DE2817607C2 - - Google Patents
Info
- Publication number
- DE2817607C2 DE2817607C2 DE2817607A DE2817607A DE2817607C2 DE 2817607 C2 DE2817607 C2 DE 2817607C2 DE 2817607 A DE2817607 A DE 2817607A DE 2817607 A DE2817607 A DE 2817607A DE 2817607 C2 DE2817607 C2 DE 2817607C2
- Authority
- DE
- Germany
- Prior art keywords
- polymer
- developer composition
- composition according
- layer
- developer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 229920000642 polymer Polymers 0.000 claims description 76
- 239000000203 mixture Substances 0.000 claims description 44
- -1 amino, phenyl Chemical group 0.000 claims description 34
- 229920001577 copolymer Polymers 0.000 claims description 25
- 229910052709 silver Inorganic materials 0.000 claims description 25
- 239000004332 silver Substances 0.000 claims description 25
- 239000000178 monomer Substances 0.000 claims description 22
- 239000000126 substance Substances 0.000 claims description 22
- 229920000578 graft copolymer Polymers 0.000 claims description 21
- 239000000463 material Substances 0.000 claims description 17
- 239000004354 Hydroxyethyl cellulose Substances 0.000 claims description 15
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 claims description 15
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 claims description 15
- 238000012545 processing Methods 0.000 claims description 12
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 11
- 125000001424 substituent group Chemical group 0.000 claims description 11
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- 239000000049 pigment Substances 0.000 claims description 9
- 125000002947 alkylene group Chemical group 0.000 claims description 8
- 239000006185 dispersion Substances 0.000 claims description 8
- 239000003795 chemical substances by application Substances 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 230000001965 increasing effect Effects 0.000 claims description 6
- 229920002678 cellulose Polymers 0.000 claims description 5
- 239000001913 cellulose Substances 0.000 claims description 5
- 239000003605 opacifier Substances 0.000 claims description 5
- 239000004408 titanium dioxide Substances 0.000 claims description 5
- 238000004804 winding Methods 0.000 claims description 5
- 125000003544 oxime group Chemical group 0.000 claims description 4
- 229920000915 polyvinyl chloride Polymers 0.000 claims description 4
- BRXCDHOLJPJLLT-UHFFFAOYSA-N butane-2-sulfonic acid Chemical compound CCC(C)S(O)(=O)=O BRXCDHOLJPJLLT-UHFFFAOYSA-N 0.000 claims description 3
- 239000006229 carbon black Substances 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 239000012736 aqueous medium Substances 0.000 claims description 2
- 239000000975 dye Substances 0.000 description 33
- 150000002923 oximes Chemical class 0.000 description 28
- OMNKZBIFPJNNIO-UHFFFAOYSA-N n-(2-methyl-4-oxopentan-2-yl)prop-2-enamide Chemical compound CC(=O)CC(C)(C)NC(=O)C=C OMNKZBIFPJNNIO-UHFFFAOYSA-N 0.000 description 23
- 239000000243 solution Substances 0.000 description 23
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 22
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 21
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 19
- 238000009792 diffusion process Methods 0.000 description 16
- 238000012546 transfer Methods 0.000 description 16
- 229910052757 nitrogen Inorganic materials 0.000 description 11
- 238000006116 polymerization reaction Methods 0.000 description 11
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 10
- 150000001875 compounds Chemical class 0.000 description 9
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 8
- 229920001519 homopolymer Polymers 0.000 description 8
- 238000000034 method Methods 0.000 description 8
- 238000006146 oximation reaction Methods 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- 239000012153 distilled water Substances 0.000 description 7
- 239000000839 emulsion Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 6
- 230000005540 biological transmission Effects 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 238000011161 development Methods 0.000 description 6
- 238000009826 distribution Methods 0.000 description 6
- 150000002500 ions Chemical class 0.000 description 6
- 239000002609 medium Substances 0.000 description 6
- 230000003647 oxidation Effects 0.000 description 6
- 238000007254 oxidation reaction Methods 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 150000001299 aldehydes Chemical class 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- 229910052723 transition metal Inorganic materials 0.000 description 5
- 150000003624 transition metals Chemical class 0.000 description 5
- XHZPRMZZQOIPDS-UHFFFAOYSA-N 2-Methyl-2-[(1-oxo-2-propenyl)amino]-1-propanesulfonic acid Chemical compound OS(=O)(=O)CC(C)(C)NC(=O)C=C XHZPRMZZQOIPDS-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 4
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 239000003513 alkali Substances 0.000 description 4
- 229920003090 carboxymethyl hydroxyethyl cellulose Polymers 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000000758 substrate Substances 0.000 description 4
- 229920000536 2-Acrylamido-2-methylpropane sulfonic acid Polymers 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- 229910017912 NH2OH Inorganic materials 0.000 description 3
- 239000004372 Polyvinyl alcohol Substances 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000003929 acidic solution Substances 0.000 description 3
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 description 3
- 238000013459 approach Methods 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 238000007720 emulsion polymerization reaction Methods 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 150000002576 ketones Chemical class 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 229920002451 polyvinyl alcohol Polymers 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 125000006850 spacer group Chemical group 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 125000003435 aroyl group Chemical group 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- FUSUHKVFWTUUBE-UHFFFAOYSA-N buten-2-one Chemical compound CC(=O)C=C FUSUHKVFWTUUBE-UHFFFAOYSA-N 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 239000008119 colloidal silica Substances 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 239000008232 de-aerated water Substances 0.000 description 2
- 230000003028 elevating effect Effects 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 230000002708 enhancing effect Effects 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000011888 foil Substances 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 125000000468 ketone group Chemical group 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- AJDUTMFFZHIJEM-UHFFFAOYSA-N n-(9,10-dioxoanthracen-1-yl)-4-[4-[[4-[4-[(9,10-dioxoanthracen-1-yl)carbamoyl]phenyl]phenyl]diazenyl]phenyl]benzamide Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC(=O)C(C=C1)=CC=C1C(C=C1)=CC=C1N=NC(C=C1)=CC=C1C(C=C1)=CC=C1C(=O)NC1=CC=CC2=C1C(=O)C1=CC=CC=C1C2=O AJDUTMFFZHIJEM-UHFFFAOYSA-N 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 229920000139 polyethylene terephthalate Polymers 0.000 description 2
- 239000005020 polyethylene terephthalate Substances 0.000 description 2
- 239000004800 polyvinyl chloride Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- 239000012463 white pigment Substances 0.000 description 2
- 239000001043 yellow dye Substances 0.000 description 2
- FZENGILVLUJGJX-NSCUHMNNSA-N (E)-acetaldehyde oxime Chemical compound C\C=N\O FZENGILVLUJGJX-NSCUHMNNSA-N 0.000 description 1
- DZSVIVLGBJKQAP-UHFFFAOYSA-N 1-(2-methyl-5-propan-2-ylcyclohex-2-en-1-yl)propan-1-one Chemical compound CCC(=O)C1CC(C(C)C)CC=C1C DZSVIVLGBJKQAP-UHFFFAOYSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- FECNOIODIVNEKI-UHFFFAOYSA-N 2-[(2-aminobenzoyl)amino]benzoic acid Chemical class NC1=CC=CC=C1C(=O)NC1=CC=CC=C1C(O)=O FECNOIODIVNEKI-UHFFFAOYSA-N 0.000 description 1
- AYHBRSKXFVQPPX-UHFFFAOYSA-M 2-methyl-1-(2-phenylethyl)pyridin-1-ium;bromide Chemical compound [Br-].CC1=CC=CC=[N+]1CCC1=CC=CC=C1 AYHBRSKXFVQPPX-UHFFFAOYSA-M 0.000 description 1
- FPBFWDHYZMVTJD-UHFFFAOYSA-N 2-methyl-2-(prop-2-enoylamino)propanoic acid Chemical compound OC(=O)C(C)(C)NC(=O)C=C FPBFWDHYZMVTJD-UHFFFAOYSA-N 0.000 description 1
- GKGOIYMLPJJVQI-UHFFFAOYSA-N 4-ethenylbenzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=C(C=C)C=C1 GKGOIYMLPJJVQI-UHFFFAOYSA-N 0.000 description 1
- SHVCSCWHWMSGTE-UHFFFAOYSA-N 6-methyluracil Chemical compound CC1=CC(=O)NC(=O)N1 SHVCSCWHWMSGTE-UHFFFAOYSA-N 0.000 description 1
- LHCPRYRLDOSKHK-UHFFFAOYSA-N 7-deaza-8-aza-adenine Chemical compound NC1=NC=NC2=C1C=NN2 LHCPRYRLDOSKHK-UHFFFAOYSA-N 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical class NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- 229920002126 Acrylic acid copolymer Polymers 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000008431 aliphatic amides Chemical class 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- LHIJANUOQQMGNT-UHFFFAOYSA-N aminoethylethanolamine Chemical compound NCCNCCO LHIJANUOQQMGNT-UHFFFAOYSA-N 0.000 description 1
- 229910001870 ammonium persulfate Inorganic materials 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000008430 aromatic amides Chemical class 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 1
- 239000012964 benzotriazole Substances 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- XMPZTFVPEKAKFH-UHFFFAOYSA-P ceric ammonium nitrate Chemical compound [NH4+].[NH4+].[Ce+4].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O XMPZTFVPEKAKFH-UHFFFAOYSA-P 0.000 description 1
- 229910052681 coesite Inorganic materials 0.000 description 1
- 230000000295 complement effect Effects 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 239000013068 control sample Substances 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- 229910052906 cristobalite Inorganic materials 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 238000001212 derivatisation Methods 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 238000010528 free radical solution polymerization reaction Methods 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 229920006158 high molecular weight polymer Polymers 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000003384 imaging method Methods 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 230000000873 masking effect Effects 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 229920000620 organic polymer Polymers 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- NWVVVBRKAWDGAB-UHFFFAOYSA-N p-methoxyphenol Chemical compound COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 1
- 229920005735 poly(methyl vinyl ketone) Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- DFONPBPAXHASSF-UHFFFAOYSA-N propan-2-one prop-2-enamide prop-2-enoic acid Chemical compound CC(=O)C.CC(=O)C.C(C=C)(=O)N.C(C=C)(=O)O DFONPBPAXHASSF-UHFFFAOYSA-N 0.000 description 1
- 230000000979 retarding effect Effects 0.000 description 1
- 150000003839 salts Chemical group 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 239000004071 soot Substances 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 229910052682 stishovite Inorganic materials 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 229910001428 transition metal ion Inorganic materials 0.000 description 1
- 238000013519 translation Methods 0.000 description 1
- 229910052905 tridymite Inorganic materials 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 238000003466 welding Methods 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C8/00—Diffusion transfer processes or agents therefor; Photosensitive materials for such processes
- G03C8/32—Development processes or agents therefor
- G03C8/36—Developers
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F20/00—Homopolymers and copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and only one being terminated by only one carboxyl radical or a salt, anhydride, ester, amide, imide or nitrile thereof
- C08F20/02—Monocarboxylic acids having less than ten carbon atoms, Derivatives thereof
- C08F20/52—Amides or imides
- C08F20/54—Amides, e.g. N,N-dimethylacrylamide or N-isopropylacrylamide
- C08F20/60—Amides, e.g. N,N-dimethylacrylamide or N-isopropylacrylamide containing nitrogen in addition to the carbonamido nitrogen
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F8/00—Chemical modification by after-treatment
- C08F8/30—Introducing nitrogen atoms or nitrogen-containing groups
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C5/00—Photographic processes or agents therefor; Regeneration of such processing agents
- G03C5/26—Processes using silver-salt-containing photosensitive materials or agents therefor
- G03C5/261—Non-bath processes, e.g. using pastes, webs, viscous compositions
Landscapes
- Chemical & Material Sciences (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- General Chemical & Material Sciences (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Other Resins Obtained By Reactions Not Involving Carbon-To-Carbon Unsaturated Bonds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US78942277A | 1977-04-21 | 1977-04-21 | |
| US05/894,545 US4202694A (en) | 1977-04-21 | 1978-04-07 | Pendant oxime polymers and photographic use thereof |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2817607A1 DE2817607A1 (de) | 1978-10-26 |
| DE2817607C2 true DE2817607C2 (enExample) | 1990-01-11 |
Family
ID=27120914
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19782817607 Granted DE2817607A1 (de) | 1977-04-21 | 1978-04-21 | Photographische verfahren und aaufzeichnungsmaterialien, entwicklermassen und polymere fuer entwicklermassen |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4202694A (enExample) |
| JP (1) | JPS6019497B2 (enExample) |
| AU (1) | AU515489B2 (enExample) |
| CA (1) | CA1123148A (enExample) |
| DE (1) | DE2817607A1 (enExample) |
| FR (2) | FR2396333A1 (enExample) |
| GB (2) | GB1602424A (enExample) |
| IT (1) | IT1094122B (enExample) |
| NL (1) | NL186721C (enExample) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4256614A (en) * | 1978-04-07 | 1981-03-17 | Polaroid Corporation | Novel oxime polymers and process for preparing same |
| US4350801A (en) * | 1981-02-27 | 1982-09-21 | Polaroid Corporation | Process for preparing polymeric oximes |
| US4397996A (en) * | 1981-05-22 | 1983-08-09 | Polaroid Corporation | Process for preparing polymeric oximes and compositions containing same |
| FR2519973A1 (fr) * | 1982-01-15 | 1983-07-22 | Centre Nat Rech Scient | Procede d'hydrolyse catalytique d'un alpha-amino-nitrile en phase heterogene, ainsi que les resines polymeres a activite catalytique pour la mise en oeuvre du procede |
| JPS58146237A (ja) * | 1982-02-22 | 1983-08-31 | Ajinomoto Co Inc | チ−ズ様食品の製造法 |
| US4510294A (en) * | 1982-07-02 | 1985-04-09 | Polaroid Corporation | Polymerization of monomeric hydrogen-blocked oxime derivatives |
| JPS5939245A (ja) * | 1982-08-27 | 1984-03-03 | Taiyo Yushi Kk | 熱融解性チ−ズ様食品の製造方法 |
| JPS6035729A (ja) * | 1983-08-08 | 1985-02-23 | Fuji Photo Film Co Ltd | ハロゲン化銀写真感光材料の処理方法 |
| US4680247A (en) * | 1986-03-31 | 1987-07-14 | Polaroid Corporation, Patent Dept. | Photographic processing composition with poly(diacetone acrylamide) oxime and styrene-butadiene latex |
| JPH0256700U (enExample) * | 1988-10-15 | 1990-04-24 | ||
| DE4121946A1 (de) * | 1991-07-03 | 1993-01-07 | Basf Ag | Bei raumtemperatur vernetzende, waessrige kunstharzzubereitung und ihre verwendung als kaschierkleber |
| US5322758A (en) * | 1992-09-28 | 1994-06-21 | Eastman Kodak Company | Integral color diffusion transfer element for large volume development |
| US5342730A (en) * | 1992-09-28 | 1994-08-30 | Eastman Kodak Company | Dye releasing couplers for color diffusion transfer elements with dye barrier layers |
| US5422233A (en) * | 1994-05-17 | 1995-06-06 | Polaroid Corporation | Photographic processing compositions including hydrophobically modified thickening agent |
| GB2304200B (en) * | 1995-07-07 | 1999-04-14 | Kodak Ltd | Processing liquid for lamination processing |
| US5947283A (en) * | 1996-06-04 | 1999-09-07 | Marshall; John C. | Fan blade display package |
Family Cites Families (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2959574A (en) * | 1958-02-17 | 1960-11-08 | American Cyanamid Co | Water-soluble reaction composition of hydroxylamine with acrylamide-acrylonitrile copolymer |
| US3088799A (en) * | 1959-05-25 | 1963-05-07 | Nopco Chem Co | Metal extraction process |
| US3063951A (en) * | 1962-02-26 | 1962-11-13 | Gevaert Photo Producten | Polymeric amidoximes and their derivatives and a method of preparing same |
| NL203642A (enExample) * | 1962-02-26 | |||
| US3293216A (en) * | 1963-03-01 | 1966-12-20 | American Cyanamid Co | Derivatives of polycrotonaldehyde |
| US3328357A (en) * | 1964-06-03 | 1967-06-27 | Dow Chemical Co | N-hydroxymaleimide copolymers |
| US3362822A (en) * | 1965-08-25 | 1968-01-09 | Polaroid Corp | Film formation in silver and color diffusion transfer processes |
| GB1180846A (en) * | 1967-08-08 | 1970-02-11 | Agfa Gevaert Nv | Photopolymerisation of Ethylenically Unsaturated Organic Compounds |
| GB1180845A (en) * | 1967-08-08 | 1970-02-11 | Agfa Gevaert Nv | Light-Sensitive Polymers and their use in the preparation of Photographic Printing Plates |
| US3488329A (en) * | 1968-04-01 | 1970-01-06 | Monsanto Co | N-hydroxy nitrogenous copolymers |
| US3575701A (en) * | 1969-01-13 | 1971-04-20 | Polaroid Corp | Polyvinylamide grafts in spacer layers for color diffusion transfer imagereceiving units |
| CA931299A (en) * | 1970-09-25 | 1973-07-31 | Polysar Limited | Terminally reactive polymers |
| US3647437A (en) * | 1970-12-18 | 1972-03-07 | Polaroid Corp | Photographic products, processes and compositions |
| CA998495A (en) * | 1971-04-15 | 1976-10-12 | Snamprogetti S.P.A. | Modified polyisoprene and process for the preparation thereof |
| US3706715A (en) * | 1971-07-01 | 1972-12-19 | Hercules Inc | Cross-linkable polymer compositions comprising ethylenically unsaturated polymer |
| US3711446A (en) * | 1971-07-01 | 1973-01-16 | Hercules Inc | Cross-linkable polymer compositions comprising ethylenically unsaturated polymer |
| AU7496074A (en) * | 1973-11-21 | 1976-05-06 | Snam Progetti | Transforming hydrocarbon polymers into photodegradable |
| IL44168A (en) * | 1974-02-08 | 1980-03-31 | Yeda Res & Dev | Acyl amino acylamino or oxime activated phenalkyl (or heteroacylalkyl) benzenes optionally linked to a polymer backbone as reagents useful in organic synthesis as ion exchange agents for the capture of aldehydes or for extracting metals and process for their preparation |
-
1978
- 1978-04-07 US US05/894,545 patent/US4202694A/en not_active Expired - Lifetime
- 1978-04-19 AU AU35263/78A patent/AU515489B2/en not_active Expired
- 1978-04-20 CA CA301,513A patent/CA1123148A/en not_active Expired
- 1978-04-21 DE DE19782817607 patent/DE2817607A1/de active Granted
- 1978-04-21 NL NLAANVRAGE7804317,A patent/NL186721C/xx not_active IP Right Cessation
- 1978-04-21 JP JP53047612A patent/JPS6019497B2/ja not_active Expired
- 1978-04-21 GB GB37580/79A patent/GB1602424A/en not_active Expired
- 1978-04-21 FR FR7811817A patent/FR2396333A1/fr active Granted
- 1978-04-21 IT IT22565/78A patent/IT1094122B/it active
- 1978-04-21 GB GB15932/78A patent/GB1602423A/en not_active Expired
- 1978-10-03 FR FR7828215A patent/FR2396031A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| IT1094122B (it) | 1985-07-26 |
| JPS5417020A (en) | 1979-02-08 |
| FR2396333B1 (enExample) | 1981-04-17 |
| AU515489B2 (en) | 1981-04-09 |
| NL186721B (nl) | 1990-09-03 |
| GB1602424A (en) | 1981-11-11 |
| NL7804317A (nl) | 1978-10-24 |
| AU3526378A (en) | 1979-10-25 |
| CA1123148A (en) | 1982-05-04 |
| US4202694A (en) | 1980-05-13 |
| JPS6019497B2 (ja) | 1985-05-16 |
| NL186721C (nl) | 1991-02-01 |
| FR2396333A1 (fr) | 1979-01-26 |
| GB1602423A (en) | 1981-11-11 |
| FR2396031B1 (enExample) | 1984-08-10 |
| DE2817607A1 (de) | 1978-10-26 |
| FR2396031A1 (fr) | 1979-01-26 |
| IT7822565A0 (it) | 1978-04-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2551786C3 (de) | Photographisches Aufzeichnungsmaterial für das Farbdiffusionsübertragungsverfahren | |
| DE2817607C2 (enExample) | ||
| DE69531605T2 (de) | Zweiphasige acidische wässrige zusammensetzung für diffusionsübertragungsprodukte | |
| DE3247901C2 (enExample) | ||
| DE3116044C2 (de) | Photographisches Aufzeichnungsmaterial nach dem Diffusionsübertragungsverfahren | |
| DE3109259C2 (enExample) | ||
| DE3247552A1 (de) | Verfahren zur herstellung eines polymerbildes und photographisches lichtempfindliches material | |
| EP0027231B1 (de) | Photographisches Material mit einer Beizmittelschicht | |
| DE2200063A1 (de) | Polymere Beizmittel | |
| DE3027298C2 (de) | Photographisches Aufzeichnungsmaterial | |
| DE2230936C3 (de) | Lichtempfindliches Gemisch | |
| DE3851509T2 (de) | Photographische Materialien die copolymerische Beizmittel enthalten. | |
| DE3206030C2 (enExample) | ||
| DE1154717B (de) | Photographisches Mehrschichtenfarbmaterial und Verfahren zur Herstellung von Farbbildern hiermit | |
| DE2729819C3 (de) | Photographisches Aufzeichnungsmaterial für das Diffusionsübertragungsverfahren | |
| DE2319489A1 (de) | Photographische entwicklungs- oder behandlungsmasse, insbesondere fuer das diffusionsuebertragungsverfahren | |
| DE2652464A1 (de) | Fotografische filmeinheit zur herstellung farbiger uebertragsbilder | |
| DE2300174C2 (de) | Fotografisches Aufzeichnungsmaterial | |
| EP0017025B1 (de) | Fotografische Filmeinheit zur Herstellung farbiger Übertragsbilder | |
| DE3426276A1 (de) | Photographisches element | |
| DE1797198A1 (de) | Bildempfangsmaterial fuer das Farbstoffdiffusionsuebertragungsverfahren | |
| DE2440537A1 (de) | Photographisches element zur farbdiffusionsuebertragung | |
| DE2005300A1 (de) | Photographisches Verfahren zur Herstellung von Farbbildern nach dem Farbdiffus ions üb ertragungs verfahren | |
| DE3025080A1 (de) | Photographisches aufzeichnungsmaterial fuer das farbdiffusionsuebertragungsverfahren | |
| US4276370A (en) | Photographic processing composition containing polymerics oxime |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8125 | Change of the main classification |
Ipc: G03C 5/54 |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |