DE2750570A1 - Photographischer silberhalogenidentwickler - Google Patents
Photographischer silberhalogenidentwicklerInfo
- Publication number
- DE2750570A1 DE2750570A1 DE19772750570 DE2750570A DE2750570A1 DE 2750570 A1 DE2750570 A1 DE 2750570A1 DE 19772750570 DE19772750570 DE 19772750570 DE 2750570 A DE2750570 A DE 2750570A DE 2750570 A1 DE2750570 A1 DE 2750570A1
- Authority
- DE
- Germany
- Prior art keywords
- silver halide
- thiadiazole
- radical
- bis
- developer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 229910052709 silver Inorganic materials 0.000 title claims description 73
- 239000004332 silver Substances 0.000 title claims description 73
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 title description 6
- -1 silver halide Chemical class 0.000 claims description 124
- 150000001875 compounds Chemical class 0.000 claims description 85
- 239000000463 material Substances 0.000 claims description 45
- 239000000839 emulsion Substances 0.000 claims description 30
- 238000000034 method Methods 0.000 claims description 26
- 239000003795 chemical substances by application Substances 0.000 claims description 23
- 230000008569 process Effects 0.000 claims description 17
- 238000011161 development Methods 0.000 claims description 16
- 125000004432 carbon atom Chemical group C* 0.000 claims description 15
- 150000003254 radicals Chemical class 0.000 claims description 11
- 238000009792 diffusion process Methods 0.000 claims description 9
- 238000012546 transfer Methods 0.000 claims description 9
- 239000012190 activator Substances 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 8
- 150000005840 aryl radicals Chemical class 0.000 claims description 8
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 claims description 8
- 229910052717 sulfur Inorganic materials 0.000 claims description 6
- KHSWZJPSBCYNPR-UHFFFAOYSA-N 2-n,5-n-dimethyl-1,3,4-thiadiazole-2,5-diamine Chemical compound CNC1=NN=C(NC)S1 KHSWZJPSBCYNPR-UHFFFAOYSA-N 0.000 claims description 4
- AEUNZJZMCYUBRB-UHFFFAOYSA-N 2-n-(2-ethoxyethyl)-5-n-(2-methoxyethyl)-1,3,4-thiadiazole-2,5-diamine Chemical compound CCOCCNC1=NN=C(NCCOC)S1 AEUNZJZMCYUBRB-UHFFFAOYSA-N 0.000 claims description 4
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 claims description 4
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 4
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 claims description 4
- 239000011593 sulfur Substances 0.000 claims description 4
- ARFTYLINKKVNAT-UHFFFAOYSA-N 2-n,5-n-bis(2-methoxyethyl)-1,3,4-thiadiazole-2,5-diamine Chemical compound COCCNC1=NN=C(NCCOC)S1 ARFTYLINKKVNAT-UHFFFAOYSA-N 0.000 claims description 3
- ZRXLMIWLKAOWQN-UHFFFAOYSA-N 2-n-(2-ethoxyethyl)-5-n-methyl-1,3,4-thiadiazole-2,5-diamine Chemical compound CCOCCNC1=NN=C(NC)S1 ZRXLMIWLKAOWQN-UHFFFAOYSA-N 0.000 claims description 3
- UVJUTLRDOSOEAW-UHFFFAOYSA-N 2-n-ethyl-5-n-methyl-1,3,4-thiadiazole-2,5-diamine Chemical compound CCNC1=NN=C(NC)S1 UVJUTLRDOSOEAW-UHFFFAOYSA-N 0.000 claims description 3
- 229910021607 Silver chloride Inorganic materials 0.000 claims description 3
- OIPQUBBCOVJSNS-UHFFFAOYSA-L bromo(iodo)silver Chemical compound Br[Ag]I OIPQUBBCOVJSNS-UHFFFAOYSA-L 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- HKZLPVFGJNLROG-UHFFFAOYSA-M silver monochloride Chemical compound [Cl-].[Ag+] HKZLPVFGJNLROG-UHFFFAOYSA-M 0.000 claims description 3
- PYPGTBRGXXKPCX-UHFFFAOYSA-N 2-n,5-n-diethyl-1,3,4-thiadiazole-2,5-diamine Chemical compound CCNC1=NN=C(NCC)S1 PYPGTBRGXXKPCX-UHFFFAOYSA-N 0.000 claims description 2
- 239000007864 aqueous solution Substances 0.000 claims description 2
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 claims description 2
- 239000012964 benzotriazole Substances 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims 5
- KOWTYQYOWJJZRX-UHFFFAOYSA-N 2-n,5-n-dimethyl-1,3,4-oxadiazole-2,5-diamine Chemical compound CNC1=NN=C(NC)O1 KOWTYQYOWJJZRX-UHFFFAOYSA-N 0.000 claims 3
- VSKZWSBRUFQBQT-UHFFFAOYSA-N 2-n,5-n-bis(2-ethoxyethyl)-1,3,4-thiadiazole-2,5-diamine Chemical compound CCOCCNC1=NN=C(NCCOCC)S1 VSKZWSBRUFQBQT-UHFFFAOYSA-N 0.000 claims 2
- GDPGXEFQHMGQCQ-UHFFFAOYSA-N 2-n,5-n-diethyl-1,3,4-oxadiazole-2,5-diamine Chemical compound CCNC1=NN=C(NCC)O1 GDPGXEFQHMGQCQ-UHFFFAOYSA-N 0.000 claims 2
- PDAHIAKESSDNAR-UHFFFAOYSA-N 2-n-(2-methoxyethyl)-5-n-(3-methylsulfanylpropyl)-1,3,4-thiadiazole-2,5-diamine Chemical compound COCCNC1=NN=C(NCCCSC)S1 PDAHIAKESSDNAR-UHFFFAOYSA-N 0.000 claims 2
- RMRFFCXPLWYOOY-UHFFFAOYSA-N allyl radical Chemical compound [CH2]C=C RMRFFCXPLWYOOY-UHFFFAOYSA-N 0.000 claims 2
- 125000006232 ethoxy propyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])C([H])([H])* 0.000 claims 2
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 claims 2
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 claims 2
- 125000004092 methylthiomethyl group Chemical group [H]C([H])([H])SC([H])([H])* 0.000 claims 2
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 claims 1
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 claims 1
- 125000006351 ethylthiomethyl group Chemical group [H]C([H])([H])C([H])([H])SC([H])([H])* 0.000 claims 1
- 125000004372 methylthioethyl group Chemical group [H]C([H])([H])SC([H])([H])C([H])([H])* 0.000 claims 1
- 125000004373 methylthiopropyl group Chemical group [H]C([H])([H])SC([H])([H])C([H])([H])C([H])([H])* 0.000 claims 1
- 239000010410 layer Substances 0.000 description 20
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 18
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- 239000000243 solution Substances 0.000 description 14
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 8
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 6
- 239000000203 mixture Substances 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 238000012360 testing method Methods 0.000 description 5
- 150000004867 thiadiazoles Chemical class 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 125000003289 ascorbyl group Chemical class [H]O[C@@]([H])(C([H])([H])O*)[C@@]1([H])OC(=O)C(O*)=C1O* 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- WCPAKWJPBJAGKN-UHFFFAOYSA-N oxadiazole Chemical compound C1=CON=N1 WCPAKWJPBJAGKN-UHFFFAOYSA-N 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 4
- 150000005208 1,4-dihydroxybenzenes Chemical class 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 230000009471 action Effects 0.000 description 3
- 230000004913 activation Effects 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 150000004866 oxadiazoles Chemical class 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 description 3
- LAQYHRQFABOIFD-UHFFFAOYSA-N 2-methoxyhydroquinone Chemical compound COC1=CC(O)=CC=C1O LAQYHRQFABOIFD-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 241000792859 Enema Species 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 2
- 239000012670 alkaline solution Substances 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- ZOJBYZNEUISWFT-UHFFFAOYSA-N allyl isothiocyanate Chemical compound C=CCN=C=S ZOJBYZNEUISWFT-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000002026 chloroform extract Substances 0.000 description 2
- 238000002845 discoloration Methods 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000007920 enema Substances 0.000 description 2
