DE2736469C2 - Furfurylalkoholmischpolymerisat und Verfahren zu seiner Herstellung - Google Patents
Furfurylalkoholmischpolymerisat und Verfahren zu seiner HerstellungInfo
- Publication number
- DE2736469C2 DE2736469C2 DE2736469A DE2736469A DE2736469C2 DE 2736469 C2 DE2736469 C2 DE 2736469C2 DE 2736469 A DE2736469 A DE 2736469A DE 2736469 A DE2736469 A DE 2736469A DE 2736469 C2 DE2736469 C2 DE 2736469C2
- Authority
- DE
- Germany
- Prior art keywords
- reaction
- metal
- prepolymer
- furfuryl alcohol
- pyrrolidine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- XPFVYQJUAUNWIW-UHFFFAOYSA-N furfuryl alcohol Natural products OCC1=CC=CO1 XPFVYQJUAUNWIW-UHFFFAOYSA-N 0.000 title claims description 38
- 229920001577 copolymer Polymers 0.000 title claims description 11
- 238000000034 method Methods 0.000 title description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 44
- 238000006243 chemical reaction Methods 0.000 claims description 21
- 229920000728 polyester Polymers 0.000 claims description 17
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 claims description 9
- 229920005862 polyol Polymers 0.000 claims description 7
- 229910052750 molybdenum Inorganic materials 0.000 claims description 6
- 239000011733 molybdenum Substances 0.000 claims description 6
- 150000003077 polyols Chemical class 0.000 claims description 6
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 5
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 claims description 5
- 239000011976 maleic acid Substances 0.000 claims description 5
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 claims description 5
- FQNHWXHRAUXLFU-UHFFFAOYSA-N carbon monoxide;tungsten Chemical group [W].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-] FQNHWXHRAUXLFU-UHFFFAOYSA-N 0.000 claims description 4
- 229920001187 thermosetting polymer Polymers 0.000 claims description 3
- 229920005989 resin Polymers 0.000 description 25
- 239000011347 resin Substances 0.000 description 25
- 229910052751 metal Inorganic materials 0.000 description 24
- 239000002184 metal Substances 0.000 description 24
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 17
- 239000007795 chemical reaction product Substances 0.000 description 15
- 239000000047 product Substances 0.000 description 13
- 229920000642 polymer Polymers 0.000 description 11
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 10
- 239000000463 material Substances 0.000 description 8
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 7
- 238000004519 manufacturing process Methods 0.000 description 7
- 238000002156 mixing Methods 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 229910052799 carbon Inorganic materials 0.000 description 5
- 229910002804 graphite Inorganic materials 0.000 description 5
- 239000010439 graphite Substances 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 239000011159 matrix material Substances 0.000 description 5
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 125000004429 atom Chemical group 0.000 description 4
- 238000005260 corrosion Methods 0.000 description 4
- 230000007797 corrosion Effects 0.000 description 4
- 239000004744 fabric Substances 0.000 description 4
- 239000000835 fiber Substances 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 238000000197 pyrolysis Methods 0.000 description 4
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 4
- 229910052721 tungsten Inorganic materials 0.000 description 4
- 239000010937 tungsten Substances 0.000 description 4
- 238000002679 ablation Methods 0.000 description 3
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- -1 Polyoxyethylene Polymers 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 238000007334 copolymerization reaction Methods 0.000 description 2
- 239000002657 fibrous material Substances 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 239000002923 metal particle Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- YPFDHNVEDLHUCE-UHFFFAOYSA-N propane-1,3-diol Chemical compound OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 229920003002 synthetic resin Polymers 0.000 description 2
- 239000000057 synthetic resin Substances 0.000 description 2
- 229920000049 Carbon (fiber) Polymers 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- ALQSHHUCVQOPAS-UHFFFAOYSA-N Pentane-1,5-diol Chemical compound OCCCCCO ALQSHHUCVQOPAS-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 229920000297 Rayon Polymers 0.000 description 1
- UWHCKJMYHZGTIT-UHFFFAOYSA-N Tetraethylene glycol, Natural products OCCOCCOCCOCCO UWHCKJMYHZGTIT-UHFFFAOYSA-N 0.000 description 1
- XMUZQOKACOLCSS-UHFFFAOYSA-N [2-(hydroxymethyl)phenyl]methanol Chemical compound OCC1=CC=CC=C1CO XMUZQOKACOLCSS-UHFFFAOYSA-N 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 230000035508 accumulation Effects 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 239000004917 carbon fiber Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 239000000806 elastomer Substances 0.000 description 1
- 239000003822 epoxy resin Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000010419 fine particle Substances 0.000 description 1
- 238000010304 firing Methods 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 1
- 125000001183 hydrocarbyl group Chemical group 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 238000002386 leaching Methods 0.000 description 1
- 150000001247 metal acetylides Chemical class 0.000 description 1
- 229920005588 metal-containing polymer Polymers 0.000 description 1
- OEIJHBUUFURJLI-UHFFFAOYSA-N octane-1,8-diol Chemical compound OCCCCCCCCO OEIJHBUUFURJLI-UHFFFAOYSA-N 0.000 description 1
- 150000002902 organometallic compounds Chemical class 0.000 description 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 239000005011 phenolic resin Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 229920001521 polyalkylene glycol ether Polymers 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 239000002964 rayon Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000011819 refractory material Substances 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000011342 resin composition Substances 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- ZIBGPFATKBEMQZ-UHFFFAOYSA-N triethylene glycol Chemical compound OCCOCCOCCO ZIBGPFATKBEMQZ-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/68—Polyesters containing atoms other than carbon, hydrogen and oxygen
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K3/00—Use of inorganic substances as compounding ingredients
- C08K3/02—Elements
- C08K3/04—Carbon
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K3/00—Use of inorganic substances as compounding ingredients
- C08K3/02—Elements
- C08K3/08—Metals
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Reinforced Plastic Materials (AREA)
- Polyesters Or Polycarbonates (AREA)
- Polyethers (AREA)
- Macromonomer-Based Addition Polymer (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/714,403 US4087482A (en) | 1976-08-16 | 1976-08-16 | Furfuryl alcohol modified polyester resins containing metal atoms |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2736469A1 DE2736469A1 (de) | 1978-02-23 |
| DE2736469C2 true DE2736469C2 (de) | 1982-04-01 |
Family
ID=24869899
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2736469A Expired DE2736469C2 (de) | 1976-08-16 | 1977-08-12 | Furfurylalkoholmischpolymerisat und Verfahren zu seiner Herstellung |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4087482A (OSRAM) |
| JP (2) | JPS5391997A (OSRAM) |
| DE (1) | DE2736469C2 (OSRAM) |
| FR (1) | FR2362177A1 (OSRAM) |
| GB (1) | GB1563446A (OSRAM) |
Families Citing this family (35)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4343922A (en) * | 1976-08-16 | 1982-08-10 | Hitco | Polymers containing chemically bonded metal atoms |
| US4302392A (en) * | 1976-08-16 | 1981-11-24 | Hitco | Polymers containing chemically bonded metal atoms |
| US4284744A (en) * | 1976-08-16 | 1981-08-18 | Hitco | Polymers containing chemically bonded metal atoms |
| US4256868A (en) * | 1979-12-12 | 1981-03-17 | Hitco | Epoxy resins containing chemically bonded metal atoms |
| US4321298A (en) * | 1980-02-26 | 1982-03-23 | Hitco | Carbon fabrics sequentially resin coated with (1) a metal-containing composition and (2) a boron-containing composition are laminated and carbonized |
| US4288568A (en) * | 1980-07-30 | 1981-09-08 | Hitco | Elastomers containing chemically bonded metal atoms |
| FR2519296A1 (fr) * | 1982-01-06 | 1983-07-08 | Hitco | Matiere carbonee fibreuse a resistance elevee a l'oxydation et aux fortes temperatures et son application a la fabrication de produits composites stratifies du type carbone-carbone |
| US4588799A (en) * | 1984-05-18 | 1986-05-13 | Hitco | Reimpregnation resin comprising reaction product of metal complex and furfuryl alcohol |
| US4604433A (en) * | 1984-07-06 | 1986-08-05 | Hitco | Thermosetting furan based resin containing niobium and/or tantalum |
| US8110814B2 (en) | 2003-10-16 | 2012-02-07 | Alis Corporation | Ion sources, systems and methods |
| US7368523B2 (en) * | 2004-11-12 | 2008-05-06 | Eastman Chemical Company | Polyester polymer and copolymer compositions containing titanium nitride particles |
| US20060051542A1 (en) * | 2004-09-03 | 2006-03-09 | Zhiyong Xia | Polyester polymer and copolymer compositions containing metallic molybdenum particles |
| US20060110557A1 (en) * | 2004-09-03 | 2006-05-25 | Zhiyong Xia | Polyester polymer and copolymer compositions containing metallic tungsten particles |
| US7662880B2 (en) * | 2004-09-03 | 2010-02-16 | Eastman Chemical Company | Polyester polymer and copolymer compositions containing metallic nickel particles |
| US7300967B2 (en) * | 2004-11-12 | 2007-11-27 | Eastman Chemical Company | Polyester polymer and copolymer compositions containing metallic titanium particles |
| US20060105129A1 (en) * | 2004-11-12 | 2006-05-18 | Zhiyong Xia | Polyester polymer and copolymer compositions containing titanium carbide particles |
| US20060122300A1 (en) * | 2004-12-07 | 2006-06-08 | Zhiyong Xia | Polyester polymer and copolymer compositions containing steel particles |
| US20060177614A1 (en) * | 2005-02-09 | 2006-08-10 | Zhiyong Xia | Polyester polymer and copolymer compositions containing metallic tantalum particles |
| US20060222795A1 (en) * | 2005-03-31 | 2006-10-05 | Howell Earl E Jr | Polyester polymer and copolymer compositions containing particles of one or more transition metal compounds |
| US20060287471A1 (en) * | 2005-06-16 | 2006-12-21 | Schreiber Benjamin R | Accelerated acetaldehyde testing of polymers |
| US8557950B2 (en) | 2005-06-16 | 2013-10-15 | Grupo Petrotemex, S.A. De C.V. | High intrinsic viscosity melt phase polyester polymers with acceptable acetaldehyde generation rates |
| US7655746B2 (en) * | 2005-09-16 | 2010-02-02 | Eastman Chemical Company | Phosphorus containing compounds for reducing acetaldehyde in polyesters polymers |
| US9267007B2 (en) * | 2005-09-16 | 2016-02-23 | Grupo Petrotemex, S.A. De C.V. | Method for addition of additives into a polymer melt |
| US8431202B2 (en) * | 2005-09-16 | 2013-04-30 | Grupo Petrotemex, S.A. De C.V. | Aluminum/alkaline or alkali/titanium containing polyesters having improved reheat, color and clarity |
| US7838596B2 (en) * | 2005-09-16 | 2010-11-23 | Eastman Chemical Company | Late addition to effect compositional modifications in condensation polymers |
| US7745512B2 (en) * | 2005-09-16 | 2010-06-29 | Eastman Chemical Company | Polyester polymer and copolymer compositions containing carbon-coated iron particles |
| US7932345B2 (en) | 2005-09-16 | 2011-04-26 | Grupo Petrotemex, S.A. De C.V. | Aluminum containing polyester polymers having low acetaldehyde generation rates |
| US7776942B2 (en) * | 2005-09-16 | 2010-08-17 | Eastman Chemical Company | Polyester polymer and copolymer compositions containing particles of titanium nitride and carbon-coated iron |
| US20070260002A1 (en) * | 2006-05-04 | 2007-11-08 | Zhiyong Xia | Titanium nitride particles, methods of making them, and their use in polyester compositions |
| US20080027207A1 (en) * | 2006-07-28 | 2008-01-31 | Jason Christopher Jenkins | Non-precipitating alkali/alkaline earth metal and aluminum compositions made with mono-ol ether solvents |
| US7709595B2 (en) * | 2006-07-28 | 2010-05-04 | Eastman Chemical Company | Non-precipitating alkali/alkaline earth metal and aluminum solutions made with polyhydroxyl ether solvents |
| US7709593B2 (en) * | 2006-07-28 | 2010-05-04 | Eastman Chemical Company | Multiple feeds of catalyst metals to a polyester production process |
| US7745368B2 (en) * | 2006-07-28 | 2010-06-29 | Eastman Chemical Company | Non-precipitating alkali/alkaline earth metal and aluminum compositions made with organic hydroxyacids |
| US20080058495A1 (en) * | 2006-09-05 | 2008-03-06 | Donna Rice Quillen | Polyester polymer and copolymer compositions containing titanium and yellow colorants |
| US8563677B2 (en) * | 2006-12-08 | 2013-10-22 | Grupo Petrotemex, S.A. De C.V. | Non-precipitating alkali/alkaline earth metal and aluminum solutions made with diols having at least two primary hydroxyl groups |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3370026A (en) * | 1964-09-24 | 1968-02-20 | American Cyanamid Co | Method of producing photochromic castings |
| FR1449188A (fr) * | 1965-10-01 | 1966-08-12 | Kennametal Inc | élément d'éjection de produits à températures élevées, notamment tuyère ou ajutage, procédé pour sa fabrication et procédé d'éjection correspondant |
| US3519698A (en) * | 1967-11-01 | 1970-07-07 | Koppers Co Inc | Thickenable unsaturated polyester resin system |
| US3544530A (en) * | 1968-10-01 | 1970-12-01 | Hitco | Furfuryl alcohol co-polymers |
-
1976
- 1976-08-16 US US05/714,403 patent/US4087482A/en not_active Expired - Lifetime
-
1977
- 1977-08-12 FR FR7724966A patent/FR2362177A1/fr active Granted
- 1977-08-12 DE DE2736469A patent/DE2736469C2/de not_active Expired
- 1977-08-15 JP JP9771377A patent/JPS5391997A/ja active Granted
- 1977-08-15 GB GB34166/77A patent/GB1563446A/en not_active Expired
-
1986
- 1986-02-12 JP JP61028735A patent/JPS61203166A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| GB1563446A (en) | 1980-03-26 |
| FR2362177A1 (fr) | 1978-03-17 |
| US4087482A (en) | 1978-05-02 |
| FR2362177B1 (OSRAM) | 1983-10-14 |
| JPS61203166A (ja) | 1986-09-09 |
| JPS6134454B2 (OSRAM) | 1986-08-07 |
| JPS6410548B2 (OSRAM) | 1989-02-22 |
| JPS5391997A (en) | 1978-08-12 |
| DE2736469A1 (de) | 1978-02-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2736469C2 (de) | Furfurylalkoholmischpolymerisat und Verfahren zu seiner Herstellung | |
| DE69220385T2 (de) | Verdichtung von strukturgebilden mit benzoxazinen | |
| DE2826114C2 (de) | Kohlenstoff-Kohlenstoff-Verbundmaterialien und Verfahren zu dessen Herstellung | |
| DE1643309B2 (de) | Epoxyharze, verfahren zu ihrer herstellung und deren verwendung | |
| DE1226926B (de) | Verfahren zum Herstellen von Mineral-fasermatten | |
| DE2728843A1 (de) | Waermehaertbare harzmasse | |
| DE1808713B1 (de) | Formmassen aus Diallylphthalat und Polyphenylenaethern | |
| DE1495718C3 (de) | Verfahren zur Herstellung hochmolekularer Copolymerisate | |
| DE2533087C2 (de) | Thermoplastische Form- und Preßharze und ihre Herstellung | |
| EP0652190B1 (de) | Verfahren zur Herstellung von Sinterformteilen | |
| DE2505946A1 (de) | Waermehaertbare polymere und praepolymere, erhalten durch polykondensation eines pyridins mit mindestens drei methylsubstituenten | |
| DE2251169A1 (de) | Haertbare epoxyharz-zusammensetzungen | |
| DE1495365A1 (de) | Verfahren zur Stabilisierung von unter Normalbedingungen festen Polymeren | |
| EP2807212B1 (de) | Schäume aus lignin-furanderivat-polymeren und deren herstellungsmethode | |
| DE2249701A1 (de) | Harzhaltige haerter fuer epoxyharze und verfahren zu ihrer herstellung | |
| DE1696152A1 (de) | Ausgangsmischung fuer die Herstellung von geformten,brennbaren Produkten und Verfahren zu ihrer Herstellung | |
| DE3342359C2 (OSRAM) | ||
| DE3342357C2 (de) | Furan-Reimprägnierharze | |
| DE2723792C3 (de) | Feuerfeste Masse | |
| DE3523995C2 (de) | Wärmehärtbare, Niob oder Tantal enthaltende Harze auf Furanbasis | |
| DE2442299A1 (de) | Feuerhemmende epoxyharze und verfahren zu deren herstellung | |
| DE2418507A1 (de) | Materialgemisch zur herstellung homogener und dichter gegenstaende aus kohlenstoff | |
| DE2456179C3 (de) | Verbundstoff aus Thermoplast und Asbest | |
| DE1210178B (de) | Herstellen von Formteilen aus Epoxyharz-Formmassen, die Aluminium enthalten | |
| DE2064070C3 (de) | Verfahren zur Herstellung von wärmebeständigen Formteilen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8125 | Change of the main classification | ||
| 8126 | Change of the secondary classification | ||
| D2 | Grant after examination | ||
| 8339 | Ceased/non-payment of the annual fee |