DE2750902A1 - Schaedlingsbekaempfungsmittel, insbesondere zur bekaempfung von ektoparasiten und mikroorganismen - Google Patents
Schaedlingsbekaempfungsmittel, insbesondere zur bekaempfung von ektoparasiten und mikroorganismenInfo
- Publication number
- DE2750902A1 DE2750902A1 DE19772750902 DE2750902A DE2750902A1 DE 2750902 A1 DE2750902 A1 DE 2750902A1 DE 19772750902 DE19772750902 DE 19772750902 DE 2750902 A DE2750902 A DE 2750902A DE 2750902 A1 DE2750902 A1 DE 2750902A1
- Authority
- DE
- Germany
- Prior art keywords
- formula
- compound
- hcl
- carbon atoms
- parts
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 244000005700 microbiome Species 0.000 title claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 39
- 239000003795 chemical substances by application Substances 0.000 claims description 18
- 125000004432 carbon atom Chemical group C* 0.000 claims description 16
- 241000238876 Acari Species 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 12
- 239000002904 solvent Substances 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 150000003839 salts Chemical class 0.000 claims description 9
- 241000233866 Fungi Species 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical group 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 4
- 230000001984 ectoparasiticidal effect Effects 0.000 claims description 3
- 239000000575 pesticide Substances 0.000 claims description 3
- 230000003032 phytopathogenic effect Effects 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 229910052740 iodine Inorganic materials 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 125000004001 thioalkyl group Chemical group 0.000 claims description 2
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims 3
- 150000002431 hydrogen Chemical class 0.000 claims 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 71
- 239000004480 active ingredient Substances 0.000 description 27
- 239000000243 solution Substances 0.000 description 14
- 239000000203 mixture Substances 0.000 description 13
- 239000000126 substance Substances 0.000 description 13
- 239000000839 emulsion Substances 0.000 description 12
- 239000013543 active substance Substances 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 10
- -1 acetone Chemical compound 0.000 description 10
- 239000008187 granular material Substances 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- 241000196324 Embryophyta Species 0.000 description 9
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 8
- 239000005995 Aluminium silicate Substances 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- 235000012211 aluminium silicate Nutrition 0.000 description 7
- 239000012141 concentrate Substances 0.000 description 7
- 235000008504 concentrate Nutrition 0.000 description 7
- 238000012360 testing method Methods 0.000 description 7
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- 239000004563 wettable powder Substances 0.000 description 6
- 241001465754 Metazoa Species 0.000 description 5
- 239000000969 carrier Substances 0.000 description 5
- 229920000151 polyglycol Polymers 0.000 description 5
- 239000010695 polyglycol Substances 0.000 description 5
- 238000012545 processing Methods 0.000 description 5
- 244000105624 Arachis hypogaea Species 0.000 description 4
- 239000000654 additive Substances 0.000 description 4
- CVXBEEMKQHEXEN-UHFFFAOYSA-N carbaryl Chemical compound C1=CC=C2C(OC(=O)NC)=CC=CC2=C1 CVXBEEMKQHEXEN-UHFFFAOYSA-N 0.000 description 4
- 235000019329 dioctyl sodium sulphosuccinate Nutrition 0.000 description 4
- YHAIUSTWZPMYGG-UHFFFAOYSA-L disodium;2,2-dioctyl-3-sulfobutanedioate Chemical compound [Na+].[Na+].CCCCCCCCC(C([O-])=O)(C(C([O-])=O)S(O)(=O)=O)CCCCCCCC YHAIUSTWZPMYGG-UHFFFAOYSA-L 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 239000000377 silicon dioxide Substances 0.000 description 4
- 239000007921 spray Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- UFQDKRWQSFLPQY-UHFFFAOYSA-N 4,5-dihydro-1h-imidazol-3-ium;chloride Chemical compound Cl.C1CN=CN1 UFQDKRWQSFLPQY-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 244000299507 Gossypium hirsutum Species 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 235000019993 champagne Nutrition 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000002270 dispersing agent Substances 0.000 description 3
- 235000013399 edible fruits Nutrition 0.000 description 3
- 238000005516 engineering process Methods 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 230000017448 oviposition Effects 0.000 description 3
- 239000004540 pour-on Substances 0.000 description 3
- 239000000454 talc Substances 0.000 description 3
- 229910052623 talc Inorganic materials 0.000 description 3
- MKSYSNRVVYYBIZ-UHFFFAOYSA-N 1-butyl-n-(3,4-dichlorophenyl)pyrrolidin-2-imine Chemical compound CCCCN1CCCC1=NC1=CC=C(Cl)C(Cl)=C1 MKSYSNRVVYYBIZ-UHFFFAOYSA-N 0.000 description 2
- WBIQQQGBSDOWNP-UHFFFAOYSA-N 2-dodecylbenzenesulfonic acid Chemical compound CCCCCCCCCCCCC1=CC=CC=C1S(O)(=O)=O WBIQQQGBSDOWNP-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- 101100260565 Dictyostelium discoideum thyA gene Proteins 0.000 description 2
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 240000002024 Gossypium herbaceum Species 0.000 description 2
- 235000004341 Gossypium herbaceum Nutrition 0.000 description 2
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 2
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 206010061217 Infestation Diseases 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 235000019483 Peanut oil Nutrition 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- 241001481703 Rhipicephalus <genus> Species 0.000 description 2
- 241000949016 Rhipicephalus bursa Species 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 230000001070 adhesive effect Effects 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 235000019445 benzyl alcohol Nutrition 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 159000000007 calcium salts Chemical class 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000012876 carrier material Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 229940060296 dodecylbenzenesulfonic acid Drugs 0.000 description 2
- 244000078703 ectoparasite Species 0.000 description 2
- 239000004495 emulsifiable concentrate Substances 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 230000003641 microbiacidal effect Effects 0.000 description 2
- WLUCWSITOBZYRR-UHFFFAOYSA-N n-(4,5-dihydro-1h-imidazol-2-ylmethyl)-2,3-dimethylaniline Chemical compound CC1=CC=CC(NCC=2NCCN=2)=C1C WLUCWSITOBZYRR-UHFFFAOYSA-N 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 235000019198 oils Nutrition 0.000 description 2
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 235000020232 peanut Nutrition 0.000 description 2
- 239000000312 peanut oil Substances 0.000 description 2
- 239000003209 petroleum derivative Substances 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 101150068774 thyX gene Proteins 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- 238000010792 warming Methods 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- QIVUCLWGARAQIO-OLIXTKCUSA-N (3s)-n-[(3s,5s,6r)-6-methyl-2-oxo-1-(2,2,2-trifluoroethyl)-5-(2,3,6-trifluorophenyl)piperidin-3-yl]-2-oxospiro[1h-pyrrolo[2,3-b]pyridine-3,6'-5,7-dihydrocyclopenta[b]pyridine]-3'-carboxamide Chemical compound C1([C@H]2[C@H](N(C(=O)[C@@H](NC(=O)C=3C=C4C[C@]5(CC4=NC=3)C3=CC=CN=C3NC5=O)C2)CC(F)(F)F)C)=C(F)C=CC(F)=C1F QIVUCLWGARAQIO-OLIXTKCUSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- VVAKEQGKZNKUSU-UHFFFAOYSA-N 2,3-dimethylaniline Chemical compound CC1=CC=CC(N)=C1C VVAKEQGKZNKUSU-UHFFFAOYSA-N 0.000 description 1
- GHCCHMFFNHOXEU-UHFFFAOYSA-N 2-(chloromethyl)-4,5-dihydro-1H-imidazole hydrochloride Chemical compound Cl.ClCC1=NCCN1 GHCCHMFFNHOXEU-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- TZVFFXNGZDPRSN-UHFFFAOYSA-N 2-chloro-n-(4,5-dihydro-1h-imidazol-2-ylmethyl)aniline;hydrochloride Chemical compound Cl.ClC1=CC=CC=C1NCC1=NCCN1 TZVFFXNGZDPRSN-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 description 1
- UHPMCKVQTMMPCG-UHFFFAOYSA-N 5,8-dihydroxy-2-methoxy-6-methyl-7-(2-oxopropyl)naphthalene-1,4-dione Chemical compound CC1=C(CC(C)=O)C(O)=C2C(=O)C(OC)=CC(=O)C2=C1O UHPMCKVQTMMPCG-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 241000238679 Amblyomma Species 0.000 description 1
- 235000010777 Arachis hypogaea Nutrition 0.000 description 1
- 241000235349 Ascomycota Species 0.000 description 1
- 241000221198 Basidiomycota Species 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 241001157813 Cercospora Species 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 1
- 240000008067 Cucumis sativus Species 0.000 description 1
- 235000010799 Cucumis sativus var sativus Nutrition 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 241000221787 Erysiphe Species 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 206010017533 Fungal infection Diseases 0.000 description 1
- 241000223218 Fusarium Species 0.000 description 1
- 235000009432 Gossypium hirsutum Nutrition 0.000 description 1
- 241000238889 Ixodidae Species 0.000 description 1
- 240000008790 Musa x paradisiaca Species 0.000 description 1
- 208000031888 Mycoses Diseases 0.000 description 1
- KZONXCJSBHOKKB-UHFFFAOYSA-N N-(4-chlorophenyl)-3-methyl-1,3-thiazol-2-imine Chemical compound ClC1=CC=C(C=C1)N=C1SC=CN1C KZONXCJSBHOKKB-UHFFFAOYSA-N 0.000 description 1
- 241000237955 Nassarius Species 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 241000315044 Passalora arachidicola Species 0.000 description 1
- 241001674048 Phthiraptera Species 0.000 description 1
- 241000233626 Plasmopara Species 0.000 description 1
- 241000221300 Puccinia Species 0.000 description 1
- 241000238680 Rhipicephalus microplus Species 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 235000021536 Sugar beet Nutrition 0.000 description 1
- 101150052863 THY1 gene Proteins 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- CRPUJAZIXJMDBK-UHFFFAOYSA-N Toxaphene Natural products C1CC2C(=C)C(C)(C)C1C2 CRPUJAZIXJMDBK-UHFFFAOYSA-N 0.000 description 1
- 241000317942 Venturia <ichneumonid wasp> Species 0.000 description 1
- 241001123669 Verticillium albo-atrum Species 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 239000002390 adhesive tape Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 235000021015 bananas Nutrition 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 210000000748 cardiovascular system Anatomy 0.000 description 1
- 229940000032 cardiovascular system drug Drugs 0.000 description 1
- 239000004359 castor oil Substances 0.000 description 1
- 235000019438 castor oil Nutrition 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 229930016911 cinnamic acid Natural products 0.000 description 1
- 235000013985 cinnamic acid Nutrition 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 210000003298 dental enamel Anatomy 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 239000013057 ectoparasiticide Substances 0.000 description 1
- 235000013601 eggs Nutrition 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229940071870 hydroiodic acid Drugs 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 230000002147 killing effect Effects 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 235000014666 liquid concentrate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 1
- 229940124561 microbicide Drugs 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- GGARFKXRBDJCPO-UHFFFAOYSA-N n-(3,4-dichlorophenyl)-3-methyl-1,3-thiazol-2-imine Chemical compound CN1C=CSC1=NC1=CC=C(Cl)C(Cl)=C1 GGARFKXRBDJCPO-UHFFFAOYSA-N 0.000 description 1
- JLRGGNFHZLXKOR-UHFFFAOYSA-N n-(4,5-dihydro-1h-imidazol-2-ylmethyl)-2,3-dimethylaniline;hydrochloride Chemical compound Cl.CC1=CC=CC(NCC=2NCCN=2)=C1C JLRGGNFHZLXKOR-UHFFFAOYSA-N 0.000 description 1
- AYOOGWWGECJQPI-NSHDSACASA-N n-[(1s)-1-(5-fluoropyrimidin-2-yl)ethyl]-3-(3-propan-2-yloxy-1h-pyrazol-5-yl)imidazo[4,5-b]pyridin-5-amine Chemical compound N1C(OC(C)C)=CC(N2C3=NC(N[C@@H](C)C=4N=CC(F)=CN=4)=CC=C3N=C2)=N1 AYOOGWWGECJQPI-NSHDSACASA-N 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 230000003071 parasitic effect Effects 0.000 description 1
- 244000052769 pathogen Species 0.000 description 1
- 230000001717 pathogenic effect Effects 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- 230000008635 plant growth Effects 0.000 description 1
- 235000012015 potatoes Nutrition 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- DAJSVUQLFFJUSX-UHFFFAOYSA-M sodium;dodecane-1-sulfonate Chemical compound [Na+].CCCCCCCCCCCCS([O-])(=O)=O DAJSVUQLFFJUSX-UHFFFAOYSA-M 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- OEJNXTAZZBRGDN-UHFFFAOYSA-N toxaphene Chemical compound ClC1C(Cl)C2(Cl)C(CCl)(CCl)C(=C)C1(Cl)C2(Cl)Cl OEJNXTAZZBRGDN-UHFFFAOYSA-N 0.000 description 1
- 229940005605 valeric acid Drugs 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/04—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D233/20—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D233/24—Radicals substituted by nitrogen atoms not forming part of a nitro radical
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1440176 | 1976-11-16 | ||
| CH1440276 | 1976-11-16 | ||
| CH1239077A CH630507A5 (en) | 1977-10-11 | 1977-10-11 | Pesticides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2750902A1 true DE2750902A1 (de) | 1978-05-24 |
Family
ID=27176829
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19772750902 Withdrawn DE2750902A1 (de) | 1976-11-16 | 1977-11-14 | Schaedlingsbekaempfungsmittel, insbesondere zur bekaempfung von ektoparasiten und mikroorganismen |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4254133A (enExample) |
| JP (1) | JPS5363378A (enExample) |
| AR (1) | AR216660A1 (enExample) |
| BR (1) | BR7707589A (enExample) |
| CA (1) | CA1104143A (enExample) |
| DE (1) | DE2750902A1 (enExample) |
| EG (1) | EG12913A (enExample) |
| ES (1) | ES464150A1 (enExample) |
| FR (2) | FR2380733A1 (enExample) |
| GB (1) | GB1592699A (enExample) |
| IL (1) | IL53374A (enExample) |
| IT (1) | IT1143778B (enExample) |
| MX (1) | MX5135E (enExample) |
| NL (1) | NL7712401A (enExample) |
| NZ (1) | NZ185685A (enExample) |
| OA (1) | OA05802A (enExample) |
| PT (1) | PT67271B (enExample) |
| YU (2) | YU40019B (enExample) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2401142A1 (fr) * | 1976-12-20 | 1979-03-23 | Wellcome Found | Derives de l'imidazoline et leur preparation |
| EP0001647A3 (en) * | 1977-10-26 | 1979-05-30 | The Wellcome Foundation Limited | Imidazoline derivatives and salts thereof, their synthesis, and intermediates, and pesticidal formulations |
| DE2924715A1 (de) * | 1978-06-19 | 1980-01-03 | Wellcome Found | Imidazolinderivate, verfahren zu ihrer herstellung und ihre verwendung als pesticide |
| EP0374757A1 (de) * | 1988-12-20 | 1990-06-27 | Hoechst Aktiengesellschaft | Imidazolinderivate enthaltende Mittel zur wirtstiersystemischen Bekämpfung von Ektoparasiten sowie neue Imidazolinderivate |
| WO2009003868A3 (en) * | 2007-07-02 | 2009-04-09 | Hoffmann La Roche | 2 -imidazolines having a good affinity to the trace amine associated receptors (taars) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| KR20080009144A (ko) * | 2005-05-03 | 2008-01-24 | 바이엘 크롭사이언스 아게 | 살충성을 가지는 치환된 아미노알킬 헤테로사이클릭 및헤테로아릴 유도체 |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1174349A (en) * | 1966-08-25 | 1969-12-17 | Boehringer Sohn Ingelheim | Novel 2-Anilinomethylimidazoline Derivatives and process for the preparation thereof |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA563673A (en) * | 1958-09-23 | Miescher Karl | 2-(n:n-diphenyl-aminoethyl)-imidazolines and process of making same | |
| CH234983A (de) * | 1938-05-11 | 1944-10-31 | Chem Ind Basel | Verfahren zur Darstellung eines neuen therapeutisch wirksamen Amidins. |
| CH234987A (de) * | 1938-05-11 | 1944-10-31 | Chem Ind Basel | Verfahren zur Darstellung eines neuen therapeutisch wirksamen Amidins. |
| CH234986A (de) * | 1938-05-11 | 1944-10-31 | Chem Ind Basel | Verfahren zur Darstellung eines neuen therapeutisch wirksamen Amidins. |
| CH234982A (de) * | 1938-05-11 | 1944-10-31 | Chem Ind Basel | Verfahren zur Darstellung eines neuen therapeutisch wirksamen Amidins. |
| DE701322C (de) * | 1938-05-11 | 1941-01-14 | Chemische Ind Ges | Verfahren zur Darstellung von Imidazolin- und Tetrahydropyrimidinverbindungen |
| US3193454A (en) * | 1959-04-27 | 1965-07-06 | Standard Oil Co | Insecticidal oil-soluble chlorinated substituted imidazolines |
| US3862318A (en) * | 1969-12-09 | 1975-01-21 | Millmaster Onyx Corp | Microbiocidal naphthenyl imidazolines |
| DE2235093C2 (de) * | 1972-07-18 | 1974-07-04 | Bayer Ag, 5090 Leverkusen | Korrosionsschutzmittel |
| JPS51106739A (en) * | 1975-03-12 | 1976-09-21 | Takeda Chemical Industries Ltd | Satsuchu satsudanizai |
-
1977
- 1977-11-10 NL NL7712401A patent/NL7712401A/xx not_active Application Discontinuation
- 1977-11-11 BR BR7707589A patent/BR7707589A/pt unknown
- 1977-11-14 DE DE19772750902 patent/DE2750902A1/de not_active Withdrawn
- 1977-11-14 CA CA290,708A patent/CA1104143A/en not_active Expired
- 1977-11-14 GB GB47367/77A patent/GB1592699A/en not_active Expired
- 1977-11-14 IL IL53374A patent/IL53374A/xx unknown
- 1977-11-14 PT PT67271A patent/PT67271B/pt unknown
- 1977-11-14 AR AR269973A patent/AR216660A1/es active
- 1977-11-15 MX MX776558U patent/MX5135E/es unknown
- 1977-11-15 IT IT29695/77A patent/IT1143778B/it active
- 1977-11-15 YU YU2721/77A patent/YU40019B/xx unknown
- 1977-11-15 OA OA56316A patent/OA05802A/xx unknown
- 1977-11-15 EG EG640/77A patent/EG12913A/xx active
- 1977-11-15 NZ NZ185685A patent/NZ185685A/xx unknown
- 1977-11-15 ES ES464150A patent/ES464150A1/es not_active Expired
- 1977-11-16 JP JP13776277A patent/JPS5363378A/ja active Pending
- 1977-11-16 FR FR7734431A patent/FR2380733A1/fr active Granted
-
1978
- 1978-05-31 FR FR7816218A patent/FR2381030A1/fr active Granted
-
1979
- 1979-05-29 US US06/042,822 patent/US4254133A/en not_active Expired - Lifetime
-
1982
- 1982-08-09 YU YU1731/82A patent/YU39701B/xx unknown
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1174349A (en) * | 1966-08-25 | 1969-12-17 | Boehringer Sohn Ingelheim | Novel 2-Anilinomethylimidazoline Derivatives and process for the preparation thereof |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2401142A1 (fr) * | 1976-12-20 | 1979-03-23 | Wellcome Found | Derives de l'imidazoline et leur preparation |
| EP0001647A3 (en) * | 1977-10-26 | 1979-05-30 | The Wellcome Foundation Limited | Imidazoline derivatives and salts thereof, their synthesis, and intermediates, and pesticidal formulations |
| DE2924715A1 (de) * | 1978-06-19 | 1980-01-03 | Wellcome Found | Imidazolinderivate, verfahren zu ihrer herstellung und ihre verwendung als pesticide |
| EP0374757A1 (de) * | 1988-12-20 | 1990-06-27 | Hoechst Aktiengesellschaft | Imidazolinderivate enthaltende Mittel zur wirtstiersystemischen Bekämpfung von Ektoparasiten sowie neue Imidazolinderivate |
| WO2009003868A3 (en) * | 2007-07-02 | 2009-04-09 | Hoffmann La Roche | 2 -imidazolines having a good affinity to the trace amine associated receptors (taars) |
| US7652055B2 (en) * | 2007-07-02 | 2010-01-26 | Hoffman-La Roche Inc. | 2-imidazolines |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2381030A1 (fr) | 1978-09-15 |
| IL53374A (en) | 1983-06-15 |
| EG12913A (en) | 1980-12-31 |
| AR216660A1 (es) | 1980-01-15 |
| JPS5363378A (en) | 1978-06-06 |
| YU173182A (en) | 1983-01-21 |
| IT1143778B (it) | 1986-10-22 |
| FR2380733B1 (enExample) | 1982-07-30 |
| NZ185685A (en) | 1980-09-12 |
| PT67271A (en) | 1977-12-01 |
| FR2380733A1 (fr) | 1978-09-15 |
| GB1592699A (en) | 1981-07-08 |
| NL7712401A (nl) | 1978-05-18 |
| YU40019B (en) | 1985-06-30 |
| ES464150A1 (es) | 1979-01-01 |
| FR2381030B1 (enExample) | 1982-10-01 |
| OA05802A (fr) | 1981-05-31 |
| US4254133A (en) | 1981-03-03 |
| CA1104143A (en) | 1981-06-30 |
| BR7707589A (pt) | 1978-06-20 |
| YU272177A (en) | 1983-01-21 |
| IL53374A0 (en) | 1978-01-31 |
| PT67271B (en) | 1979-04-18 |
| YU39701B (en) | 1985-03-20 |
| MX5135E (es) | 1983-03-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2609280A1 (de) | Schaedlingsbekaempfungsmittel | |
| DE3123018C2 (de) | Substituierte Cyclohexan-1,3-dion-Derivate, Verfahren zu deren Herstellung und herbicide Mittel | |
| DE1955750A1 (de) | Ureidophenylguanidine,Verfahren zu ihrer Herstellung und ihre fungizide Verwendung | |
| DE1667979C3 (de) | 13-Benzodioxolcarbamate sowie Verfahren zu deren Herstellung und Schädlingsbekämpfungsmittel mit einem Gehalt dieser Verbindungen | |
| EP0037971B1 (de) | Trisubstituierte Cyanguanidine, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide | |
| DE2431073A1 (de) | Fungizides mittel | |
| DE2750902A1 (de) | Schaedlingsbekaempfungsmittel, insbesondere zur bekaempfung von ektoparasiten und mikroorganismen | |
| DE1960029A1 (de) | Ureidophenylthioharnstoffe,Verfahren zu ihrer Herstellung und ihre fungizide Verwendung | |
| EP0094539B1 (de) | Halogenpropargylformamide | |
| DE1955749A1 (de) | Amidophenylguanidine,Verfahren zu ihrer Herstellung und ihre fungizide Verwendung | |
| DE2824126A1 (de) | Tetrahydro-1,3,5-thiadiazin-4-on- verbindungen | |
| DE2061133B2 (de) | N-2,4-Dimethylphenyl-N'-methylformamidin, dessen Salze, Verfahren zu ihrer Herstellung und Mittel, enthaltend diese Verbindungen | |
| DE2123023C2 (de) | Fungizide 1,3,4-Thiadiazol-Derivate | |
| CH630507A5 (en) | Pesticides | |
| DE2129524C3 (de) | Fungizide Mittel auf Basis von Phenylhydrazono-imid azolenin-Derivaten | |
| DE2518542A1 (de) | Biocides mittel | |
| DE2144125A1 (de) | Dithiocarbamidsaure salze von harnstoff-derivaten, verfahren zu ihrer herstellung und ihre fungizide und mikrobizide verwendung | |
| DE2062346C3 (de) | 4,5-Bis-trifluormethylimino-imidazolon-2-Derivate | |
| DE1930540C (de) | Alkoxycarbony lthioureidobenzole und ihre Verwendung als Schädlingsbekämpfungsmittel | |
| DE2114882A1 (de) | Cyclohexyhdeniminophenyl thioharnstoffe, Verfahren zu ihrer Herstellung und ihre fungi zide Verwendung | |
| DE2453210B2 (de) | Bekämpfung von Pilzen der Gattung Helminthosporium mit Dimethylpyrazolylbenzimidazol | |
| DE1668899C (de) | 2-Methyl-5,6-dihydropyran-3-carbonsäureanilid und dieses enthaltende Pflanzenschutzmittel | |
| DE2514992A1 (de) | Fungizide mittel | |
| DE1810581C3 (de) | N-Acyl-p-dialkylamino-phenylhydrazone, Verfahren zu ihrer Herstellung und deren Verwendung zur Bekämpfung von phytopathogene Pilzen | |
| DE2604726A1 (de) | S-triazolo eckige klammer auf 5,1-b eckige klammer zu benzthiazole, verfahren zu ihrer herstellung und ihre verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8128 | New person/name/address of the agent |
Representative=s name: ZUMSTEIN SEN., F., DR. ASSMANN, E., DIPL.-CHEM. DR |
|
| 8139 | Disposal/non-payment of the annual fee |