- 229940095399 enema Drugs 0.000 description 2
- 150000002466 imines Chemical class 0.000 description 2
- 238000007654 immersion Methods 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- WQGWDDDVZFFDIG-UHFFFAOYSA-N pyrogallol Chemical compound OC1=CC=CC(O)=C1O WQGWDDDVZFFDIG-UHFFFAOYSA-N 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 150000003378 silver Chemical class 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- 235000010265 sodium sulphite Nutrition 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 230000002269 spontaneous effect Effects 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- CNHDIAIOKMXOLK-UHFFFAOYSA-N toluquinol Chemical compound CC1=CC(O)=CC=C1O CNHDIAIOKMXOLK-UHFFFAOYSA-N 0.000 description 2
- 150000005206 1,2-dihydroxybenzenes Chemical class 0.000 description 1
- 150000005072 1,3,4-oxadiazoles Chemical class 0.000 description 1
- MBIZXFATKUQOOA-UHFFFAOYSA-N 1,3,4-thiadiazole Chemical compound C1=NN=CS1 MBIZXFATKUQOOA-UHFFFAOYSA-N 0.000 description 1
- YHMYGUUIMTVXNW-UHFFFAOYSA-N 1,3-dihydrobenzimidazole-2-thione Chemical compound C1=CC=C2NC(S)=NC2=C1 YHMYGUUIMTVXNW-UHFFFAOYSA-N 0.000 description 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 1
- VLPZUANQXMDIPV-UHFFFAOYSA-N 1h-pyrazole;silver Chemical compound [Ag].C=1C=NNC=1 VLPZUANQXMDIPV-UHFFFAOYSA-N 0.000 description 1
- JAAIPIWKKXCNOC-UHFFFAOYSA-N 1h-tetrazol-1-ium-5-thiolate Chemical compound SC1=NN=NN1 JAAIPIWKKXCNOC-UHFFFAOYSA-N 0.000 description 1
- DBCKMJVEAUXWJJ-UHFFFAOYSA-N 2,3-dichlorobenzene-1,4-diol Chemical compound OC1=CC=C(O)C(Cl)=C1Cl DBCKMJVEAUXWJJ-UHFFFAOYSA-N 0.000 description 1
- VEUMBMHMMCOFAG-UHFFFAOYSA-N 2,3-dihydrooxadiazole Chemical compound N1NC=CO1 VEUMBMHMMCOFAG-UHFFFAOYSA-N 0.000 description 1
- GPASWZHHWPVSRG-UHFFFAOYSA-N 2,5-dimethylbenzene-1,4-diol Chemical compound CC1=CC(O)=C(C)C=C1O GPASWZHHWPVSRG-UHFFFAOYSA-N 0.000 description 1
- JHKKTXXMAQLGJB-UHFFFAOYSA-N 2-(methylamino)phenol Chemical class CNC1=CC=CC=C1O JHKKTXXMAQLGJB-UHFFFAOYSA-N 0.000 description 1
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 1
- PHNGKIFUTBFGAG-UHFFFAOYSA-N 2-ethoxybenzene-1,4-diol Chemical compound CCOC1=CC(O)=CC=C1O PHNGKIFUTBFGAG-UHFFFAOYSA-N 0.000 description 1
- VEWFVWBQBFQRPR-UHFFFAOYSA-N 2-n,5-n-dibutyl-1,3,4-thiadiazole-2,5-diamine Chemical compound CCCCNC1=NN=C(NCCCC)S1 VEWFVWBQBFQRPR-UHFFFAOYSA-N 0.000 description 1
- IFBVXTYQCVAYLA-UHFFFAOYSA-N 2-n,5-n-diphenyl-1,3,4-thiadiazole-2,5-diamine Chemical compound C=1C=CC=CC=1NC(S1)=NN=C1NC1=CC=CC=C1 IFBVXTYQCVAYLA-UHFFFAOYSA-N 0.000 description 1
- DSVIHYOAKPVFEH-UHFFFAOYSA-N 4-(hydroxymethyl)-4-methyl-1-phenylpyrazolidin-3-one Chemical compound N1C(=O)C(C)(CO)CN1C1=CC=CC=C1 DSVIHYOAKPVFEH-UHFFFAOYSA-N 0.000 description 1
- PTVZQOAHCSKAAS-UHFFFAOYSA-N 4-methyl-3-thiosemicarbazide Chemical compound CNC(=S)NN PTVZQOAHCSKAAS-UHFFFAOYSA-N 0.000 description 1
- UTMDJGPRCLQPBT-UHFFFAOYSA-N 4-nitro-1h-1,2,3-benzotriazole Chemical compound [O-][N+](=O)C1=CC=CC2=NNN=C12 UTMDJGPRCLQPBT-UHFFFAOYSA-N 0.000 description 1
- VLGRNXDVLOEYLB-UHFFFAOYSA-N 5-n-(2-methoxyethyl)-2-n-phenyl-1,3,4-thiadiazole-2,5-diamine Chemical compound S1C(NCCOC)=NN=C1NC1=CC=CC=C1 VLGRNXDVLOEYLB-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 101100189378 Caenorhabditis elegans pat-3 gene Proteins 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- BGNXCDMCOKJUMV-UHFFFAOYSA-N Tert-Butylhydroquinone Chemical compound CC(C)(C)C1=CC(O)=CC=C1O BGNXCDMCOKJUMV-UHFFFAOYSA-N 0.000 description 1
- SDGOKYAKHWEFKN-UHFFFAOYSA-N [3-(carbamoylamino)-1h-1,2,4-triazol-5-yl]urea Chemical class NC(=O)NC1=NNC(NC(N)=O)=N1 SDGOKYAKHWEFKN-UHFFFAOYSA-N 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 239000012790 adhesive layer Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910000318 alkali metal phosphate Inorganic materials 0.000 description 1
- 235000016720 allyl isothiocyanate Nutrition 0.000 description 1
- MDFFNEOEWAXZRQ-UHFFFAOYSA-N aminyl Chemical compound [NH2] MDFFNEOEWAXZRQ-UHFFFAOYSA-N 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- AJPXTSMULZANCB-UHFFFAOYSA-N chlorohydroquinone Chemical compound OC1=CC=C(O)C(Cl)=C1 AJPXTSMULZANCB-UHFFFAOYSA-N 0.000 description 1
- 230000001351 cycling effect Effects 0.000 description 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- NWVVVBRKAWDGAB-UHFFFAOYSA-N hydroquinone methyl ether Natural products COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- KPCHOCIEAXFUHZ-UHFFFAOYSA-N oxadiazole-4-thiol Chemical class SC1=CON=N1 KPCHOCIEAXFUHZ-UHFFFAOYSA-N 0.000 description 1
- CMCWWLVWPDLCRM-UHFFFAOYSA-N phenidone Chemical compound N1C(=O)CCN1C1=CC=CC=C1 CMCWWLVWPDLCRM-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 239000004848 polyfunctional curative Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- QYPXCXAKFZEADZ-UHFFFAOYSA-N pyrazole-1,3-diamine Chemical class NC=1C=CN(N)N=1 QYPXCXAKFZEADZ-UHFFFAOYSA-N 0.000 description 1
- 229940079877 pyrogallol Drugs 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- ADZWSOLPGZMUMY-UHFFFAOYSA-M silver bromide Chemical compound [Ag]Br ADZWSOLPGZMUMY-UHFFFAOYSA-M 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000004250 tert-Butylhydroquinone Substances 0.000 description 1
- 235000019281 tert-butylhydroquinone Nutrition 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 210000001550 testis Anatomy 0.000 description 1
- JJJPTTANZGDADF-UHFFFAOYSA-N thiadiazole-4-thiol Chemical class SC1=CSN=N1 JJJPTTANZGDADF-UHFFFAOYSA-N 0.000 description 1
- 150000003567 thiocyanates Chemical class 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 229910000406 trisodium phosphate Inorganic materials 0.000 description 1
- 235000019801 trisodium phosphate Nutrition 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C5/00—Photographic processes or agents therefor; Regeneration of such processing agents
- G03C5/26—Processes using silver-salt-containing photosensitive materials or agents therefor
- G03C5/29—Development processes or agents therefor
- G03C5/30—Developers
- G03C5/3028—Heterocyclic compounds
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/741,164 US4093462A (en) | 1976-11-11 | 1976-11-11 | 2,5-Bis(secondary amino) oxa- and thiadiazole photographic developing agents |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2750570A1 true DE2750570A1 (de) | 1978-05-24 |
Family
ID=24979650
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19772750570 Withdrawn DE2750570A1 (de) | 1976-11-11 | 1977-11-11 | Photographischer silberhalogenidentwickler |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4093462A (enExample) |
| JP (1) | JPS5361334A (enExample) |
| CA (1) | CA1094858A (enExample) |
| DE (1) | DE2750570A1 (enExample) |
| FR (1) | FR2375625A1 (enExample) |
| GB (1) | GB1589580A (enExample) |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE557693A (enExample) * | 1956-05-23 | |||
| US2915395A (en) * | 1957-02-15 | 1959-12-01 | Gen Aniline & Film Corp | Antifogging agents for light sensitive paper emulsions |
| BE606550A (enExample) * | 1960-07-27 | |||
| US3314789A (en) * | 1964-07-24 | 1967-04-18 | Eastman Kodak Co | Quaternary ammonium salts in silver halide processing solutions |
| US3306746A (en) * | 1965-08-20 | 1967-02-28 | Harriet S Schwartz | Photographic developers containing sulfa compounds |
| DE1921740A1 (de) * | 1969-04-29 | 1970-11-12 | Agfa Gevaert Ag | Stabilisierung entwickelter photographischer Bilder |
| US3882123A (en) * | 1973-08-01 | 1975-05-06 | American Cyanamid Co | 2,5-Bis-substituted amino-1,3,4-thiadiazoles and method of use |
-
1976
- 1976-11-11 US US05/741,164 patent/US4093462A/en not_active Expired - Lifetime
-
1977
- 1977-10-07 CA CA288,379A patent/CA1094858A/en not_active Expired
- 1977-11-09 FR FR7733749A patent/FR2375625A1/fr active Granted
- 1977-11-10 JP JP13416377A patent/JPS5361334A/ja active Pending
- 1977-11-10 GB GB46863/77A patent/GB1589580A/en not_active Expired
- 1977-11-11 DE DE19772750570 patent/DE2750570A1/de not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| FR2375625A1 (fr) | 1978-07-21 |
| GB1589580A (en) | 1981-05-13 |
| FR2375625B1 (enExample) | 1981-11-27 |
| US4093462A (en) | 1978-06-06 |
| CA1094858A (en) | 1981-02-03 |
| JPS5361334A (en) | 1978-06-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1547711C3 (de) | Verfahren zur Herstellung von hchtentwickelbarem Silberhalogenid | |
| DE2758762C2 (enExample) | ||
| DE1447632C3 (de) | Photographisches Aufzeichnungsmaterial | |
| DE3203661C2 (enExample) | ||
| DE2811025A1 (de) | Silbersalze von 3-amino-1,2,4-mercaptotriazolderivaten | |
| DE2803199C2 (de) | Verfahren zur Entwicklung eines lichtempfindlichen photographischen Silberhalogenid-Aufzeichnungsmaterials vom Lith-Typ | |
| DE1255484B (de) | Lichtempfindliches photographisches Material mit mindestens einer lichtempfindlichen Silbersalzemulsionsschicht | |
| DE957183C (de) | Stabilisiertes photographisches Material | |
| DE2344563A1 (de) | Photographische silberhalogenidemulsion, photographisches silberhalogenidmaterial und verfahren zur chemischen reifung einer photographischen silberhalogenidemulsion | |
| DE1772724A1 (de) | Photographisches Umkehrverfahren | |
| DE1177002B (de) | Verfahren zur Verhinderung der Schleierbildung und lichtempfindliche photographische Halogen-silberemulsion bzw. Photomaterial | |
| DE1929223A1 (de) | Entwickler-Vorlaeufer-Verbindungen und ihre Verwendung in der Photographie | |
| DE2034064B2 (de) | Farbfotografisches Aufzeichenmaterial | |
| DE2439919A1 (de) | Verfahren zum entwickeln eines belichteten photographischen silberhalogenidmaterials | |
| DE2061972C3 (de) | Photographisches Aufzeichnungsmaterial | |
| DE3014628C2 (enExample) | ||
| DE2734335C2 (de) | Lichtempfindliches, photographisches, spektral sensibilisiertes Silberhalogenidaufzeichnungsmaterial vom Lith-Typ | |
| DE3337882A1 (de) | Verfahren zum entwickeln von belichteten photographischen silberhalogenidmaterialien | |
| DE2936081A1 (de) | Lichtempfindliches, fotografisches silberhalogenidaufzeichnungsmaterial | |
| DE2009056C2 (de) | Verwendung von Anhydrodihydrohexosereductonen zum Entwickeln photographischer Aufzeichnungsmaterialien | |
| DE2212550C2 (de) | Verwendung von Azooligoazolen in photographischen Silberhalogenidemulsionen, in den Silberhalegonidemulsionsschichten von photographischen Aufzeichnungsmaterialien und in photographischen Behandlungsbädern sowie diese Verbindungen enthaltende Silberhalegonidemulsionen, photographische Aufzeichnungsmaterialien und photographische Behandlungsbäder | |
| EP0618491B1 (de) | Verfahren zur Erzeugung von Negativbildern mit ultrasteilem Kontrast | |
| DE68917945T2 (de) | Verfahren zur photographischen Entwicklungsbehandlung. | |
| DE2750570A1 (de) | Photographischer silberhalogenidentwickler | |
| DE3438249A1 (de) | Photographisches silberhalogenidmaterial |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |