DE3037303C2 - - Google Patents
Info
- Publication number
- DE3037303C2 DE3037303C2 DE3037303A DE3037303A DE3037303C2 DE 3037303 C2 DE3037303 C2 DE 3037303C2 DE 3037303 A DE3037303 A DE 3037303A DE 3037303 A DE3037303 A DE 3037303A DE 3037303 C2 DE3037303 C2 DE 3037303C2
- Authority
- DE
- Germany
- Prior art keywords
- liquid crystal
- formula
- compounds
- materials
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000000463 material Substances 0.000 claims description 55
- 239000004973 liquid crystal related substance Substances 0.000 claims description 53
- 150000001875 compounds Chemical class 0.000 claims description 45
- 125000000217 alkyl group Chemical group 0.000 claims description 14
- 125000001424 substituent group Chemical group 0.000 claims description 10
- 229910052731 fluorine Inorganic materials 0.000 claims description 9
- 239000011737 fluorine Substances 0.000 claims description 9
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 7
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 238000000034 method Methods 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 125000001153 fluoro group Chemical group F* 0.000 claims description 2
- 239000000203 mixture Substances 0.000 description 21
- 239000007788 liquid Substances 0.000 description 19
- 239000012071 phase Substances 0.000 description 18
- 239000011521 glass Substances 0.000 description 16
- 230000007704 transition Effects 0.000 description 16
- 150000002148 esters Chemical group 0.000 description 15
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 13
- 239000004990 Smectic liquid crystal Substances 0.000 description 10
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 230000008859 change Effects 0.000 description 8
- LIVNPJMFVYWSIS-UHFFFAOYSA-N silicon monoxide Chemical compound [Si-]#[O+] LIVNPJMFVYWSIS-UHFFFAOYSA-N 0.000 description 8
- 235000012000 cholesterol Nutrition 0.000 description 7
- 210000002858 crystal cell Anatomy 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 230000010287 polarization Effects 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 5
- FJKROLUGYXJWQN-UHFFFAOYSA-N 4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 230000032050 esterification Effects 0.000 description 4
- 238000005886 esterification reaction Methods 0.000 description 4
- 239000004988 Nematic liquid crystal Substances 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 230000006399 behavior Effects 0.000 description 3
- 230000003098 cholesteric effect Effects 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 150000001564 phenyl benzoates Chemical class 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 238000004381 surface treatment Methods 0.000 description 3
- 229940090248 4-hydroxybenzoic acid Drugs 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 125000005194 alkoxycarbonyloxy group Chemical group 0.000 description 2
- -1 alkyl chloroformate Chemical compound 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 210000004027 cell Anatomy 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- NZNMSOFKMUBTKW-UHFFFAOYSA-N cyclohexanecarboxylic acid Chemical compound OC(=O)C1CCCCC1 NZNMSOFKMUBTKW-UHFFFAOYSA-N 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 230000005684 electric field Effects 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- 230000003446 memory effect Effects 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 238000010587 phase diagram Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- HJIAMFHSAAEUKR-UHFFFAOYSA-N (2-hydroxyphenyl)-phenylmethanone Chemical class OC1=CC=CC=C1C(=O)C1=CC=CC=C1 HJIAMFHSAAEUKR-UHFFFAOYSA-N 0.000 description 1
- GRXYPNCZCDBAOC-UHFFFAOYSA-N 1,5-bis(4-butylanilino)anthracene-9,10-dione Chemical compound C1=CC(CCCC)=CC=C1NC1=CC=CC2=C1C(=O)C1=CC=CC(NC=3C=CC(CCCC)=CC=3)=C1C2=O GRXYPNCZCDBAOC-UHFFFAOYSA-N 0.000 description 1
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 1
- KSUDMDCPWIYYNA-UHFFFAOYSA-N 2-fluoro-4-pentylphenol Chemical compound CCCCCC1=CC=C(O)C(F)=C1 KSUDMDCPWIYYNA-UHFFFAOYSA-N 0.000 description 1
- HFHFGHLXUCOHLN-UHFFFAOYSA-N 2-fluorophenol Chemical compound OC1=CC=CC=C1F HFHFGHLXUCOHLN-UHFFFAOYSA-N 0.000 description 1
- LAUFPZPAKULAGB-UHFFFAOYSA-N 4-butoxybenzoic acid Chemical compound CCCCOC1=CC=C(C(O)=O)C=C1 LAUFPZPAKULAGB-UHFFFAOYSA-N 0.000 description 1
- 239000004986 Cholesteric liquid crystals (ChLC) Substances 0.000 description 1
- 239000007832 Na2SO4 Substances 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- VZFUCHSFHOYXIS-UHFFFAOYSA-N cycloheptane carboxylic acid Natural products OC(=O)C1CCCCCC1 VZFUCHSFHOYXIS-UHFFFAOYSA-N 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 238000013213 extrapolation Methods 0.000 description 1
- 238000001030 gas--liquid chromatography Methods 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 239000000787 lecithin Substances 0.000 description 1
- 229940067606 lecithin Drugs 0.000 description 1
- 235000010445 lecithin Nutrition 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- ORUIBWPALBXDOA-UHFFFAOYSA-L magnesium fluoride Chemical compound [F-].[F-].[Mg+2] ORUIBWPALBXDOA-UHFFFAOYSA-L 0.000 description 1
- 229910001635 magnesium fluoride Inorganic materials 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000005693 optoelectronics Effects 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- OPYYWWIJPHKUDZ-UHFFFAOYSA-N phenyl cyclohexanecarboxylate Chemical class C1CCCCC1C(=O)OC1=CC=CC=C1 OPYYWWIJPHKUDZ-UHFFFAOYSA-N 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007790 solid phase Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000001308 synthesis method Methods 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 description 1
- 229910001887 tin oxide Inorganic materials 0.000 description 1
- 230000017105 transposition Effects 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
- 238000007740 vapor deposition Methods 0.000 description 1
- 238000009834 vaporization Methods 0.000 description 1
- 230000008016 vaporization Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09K—MATERIALS FOR MISCELLANEOUS APPLICATIONS, NOT PROVIDED FOR ELSEWHERE
- C09K19/00—Liquid crystal materials
- C09K19/04—Liquid crystal materials characterised by the chemical structure of the liquid crystal components, e.g. by a specific unit
- C09K19/06—Non-steroidal liquid crystal compounds
- C09K19/08—Non-steroidal liquid crystal compounds containing at least two non-condensed rings
- C09K19/10—Non-steroidal liquid crystal compounds containing at least two non-condensed rings containing at least two benzene rings
- C09K19/20—Non-steroidal liquid crystal compounds containing at least two non-condensed rings containing at least two benzene rings linked by a chain containing carbon and oxygen atoms as chain links, e.g. esters or ethers
- C09K19/2007—Non-steroidal liquid crystal compounds containing at least two non-condensed rings containing at least two benzene rings linked by a chain containing carbon and oxygen atoms as chain links, e.g. esters or ethers the chain containing -COO- or -OCO- groups
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09K—MATERIALS FOR MISCELLANEOUS APPLICATIONS, NOT PROVIDED FOR ELSEWHERE
- C09K19/00—Liquid crystal materials
- C09K19/04—Liquid crystal materials characterised by the chemical structure of the liquid crystal components, e.g. by a specific unit
- C09K19/06—Non-steroidal liquid crystal compounds
- C09K19/08—Non-steroidal liquid crystal compounds containing at least two non-condensed rings
- C09K19/30—Non-steroidal liquid crystal compounds containing at least two non-condensed rings containing saturated or unsaturated non-aromatic rings, e.g. cyclohexane rings
- C09K19/3001—Cyclohexane rings
- C09K19/3066—Cyclohexane rings in which the rings are linked by a chain containing carbon and oxygen atoms, e.g. esters or ethers
- C09K19/3068—Cyclohexane rings in which the rings are linked by a chain containing carbon and oxygen atoms, e.g. esters or ethers chain containing -COO- or -OCO- groups
Landscapes
- Chemical & Material Sciences (AREA)
- Crystallography & Structural Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Liquid Crystal Substances (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB7934127 | 1979-10-02 | ||
| GB8021072 | 1980-06-27 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3037303A1 DE3037303A1 (de) | 1981-04-23 |
| DE3037303C2 true DE3037303C2 (enExample) | 1990-05-03 |
Family
ID=26273067
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19803037303 Granted DE3037303A1 (de) | 1979-10-02 | 1980-10-02 | Fluessigkristalline ester und ihre verwendung |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4542230A (enExample) |
| CH (1) | CH646938A5 (enExample) |
| DE (1) | DE3037303A1 (enExample) |
| FR (1) | FR2466496B1 (enExample) |
| GB (1) | GB2063250B (enExample) |
| HK (1) | HK100885A (enExample) |
| MY (1) | MY8700219A (enExample) |
| SG (1) | SG64385G (enExample) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0019665B2 (de) * | 1979-05-28 | 1987-12-16 | MERCK PATENT GmbH | Flüssigkristalline Verbindungen |
| DE3209178A1 (de) * | 1982-03-13 | 1983-09-15 | Merck Patent Gmbh, 6100 Darmstadt | Polyhalogenaromaten |
| US4548731A (en) * | 1982-05-17 | 1985-10-22 | Chisso Corporation | 2,4-Difluorobenzene derivatives |
| GB2132192B (en) * | 1982-10-30 | 1986-01-22 | Dainippon Ink & Chemicals | Nematic liquid crystalline 3-fluro-4-cyanophenol derivatives |
| DE3405914A1 (de) * | 1984-02-18 | 1985-08-22 | Merck Patent Gmbh, 6100 Darmstadt | Fluessigkristalline verbindungen |
| GB8428653D0 (en) * | 1984-11-13 | 1984-12-19 | Secr Defence | Diesters |
| DE3685032D1 (de) * | 1985-01-09 | 1992-06-04 | Dainippon Ink & Chemicals | Substituierte fluessigkristallverbindungen. |
| US4943386A (en) * | 1985-01-09 | 1990-07-24 | Dainippon Ink & Chemicals, Inc. | Liquid crystalline compounds having substituents |
| GB8501509D0 (en) * | 1985-01-22 | 1985-02-20 | Secr Defence | Esters |
| JPH0825957B2 (ja) * | 1985-03-12 | 1996-03-13 | チッソ株式会社 | ジフルオロ芳香族化合物 |
| JPS61210056A (ja) * | 1985-03-14 | 1986-09-18 | Chisso Corp | 含ハロゲン光学活性液晶化合物及び液晶組成物 |
| EP0202514B1 (en) * | 1985-05-22 | 1991-01-09 | Chisso Corporation | Liquid crystal esters |
| EP0231853B1 (en) * | 1986-01-31 | 1990-11-22 | Dainippon Ink And Chemicals, Inc. | Optically active carboxylic acid derivatives and liquid crystalline compositions comprising them |
| FR2595094B1 (fr) * | 1986-02-28 | 1988-08-12 | Commissariat Energie Atomique | Difluoro-2,2' alcoxy-4 hydroxy-4' biphenyles et leurs derives, leur procede de fabrication et leur utilisation dans des dispositifs d'affichage a cristaux liquides |
| GB8610349D0 (en) * | 1986-04-28 | 1986-06-04 | Bdh Ltd | 6-hydroxy-2-naphthoic acid derivatives |
| WO1989006678A1 (en) * | 1988-01-14 | 1989-07-27 | MERCK Patent Gesellschaft mit beschränkter Haftung | Fluorinated oligophenyl derivatives |
| GB8804330D0 (en) * | 1988-02-24 | 1988-03-23 | Secr Defence | Laterally fluorinated 4-cyanophenyl & 4-cyanobiphenyl benzoates |
| US5230827A (en) * | 1988-03-10 | 1993-07-27 | Merck Patent Gesellschaft Mit Beschrankter Haftung | Derivatives of 2,3-difluorobenzoic acid |
| CH678334A5 (enExample) * | 1988-03-10 | 1991-08-30 | Merck Patent Gmbh | |
| DE3807957A1 (de) * | 1988-03-10 | 1989-09-21 | Merck Patent Gmbh | Derivate des 2,3-difluorphenols |
| US5292453A (en) * | 1988-06-24 | 1994-03-08 | Canon Kabushiki Kaisha | Ferroelectric liquid crystal composition with improved driving voltage and temperature margins and liquid crystal device using same |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE86269C (enExample) * | ||||
| BE759491A (fr) * | 1969-11-28 | 1971-04-30 | Sandoz Sa | Procede de preparation de nouveaux esters phenyliques d'acides benzoiques |
| BE787198A (fr) * | 1971-08-07 | 1973-02-05 | Merck Patent Gmbh | Composes et melanges nematiques |
| FR2184512B1 (enExample) * | 1972-05-19 | 1975-11-28 | Thomson Csf | |
| US3876286A (en) * | 1972-06-14 | 1975-04-08 | Werk Fernsehelektronik Veb | Use of nematic liquid crystalline substances |
| DE2800553A1 (de) * | 1978-01-07 | 1979-07-12 | Merck Patent Gmbh | Cyclohexanderivate |
| AT364000B (de) * | 1978-01-30 | 1981-09-10 | Bbc Brown Boveri & Cie | Fluessigkristallsubstanz |
| FR2429832A1 (fr) * | 1978-06-26 | 1980-01-25 | Orogil | Procede perfectionne de preparation d'additifs detergents-dispersants, metalliques de haute alcalinite notamment pour huiles lubrifiantes |
| DE2933563A1 (de) * | 1979-07-18 | 1981-02-05 | Bbc Brown Boveri & Cie | Anisotrope verbindungen mit negativer dk-anisotropie |
-
1980
- 1980-09-26 GB GB8031247A patent/GB2063250B/en not_active Expired
- 1980-09-30 US US06/192,557 patent/US4542230A/en not_active Expired - Lifetime
- 1980-10-01 FR FR8021076A patent/FR2466496B1/fr not_active Expired
- 1980-10-01 CH CH733780A patent/CH646938A5/de not_active IP Right Cessation
- 1980-10-02 DE DE19803037303 patent/DE3037303A1/de active Granted
-
1985
- 1985-09-05 SG SG64385A patent/SG64385G/en unknown
- 1985-12-18 HK HK1008/85A patent/HK100885A/xx not_active IP Right Cessation
-
1987
- 1987-12-31 MY MY1987219A patent/MY8700219A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CH646938A5 (de) | 1984-12-28 |
| GB2063250B (en) | 1984-05-31 |
| US4542230A (en) | 1985-09-17 |
| FR2466496B1 (fr) | 1984-12-07 |
| HK100885A (en) | 1985-12-27 |
| FR2466496A1 (fr) | 1981-04-10 |
| MY8700219A (en) | 1987-12-31 |
| SG64385G (en) | 1987-03-27 |
| DE3037303A1 (de) | 1981-04-23 |
| GB2063250A (en) | 1981-06-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3037303C2 (enExample) | ||
| EP0474062B1 (de) | Matrix-Flüssigkristallanzeige | |
| EP0207975B1 (de) | Flüssigkristalline phase | |
| DE2854310C2 (enExample) | ||
| DE2931637C2 (enExample) | ||
| EP0205503B1 (de) | Flüssigkristalline phase | |
| DE69708231T2 (de) | Azin-Derivat, Verfahren zu seiner Herstellung, diese enthaltende nematische flüssigkristalline Zusammensetzung und diese enthaltende flüssigkristalline Anzeigevorrichtung | |
| CH653143A5 (de) | Fluessigkristall-anzeigeelemente. | |
| EP1146104A2 (de) | Flüssigkristallines Medium | |
| DE2617593A1 (de) | Diphenylderivate und ihre verwendung | |
| EP0218132A1 (de) | Flüssigkristall-Phase mit eine Temperaturkompensation bewirkenden Dotierstoffen | |
| DE3685569T2 (de) | Ferroelektrische pyridinverbindungen und sie enthaltende fluessigkristalline zusammensetzungen. | |
| DE10064995A1 (de) | Flüssigkristallines Medium | |
| EP0307880B1 (de) | Flüssigkristalline, insbesondere ferroelektrische flüssigkristalline Mischungen | |
| DE69106160T2 (de) | Tolanderivate, sie enthaltende flüssigkristalline Zusammensetzungen und sie verwendende Flüssigkristallelemente. | |
| EP0258349B1 (de) | Elektrooptisches anzeigeelement | |
| EP0363451B2 (de) | Supertwist-flüssigkristallanzeige | |
| CH625498A5 (enExample) | ||
| DE69010731T2 (de) | Ferroelektrische Flüssigkristall-Zusammensetzung. | |
| DE3241027A1 (de) | Fluessigkristalline, chirale verbindung, insbesondere als bestandteil eines fluessigkristallinen gast/wirt-materials und elektro-optische anzeigeeinheit mit diesem material | |
| DE112008000662B4 (de) | Verfahren zur Herstellung einer Flüssigkristallzusammensetzung | |
| DE69114730T2 (de) | Flüssigkristallverbindung. | |
| DE3510733A1 (de) | Fluessigkristallphase | |
| DE3780173T2 (de) | Cyano-alicyclische ester und fluessigkristall-zusammensetzungen. | |
| DE4011804A1 (de) | Verwendung von makrocyclischen verbindungen als komponente fuer ferroelektrische fluessigkristallmischungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8128 | New person/name/address of the agent |
Representative=s name: BEETZ SEN., R., DIPL.-ING. BEETZ JUN., R., DIPL.-I |
|
| 8125 | Change of the main classification |
Ipc: C07C 69/75 |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |