CA1094858A - 2,5-bis (secondary amino) oxa-and thiadiazole photographic developing agents - Google Patents
2,5-bis (secondary amino) oxa-and thiadiazole photographic developing agentsInfo
- Publication number
- CA1094858A CA1094858A CA288,379A CA288379A CA1094858A CA 1094858 A CA1094858 A CA 1094858A CA 288379 A CA288379 A CA 288379A CA 1094858 A CA1094858 A CA 1094858A
- Authority
- CA
- Canada
- Prior art keywords
- thiadiazole
- bis
- methylamino
- silver halide
- ethylamino
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 title claims abstract description 15
- WCPAKWJPBJAGKN-UHFFFAOYSA-N oxadiazole Chemical compound C1=CON=N1 WCPAKWJPBJAGKN-UHFFFAOYSA-N 0.000 title abstract description 7
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 title abstract description 5
- 239000003795 chemical substances by application Substances 0.000 claims abstract description 92
- -1 AMINO Chemical group 0.000 claims abstract description 73
- 239000000203 mixture Substances 0.000 claims abstract description 38
- 238000000034 method Methods 0.000 claims abstract description 22
- 230000008569 process Effects 0.000 claims abstract description 19
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 10
- 238000009792 diffusion process Methods 0.000 claims abstract description 10
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 10
- 239000011593 sulfur Substances 0.000 claims abstract description 10
- 238000012546 transfer Methods 0.000 claims abstract description 10
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 8
- 229910052760 oxygen Chemical group 0.000 claims abstract description 8
- 239000001301 oxygen Chemical group 0.000 claims abstract description 8
- 229910052709 silver Inorganic materials 0.000 claims description 53
- 239000004332 silver Substances 0.000 claims description 53
- 239000000839 emulsion Substances 0.000 claims description 29
- 125000004432 carbon atom Chemical group C* 0.000 claims description 19
- 238000011161 development Methods 0.000 claims description 16
- 125000003118 aryl group Chemical group 0.000 claims description 14
- 239000000243 solution Substances 0.000 claims description 13
- 239000012190 activator Substances 0.000 claims description 12
- 125000003545 alkoxy group Chemical group 0.000 claims description 12
- 238000012545 processing Methods 0.000 claims description 11
- 125000004414 alkyl thio group Chemical group 0.000 claims description 9
- VSKZWSBRUFQBQT-UHFFFAOYSA-N 2-n,5-n-bis(2-ethoxyethyl)-1,3,4-thiadiazole-2,5-diamine Chemical compound CCOCCNC1=NN=C(NCCOCC)S1 VSKZWSBRUFQBQT-UHFFFAOYSA-N 0.000 claims description 7
- KHSWZJPSBCYNPR-UHFFFAOYSA-N 2-n,5-n-dimethyl-1,3,4-thiadiazole-2,5-diamine Chemical group CNC1=NN=C(NC)S1 KHSWZJPSBCYNPR-UHFFFAOYSA-N 0.000 claims description 7
- AEUNZJZMCYUBRB-UHFFFAOYSA-N 2-n-(2-ethoxyethyl)-5-n-(2-methoxyethyl)-1,3,4-thiadiazole-2,5-diamine Chemical compound CCOCCNC1=NN=C(NCCOC)S1 AEUNZJZMCYUBRB-UHFFFAOYSA-N 0.000 claims description 7
- PDAHIAKESSDNAR-UHFFFAOYSA-N 2-n-(2-methoxyethyl)-5-n-(3-methylsulfanylpropyl)-1,3,4-thiadiazole-2,5-diamine Chemical compound COCCNC1=NN=C(NCCCSC)S1 PDAHIAKESSDNAR-UHFFFAOYSA-N 0.000 claims description 7
- UVJUTLRDOSOEAW-UHFFFAOYSA-N 2-n-ethyl-5-n-methyl-1,3,4-thiadiazole-2,5-diamine Chemical compound CCNC1=NN=C(NC)S1 UVJUTLRDOSOEAW-UHFFFAOYSA-N 0.000 claims description 7
- KOWTYQYOWJJZRX-UHFFFAOYSA-N 2-n,5-n-dimethyl-1,3,4-oxadiazole-2,5-diamine Chemical compound CNC1=NN=C(NC)O1 KOWTYQYOWJJZRX-UHFFFAOYSA-N 0.000 claims description 6
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 claims description 6
- ZRXLMIWLKAOWQN-UHFFFAOYSA-N 2-n-(2-ethoxyethyl)-5-n-methyl-1,3,4-thiadiazole-2,5-diamine Chemical compound CCOCCNC1=NN=C(NC)S1 ZRXLMIWLKAOWQN-UHFFFAOYSA-N 0.000 claims description 5
- 229910021607 Silver chloride Inorganic materials 0.000 claims description 5
- ZUNKMNLKJXRCDM-UHFFFAOYSA-N silver bromoiodide Chemical group [Ag].IBr ZUNKMNLKJXRCDM-UHFFFAOYSA-N 0.000 claims description 5
- HKZLPVFGJNLROG-UHFFFAOYSA-M silver monochloride Chemical compound [Cl-].[Ag+] HKZLPVFGJNLROG-UHFFFAOYSA-M 0.000 claims description 5
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 4
- VLGRNXDVLOEYLB-UHFFFAOYSA-N 5-n-(2-methoxyethyl)-2-n-phenyl-1,3,4-thiadiazole-2,5-diamine Chemical compound S1C(NCCOC)=NN=C1NC1=CC=CC=C1 VLGRNXDVLOEYLB-UHFFFAOYSA-N 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 claims description 3
- 239000012964 benzotriazole Substances 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 claims description 3
- 239000007864 aqueous solution Substances 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims 13
- ARFTYLINKKVNAT-UHFFFAOYSA-N 2-n,5-n-bis(2-methoxyethyl)-1,3,4-thiadiazole-2,5-diamine Chemical compound COCCNC1=NN=C(NCCOC)S1 ARFTYLINKKVNAT-UHFFFAOYSA-N 0.000 claims 6
- PYPGTBRGXXKPCX-UHFFFAOYSA-N 2-n,5-n-diethyl-1,3,4-thiadiazole-2,5-diamine Chemical compound CCNC1=NN=C(NCC)S1 PYPGTBRGXXKPCX-UHFFFAOYSA-N 0.000 claims 6
- GDPGXEFQHMGQCQ-UHFFFAOYSA-N 2-n,5-n-diethyl-1,3,4-oxadiazole-2,5-diamine Chemical compound CCNC1=NN=C(NCC)O1 GDPGXEFQHMGQCQ-UHFFFAOYSA-N 0.000 claims 4
- NREKMCLKHNNYGF-UHFFFAOYSA-N 5-n-(2-methoxyethyl)-2-n-(4-methoxyphenyl)-1,3,4-thiadiazole-2,5-diamine Chemical compound S1C(NCCOC)=NN=C1NC1=CC=C(OC)C=C1 NREKMCLKHNNYGF-UHFFFAOYSA-N 0.000 claims 2
- 125000006232 ethoxy propyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])C([H])([H])* 0.000 claims 2
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 claims 2
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 claims 2
- 125000006351 ethylthiomethyl group Chemical group [H]C([H])([H])C([H])([H])SC([H])([H])* 0.000 claims 2
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 claims 2
- 125000004372 methylthioethyl group Chemical group [H]C([H])([H])SC([H])([H])C([H])([H])* 0.000 claims 2
- 125000004092 methylthiomethyl group Chemical group [H]C([H])([H])SC([H])([H])* 0.000 claims 2
- YTQQIHUQLOZOJI-UHFFFAOYSA-N 2,3-dihydro-1,2-thiazole Chemical compound C1NSC=C1 YTQQIHUQLOZOJI-UHFFFAOYSA-N 0.000 claims 1
- 150000004867 thiadiazoles Chemical class 0.000 abstract description 7
- 230000005855 radiation Effects 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 description 21
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 18
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 239000010410 layer Substances 0.000 description 11
- 229960004337 hydroquinone Drugs 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 6
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical group [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 6
- 238000000576 coating method Methods 0.000 description 5
- 150000004866 oxadiazoles Chemical class 0.000 description 5
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 4
- 230000004913 activation Effects 0.000 description 4
- 238000001994 activation Methods 0.000 description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 2
- 150000005208 1,4-dihydroxybenzenes Chemical class 0.000 description 2
- LAQYHRQFABOIFD-UHFFFAOYSA-N 2-methoxyhydroquinone Chemical compound COC1=CC(O)=CC=C1O LAQYHRQFABOIFD-UHFFFAOYSA-N 0.000 description 2
- CBQYNPHHHJTCJS-UHFFFAOYSA-N Alline Chemical compound C1=CC=C2C3(O)CCN(C)C3NC2=C1 CBQYNPHHHJTCJS-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 239000012670 alkaline solution Substances 0.000 description 2
- 235000010323 ascorbic acid Nutrition 0.000 description 2
- 229960005070 ascorbic acid Drugs 0.000 description 2
- 239000011668 ascorbic acid Substances 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 239000002026 chloroform extract Substances 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 229940125898 compound 5 Drugs 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 150000002466 imines Chemical class 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 230000033458 reproduction Effects 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 150000003378 silver Chemical class 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 230000002269 spontaneous effect Effects 0.000 description 2
- CNHDIAIOKMXOLK-UHFFFAOYSA-N toluquinol Chemical compound CC1=CC(O)=CC=C1O CNHDIAIOKMXOLK-UHFFFAOYSA-N 0.000 description 2
- ULUZGMIUTMRARO-UHFFFAOYSA-N (carbamoylamino)urea Chemical class NC(=O)NNC(N)=O ULUZGMIUTMRARO-UHFFFAOYSA-N 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- YHMYGUUIMTVXNW-UHFFFAOYSA-N 1,3-dihydrobenzimidazole-2-thione Chemical compound C1=CC=C2NC(S)=NC2=C1 YHMYGUUIMTVXNW-UHFFFAOYSA-N 0.000 description 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 1
- JAAIPIWKKXCNOC-UHFFFAOYSA-N 1h-tetrazol-1-ium-5-thiolate Chemical compound SC1=NN=NN1 JAAIPIWKKXCNOC-UHFFFAOYSA-N 0.000 description 1
- DBCKMJVEAUXWJJ-UHFFFAOYSA-N 2,3-dichlorobenzene-1,4-diol Chemical compound OC1=CC=C(O)C(Cl)=C1Cl DBCKMJVEAUXWJJ-UHFFFAOYSA-N 0.000 description 1
- VEUMBMHMMCOFAG-UHFFFAOYSA-N 2,3-dihydrooxadiazole Chemical compound N1NC=CO1 VEUMBMHMMCOFAG-UHFFFAOYSA-N 0.000 description 1
- JHKKTXXMAQLGJB-UHFFFAOYSA-N 2-(methylamino)phenol Chemical class CNC1=CC=CC=C1O JHKKTXXMAQLGJB-UHFFFAOYSA-N 0.000 description 1
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 1
- PHNGKIFUTBFGAG-UHFFFAOYSA-N 2-ethoxybenzene-1,4-diol Chemical compound CCOC1=CC(O)=CC=C1O PHNGKIFUTBFGAG-UHFFFAOYSA-N 0.000 description 1
- VEWFVWBQBFQRPR-UHFFFAOYSA-N 2-n,5-n-dibutyl-1,3,4-thiadiazole-2,5-diamine Chemical compound CCCCNC1=NN=C(NCCCC)S1 VEWFVWBQBFQRPR-UHFFFAOYSA-N 0.000 description 1
- IFBVXTYQCVAYLA-UHFFFAOYSA-N 2-n,5-n-diphenyl-1,3,4-thiadiazole-2,5-diamine Chemical compound C=1C=CC=CC=1NC(S1)=NN=C1NC1=CC=CC=C1 IFBVXTYQCVAYLA-UHFFFAOYSA-N 0.000 description 1
- DSVIHYOAKPVFEH-UHFFFAOYSA-N 4-(hydroxymethyl)-4-methyl-1-phenylpyrazolidin-3-one Chemical compound N1C(=O)C(C)(CO)CN1C1=CC=CC=C1 DSVIHYOAKPVFEH-UHFFFAOYSA-N 0.000 description 1
- UTMDJGPRCLQPBT-UHFFFAOYSA-N 4-nitro-1h-1,2,3-benzotriazole Chemical compound [O-][N+](=O)C1=CC=CC2=NNN=C12 UTMDJGPRCLQPBT-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 241000857945 Anita Species 0.000 description 1
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 1
- FZQDYEPVHITTBB-UHFFFAOYSA-N Cl[Br][I][Ag] Chemical compound Cl[Br][I][Ag] FZQDYEPVHITTBB-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 150000000996 L-ascorbic acids Chemical class 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- BGNXCDMCOKJUMV-UHFFFAOYSA-N Tert-Butylhydroquinone Chemical compound CC(C)(C)C1=CC(O)=CC=C1O BGNXCDMCOKJUMV-UHFFFAOYSA-N 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 1
- SDGOKYAKHWEFKN-UHFFFAOYSA-N [3-(carbamoylamino)-1h-1,2,4-triazol-5-yl]urea Chemical compound NC(=O)NC1=NNC(NC(N)=O)=N1 SDGOKYAKHWEFKN-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910000318 alkali metal phosphate Inorganic materials 0.000 description 1
- XIWMTQIUUWJNRP-UHFFFAOYSA-N amidol Chemical class NC1=CC=C(O)C(N)=C1 XIWMTQIUUWJNRP-UHFFFAOYSA-N 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- AJPXTSMULZANCB-UHFFFAOYSA-N chlorohydroquinone Chemical compound OC1=CC=C(O)C(Cl)=C1 AJPXTSMULZANCB-UHFFFAOYSA-N 0.000 description 1
- 229930016911 cinnamic acid Natural products 0.000 description 1
- 235000013985 cinnamic acid Nutrition 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- PGRHXDWITVMQBC-UHFFFAOYSA-N dehydroacetic acid Natural products CC(=O)C1C(=O)OC(C)=CC1=O PGRHXDWITVMQBC-UHFFFAOYSA-N 0.000 description 1
- 229940075894 denatured ethanol Drugs 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 1
- NWVVVBRKAWDGAB-UHFFFAOYSA-N hydroquinone methyl ether Natural products COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 239000011229 interlayer Substances 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 229940006116 lithium hydroxide Drugs 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- ZHFBNFIXRMDULI-UHFFFAOYSA-N n,n-bis(2-ethoxyethyl)hydroxylamine Chemical compound CCOCCN(O)CCOCC ZHFBNFIXRMDULI-UHFFFAOYSA-N 0.000 description 1
- XORXZRQNXQSDQG-UHFFFAOYSA-N n-methyl-1,3,4-thiadiazol-2-amine Chemical compound CNC1=NN=CS1 XORXZRQNXQSDQG-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- KPCHOCIEAXFUHZ-UHFFFAOYSA-N oxadiazole-4-thiol Chemical class SC1=CON=N1 KPCHOCIEAXFUHZ-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- PLIKAWJENQZMHA-UHFFFAOYSA-N p-hydroxyphenylamine Natural products NC1=CC=C(O)C=C1 PLIKAWJENQZMHA-UHFFFAOYSA-N 0.000 description 1
- CMCWWLVWPDLCRM-UHFFFAOYSA-N phenidone Chemical compound N1C(=O)CCN1C1=CC=CC=C1 CMCWWLVWPDLCRM-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229920002557 polyglycidol polymer Polymers 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- QYPXCXAKFZEADZ-UHFFFAOYSA-N pyrazole-1,3-diamine Chemical class NC=1C=CN(N)N=1 QYPXCXAKFZEADZ-UHFFFAOYSA-N 0.000 description 1
- NDGRWYRVNANFNB-UHFFFAOYSA-N pyrazolidin-3-one Chemical compound O=C1CCNN1 NDGRWYRVNANFNB-UHFFFAOYSA-N 0.000 description 1
- WQGWDDDVZFFDIG-UHFFFAOYSA-N pyrogallol Chemical compound OC1=CC=CC(O)=C1O WQGWDDDVZFFDIG-UHFFFAOYSA-N 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- ADZWSOLPGZMUMY-UHFFFAOYSA-M silver bromide Chemical compound [Ag]Br ADZWSOLPGZMUMY-UHFFFAOYSA-M 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 150000001420 substituted heterocyclic compounds Chemical class 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000004250 tert-Butylhydroquinone Substances 0.000 description 1
- 235000019281 tert-butylhydroquinone Nutrition 0.000 description 1
- JJJPTTANZGDADF-UHFFFAOYSA-N thiadiazole-4-thiol Chemical class SC1=CSN=N1 JJJPTTANZGDADF-UHFFFAOYSA-N 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 229910000406 trisodium phosphate Inorganic materials 0.000 description 1
- 235000019801 trisodium phosphate Nutrition 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C5/00—Photographic processes or agents therefor; Regeneration of such processing agents
- G03C5/26—Processes using silver-salt-containing photosensitive materials or agents therefor
- G03C5/29—Development processes or agents therefor
- G03C5/30—Developers
- G03C5/3028—Heterocyclic compounds
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US741,164 | 1976-11-11 | ||
| US05/741,164 US4093462A (en) | 1976-11-11 | 1976-11-11 | 2,5-Bis(secondary amino) oxa- and thiadiazole photographic developing agents |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1094858A true CA1094858A (en) | 1981-02-03 |
Family
ID=24979650
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA288,379A Expired CA1094858A (en) | 1976-11-11 | 1977-10-07 | 2,5-bis (secondary amino) oxa-and thiadiazole photographic developing agents |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4093462A (enExample) |
| JP (1) | JPS5361334A (enExample) |
| CA (1) | CA1094858A (enExample) |
| DE (1) | DE2750570A1 (enExample) |
| FR (1) | FR2375625A1 (enExample) |
| GB (1) | GB1589580A (enExample) |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE557693A (enExample) * | 1956-05-23 | |||
| US2915395A (en) * | 1957-02-15 | 1959-12-01 | Gen Aniline & Film Corp | Antifogging agents for light sensitive paper emulsions |
| BE606550A (enExample) * | 1960-07-27 | |||
| US3314789A (en) * | 1964-07-24 | 1967-04-18 | Eastman Kodak Co | Quaternary ammonium salts in silver halide processing solutions |
| US3306746A (en) * | 1965-08-20 | 1967-02-28 | Harriet S Schwartz | Photographic developers containing sulfa compounds |
| DE1921740A1 (de) * | 1969-04-29 | 1970-11-12 | Agfa Gevaert Ag | Stabilisierung entwickelter photographischer Bilder |
| US3882123A (en) * | 1973-08-01 | 1975-05-06 | American Cyanamid Co | 2,5-Bis-substituted amino-1,3,4-thiadiazoles and method of use |
-
1976
- 1976-11-11 US US05/741,164 patent/US4093462A/en not_active Expired - Lifetime
-
1977
- 1977-10-07 CA CA288,379A patent/CA1094858A/en not_active Expired
- 1977-11-09 FR FR7733749A patent/FR2375625A1/fr active Granted
- 1977-11-10 JP JP13416377A patent/JPS5361334A/ja active Pending
- 1977-11-10 GB GB46863/77A patent/GB1589580A/en not_active Expired
- 1977-11-11 DE DE19772750570 patent/DE2750570A1/de not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| DE2750570A1 (de) | 1978-05-24 |
| FR2375625B1 (enExample) | 1981-11-27 |
| FR2375625A1 (fr) | 1978-07-21 |
| US4093462A (en) | 1978-06-06 |
| JPS5361334A (en) | 1978-06-01 |
| GB1589580A (en) | 1981-05-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4378424A (en) | Mesoionic 1,2,4-triazolium-3-thiolates as silver halide stabilizers and fixing agents | |
| US4060420A (en) | Sulfonylacetate activator-stabilizer precursor | |
| US3782949A (en) | Photographic element comprising a hydroxy substituted aliphatic carboxylic acid aryl hydrazide | |
| CA1098753A (en) | Heat developable photographic materials containing 2- carboxycarboxamide organic salt as activator precursor | |
| EP0631179B1 (en) | Method for processing a black-and-white silver halide photographic light-sensitive material | |
| US3730727A (en) | Photographic element comprising an aliphatic carboxylic acid aryl hydrazide and ascorbic acid | |
| EP0209011B1 (en) | High contrast photographic elements exhibiting stabilized sensitivity | |
| US4207392A (en) | Heat developable and stabilizable photographic materials and process | |
| JP3240334B2 (ja) | 黒白ハロゲン化銀写真感光材料の現像処理方法 | |
| CA1094858A (en) | 2,5-bis (secondary amino) oxa-and thiadiazole photographic developing agents | |
| EP0196705B1 (en) | A method of effecting high contrast development of a image-wise exposed photographic silver halide emulsion layer material | |
| US3335009A (en) | Antifoggant combination for processing evaporated silver halide layers | |
| US4243748A (en) | Light-sensitive silver halide reproduction material | |
| US5206123A (en) | High contrast developer containing an aprotic solvent | |
| JP2995360B2 (ja) | ハロゲン化銀写真感光材料 | |
| US4612277A (en) | Image-receiving element for silver salt diffusion process with image stabilizer precursor | |
| JPH01200249A (ja) | 写真現像処理方法 | |
| US5776666A (en) | Triazolium thiolate baths for silver halide development acceleration | |
| US3811896A (en) | Silver halide emulsion stabilized with isoselenoureas or ketoselenozolidines | |
| EP0713130B1 (en) | Isothiouronium salts as photographic nucleating agents | |
| JP3362291B2 (ja) | ハロゲン化銀写真感光材料及び画像形成方法 | |
| JP3225382B2 (ja) | 黒白ハロゲン化銀写真感光材料用現像液組成物 | |
| JPH06347954A (ja) | ハロゲン化銀写真感光材料の画像形成方法 | |
| JP3289154B2 (ja) | ハロゲン化銀写真感光材料 | |
| JP3177797B2 (ja) | 黒白ハロゲン化銀写真感光材料の現像処理方法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |