DE2831469C2 - Flüssigkristall-Zusammensetzung - Google Patents
Flüssigkristall-ZusammensetzungInfo
- Publication number
- DE2831469C2 DE2831469C2 DE2831469A DE2831469A DE2831469C2 DE 2831469 C2 DE2831469 C2 DE 2831469C2 DE 2831469 A DE2831469 A DE 2831469A DE 2831469 A DE2831469 A DE 2831469A DE 2831469 C2 DE2831469 C2 DE 2831469C2
- Authority
- DE
- Germany
- Prior art keywords
- liquid crystal
- coo
- crystal composition
- composition according
- mixture
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000004973 liquid crystal related substance Substances 0.000 title claims description 224
- 239000000203 mixture Substances 0.000 title claims description 164
- 150000001875 compounds Chemical class 0.000 claims description 176
- 229910052799 carbon Inorganic materials 0.000 claims description 6
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 claims description 6
- 235000012000 cholesterol Nutrition 0.000 claims description 3
- 239000004986 Cholesteric liquid crystals (ChLC) Substances 0.000 claims description 2
- SZUVGFMDDVSKSI-WIFOCOSTSA-N (1s,2s,3s,5r)-1-(carboxymethyl)-3,5-bis[(4-phenoxyphenyl)methyl-propylcarbamoyl]cyclopentane-1,2-dicarboxylic acid Chemical compound O=C([C@@H]1[C@@H]([C@](CC(O)=O)([C@H](C(=O)N(CCC)CC=2C=CC(OC=3C=CC=CC=3)=CC=2)C1)C(O)=O)C(O)=O)N(CCC)CC(C=C1)=CC=C1OC1=CC=CC=C1 SZUVGFMDDVSKSI-WIFOCOSTSA-N 0.000 claims 1
- 229940126543 compound 14 Drugs 0.000 claims 1
- 229940126062 Compound A Drugs 0.000 description 18
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 18
- 210000002858 crystal cell Anatomy 0.000 description 14
- 210000004027 cell Anatomy 0.000 description 11
- 210000003608 fece Anatomy 0.000 description 9
- 125000004432 carbon atom Chemical group C* 0.000 description 7
- 230000004043 responsiveness Effects 0.000 description 5
- 239000004988 Nematic liquid crystal Substances 0.000 description 4
- 125000003545 alkoxy group Chemical group 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 239000011159 matrix material Substances 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- 230000004044 response Effects 0.000 description 4
- 230000007704 transition Effects 0.000 description 4
- OTVRYZXVVMZHHW-DPAQBDIFSA-N cholesteryl chloride Chemical compound C1C=C2C[C@@H](Cl)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 OTVRYZXVVMZHHW-DPAQBDIFSA-N 0.000 description 3
- 230000002631 hypothermal effect Effects 0.000 description 3
- 239000010871 livestock manure Substances 0.000 description 3
- ONCCWDRMOZMNSM-FBCQKBJTSA-N compound Z Chemical compound N1=C2C(=O)NC(N)=NC2=NC=C1C(=O)[C@H]1OP(O)(=O)OC[C@H]1O ONCCWDRMOZMNSM-FBCQKBJTSA-N 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 238000003487 electrochemical reaction Methods 0.000 description 2
- 229910003437 indium oxide Inorganic materials 0.000 description 2
- PJXISJQVUVHSOJ-UHFFFAOYSA-N indium(iii) oxide Chemical compound [O-2].[O-2].[O-2].[In+3].[In+3] PJXISJQVUVHSOJ-UHFFFAOYSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- -1 phenylcyclohexanecarboxylic acid phenyl ester compound Chemical class 0.000 description 2
- 238000011160 research Methods 0.000 description 2
- 125000006850 spacer group Chemical group 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 238000002834 transmittance Methods 0.000 description 2
- QIVUCLWGARAQIO-OLIXTKCUSA-N (3s)-n-[(3s,5s,6r)-6-methyl-2-oxo-1-(2,2,2-trifluoroethyl)-5-(2,3,6-trifluorophenyl)piperidin-3-yl]-2-oxospiro[1h-pyrrolo[2,3-b]pyridine-3,6'-5,7-dihydrocyclopenta[b]pyridine]-3'-carboxamide Chemical compound C1([C@H]2[C@H](N(C(=O)[C@@H](NC(=O)C=3C=C4C[C@]5(CC4=NC=3)C3=CC=CN=C3NC5=O)C2)CC(F)(F)F)C)=C(F)C=CC(F)=C1F QIVUCLWGARAQIO-OLIXTKCUSA-N 0.000 description 1
- ILYSAKHOYBPSPC-UHFFFAOYSA-N 2-phenylbenzoic acid Chemical class OC(=O)C1=CC=CC=C1C1=CC=CC=C1 ILYSAKHOYBPSPC-UHFFFAOYSA-N 0.000 description 1
- XUGISPSHIFXEHZ-UHFFFAOYSA-N 3beta-acetoxy-cholest-5-ene Natural products C1C=C2CC(OC(C)=O)CCC2(C)C2C1C1CCC(C(C)CCCC(C)C)C1(C)CC2 XUGISPSHIFXEHZ-UHFFFAOYSA-N 0.000 description 1
- DNJQGRFZQMOYGM-UHFFFAOYSA-N 4-[4-(2-methylbutyl)phenyl]benzonitrile Chemical group C1=CC(CC(C)CC)=CC=C1C1=CC=C(C#N)C=C1 DNJQGRFZQMOYGM-UHFFFAOYSA-N 0.000 description 1
- WQGDFCIPMUSDTA-UHFFFAOYSA-N 4-[4-(3-methylhexyl)phenyl]benzonitrile Chemical group C1=CC(CCC(C)CCC)=CC=C1C1=CC=C(C#N)C=C1 WQGDFCIPMUSDTA-UHFFFAOYSA-N 0.000 description 1
- 101100231515 Caenorhabditis elegans ceh-13 gene Proteins 0.000 description 1
- 102100035861 Cytosolic 5'-nucleotidase 1A Human genes 0.000 description 1
- 101000802744 Homo sapiens Cytosolic 5'-nucleotidase 1A Proteins 0.000 description 1
- 239000002262 Schiff base Substances 0.000 description 1
- 150000004753 Schiff bases Chemical class 0.000 description 1
- 239000004990 Smectic liquid crystal Substances 0.000 description 1
- 108010021119 Trichosanthin Proteins 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000005337 azoxy group Chemical group [N+]([O-])(=N*)* 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 150000001841 cholesterols Chemical class 0.000 description 1
- XUGISPSHIFXEHZ-VEVYEIKRSA-N cholesteryl acetate Chemical compound C1C=C2C[C@@H](OC(C)=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 XUGISPSHIFXEHZ-VEVYEIKRSA-N 0.000 description 1
- JNGZXGGOCLZBFB-IVCQMTBJSA-N compound E Chemical compound N([C@@H](C)C(=O)N[C@@H]1C(N(C)C2=CC=CC=C2C(C=2C=CC=CC=2)=N1)=O)C(=O)CC1=CC(F)=CC(F)=C1 JNGZXGGOCLZBFB-IVCQMTBJSA-N 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 230000005684 electric field Effects 0.000 description 1
- 238000005265 energy consumption Methods 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- ZTQSADJAYQOCDD-UHFFFAOYSA-N ginsenoside-Rd2 Natural products C1CC(C2(CCC3C(C)(C)C(OC4C(C(O)C(O)C(CO)O4)O)CCC3(C)C2CC2O)C)(C)C2C1C(C)(CCC=C(C)C)OC(C(C(O)C1O)O)OC1COC1OCC(O)C(O)C1O ZTQSADJAYQOCDD-UHFFFAOYSA-N 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000011346 highly viscous material Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 229940049964 oleate Drugs 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 230000005693 optoelectronics Effects 0.000 description 1
- 230000010287 polarization Effects 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
- 150000003431 steroids Chemical class 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 description 1
- 229910001887 tin oxide Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09K—MATERIALS FOR MISCELLANEOUS APPLICATIONS, NOT PROVIDED FOR ELSEWHERE
- C09K19/00—Liquid crystal materials
- C09K19/04—Liquid crystal materials characterised by the chemical structure of the liquid crystal components, e.g. by a specific unit
- C09K19/42—Mixtures of liquid crystal compounds covered by two or more of the preceding groups C09K19/06 - C09K19/40
Landscapes
- Chemical & Material Sciences (AREA)
- Crystallography & Structural Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Organic Chemistry (AREA)
- Liquid Crystal Substances (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP8700877A JPS5421978A (en) | 1977-07-19 | 1977-07-19 | Liquid crystal composition |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2831469A1 DE2831469A1 (de) | 1979-02-01 |
| DE2831469C2 true DE2831469C2 (de) | 1986-09-11 |
Family
ID=13902911
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2831469A Expired DE2831469C2 (de) | 1977-07-19 | 1978-07-18 | Flüssigkristall-Zusammensetzung |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US4222887A (enExample) |
| JP (1) | JPS5421978A (enExample) |
| DE (1) | DE2831469C2 (enExample) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2853728A1 (de) * | 1978-12-13 | 1980-07-17 | Merck Patent Gmbh | Fluessigkristalline carbonsaeureester, verfahren zu ihrer herstellung, diese enthaltende dielektrika und elektrooptisches anzeigeelement |
| EP0019665B2 (de) * | 1979-05-28 | 1987-12-16 | MERCK PATENT GmbH | Flüssigkristalline Verbindungen |
| DE2933611A1 (de) * | 1979-07-18 | 1981-02-12 | Bbc Brown Boveri & Cie | Cyclohexylcyclohexanoate |
| DE2933563A1 (de) * | 1979-07-18 | 1981-02-05 | Bbc Brown Boveri & Cie | Anisotrope verbindungen mit negativer dk-anisotropie |
| DE3006666A1 (de) * | 1980-02-22 | 1981-09-17 | Merck Patent Gmbh, 6100 Darmstadt | Phenylcyclohexenderivate, verfahren zu ihrer herstellung, diese enthaltende fluessigkristalline dielektrika und elektrooptisches anzeieelement |
| JPS574960A (en) * | 1980-06-09 | 1982-01-11 | Chisso Corp | 4'''-cyanobiphenyl trans-4-(trans-4'-alkylcyclohexyl)- cyclohexanecarboxylate |
| JPS5721359A (en) * | 1980-07-15 | 1982-02-04 | Chisso Corp | 4'''-cyano-4"-biphenylyl 4-(trans-4'-alkylcyclohexyl)benzoate |
| JPS57171936A (en) * | 1981-04-16 | 1982-10-22 | Chisso Corp | Trans-4-(trans-4'-alkylcyclohexyl)cyclohexanole derivative |
| US4406814A (en) * | 1981-04-10 | 1983-09-27 | Eaton Corporation | Liquid crystalline materials and optical displays utilizing same |
| US4430321A (en) | 1982-01-15 | 1984-02-07 | Merck Frosst Canada Inc. | 6-Bromocholesterol derivatives |
| JPS58140045A (ja) * | 1982-02-15 | 1983-08-19 | Kanto Kagaku Kk | 液晶化合物,液晶組成物並びに液晶表示素子 |
| US4613209A (en) * | 1982-03-23 | 1986-09-23 | At&T Bell Laboratories | Smectic liquid crystals |
| US4729639A (en) * | 1982-03-29 | 1988-03-08 | Tektronix, Inc. | Dual frequency addressable liquid crystals and methods of use |
| US4502974A (en) * | 1982-03-31 | 1985-03-05 | Chisso Corporation | High temperature liquid-crystalline ester compounds |
| EP0115693B1 (en) * | 1983-01-06 | 1987-08-26 | Chisso Corporation | Liquid crystalline compounds and mixtures thereof |
| US4630896A (en) * | 1983-06-17 | 1986-12-23 | Hoffmann-La Roche Inc. | Benzonitriles |
| JPS6126691A (ja) * | 1984-07-13 | 1986-02-05 | Matsushita Electric Ind Co Ltd | 液晶組成物 |
| US4759870A (en) * | 1984-08-14 | 1988-07-26 | Casio Computer Co., Ltd. | Liquid crystal composition |
| JPH0662476B2 (ja) * | 1984-09-04 | 1994-08-17 | チッソ株式会社 | メチレンオキシ基を有する液晶性化合物及びその組成物 |
| US5188758A (en) * | 1986-03-19 | 1993-02-23 | Merck Patent Gesellschaft Mit Beschraenkter Haftung | Electrooptical display element using a supertwist liquid crystal having specified elastic constants |
| JPH07278545A (ja) * | 1994-04-14 | 1995-10-24 | Chisso Corp | ネマテック液晶組成物 |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4058477A (en) * | 1972-02-23 | 1977-11-15 | Hoffmann-La Roche Inc. | Liquid crystal Schiffs bases |
| US4058478A (en) * | 1972-02-23 | 1977-11-15 | Hoffmann-La Roche Inc. | Liquid crystal esters |
| US4011173A (en) * | 1972-08-03 | 1977-03-08 | Merck Patent Gesellschaft Mit Beschrankter Haftung | Modified nematic mixtures with positive dielectric anisotropy |
| GB1551043A (en) * | 1975-04-22 | 1979-08-22 | Secr Defence | Biphenyl compounds containing a cyano group and liquid crystal materials and devices containing such compounds |
| US4053431A (en) * | 1973-11-19 | 1977-10-11 | Hoffmann-La Roche Inc. | Liquid crystalline biphenyls |
| US4137192A (en) * | 1974-01-25 | 1979-01-30 | Canon Kabushiki Kaisha | Liquid crystalline composition |
| US4020002A (en) * | 1974-02-28 | 1977-04-26 | Beckman Instruments, Inc. | Non-schiff base field effect liquid crystal composition |
| US3925238A (en) * | 1974-06-28 | 1975-12-09 | Rca Corp | Novel liquid crystal electro-optic devices |
| US4147651A (en) * | 1974-09-03 | 1979-04-03 | Beckman Instruments, Inc. | Biphenyl based liquid crystal compositions |
| US4017416A (en) * | 1974-10-11 | 1977-04-12 | Chisso Corporation | P-cyanophenyl 4-alkyl-4'-biphenylcarboxylate, method for preparing same and liquid crystal compositions using same |
| FR2288732A1 (fr) * | 1974-10-22 | 1976-05-21 | Merck Patent Gmbh | Nouveaux esters biphenyliques, procede pour leur preparation et application comme constituants de cristaux liquides |
| US4029595A (en) * | 1976-09-17 | 1977-06-14 | Rca Corporation | Novel liquid crystal compounds and electro-optic devices incorporating them |
-
1977
- 1977-07-19 JP JP8700877A patent/JPS5421978A/ja active Granted
-
1978
- 1978-07-11 US US05/923,732 patent/US4222887A/en not_active Expired - Lifetime
- 1978-07-18 DE DE2831469A patent/DE2831469C2/de not_active Expired
Non-Patent Citations (1)
| Title |
|---|
| NICHTS-ERMITTELT |
Also Published As
| Publication number | Publication date |
|---|---|
| US4222887A (en) | 1980-09-16 |
| DE2831469A1 (de) | 1979-02-01 |
| JPS5421978A (en) | 1979-02-19 |
| JPS6236078B2 (enExample) | 1987-08-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2831469C2 (de) | Flüssigkristall-Zusammensetzung | |
| DE2502904C2 (enExample) | ||
| DE2854310C2 (enExample) | ||
| DE2656252C3 (de) | Dotierungsmittel für nematische Flüssigkristalle und damit dotiertes Flüssigkristallmaterial | |
| EP0131216B1 (de) | Flüssigkristallanzeige | |
| DE2244195A1 (de) | Elektrooptisch-aktive materialzusammensetzungen und elektrooptisch-aktive vorrichtung unter verwendung derartiger materialzusammensetzungen | |
| DE2500838A1 (de) | Verfahren zur modulierung von licht mittels einer elektro-optischen vorrichtung | |
| DE3851166T2 (de) | Flexoelektrische Flüssigkristallvorrichtung. | |
| DE3037303C2 (enExample) | ||
| DE3787279T2 (de) | Vorrichtungen mit einem smektischen flüssigkristall. | |
| DE3788724T2 (de) | Vorrichtungen mit einem smektischen flüssigkristall. | |
| DD217061A5 (de) | Fluessigkristallanzeige | |
| DE2617924B2 (de) | Flüssigkristall-Anzeigevorrichtung zur Farbanzeige | |
| DE2913753A1 (de) | Gast-wirts-fluessigkristall-darstellungsvorrichtung | |
| DE2558176A1 (de) | Verfahren und vorrichtung zur steuerung der optischen eigenschaften von fluessigkristallen | |
| DD222039A5 (de) | Nematische fluessigkristall-zusammensetzung | |
| DE2847601A1 (de) | Fluessigkristallgemische und ihre verwendung in anzeigevorrichtungen | |
| DE2538865A1 (de) | Nematische fluessigkristallmassen | |
| DE3784388T2 (de) | Fluessigkristallzelle. | |
| DE2839639C2 (de) | Flüssigkristallmaterialien und diese enthaltende Vorrichtungen | |
| DE2644219C2 (de) | Verwendung einer nichtsmektischen Flüssigkristallmischung | |
| DE69221891T2 (de) | Fluessigkristallanzeige mit aktiver matrix sowie dazugehoerige fluessigkristallstruktur | |
| DE2143547A1 (de) | Elektro-optische Anzeigevorrichtung mit smektisch-nematischen Flüssigkristallmischungen | |
| DE3122529A1 (de) | Nematische fluessigkristallmaterialien und ihre verwendung | |
| DE3004764A1 (de) | Fluessigkristall-anzeigezelle |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8328 | Change in the person/name/address of the agent |
Free format text: DRES. WESER UND MARTIN, 81245 MUENCHEN |