | 1979-07-31 | Valoherkkä jäljennösaine, joka pohjautuu diatsoniumsuola- kondensaatiotuotteisiin sekä menetelmä sen valmistamivalmistamiseksi. |
| IL57952A IL57952A0 (en) | 1978-08-03 | 1979-08-01 | Light-sensitive copying material based on diazonium salt condensation products and process for the manufacture thereof |
| PT70014A PT70014A (de) | 1978-08-03 | 1979-08-01 | Lichtempfindliches kopiermaterial auf basis von diazoniumsalz-kondensationsprodukten und verfahren zu seiner herstellung |
| ZA00793950A ZA793950B (en) | 1978-08-03 | 1979-08-01 | Light-sensitive copying material based on diazonium salt condensation products and processes for the manufacture thereof |
| BR7904975A BR7904975A (pt) | 1978-08-03 | 1979-08-02 | Material para copias sensivel a luz e processo para sua producao |
| DK326479A DK326479A (da) | 1978-08-03 | 1979-08-02 | Lysfoelsomt kopieringsmateriale paa basis af diazoniumsaltkondendensationsprodukterog fremgangsmaade til fremstilling heraf |
| JP9815579A JPS5522791A (en) | 1978-08-03 | 1979-08-02 | Photosensitive copying material based on diazonium salt condensate and preparing same |
| AU49558/79A AU529388B2 (en) | 1978-08-03 | 1979-08-03 | Diazonium salt-polymer condensate containing copying material |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782834059 DE2834059A1 (de) | 1978-08-03 | 1978-08-03 | Lichtempfindliches kopiermaterial und verfahren zu seiner herstellung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2834059A1 true DE2834059A1 (de) | 1980-02-14 |
Family
ID=6046122
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19782834059 Withdrawn DE2834059A1 (de) | 1978-08-03 | 1978-08-03 | Lichtempfindliches kopiermaterial und verfahren zu seiner herstellung |
| DE7979102631T Expired DE2965434D1 (en) | 1978-08-03 | 1979-07-25 | Process for the preparation of a light-sensitive copying material based on condensation products of diazonium salts |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE7979102631T Expired DE2965434D1 (en) | 1978-08-03 | 1979-07-25 | Process for the preparation of a light-sensitive copying material based on condensation products of diazonium salts |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4288520A (cg-RX-API-DMAC7.html) |
| EP (1) | EP0008038B1 (cg-RX-API-DMAC7.html) |
| JP (1) | JPS5522791A (cg-RX-API-DMAC7.html) |
| AT (1) | ATE3475T1 (cg-RX-API-DMAC7.html) |
| AU (1) | AU529388B2 (cg-RX-API-DMAC7.html) |
| BR (1) | BR7904975A (cg-RX-API-DMAC7.html) |
| CA (1) | CA1149217A (cg-RX-API-DMAC7.html) |
| DE (2) | DE2834059A1 (cg-RX-API-DMAC7.html) |
| DK (1) | DK326479A (cg-RX-API-DMAC7.html) |
| FI (1) | FI792391A7 (cg-RX-API-DMAC7.html) |
| IL (1) | IL57952A0 (cg-RX-API-DMAC7.html) |
| PT (1) | PT70014A (cg-RX-API-DMAC7.html) |
| ZA (1) | ZA793950B (cg-RX-API-DMAC7.html) |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0051080A1 (en) * | 1980-11-03 | 1982-05-12 | Howard A. Fromson | Aluminum lithographic plate with visible image and process |
| US4436804A (en) | 1981-03-20 | 1984-03-13 | American Hoechst Corporation | Light-sensitive polymeric diazonium condensates and reproduction compositions and materials therewith |
| NL8220287A (nl) * | 1981-08-24 | 1983-12-01 | Commw Scient Ind Res Org | Fotografische overbrengmaterialen voor fijne lijnen. |
| US4533620A (en) * | 1982-03-18 | 1985-08-06 | American Hoechst Corporation | Light sensitive co-condensates |
| JPS58162960A (ja) * | 1982-03-24 | 1983-09-27 | Fuji Photo Film Co Ltd | 平版印刷版の製造方法および平版印刷版用感光材料 |
| US4469772A (en) * | 1982-06-03 | 1984-09-04 | American Hoechst Corporation | Water developable dye coating on substrate with two diazo polycondensation products and water soluble polymeric binder |
| DE3328019A1 (de) * | 1982-09-21 | 1984-03-22 | Polychrome Corp., 10702 Yonkers, N.Y. | Mit wasser entwickelbare druckplatte |
| US4568628A (en) * | 1982-09-21 | 1986-02-04 | Polychrome Corporation | Water developable diazo printing plate composition with quaternary nitrogen stabilizer |
| DE3323343A1 (de) * | 1983-06-29 | 1985-01-10 | Hoechst Ag, 6230 Frankfurt | Lichtempfindliches gemisch und daraus hergestelltes kopiermaterial |
| US4511640A (en) * | 1983-08-25 | 1985-04-16 | American Hoechst Corporation | Aqueous developable diazo lithographic printing plates with admixture of polyvinyl acetate and styrene maleic acid ester copolymer |
| GB8405549D0 (en) * | 1984-03-02 | 1984-04-04 | Sericol Group Ltd | Screen printing compositions |
| US4539285A (en) * | 1984-03-14 | 1985-09-03 | American Hoechst Corporation | Photosensitive negative diazo composition with two acrylic polymers for photolithography |
| DE3433911A1 (de) * | 1984-09-15 | 1986-03-27 | Hoechst Ag, 6230 Frankfurt | Lichtempfindliches aufzeichnungsmaterial und verfahren zu seiner herstellung |
| JPH0782236B2 (ja) * | 1984-10-12 | 1995-09-06 | 三菱化学株式会社 | 感光性組成物 |
| DE3504658A1 (de) * | 1985-02-12 | 1986-08-14 | Hoechst Ag, 6230 Frankfurt | Lichtempfindliches gemisch und damit hergestelltes aufzeichnungsmaterial |
| JPH01180540A (ja) * | 1988-01-12 | 1989-07-18 | Sanyo Kokusaku Pulp Co Ltd | 画像形成方法 |
| US5212041A (en) * | 1988-04-20 | 1993-05-18 | Hoechst Celanese Corporation | Water developable, negative working overlay color proofing system utilizing water soluble polymeric diazonium compound and water insoluble, water swellable, binder resin |
| US4914039A (en) * | 1988-04-20 | 1990-04-03 | Hoechst Celanese Corporation | Water developable, negative working overlay or transfer type diazo color proofing system |
| US5219705A (en) * | 1988-07-04 | 1993-06-15 | Fuji Photo Film Co., Ltd. | Lithographic printing plate precursor of direct image type |
| US4985337A (en) * | 1988-11-15 | 1991-01-15 | Konica Corporation | Image forming method and element, in which the element contains a release layer and a photosensitive o-quinone diaziode layer |
| DE69512321T2 (de) * | 1994-06-16 | 2000-05-11 | Kodak Polychrome Graphics Llc, Norwalk | Lithographische Druckplatten mit einer oleophilen bilderzeugenden Schicht |
| DE4430680A1 (de) * | 1994-08-29 | 1996-03-07 | Hoechst Ag | Lichtempfindliches Gemisch |
| US5688627A (en) * | 1996-07-02 | 1997-11-18 | Precision Lithograining Corp. | Light sensitive diazonium compounds having both bisulfate and zincate parts, method of making the compounds and compositions utilizing them |
| US20040154489A1 (en) * | 2000-05-08 | 2004-08-12 | Deutsch Albert S. | Chemical imaging of a lithographic printing plate |
| US6315916B1 (en) | 2000-05-08 | 2001-11-13 | Pisces-Print Image Sciences, Inc. | Chemical imaging of a lithographic printing plate |
| US6691618B2 (en) | 2000-05-08 | 2004-02-17 | Pisces-Print Imaging Sciences, Inc. | Chemical imaging of a lithographic printing plate |
| TWI278012B (en) * | 2001-09-13 | 2007-04-01 | Matsushita Electric Industrial Co Ltd | Pattern forming material and method of pattern formation |
Family Cites Families (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE490100A (cg-RX-API-DMAC7.html) * | 1948-07-09 | |||
| FR1023396A (fr) * | 1950-07-24 | 1953-03-18 | Plaque offset et procédé de fabrication | |
| NL188976B (nl) * | 1954-02-10 | Van Der Lely Nv C | Maaimachine. | |
| US2871119A (en) * | 1955-02-21 | 1959-01-27 | Dietzgen Co Eugene | Diazotype reproduction material and method |
| US2980534A (en) * | 1956-12-17 | 1961-04-18 | Monsanto Chemicals | Photographic compositions and photographic elements |
| DE1105280B (de) * | 1957-03-27 | 1961-04-20 | Forsch Deutsche Ges | Positiv-Kopierschicht zur Herstellung von Druckplatten fuer den Offsetdruck auf photomechanischem Wege |
| US3091533A (en) * | 1958-05-22 | 1963-05-28 | Developer composition for a light | |
| BE606888A (cg-RX-API-DMAC7.html) * | 1960-08-05 | 1900-01-01 | ||
| US3247791A (en) * | 1960-05-06 | 1966-04-26 | Litho Chemical And Supply Co I | Surface treated lithographic plates and production thereof |
| FR1348383A (fr) * | 1961-08-07 | 1964-01-10 | Kalle Ag | Procédé et matériel pour l'impression sérographique |
| BE621176A (cg-RX-API-DMAC7.html) * | 1961-08-07 | |||
| US3298852A (en) * | 1963-02-07 | 1967-01-17 | Dick Co Ab | Metal offset plate and method for manufacture |
| FR1405876A (fr) * | 1963-05-01 | 1965-07-16 | Gevaert Photo Prod Nv | Procédé pour la confection d'un cliché d'héliogravure |
| NL292176A (cg-RX-API-DMAC7.html) * | 1963-05-01 | 1900-01-01 | ||
| US3382069A (en) * | 1964-06-18 | 1968-05-07 | Azoplate Corp | Planographic printing plate |
| US3765894A (en) * | 1967-04-03 | 1973-10-16 | Polychrome Corp | Elevated image printing plate |
| JPS492286B1 (cg-RX-API-DMAC7.html) * | 1970-02-19 | 1974-01-19 | ||
| US3847614A (en) * | 1971-09-13 | 1974-11-12 | Scott Paper Co | Diazo photopolymer composition and article comprising carboxylated resin |
| DD96345A1 (cg-RX-API-DMAC7.html) * | 1972-01-05 | 1973-03-12 | ||
| US3996056A (en) * | 1973-04-10 | 1976-12-07 | Andrews Paper & Chemical Co. | Diazotype reproduction layer formed from matrix of spheric particle polystyrene pigment and diazotype components |
| GB1523762A (en) * | 1975-02-25 | 1978-09-06 | Oce Van Der Grinten Nv | Photocopying materials |
| CA1091969A (en) * | 1975-06-19 | 1980-12-23 | Robert W. Hallman | Photosensitive unilayer film structure cast from a polymeric emulsion dispersion |
| US4154614A (en) * | 1975-07-02 | 1979-05-15 | Nippon Paint Co., Ltd. | Photosensitive diazo composition with graft copolymer for use in printing screen |
| US4186069A (en) * | 1978-01-30 | 1980-01-29 | Richardson Graphics Company | Photopolymerizable latex systems |
-
1978
- 1978-08-03 DE DE19782834059 patent/DE2834059A1/de not_active Withdrawn
-
1979
- 1979-07-25 EP EP79102631A patent/EP0008038B1/de not_active Expired
- 1979-07-25 DE DE7979102631T patent/DE2965434D1/de not_active Expired
- 1979-07-25 AT AT79102631T patent/ATE3475T1/de active
- 1979-07-30 US US06/062,026 patent/US4288520A/en not_active Expired - Lifetime
- 1979-07-31 CA CA000332942A patent/CA1149217A/en not_active Expired
- 1979-07-31 FI FI792391A patent/FI792391A7/fi not_active Application Discontinuation
- 1979-08-01 PT PT70014A patent/PT70014A/pt unknown
- 1979-08-01 IL IL57952A patent/IL57952A0/xx unknown
- 1979-08-01 ZA ZA00793950A patent/ZA793950B/xx unknown
- 1979-08-02 BR BR7904975A patent/BR7904975A/pt unknown
- 1979-08-02 JP JP9815579A patent/JPS5522791A/ja active Granted
- 1979-08-02 DK DK326479A patent/DK326479A/da unknown
- 1979-08-03 AU AU49558/79A patent/AU529388B2/en not_active Ceased
Also Published As
| Publication number | Publication date |
|---|---|
| BR7904975A (pt) | 1980-04-29 |
| DE2965434D1 (en) | 1983-07-07 |
| PT70014A (de) | 1979-09-01 |
| ATE3475T1 (de) | 1983-06-15 |
| JPS5522791A (en) | 1980-02-18 |
| EP0008038A1 (de) | 1980-02-20 |
| CA1149217A (en) | 1983-07-05 |
| FI792391A7 (fi) | 1981-01-01 |
| JPH039455B2 (cg-RX-API-DMAC7.html) | 1991-02-08 |
| ZA793950B (en) | 1980-07-30 |
| EP0008038B1 (de) | 1983-05-18 |
| AU4955879A (en) | 1980-02-07 |
| DK326479A (da) | 1980-02-04 |
| IL57952A0 (en) | 1979-12-30 |
| US4288520A (en) | 1981-09-08 |
| AU529388B2 (en) | 1983-06-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0008038B1 (de) | Verfahren zur Herstellung eines lichtempfindlichen Kopiermaterials auf Basis von Diazoniumsalz-Kondensationsprodukten | |
| EP0042104B1 (de) | Lichtempfindliches Kopiermaterial und Verfahren zu seiner Herstellung | |
| DE2027467C3 (de) | Photopolymerisierbare Kopiermasse | |
| EP0155620B1 (de) | Einbrenngummierung für Offsetdruckplatten und Verfahren zur Herstellung einer Offsetdruckform | |
| DE954127C (de) | Verfahren zur Herstellung lichtempfindlicher Platten und aus ihnen Druckplatten | |
| EP0222297B1 (de) | Einbrenngummierung für Offsetdruckplatten | |
| DE2607207A1 (de) | Verfahren zur herstellung von flachdruckformen mit laserstrahlen | |
| DE1572153B2 (de) | Fotopolymerisierbares aufzeichnungsmaterial | |
| DE2543820C2 (de) | Verfahren zur Herstellung von Flachdruckformen mittels Laserstrahlen | |
| DE2903454A1 (de) | Lichtempfindliche latexbeschichtungsmasse und ihre verwendung | |
| DE69916773T2 (de) | Wärmeempfindliches Bildaufzeichnungsmaterial zur Herstellung von positiv arbeitenden Flachdruckformen | |
| DE3022362A1 (de) | Lichtempfindliches kopiermaterial und verfahren zu seiner herstellung | |
| EP0021428B1 (de) | Lichtempfindliches, positiv arbeitendes Kopiermaterial mit rauher Oberfläche | |
| EP0174588A2 (de) | Strahlungsempfindliches Aufzeichnungsmaterial und Verfahren zu seiner Herstellung | |
| DE2620961A1 (de) | Metallbild-erzeugendes material | |
| DE2660103C3 (de) | Farbkorrektursystem für die Mehrfarbenbildreproduktion | |
| DE2932035C2 (cg-RX-API-DMAC7.html) | ||
| DE1522497B2 (de) | Verfahren zum Herstellen von Druckformen | |
| EP0064733B1 (de) | Verfahren zur Herstellung von Reliefkopien | |
| DE69620556T2 (de) | Wässrig entwickelbare, negativ arbeitende, fotoempfindliche Zusammensetzung mit verbessertem Bildkontrast | |
| DE1244582B (de) | Verfahren zur Herstellung einer Flachdruckform | |
| DE69909733T2 (de) | Verfahren zur Herstellung positiv arbeitender Druckplatten | |
| EP0053708A2 (de) | Verfahren zur Herstellung von Reliefkopien | |
| EP0429955B1 (de) | Verfahren zur Herstellung einer negativ arbeitenden lichtempfindlichen Druckform | |
| DE1572060C3 (de) | Lichtempfindliche Kopierschicht |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8139 | Disposal/non-payment of the annual fee |