DE2741624C3 - - Google Patents
Info
- Publication number
- DE2741624C3 DE2741624C3 DE2741624C3 DE 2741624 C3 DE2741624 C3 DE 2741624C3 DE 2741624 C3 DE2741624 C3 DE 2741624C3
- Authority
- DE
- Germany
- Prior art keywords
- divinyl
- tetramethyldisiloxane
- tetrahydrofuran
- grignard
- reaction mixture
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 238000000034 method Methods 0.000 claims description 10
- 150000001875 compounds Chemical class 0.000 claims description 8
- 239000011541 reaction mixture Substances 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- KWEKXPWNFQBJAY-UHFFFAOYSA-N (dimethyl-$l^{3}-silanyl)oxy-dimethylsilicon Chemical compound C[Si](C)O[Si](C)C KWEKXPWNFQBJAY-UHFFFAOYSA-N 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 14
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 7
- 238000009835 boiling Methods 0.000 description 4
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 4
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical compound [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 4
- 238000000926 separation method Methods 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 238000003747 Grignard reaction Methods 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- 239000005662 Paraffin oil Substances 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- NNBZCPXTIHJBJL-UHFFFAOYSA-N decalin Chemical compound C1CCCC2CCCCC21 NNBZCPXTIHJBJL-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- XMGQYMWWDOXHJM-UHFFFAOYSA-N limonene Chemical compound CC(=C)C1CCC(C)=CC1 XMGQYMWWDOXHJM-UHFFFAOYSA-N 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 229940050176 methyl chloride Drugs 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 150000003961 organosilicon compounds Chemical class 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000001293 FEMA 3089 Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- XSDCTSITJJJDPY-UHFFFAOYSA-N chloro-ethenyl-dimethylsilane Chemical compound C[Si](C)(Cl)C=C XSDCTSITJJJDPY-UHFFFAOYSA-N 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 230000009918 complex formation Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000004205 dimethyl polysiloxane Substances 0.000 description 1
- 235000013870 dimethyl polysiloxane Nutrition 0.000 description 1
- BITPLIXHRASDQB-UHFFFAOYSA-N ethenyl-[ethenyl(dimethyl)silyl]oxy-dimethylsilane Chemical compound C=C[Si](C)(C)O[Si](C)(C)C=C BITPLIXHRASDQB-UHFFFAOYSA-N 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- CCERQOYLJJULMD-UHFFFAOYSA-M magnesium;carbanide;chloride Chemical compound [CH3-].[Mg+2].[Cl-] CCERQOYLJJULMD-UHFFFAOYSA-M 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 125000005375 organosiloxane group Chemical group 0.000 description 1
- 229920000435 poly(dimethylsiloxane) Polymers 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 150000004756 silanes Chemical class 0.000 description 1
- -1 siloxane units Chemical group 0.000 description 1
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2642833B2 (de) | Oxysilan-Verbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE60117106T2 (de) | Verfahren zur Herstellung von Halopropyldimethylchlorosilanen | |
| EP0304720B1 (de) | Dimethylsilyl-substituierte Benzoylchloride und Verfahren zu ihrer Herstellung | |
| EP0322537A2 (de) | Verfahren zur Herstellung von cyclischen Ketonen durch Isomerisierung von Epoxiden | |
| DE2263819C3 (de) | Verfahren zur Herstellung von a- Alkoxy w-siloxanolen | |
| DE3149357A1 (de) | Verbessertes verfahren zur herstellung von beta-chlor-isobuttersaeure | |
| DE1203773B (de) | Verfahren zur Herstellung von tertiaeren Phosphinen | |
| DE2741624C3 (enExample) | ||
| DE2741624B1 (de) | Verfahren zur Herstellung von 1,3-Divinyl-1,1,3,3-tetramethyldisiloxan | |
| EP0087585A1 (de) | Verfahren zur Herstellung von 3-Alkoxi-acrylnitrilen | |
| DE1568945C3 (de) | Verfahren zur Herstellung ungesättigter Phosphonsäuredichloride | |
| EP0829466B1 (de) | Verfahren zur Herstellung von Cyclopentanolen | |
| DE1261507B (de) | Verfahren zur Gewinnung von Trialkylphosphinen aus einem Reaktionsgemisch | |
| DE69104782T2 (de) | Verfahren zur Herstellung von ungesättigten Bromiden. | |
| DE69323854T2 (de) | Wasserfreies Verfahren zur Herstellung von Polyorganosiloxanen | |
| EP0578983B1 (de) | Verfahren zur Herstellung von Trialkylzinnhydriden | |
| EP0705840B1 (de) | Verfahren zur Herstellung von 0,0-Dialkyl-4-phosphono-2-methyl-2-butensäurealkylestern und 4-Halogen-2-methyl-2-butensäurealkylestern mit hohem Anteil an E-Isomeren | |
| DE2113858C3 (de) | Verfahren zur Herstellung von 2,3 Dichlorbutadien-(1,3) | |
| DE2527654A1 (de) | Olefinische sulfone, verfahren zu ihrer herstellung und ihre verwendung fuer die herstellung von biologisch aktiven produkten | |
| DE2204194C3 (de) | Verfahren zur Herstellung von Allylbromid | |
| DE961623C (de) | Verfahren zur Herstellung von 1, 18-Di-[2', 6', 6'-trimethylcyclohexen-(1')-yl]-3, 7, 12, 16-tetramethyl-8, 11-dioxyoktadekahexaen-(2, 4, 6, 12, 14, 16)-in-(9) (C-Acetylendiol) | |
| DE1618116C (de) | Verfahren zur Herstellung von Tnaryl phosphinen | |
| DE2414878A1 (de) | Verfahren zur herstellung von 1.1.3.3tetramethyldisiloxan | |
| DD241606A1 (de) | Verfahren zur herstellung von heptamethyltrisiloxan | |
| DE2409674A1 (de) | Verfahren zur herstellung von silazanen |