DE2808070A1 - Verfahren zur herstellung von 4-pyridon-3-carbonsaeuren und/oder deren derivaten - Google Patents
Verfahren zur herstellung von 4-pyridon-3-carbonsaeuren und/oder deren derivatenInfo
- Publication number
- DE2808070A1 DE2808070A1 DE19782808070 DE2808070A DE2808070A1 DE 2808070 A1 DE2808070 A1 DE 2808070A1 DE 19782808070 DE19782808070 DE 19782808070 DE 2808070 A DE2808070 A DE 2808070A DE 2808070 A1 DE2808070 A1 DE 2808070A1
- Authority
- DE
- Germany
- Prior art keywords
- formula
- alkyl
- reaction stage
- substituted carbon
- carbon atoms
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims description 43
- 238000004519 manufacturing process Methods 0.000 title description 3
- 238000006243 chemical reaction Methods 0.000 claims description 47
- -1 N-morpholinyl Chemical group 0.000 claims description 25
- 125000004432 carbon atom Chemical group C* 0.000 claims description 25
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 24
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 22
- 125000005842 heteroatom Chemical group 0.000 claims description 18
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 claims description 17
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 16
- 229910052757 nitrogen Inorganic materials 0.000 claims description 16
- 150000001875 compounds Chemical class 0.000 claims description 12
- 150000002081 enamines Chemical class 0.000 claims description 12
- 229910052736 halogen Inorganic materials 0.000 claims description 12
- 150000003839 salts Chemical class 0.000 claims description 12
- 229910052799 carbon Inorganic materials 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 9
- 125000003118 aryl group Chemical group 0.000 claims description 8
- 239000000010 aprotic solvent Substances 0.000 claims description 7
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 7
- 238000002360 preparation method Methods 0.000 claims description 7
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 6
- 150000002431 hydrogen Chemical group 0.000 claims description 6
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 6
- 150000002367 halogens Chemical class 0.000 claims description 5
- 125000000623 heterocyclic group Chemical group 0.000 claims description 5
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 4
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 4
- 229910052731 fluorine Inorganic materials 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 239000012876 carrier material Substances 0.000 claims 1
- 239000008194 pharmaceutical composition Substances 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 35
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 20
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 18
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 18
- 239000002585 base Substances 0.000 description 18
- 235000019441 ethanol Nutrition 0.000 description 14
- 238000002844 melting Methods 0.000 description 14
- 230000008018 melting Effects 0.000 description 14
- 239000000203 mixture Substances 0.000 description 14
- 239000000243 solution Substances 0.000 description 13
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 12
- 239000002904 solvent Substances 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 239000002253 acid Substances 0.000 description 9
- 238000001816 cooling Methods 0.000 description 9
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 9
- 150000003254 radicals Chemical class 0.000 description 9
- 230000000844 anti-bacterial effect Effects 0.000 description 7
- 238000009835 boiling Methods 0.000 description 7
- 150000002148 esters Chemical class 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 6
- 229910052794 bromium Inorganic materials 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 6
- 238000000354 decomposition reaction Methods 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- 238000001953 recrystallisation Methods 0.000 description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 5
- 239000004480 active ingredient Substances 0.000 description 5
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 5
- 229910052801 chlorine Inorganic materials 0.000 description 5
- 238000005580 one pot reaction Methods 0.000 description 5
- OGLKKYALUKXVPQ-UHFFFAOYSA-N 2-chloro-5-nitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=CC=C(Cl)C(C(Cl)=O)=C1 OGLKKYALUKXVPQ-UHFFFAOYSA-N 0.000 description 4
- ZDWXDEDBIUIQMY-UHFFFAOYSA-N 2-chloro-6-methylpyridine-3-carbonyl chloride Chemical compound CC1=CC=C(C(Cl)=O)C(Cl)=N1 ZDWXDEDBIUIQMY-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 4
- 125000003277 amino group Chemical group 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- 239000000825 pharmaceutical preparation Substances 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 238000007363 ring formation reaction Methods 0.000 description 4
- 238000007127 saponification reaction Methods 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 150000004982 aromatic amines Chemical class 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 150000001721 carbon Chemical group 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- FIMJSWFMQJGVAM-UHFFFAOYSA-N chloroform;hydrate Chemical compound O.ClC(Cl)Cl FIMJSWFMQJGVAM-UHFFFAOYSA-N 0.000 description 3
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical group C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 3
- 125000004494 ethyl ester group Chemical group 0.000 description 3
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 150000004702 methyl esters Chemical class 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 2
- QIMCIIVGSIZXFU-UHFFFAOYSA-N 3-chloroquinoxaline-2-carbonyl chloride Chemical compound C1=CC=C2N=C(Cl)C(C(=O)Cl)=NC2=C1 QIMCIIVGSIZXFU-UHFFFAOYSA-N 0.000 description 2
- LKPFDPSGMYVOLT-UHFFFAOYSA-N 4-chloro-2-ethylsulfanylpyrimidine-5-carbonyl chloride Chemical compound CCSC1=NC=C(C(Cl)=O)C(Cl)=N1 LKPFDPSGMYVOLT-UHFFFAOYSA-N 0.000 description 2
- CSQKICWPCREIJP-UHFFFAOYSA-N 4-chloropyridine-3-carbonyl chloride Chemical compound ClC(=O)C1=CN=CC=C1Cl CSQKICWPCREIJP-UHFFFAOYSA-N 0.000 description 2
- 241000894006 Bacteria Species 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- OJGMBLNIHDZDGS-UHFFFAOYSA-N N-Ethylaniline Chemical compound CCNC1=CC=CC=C1 OJGMBLNIHDZDGS-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 241000588769 Proteus <enterobacteria> Species 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 239000003674 animal food additive Substances 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 239000003899 bactericide agent Substances 0.000 description 2
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical class ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- MEFCRZOOCKJWMB-WAYWQWQTSA-N methyl (z)-3-(2,2-dimethylhydrazinyl)but-2-enoate Chemical compound COC(=O)\C=C(\C)NN(C)C MEFCRZOOCKJWMB-WAYWQWQTSA-N 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- RQSNAVWMKNCCCT-QXMHVHEDSA-N (Z)-3-(morpholin-4-ylamino)-N-phenylbut-2-enamide Chemical compound N1(CCOCC1)N\C(=C/C(=O)NC1=CC=CC=C1)\C RQSNAVWMKNCCCT-QXMHVHEDSA-N 0.000 description 1
- KMZCSIZVHSRFPJ-UHFFFAOYSA-N 1-cyclopentyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound N=1C(C)=CC=C(C(C(C(O)=O)=C2)=O)C=1N2C1CCCC1 KMZCSIZVHSRFPJ-UHFFFAOYSA-N 0.000 description 1
- PMZDQRJGMBOQBF-UHFFFAOYSA-N 1H-quinolin-4-one Natural products C1=CC=C2C(O)=CC=NC2=C1 PMZDQRJGMBOQBF-UHFFFAOYSA-N 0.000 description 1
- XAXLEFIWFHRGMT-UHFFFAOYSA-N 2,4,5-trichloro-3-nitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=C(Cl)C(Cl)=CC(C(Cl)=O)=C1Cl XAXLEFIWFHRGMT-UHFFFAOYSA-N 0.000 description 1
- VWIPDEIWTDELAA-UHFFFAOYSA-N 2,4,6-trichloro-3,5-dinitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=C(Cl)C(C(Cl)=O)=C(Cl)C([N+]([O-])=O)=C1Cl VWIPDEIWTDELAA-UHFFFAOYSA-N 0.000 description 1
- NTYHBYCQFBJNLG-UHFFFAOYSA-N 2,4-dichloro-3,5-dinitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=CC(C(Cl)=O)=C(Cl)C([N+]([O-])=O)=C1Cl NTYHBYCQFBJNLG-UHFFFAOYSA-N 0.000 description 1
- AIUBHJLBXIFMOG-UHFFFAOYSA-N 2,4-dichloro-3-nitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=C(Cl)C=CC(C(Cl)=O)=C1Cl AIUBHJLBXIFMOG-UHFFFAOYSA-N 0.000 description 1
- MRJWZKHVENHUJA-UHFFFAOYSA-N 2,4-dichloro-5-nitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=CC(C(Cl)=O)=C(Cl)C=C1Cl MRJWZKHVENHUJA-UHFFFAOYSA-N 0.000 description 1
- DZTIFMWYYHCREC-UHFFFAOYSA-N 2,4-dichloropyrimidine-5-carbonyl chloride Chemical compound ClC(=O)C1=CN=C(Cl)N=C1Cl DZTIFMWYYHCREC-UHFFFAOYSA-N 0.000 description 1
- DRWKYBUROSTSFN-UHFFFAOYSA-N 2,5,6-trichloropyridine-3-carbonyl chloride Chemical compound ClC(=O)C1=CC(Cl)=C(Cl)N=C1Cl DRWKYBUROSTSFN-UHFFFAOYSA-N 0.000 description 1
- FPZGHBKVHMYPFO-UHFFFAOYSA-N 2,6-dichloro-3,5-dinitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=CC([N+]([O-])=O)=C(Cl)C(C(Cl)=O)=C1Cl FPZGHBKVHMYPFO-UHFFFAOYSA-N 0.000 description 1
- JHMHYTKDALCQSZ-UHFFFAOYSA-N 2,6-dichloropyridine-3-carbonyl chloride Chemical compound ClC(=O)C1=CC=C(Cl)N=C1Cl JHMHYTKDALCQSZ-UHFFFAOYSA-N 0.000 description 1
- ZSROXVDSDSXWFG-UHFFFAOYSA-N 2-bromopyridine-3-carbonyl chloride Chemical compound ClC(=O)C1=CC=CN=C1Br ZSROXVDSDSXWFG-UHFFFAOYSA-N 0.000 description 1
- QFGXKJGQMYAPIM-UHFFFAOYSA-N 2-chloro-3,5-dinitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=CC(C(Cl)=O)=C(Cl)C([N+]([O-])=O)=C1 QFGXKJGQMYAPIM-UHFFFAOYSA-N 0.000 description 1
- MOWGCWIDCJFGFG-UHFFFAOYSA-N 2-chloro-3-nitro-5-(trifluoromethyl)benzoyl chloride Chemical compound [O-][N+](=O)C1=CC(C(F)(F)F)=CC(C(Cl)=O)=C1Cl MOWGCWIDCJFGFG-UHFFFAOYSA-N 0.000 description 1
- AYUUKEMEFZPHQQ-UHFFFAOYSA-N 2-chloro-3-nitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=CC=CC(C(Cl)=O)=C1Cl AYUUKEMEFZPHQQ-UHFFFAOYSA-N 0.000 description 1
- VXUNVJXFAVQYBM-UHFFFAOYSA-N 2-chloro-4-methylpyridine-3-carbonyl chloride Chemical compound CC1=CC=NC(Cl)=C1C(Cl)=O VXUNVJXFAVQYBM-UHFFFAOYSA-N 0.000 description 1
- QGYIIOMKEPETRG-UHFFFAOYSA-N 2-chloro-5-nitrobenzoyl bromide Chemical compound [O-][N+](=O)C1=CC=C(Cl)C(C(Br)=O)=C1 QGYIIOMKEPETRG-UHFFFAOYSA-N 0.000 description 1
- SGCLUZVJDJBDPU-UHFFFAOYSA-N 2-chloro-5-nitropyridine-3-carbonyl chloride Chemical compound [O-][N+](=O)C1=CN=C(Cl)C(C(Cl)=O)=C1 SGCLUZVJDJBDPU-UHFFFAOYSA-N 0.000 description 1
- RXTRRIFWCJEMEL-UHFFFAOYSA-N 2-chloropyridine-3-carbonyl chloride Chemical compound ClC(=O)C1=CC=CN=C1Cl RXTRRIFWCJEMEL-UHFFFAOYSA-N 0.000 description 1
- GMADIUFCPFVHRX-UHFFFAOYSA-N 2-ethylsulfanyl-6-oxo-1h-pyrimidine-5-carboxylic acid Chemical compound CCSC1=NC=C(C(O)=O)C(=O)N1 GMADIUFCPFVHRX-UHFFFAOYSA-N 0.000 description 1
- SXJNRYPVXFTJOU-UHFFFAOYSA-N 2-fluoro-5-nitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=CC=C(F)C(C(Cl)=O)=C1 SXJNRYPVXFTJOU-UHFFFAOYSA-N 0.000 description 1
- DGXYTOUPKDEWNE-UHFFFAOYSA-N 2-methyl-1-(morpholin-4-ylamino)-6-nitro-4-oxoquinoline-3-carboxylic acid Chemical compound CC1=C(C(O)=O)C(=O)C2=CC([N+]([O-])=O)=CC=C2N1NN1CCOCC1 DGXYTOUPKDEWNE-UHFFFAOYSA-N 0.000 description 1
- CSWIDOHHXDZBHF-UHFFFAOYSA-N 2-methyl-1-morpholin-4-yl-6-nitro-4-oxo-n-phenylquinoline-3-carboxamide Chemical compound O=C1C2=CC([N+]([O-])=O)=CC=C2N(N2CCOCC2)C(C)=C1C(=O)NC1=CC=CC=C1 CSWIDOHHXDZBHF-UHFFFAOYSA-N 0.000 description 1
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 description 1
- MBRNPLQGJAAIBO-UHFFFAOYSA-N 3-chloropyrazine-2-carbonyl chloride Chemical compound ClC(=O)C1=NC=CN=C1Cl MBRNPLQGJAAIBO-UHFFFAOYSA-N 0.000 description 1
- IBWYHNOFSKJKKY-UHFFFAOYSA-N 3-chloropyridazine Chemical compound ClC1=CC=CN=N1 IBWYHNOFSKJKKY-UHFFFAOYSA-N 0.000 description 1
- NMOWGWOAPRKWIR-UHFFFAOYSA-N 3-oxo-4h-quinoxaline-2-carboxylic acid Chemical compound C1=CC=C2NC(=O)C(C(=O)O)=NC2=C1 NMOWGWOAPRKWIR-UHFFFAOYSA-N 0.000 description 1
- NMFCRGDGVPCDHH-UHFFFAOYSA-N 4-chloro-2-methylsulfanylpyrimidine-5-carbonyl chloride Chemical compound CSC1=NC=C(C(Cl)=O)C(Cl)=N1 NMFCRGDGVPCDHH-UHFFFAOYSA-N 0.000 description 1
- WWTPFRBEFVWVKB-UHFFFAOYSA-N 4-chloro-6-methoxypyrimidine-5-carbonyl chloride Chemical compound COC1=NC=NC(Cl)=C1C(Cl)=O WWTPFRBEFVWVKB-UHFFFAOYSA-N 0.000 description 1
- VRDAAGLJOMFOEG-UHFFFAOYSA-N 4-chloro-6-phenylpyrimidine-5-carbonyl chloride Chemical compound ClC(=O)C1=C(Cl)N=CN=C1C1=CC=CC=C1 VRDAAGLJOMFOEG-UHFFFAOYSA-N 0.000 description 1
- IMRGVWZLCZERSQ-UHFFFAOYSA-N 4-chloropyridine-3-carboxylic acid Chemical compound OC(=O)C1=CN=CC=C1Cl IMRGVWZLCZERSQ-UHFFFAOYSA-N 0.000 description 1
- YCAZALSUJDPQPP-UHFFFAOYSA-N 4-oxo-3h-quinoline-3-carboxylic acid Chemical class C1=CC=C2C(=O)C(C(=O)O)C=NC2=C1 YCAZALSUJDPQPP-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- 208000035143 Bacterial infection Diseases 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- 125000006414 CCl Chemical group ClC* 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 241000588722 Escherichia Species 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000588748 Klebsiella Species 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- 241000589516 Pseudomonas Species 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- CKUAXEQHGKSLHN-UHFFFAOYSA-N [C].[N] Chemical compound [C].[N] CKUAXEQHGKSLHN-UHFFFAOYSA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- 239000003655 absorption accelerator Substances 0.000 description 1
- 150000004729 acetoacetic acid derivatives Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000003931 anilides Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000006615 aromatic heterocyclic group Chemical group 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical compound C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 description 1
- 208000022362 bacterial infectious disease Diseases 0.000 description 1
- 230000003385 bacteriostatic effect Effects 0.000 description 1
- 235000015278 beef Nutrition 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 150000001734 carboxylic acid salts Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 229920001577 copolymer Chemical group 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- LDHQCZJRKDOVOX-NSCUHMNNSA-N crotonic acid Chemical compound C\C=C\C(O)=O LDHQCZJRKDOVOX-NSCUHMNNSA-N 0.000 description 1
- 125000001047 cyclobutenyl group Chemical group C1(=CCC1)* 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001162 cycloheptenyl group Chemical group C1(=CCCCCC1)* 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000298 cyclopropenyl group Chemical group [H]C1=C([H])C1([H])* 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- LTMHNWPUDSTBKD-UHFFFAOYSA-N diethyl 2-(ethoxymethylidene)propanedioate Chemical compound CCOC=C(C(=O)OCC)C(=O)OCC LTMHNWPUDSTBKD-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000003651 drinking water Substances 0.000 description 1
- 235000020188 drinking water Nutrition 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- DMRHWSLUTHXPPA-SREVYHEPSA-N ethyl (z)-3-(2,2-dimethylhydrazinyl)but-2-enoate Chemical compound CCOC(=O)\C=C(\C)NN(C)C DMRHWSLUTHXPPA-SREVYHEPSA-N 0.000 description 1
- WASODUMMSSUHNJ-UHFFFAOYSA-N ethyl 1,2,7-trimethyl-4-oxo-1,8-naphthyridine-3-carboxylate Chemical compound CC1=CC=C2C(=O)C(C(=O)OCC)=C(C)N(C)C2=N1 WASODUMMSSUHNJ-UHFFFAOYSA-N 0.000 description 1
- OUIIOINZTCLLEE-UHFFFAOYSA-N ethyl 1-ethyl-4-oxoquinoline-3-carboxylate Chemical compound C1=CC=C2C(=O)C(C(=O)OCC)=CN(CC)C2=C1 OUIIOINZTCLLEE-UHFFFAOYSA-N 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 239000003630 growth substance Substances 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 125000006038 hexenyl group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000003906 humectant Substances 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- JFNCRVCXCGCXGI-UHFFFAOYSA-N methyl 3-(cyclopentylamino)prop-2-enoate Chemical compound COC(=O)C=CNC1CCCC1 JFNCRVCXCGCXGI-UHFFFAOYSA-N 0.000 description 1
- IMAKHNTVDGLIRY-UHFFFAOYSA-N methyl prop-2-ynoate Chemical compound COC(=O)C#C IMAKHNTVDGLIRY-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- MHWLWQUZZRMNGJ-UHFFFAOYSA-N nalidixic acid Chemical compound C1=C(C)N=C2N(CC)C=C(C(O)=O)C(=O)C2=C1 MHWLWQUZZRMNGJ-UHFFFAOYSA-N 0.000 description 1
- 229960000210 nalidixic acid Drugs 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000004923 naphthylmethyl group Chemical group C1(=CC=CC2=CC=CC=C12)C* 0.000 description 1
- 125000002560 nitrile group Chemical group 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- ANRQGKOBLBYXFM-UHFFFAOYSA-M phenylmagnesium bromide Chemical compound Br[Mg]C1=CC=CC=C1 ANRQGKOBLBYXFM-UHFFFAOYSA-M 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical group OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- JABYJIQOLGWMQW-UHFFFAOYSA-N undec-4-ene Chemical compound CCCCCCC=CCCC JABYJIQOLGWMQW-UHFFFAOYSA-N 0.000 description 1
- 229940088594 vitamin Drugs 0.000 description 1
- 239000011782 vitamin Substances 0.000 description 1
- 229930003231 vitamin Natural products 0.000 description 1
- 235000013343 vitamin Nutrition 0.000 description 1
- 239000003799 water insoluble solvent Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D215/54—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3
- C07D215/56—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3 with oxygen atoms in position 4
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/10—Antimycotics
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C243/00—Compounds containing chains of nitrogen atoms singly-bound to each other, e.g. hydrazines, triazanes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/58—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems with hetero atoms directly attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/22—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with hetero atoms directly attached to ring nitrogen atoms
- C07D295/28—Nitrogen atoms
- C07D295/30—Nitrogen atoms non-acylated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Communicable Diseases (AREA)
- Oncology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Fodder In General (AREA)
- Quinoline Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyridine Compounds (AREA)
Priority Applications (10)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782808070 DE2808070A1 (de) | 1978-02-24 | 1978-02-24 | Verfahren zur herstellung von 4-pyridon-3-carbonsaeuren und/oder deren derivaten |
| US06/008,634 US4284629A (en) | 1978-02-24 | 1979-02-01 | Process for the preparation of 4-pyridone-3-carboxylic acids and/or derivatives thereof |
| EP79100423A EP0004279B1 (de) | 1978-02-24 | 1979-02-13 | Verfahren zur Herstellung von 4-Pyridon-3-carbonsäuren, 1-Cyclopropyl-4-Pyridon-3-Carbonsäurederivate und diese enthaltende Arzneimittel |
| DE7979100423T DE2964397D1 (en) | 1978-02-24 | 1979-02-13 | Process for the preparation of 4-pyridone-3-carboxylic acids, 1-cyclopropyl-4-pyridone-3-carboxylic acid derivatives and medicines containing them |
| AT0136979A AT376979B (de) | 1978-02-24 | 1979-02-22 | Verfahren zur herstellung von 4-pyridon-3carbons[uren und/oder deren derivaten |
| JP1915979A JPS54132582A (en) | 1978-02-24 | 1979-02-22 | Manufacture of 44pyridonee33carboxylic acid and*or its derivative |
| ES478047A ES478047A1 (es) | 1978-02-24 | 1979-02-23 | Procedimiento para la obtencion de acidos 4-piridon-3-car- boxilicos. |
| US06/733,996 USRE32975E (en) | 1978-02-24 | 1985-05-14 | 4-Pyridone-3-carboxylic acids and/or derivatives thereof |
| JP64000181A JPH01246265A (ja) | 1978-02-24 | 1989-01-05 | 4‐ピリドン‐3‐カルボン酸誘導体 |
| JP64000180A JPH02117664A (ja) | 1978-02-24 | 1989-01-05 | 4‐ピリドン‐3‐カルボン酸およびその誘導体 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782808070 DE2808070A1 (de) | 1978-02-24 | 1978-02-24 | Verfahren zur herstellung von 4-pyridon-3-carbonsaeuren und/oder deren derivaten |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2808070A1 true DE2808070A1 (de) | 1979-08-30 |
Family
ID=6032886
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19782808070 Withdrawn DE2808070A1 (de) | 1978-02-24 | 1978-02-24 | Verfahren zur herstellung von 4-pyridon-3-carbonsaeuren und/oder deren derivaten |
| DE7979100423T Expired DE2964397D1 (en) | 1978-02-24 | 1979-02-13 | Process for the preparation of 4-pyridone-3-carboxylic acids, 1-cyclopropyl-4-pyridone-3-carboxylic acid derivatives and medicines containing them |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE7979100423T Expired DE2964397D1 (en) | 1978-02-24 | 1979-02-13 | Process for the preparation of 4-pyridone-3-carboxylic acids, 1-cyclopropyl-4-pyridone-3-carboxylic acid derivatives and medicines containing them |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4284629A (enExample) |
| EP (1) | EP0004279B1 (enExample) |
| JP (3) | JPS54132582A (enExample) |
| AT (1) | AT376979B (enExample) |
| DE (2) | DE2808070A1 (enExample) |
| ES (1) | ES478047A1 (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2001085673A1 (de) * | 2000-05-08 | 2001-11-15 | Bayer Cropscience Ag | Phenyl-substituierte 2-enamino-ketonitrile |
Families Citing this family (68)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USRE32975E (en) * | 1978-02-24 | 1989-07-04 | Bayer Aktiengesellschaft | 4-Pyridone-3-carboxylic acids and/or derivatives thereof |
| DE3142854A1 (de) * | 1981-10-29 | 1983-05-11 | Bayer Ag, 5090 Leverkusen | 1-cyclopropyl-6-fluor-1,4-dihydro-4-oxo-7-piperazino-chinolin-3-carbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| US4670444B1 (en) * | 1980-09-03 | 1999-02-09 | Bayer Ag | and-naphthyridine-3-carboxylic acids and antibacte7-amino-1-cyclopropyl-4-oxo-1,4-dihydro-quinoline-rial agents containing these compounds |
| DE3033157A1 (de) * | 1980-09-03 | 1982-04-01 | Bayer Ag, 5090 Leverkusen | 7-amino-1-cyclopropyl-4-oxo-1,4-dihydro-naphthyridin-3-carbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| US4499091A (en) * | 1982-03-31 | 1985-02-12 | Sterling Drug Inc. | 1-Amino (or substituted amino)-1,4-dihydro-4-oxo-6-fluoro-7-heterylquinoline-3-carboxylic acids and their use as antibacterial agents |
| EP0090424B1 (en) * | 1982-03-31 | 1986-05-28 | Sterling Drug Inc. | New quinolone compounds and preparation thereof |
| ZA832057B (en) * | 1982-03-31 | 1984-06-27 | Sterling Drug Inc | New quinolone compounds and preparation thereof |
| US4439436A (en) * | 1982-08-04 | 1984-03-27 | Sterling Drug Inc. | 1,3-Dioxolo(4,5-G)quinoline compounds |
| US4665079A (en) * | 1984-02-17 | 1987-05-12 | Warner-Lambert Company | Antibacterial agents |
| DE3248506A1 (de) * | 1982-12-29 | 1984-07-05 | Bayer Ag, 5090 Leverkusen | 1-cyclopropyl-6-fluor-1,4-dihydro-4-oxo-7(alkyl-1-piperazinyl)-3-chinolincarbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| DE3248505A1 (de) * | 1982-12-29 | 1984-07-05 | Bayer Ag, 5090 Leverkusen | 1-cyclopropyl-6-fluor-1,4-dihydro-4-oxo-7(4- (oxoalkyl)-1-piperazinyl/-3-chinolincarbonsaeuren und ihre derivate, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| DE3306771A1 (de) * | 1983-02-25 | 1984-08-30 | Bayer Ag, 5090 Leverkusen | Chinoloncarbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| DE3306772A1 (de) * | 1983-02-25 | 1984-08-30 | Bayer Ag, 5090 Leverkusen | Chinolonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| DE3318145A1 (de) * | 1983-05-18 | 1984-11-22 | Bayer Ag, 5090 Leverkusen | 7-amino-1-cyclopropyl-6,8-difluor-1,4-dihydro-4-oxo-3-chinolincarbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| US4994599A (en) * | 1987-11-20 | 1991-02-19 | Abbott Laboratories | Intermediates for producing quinolone-3-carboxylic acids |
| US4730000A (en) * | 1984-04-09 | 1988-03-08 | Abbott Laboratories | Quinoline antibacterial compounds |
| US5262559A (en) * | 1983-07-18 | 1993-11-16 | Abbott Laboratories | Method of producing quinoline-3-carboxylic acids |
| DE3326190A1 (de) * | 1983-07-20 | 1985-01-31 | Bayer Ag, 5090 Leverkusen | 5-cyclopropyl-5,8-dihydro-8-oxo-1,3-dioxolo-(4,5-g) chinolin-7-carbonsaeure, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| JPS6028978A (ja) * | 1983-07-27 | 1985-02-14 | Dainippon Pharmaceut Co Ltd | 1,8−ナフチリジン誘導体 |
| JPS6032790A (ja) * | 1983-08-01 | 1985-02-19 | Dainippon Pharmaceut Co Ltd | 1,8−ナフチリジン類 |
| US4517191A (en) * | 1983-09-29 | 1985-05-14 | Sterling Drug Inc. | 1-Amino-1,8-naphthyridine compounds useful as bactericides |
| JPS60126284A (ja) * | 1983-12-09 | 1985-07-05 | Dainippon Pharmaceut Co Ltd | ピリドンカルボン酸誘導体およびその塩 |
| EP0154780B1 (en) * | 1984-01-26 | 1990-04-11 | Abbott Laboratories | Quinoline antibacterial compounds |
| NZ210847A (en) * | 1984-01-26 | 1988-02-29 | Abbott Lab | Naphthyridine and pyridopyrimidine derivatives and pharmaceutical compositions |
| US4774246A (en) * | 1984-01-26 | 1988-09-27 | Abbott Laboratories | Quinoline antibacterial compounds |
| DE3409922A1 (de) * | 1984-03-17 | 1985-09-26 | Bayer Ag, 5090 Leverkusen | 1,7-diamino-1,4-dihydro-4-oxo-3-(aza)chinolincarbonsaeuren, verfahren zu ihrer herstellung sowie ihre verwendung bei der bekaempfung bakterieller erkrankungen |
| DE3426486A1 (de) * | 1984-07-18 | 1986-01-30 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von chinolon- und naphthyridoncarbonsaeuren |
| DE3502935A1 (de) * | 1984-09-29 | 1986-04-10 | Bayer Ag, 5090 Leverkusen | 3-amino-2-benzoyl-acrylsaeurederivate und ein verfahren zu ihrer herstellung |
| JPS61118370A (ja) * | 1985-10-30 | 1986-06-05 | Kyorin Pharmaceut Co Ltd | キノロンカルボン酸とその製造方法 |
| DE3508816A1 (de) * | 1985-01-10 | 1986-07-10 | Bayer Ag, 5090 Leverkusen | 6,7-disubstituierte 1-cyclopropyl-1,4-dihydro-4-oxo-1,8-naphtyridin-3-carbonsaeuren |
| US4663457A (en) * | 1985-01-23 | 1987-05-05 | Warner-Lambert Company | 1-cyclopropyl-6,7-dihalo-1,4-dihydro-4-oxo-1,8-naphthyridine-3-carboxylic acid and their esters, useful as intermediates for preparing the 7-amine substituted naphthyridines |
| US4851535A (en) * | 1985-01-23 | 1989-07-25 | Toyama Chemical Co., Ltd. | Nicotinic acid derivatives |
| AT392789B (de) * | 1985-01-23 | 1991-06-10 | Toyama Chemical Co Ltd | Verfahren zur herstellung von 1-substituierten aryl-1,4-dihydro-4-oxonaphthyridinderivaten |
| AT392791B (de) * | 1985-01-23 | 1991-06-10 | Toyama Chemical Co Ltd | Verfahren zur herstellung von 1-substituierten aryl-1,4-dihydro-4-oxonaphthyridinderivaten |
| DE3522406A1 (de) * | 1985-06-22 | 1987-01-02 | Bayer Ag | Verfahren zur herstellung von 1,8-verbrueckten 4-chinolon-3-carbonsaeuren |
| US4977154A (en) * | 1985-12-12 | 1990-12-11 | Warner-Lambert Company | 5-amino and 5-hydroxy-6-fluoroquinolones as antibacterial agents |
| US4687770A (en) * | 1985-12-23 | 1987-08-18 | Abbott Laboratories | Isoxazolo-pyrido-benzoxazine and isothiazolo-pyrido-benzoxazine derivatives |
| US4689325A (en) * | 1985-12-23 | 1987-08-25 | Abbott Laboratories | Isoxazolo-pyrido-phenoxazine and isothiazolo-pyrido-phenoxazine derivatives |
| US4692454A (en) * | 1986-02-03 | 1987-09-08 | Warner-Lambert Company | Opthalmic use of quinolone antibiotics |
| FI88506C (fi) * | 1986-07-04 | 1993-05-25 | Chemie Linz Gmbh | Foerfarande foer framstaellning av farmaceutiskt anvaendbar 7-diazabicykloalkyl-6-fluor-1-(2,4-difluorfenyl)-1,4-dihydro-4-oxo-kinolin-3-karboxylsyra eller karboxylsyraester |
| ZA877471B (en) * | 1986-10-08 | 1988-04-05 | Bristol-Myers Company | 1-tertiary-alkyl-substituted naphthyridine-and quinoline-carboxylic acid antibacterial agents |
| NZ222047A (en) * | 1986-10-08 | 1991-01-29 | Bristol Myers Co | Quinoline - or naphthyridine - carboxylic acid anti-bacterial agents |
| US4965273A (en) * | 1986-10-08 | 1990-10-23 | Bristol-Myers Company | Certain 1-tertiary-butyl-naphthyridone carboxylic acid derivatives anti-bacterial agents |
| DE3724466A1 (de) * | 1987-07-24 | 1989-02-02 | Bayer Ag | Verfahren zur herstellung von chinoloncarbonsaeuren |
| US5262417A (en) * | 1988-12-06 | 1993-11-16 | The Upjohn Company | Antibacterial quinolone compounds |
| KR930703292A (ko) * | 1991-12-27 | 1993-11-29 | 쿠사이 요시히로 | 신규 퀴놀론 유도체 또는 그의 염 및 이 화합물을 함유하는 항균제 |
| CA2268190A1 (en) * | 1997-08-06 | 1999-02-18 | Suntory Limited | 1-aryl-1,8-naphthylidin-4-one derivative as type iv phosphodiesterase inhibitor |
| CN1156476C (zh) * | 1998-01-29 | 2004-07-07 | 第一三得利制药株式会社 | 作为ⅳ型磷酸二酯酶抑制剂的1-环烷基-1,8-二氮杂萘-4-酮衍生物 |
| US6541470B1 (en) * | 1999-08-30 | 2003-04-01 | Maruishi Pharmaceutical Co., Ltd. | 1,2-disubstituted 1,4-dihydro-4-oxoquinoline compounds |
| US6262072B1 (en) | 1999-10-12 | 2001-07-17 | Yung Shin Pharmaceutical Industrial Co. Ltd. | Orally administered antimicrobial pharmaceutical formulations of ciprofloxacin |
| KR20040041177A (ko) * | 2001-09-26 | 2004-05-14 | 바이엘 파마슈티칼스 코포레이션 | 당뇨병 치료제로서의 1,6-나프티리딘 유도체 |
| IS7839A (is) * | 2002-11-22 | 2004-05-23 | Merck Frosst Canada Ltd. | 4-oxó-1-(3-setið fenýl-1,4-díhýdró-1,8-naftýridín-3-karboxamíð fosfódíesterasa-4 hindrar |
| MX341797B (es) * | 2004-06-24 | 2016-09-02 | Vertex Pharmaceuticals Incorporated * | Moduladores de transportadores con casete de union con atp. |
| AU2005286965B2 (en) * | 2004-09-17 | 2009-10-22 | Senhwa Biosciences, Inc. | Quinolone analogs as cell proliferation inhibitors |
| GB0424959D0 (en) * | 2004-11-11 | 2004-12-15 | Glaxo Group Ltd | Novel compounds |
| EP1951735A1 (en) * | 2005-11-09 | 2008-08-06 | Glaxo Group Limited | New 4*-substituted erythromycin derivative |
| LT1993360T (lt) | 2005-12-28 | 2017-06-12 | Vertex Pharmaceuticals Incorporated | N-[2,4-bis(1,1-dimetiletil)-5-hidroksifenil]-1,4-dihidro-4-oksochinolin-3-karboksamido kieta forma |
| CN101020658B (zh) * | 2007-02-14 | 2010-12-15 | 杭州师范学院 | 喹诺酮主环化合物的合成方法 |
| US20110065687A1 (en) * | 2007-04-17 | 2011-03-17 | Michael Schwaebe | Hydrazide compounds and uses thereof |
| WO2009097144A1 (en) * | 2008-01-30 | 2009-08-06 | The Trustees Of Columbia University In The City Of New York | Molecular probes for pet-imaging of dopamine neurotransmission and neuroendocrine processes in vivo |
| US20100074949A1 (en) | 2008-08-13 | 2010-03-25 | William Rowe | Pharmaceutical composition and administration thereof |
| US12458635B2 (en) | 2008-08-13 | 2025-11-04 | Vertex Pharmaceuticals Incorporated | Pharmaceutical composition and administrations thereof |
| MX384179B (es) | 2009-03-20 | 2025-03-14 | Vertex Pharma | Proceso para producir moduladores del regulador de conductancia transmembrana de fibrosis quística. |
| EP2605652B1 (en) | 2010-08-18 | 2017-11-08 | Samumed, LLC | Diketones and hydroxyketones as catenin signaling pathway activators |
| JP2015511583A (ja) | 2012-02-27 | 2015-04-20 | バーテックス ファーマシューティカルズ インコーポレイテッドVertex Pharmaceuticals Incorporated | 薬学的組成物およびその投与 |
| ES2709824T3 (es) | 2013-02-22 | 2019-04-17 | Samumed Llc | Gamma-dicetonas como activadores de la ruta de señalización Wnt/beta-catenina |
| DK3206686T3 (da) | 2014-08-20 | 2019-12-16 | Samumed Llc | Gamma-diketoner til behandling og forebyggelse af ældning af huden og rynker |
| EP3204358B1 (en) | 2014-10-07 | 2018-09-19 | Vertex Pharmaceuticals Incorporated | Co-crystals of modulators of cystic fibrosis transmembrane conductance regulator |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3673184A (en) * | 1970-09-02 | 1972-06-27 | Dainippon Pharmaceutical Co | Certain 2-substituted-5,8-dihydro-5-oxopyrido{8 2,3-d{9 pyrimidine-6-carboxylic acid derivatives |
| FR2194420B1 (enExample) * | 1972-08-02 | 1975-10-17 | Bellon Labor Sa Roger | |
| DE2246503A1 (de) * | 1972-09-22 | 1974-04-04 | Boehringer Mannheim Gmbh | 7,8-dimethylchinolon-3-carbonsaeurederivate |
| US3853864A (en) * | 1972-12-07 | 1974-12-10 | American Home Prod | 1,7-dialkyl-1,2-dihydro-4-hydroxy-1,8-naphthyridine-3-carboxylic acid alkyl esters |
| CA1034124A (en) * | 1973-05-11 | 1978-07-04 | Ciba-Geigy Ag | Process for the manufacture of new quinolines |
| JPS587626B2 (ja) * | 1974-02-13 | 1983-02-10 | 大日本製薬株式会社 | ナフチリジン オヨビ キノリンユウドウタイノセイホウ |
| JPS5132595A (en) * | 1974-09-11 | 1976-03-19 | Kanebo Ltd | Pirido * 2 33d * pirimijinjudotai no seiho |
| JPS5233694A (en) * | 1975-09-09 | 1977-03-14 | Dai Ichi Seiyaku Co Ltd | Process for preparation of 6_nitro-1,8-naphthyridine derivatives |
| FR2348213A1 (fr) * | 1976-04-16 | 1977-11-10 | Bellon Labor Sa Roger | Procede pour la preparation de l'ethoxycarbonyl-6 ethyl-8 methoxy-2 oxo-5 dihydro-5,8 pyrido(2,3-d) pyrimidine |
| JPS52139094A (en) * | 1976-05-18 | 1977-11-19 | Sumitomo Chem Co Ltd | 1-fluoralkyl-1,4-dihydro-4-oxo-3-pyridinecarboxylic acid derivatives |
-
1978
- 1978-02-24 DE DE19782808070 patent/DE2808070A1/de not_active Withdrawn
-
1979
- 1979-02-01 US US06/008,634 patent/US4284629A/en not_active Ceased
- 1979-02-13 DE DE7979100423T patent/DE2964397D1/de not_active Expired
- 1979-02-13 EP EP79100423A patent/EP0004279B1/de not_active Expired
- 1979-02-22 AT AT0136979A patent/AT376979B/de not_active IP Right Cessation
- 1979-02-22 JP JP1915979A patent/JPS54132582A/ja active Granted
- 1979-02-23 ES ES478047A patent/ES478047A1/es not_active Expired
-
1989
- 1989-01-05 JP JP64000181A patent/JPH01246265A/ja active Granted
- 1989-01-05 JP JP64000180A patent/JPH02117664A/ja active Granted
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2001085673A1 (de) * | 2000-05-08 | 2001-11-15 | Bayer Cropscience Ag | Phenyl-substituierte 2-enamino-ketonitrile |
| US7049271B2 (en) | 2000-05-08 | 2006-05-23 | Bayer Aktiengesellschaft | Phenyl-substituted 2-enamino-ketonitriles |
Also Published As
| Publication number | Publication date |
|---|---|
| ES478047A1 (es) | 1979-07-16 |
| JPS54132582A (en) | 1979-10-15 |
| DE2964397D1 (en) | 1983-02-03 |
| JPH01246265A (ja) | 1989-10-02 |
| JPH0260666B2 (enExample) | 1990-12-17 |
| JPH0433789B2 (enExample) | 1992-06-04 |
| JPH02117664A (ja) | 1990-05-02 |
| US4284629A (en) | 1981-08-18 |
| EP0004279B1 (de) | 1982-12-29 |
| JPH0433790B2 (enExample) | 1992-06-04 |
| ATA136979A (de) | 1984-06-15 |
| AT376979B (de) | 1985-01-25 |
| EP0004279A1 (de) | 1979-10-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0004279B1 (de) | Verfahren zur Herstellung von 4-Pyridon-3-carbonsäuren, 1-Cyclopropyl-4-Pyridon-3-Carbonsäurederivate und diese enthaltende Arzneimittel | |
| EP0049355B1 (de) | 7-Amino-1-cyclopropyl-4-oxo-1,4-dihydro-(naphthyridin oder chinolin)-3-carbonsäuren, Verfahren zu ihrer Herstellung und sie enthaltende Arzneimittel | |
| CH381706A (de) | Verfahren zur Herstellung von Sulfamylanthranilsäuren | |
| DE3441788A1 (de) | Alkyl-1-cyclopropyl-1,4-dihydro-4-oxo-3-chinolincarbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel | |
| DE3522406A1 (de) | Verfahren zur herstellung von 1,8-verbrueckten 4-chinolon-3-carbonsaeuren | |
| EP0223140A2 (de) | Thienooxazinone, Verfahren zu ihrer Herstellung und ihre Verwendung als Leistungsförderer | |
| DE3600891A1 (de) | 1,8-verbrueckte 4-chinolon-3-carbonsaeuren und diese enthaltende arzneimittel | |
| EP0176846A2 (de) | 3-Amino-2-benzoyl-acrylsäurederivate und ein Verfahren zu ihrer Herstellung | |
| CH639662A5 (de) | Imidazoazine und imidazodiazine. | |
| EP0187376B1 (de) | 6,7-Disubstituierte 1-Cyclopropyl-1,4-dihydro-4-oxo-1,8-naphthyridin-3-carbonsäuren | |
| DE3485928T2 (de) | Imidazopyrrolopyridine und kondensierte derivate davon als zwischenprodukte fuer die herstellung von herbiziden verbindungen. | |
| DE3517535A1 (de) | 1-aryl-4-chinolon-3-carbonsaeuren | |
| EP0380712B1 (de) | Verfahren zur Herstellung von 2,6-Dichlordiphenylaminessigsäurederivaten | |
| EP0014390B1 (de) | 2-Amino-8-cyclopropyl-5-oxo-5,8-dihydro-pyrido (2,3-d) pyrimidin-6-carbonsäuren, sie enthaltende Arzneimittel sowie Verfahren zu ihrer Herstellung | |
| DE2841644C2 (enExample) | ||
| DE2051962A1 (de) | Benzimidazo eckige Klammer auf l,2d eckige Klammer zu eckige Klammer auf 1,4 eckige Klammer zu benzodiazepin 6 (5H) one und Verfahren zu deren Her stellung | |
| DE1935404C3 (de) | Verfahren zur Herstellung von Chinazoline nen | |
| DE3129718C2 (enExample) | ||
| DE3306996A1 (de) | Acrylsaeuremorpholide, ihre herstellung und verwendung | |
| DE69015756T2 (de) | 1,4-Dihydro-4-oxo-3-chinolinderivate als antibakterielle Wirkstoffe für Säugetieren mit selektiver Toxizität. | |
| DE2360329A1 (de) | 1,7-dialkyl-1,2-dihydro-4-hydroxy-1,8naphthyridin-3-carbonsaeurealkylester | |
| DE2359537A1 (de) | Indan-1-carboxamidderivate | |
| DE2025819A1 (de) | alpha-Aminopenicillinverbindungen und Verfahren zu ihrer Herstellung | |
| DE3447730A1 (de) | Pyrazolopyridinderivate | |
| AT269150B (de) | Verfahren zur Herstellung von neuen Pteridinverbindungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |