DE2733516C3 - Verfahren zum Telomerisieren von Dienen durch Umsetzung eines Diens mit einer Verbindung mit beweglichem Wasserstoffatom - Google Patents
Verfahren zum Telomerisieren von Dienen durch Umsetzung eines Diens mit einer Verbindung mit beweglichem WasserstoffatomInfo
- Publication number
- DE2733516C3 DE2733516C3 DE2733516A DE2733516A DE2733516C3 DE 2733516 C3 DE2733516 C3 DE 2733516C3 DE 2733516 A DE2733516 A DE 2733516A DE 2733516 A DE2733516 A DE 2733516A DE 2733516 C3 DE2733516 C3 DE 2733516C3
- Authority
- DE
- Germany
- Prior art keywords
- water
- reaction
- butadiene
- phosphine
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 title claims description 30
- 238000000034 method Methods 0.000 title claims description 26
- 150000001993 dienes Chemical class 0.000 title claims description 17
- 125000004435 hydrogen atom Chemical group [H]* 0.000 title claims description 14
- 238000006243 chemical reaction Methods 0.000 claims description 59
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 claims description 37
- 239000003054 catalyst Substances 0.000 claims description 35
- 229910000073 phosphorus hydride Inorganic materials 0.000 claims description 20
- 229910052751 metal Inorganic materials 0.000 claims description 12
- 239000002184 metal Substances 0.000 claims description 12
- 150000003623 transition metal compounds Chemical class 0.000 claims description 6
- 229910052723 transition metal Inorganic materials 0.000 claims description 3
- 150000003624 transition metals Chemical class 0.000 claims description 3
- 239000012442 inert solvent Substances 0.000 claims description 2
- 230000000737 periodic effect Effects 0.000 claims description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 103
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 51
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 50
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 35
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 32
- -1 m-sulfophenyl Chemical group 0.000 description 17
- 229910052786 argon Inorganic materials 0.000 description 16
- 239000000203 mixture Substances 0.000 description 15
- 229910052763 palladium Inorganic materials 0.000 description 15
- 239000002253 acid Substances 0.000 description 14
- 150000003003 phosphines Chemical class 0.000 description 13
- 239000000243 solution Substances 0.000 description 13
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 239000010410 layer Substances 0.000 description 11
- 239000000047 product Substances 0.000 description 11
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- 239000007795 chemical reaction product Substances 0.000 description 10
- 159000000000 sodium salts Chemical class 0.000 description 10
- 239000002904 solvent Substances 0.000 description 10
- 150000007513 acids Chemical class 0.000 description 9
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 8
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 8
- 150000001298 alcohols Chemical class 0.000 description 8
- 239000007864 aqueous solution Substances 0.000 description 8
- 239000003638 chemical reducing agent Substances 0.000 description 8
- 229910052739 hydrogen Inorganic materials 0.000 description 8
- 239000012044 organic layer Substances 0.000 description 8
- 239000012071 phase Substances 0.000 description 8
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 8
- ZBMZOFSLQIPSPW-UHFFFAOYSA-N 3-bis(3-sulfophenyl)phosphanylbenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC(P(C=2C=C(C=CC=2)S(O)(=O)=O)C=2C=C(C=CC=2)S(O)(=O)=O)=C1 ZBMZOFSLQIPSPW-UHFFFAOYSA-N 0.000 description 7
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 7
- 125000003118 aryl group Chemical group 0.000 description 7
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 7
- 238000004821 distillation Methods 0.000 description 7
- 229930195733 hydrocarbon Natural products 0.000 description 7
- 238000002360 preparation method Methods 0.000 description 7
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 7
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 6
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 6
- 239000008346 aqueous phase Substances 0.000 description 6
- 150000002430 hydrocarbons Chemical class 0.000 description 6
- 239000001257 hydrogen Substances 0.000 description 6
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 6
- 229910052700 potassium Inorganic materials 0.000 description 6
- 239000012429 reaction media Substances 0.000 description 6
- 239000011734 sodium Substances 0.000 description 6
- 229910052708 sodium Inorganic materials 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 150000002941 palladium compounds Chemical class 0.000 description 5
- 229910052698 phosphorus Inorganic materials 0.000 description 5
- 238000000926 separation method Methods 0.000 description 5
- CBXCPBUEXACCNR-UHFFFAOYSA-N tetraethylammonium Chemical compound CC[N+](CC)(CC)CC CBXCPBUEXACCNR-UHFFFAOYSA-N 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 4
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical class [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 239000000654 additive Substances 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 150000002739 metals Chemical class 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- 239000011574 phosphorus Substances 0.000 description 4
- 229910052697 platinum Inorganic materials 0.000 description 4
- 239000011591 potassium Substances 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 239000012279 sodium borohydride Substances 0.000 description 4
- 229910000033 sodium borohydride Inorganic materials 0.000 description 4
- 229910001220 stainless steel Inorganic materials 0.000 description 4
- 239000010935 stainless steel Substances 0.000 description 4
- HRXKRNGNAMMEHJ-UHFFFAOYSA-K trisodium citrate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O HRXKRNGNAMMEHJ-UHFFFAOYSA-K 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- YQEPTNWSGJQCOK-UHFFFAOYSA-N 2-bis(2-sulfophenyl)phosphanylbenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1P(C=1C(=CC=CC=1)S(O)(=O)=O)C1=CC=CC=C1S(O)(=O)=O YQEPTNWSGJQCOK-UHFFFAOYSA-N 0.000 description 3
- VPFKYAOGDKHTPZ-UHFFFAOYSA-N 4-diphenylphosphanylbenzenesulfonic acid Chemical compound C1=CC(S(=O)(=O)O)=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 VPFKYAOGDKHTPZ-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- PBHVCRIXMXQXPD-UHFFFAOYSA-N chembl2369102 Chemical compound C1=CC(S(=O)(=O)O)=CC=C1C(C1=CC=C(N1)C(C=1C=CC(=CC=1)S(O)(=O)=O)=C1C=CC(=N1)C(C=1C=CC(=CC=1)S(O)(=O)=O)=C1C=CC(N1)=C1C=2C=CC(=CC=2)S(O)(=O)=O)=C2N=C1C=C2 PBHVCRIXMXQXPD-UHFFFAOYSA-N 0.000 description 3
- 239000010941 cobalt Substances 0.000 description 3
- 229910017052 cobalt Inorganic materials 0.000 description 3
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 3
- 229910052759 nickel Inorganic materials 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 229910052703 rhodium Inorganic materials 0.000 description 3
- 239000010948 rhodium Substances 0.000 description 3
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 3
- NESLWCLHZZISNB-UHFFFAOYSA-M sodium phenolate Chemical compound [Na+].[O-]C1=CC=CC=C1 NESLWCLHZZISNB-UHFFFAOYSA-M 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000006228 supernatant Substances 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- HOHLLOQHISHWBX-UHFFFAOYSA-N 1-methoxyocta-1,3-diene Chemical class CCCCC=CC=COC HOHLLOQHISHWBX-UHFFFAOYSA-N 0.000 description 2
- VUKIWGYTUWFIDN-UHFFFAOYSA-N 3-(3-sulfophenyl)phosphanylbenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC(PC=2C=C(C=CC=2)S(O)(=O)=O)=C1 VUKIWGYTUWFIDN-UHFFFAOYSA-N 0.000 description 2
- ITPOKAFWZBFZCV-UHFFFAOYSA-N 3-diphenylphosphanylbenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 ITPOKAFWZBFZCV-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- DJHGAFSJWGLOIV-UHFFFAOYSA-N Arsenic acid Chemical compound O[As](O)(O)=O DJHGAFSJWGLOIV-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical group O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 229910000831 Steel Inorganic materials 0.000 description 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910001413 alkali metal ion Inorganic materials 0.000 description 2
- 229910001420 alkaline earth metal ion Inorganic materials 0.000 description 2
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 150000004982 aromatic amines Chemical class 0.000 description 2
- 229940000488 arsenic acid Drugs 0.000 description 2
- 230000001174 ascending effect Effects 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 229910052788 barium Inorganic materials 0.000 description 2
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 2
- 150000008107 benzenesulfonic acids Chemical class 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 235000011089 carbon dioxide Nutrition 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- XGRJZXREYAXTGV-UHFFFAOYSA-N chlorodiphenylphosphine Chemical compound C=1C=CC=CC=1P(Cl)C1=CC=CC=C1 XGRJZXREYAXTGV-UHFFFAOYSA-N 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical compound N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- GPRLSGONYQIRFK-UHFFFAOYSA-N hydron Chemical compound [H+] GPRLSGONYQIRFK-UHFFFAOYSA-N 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 235000021317 phosphate Nutrition 0.000 description 2
- CLSUSRZJUQMOHH-UHFFFAOYSA-L platinum dichloride Chemical compound Cl[Pt]Cl CLSUSRZJUQMOHH-UHFFFAOYSA-L 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 125000001453 quaternary ammonium group Chemical group 0.000 description 2
- 239000011833 salt mixture Substances 0.000 description 2
- 150000004819 silanols Chemical class 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000010959 steel Substances 0.000 description 2
- 238000006277 sulfonation reaction Methods 0.000 description 2
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical compound C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 2
- HZYABSBSRWFZEG-BSWSSELBSA-N (1E,3E)-octa-1,3-dien-1-ol Chemical compound CCCC\C=C\C=C\O HZYABSBSRWFZEG-BSWSSELBSA-N 0.000 description 1
- HOXGZVUCAYFWGR-KQQUZDAGSA-N (3e,5e)-octa-1,3,5-triene Chemical compound CC\C=C\C=C\C=C HOXGZVUCAYFWGR-KQQUZDAGSA-N 0.000 description 1
- PMJHHCWVYXUKFD-SNAWJCMRSA-N (E)-1,3-pentadiene Chemical group C\C=C\C=C PMJHHCWVYXUKFD-SNAWJCMRSA-N 0.000 description 1
- POILWHVDKZOXJZ-ARJAWSKDSA-M (z)-4-oxopent-2-en-2-olate Chemical compound C\C([O-])=C\C(C)=O POILWHVDKZOXJZ-ARJAWSKDSA-M 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- CVBUKMMMRLOKQR-UHFFFAOYSA-N 1-phenylbutane-1,3-dione Chemical compound CC(=O)CC(=O)C1=CC=CC=C1 CVBUKMMMRLOKQR-UHFFFAOYSA-N 0.000 description 1
- SDJHPPZKZZWAKF-UHFFFAOYSA-N 2,3-dimethylbuta-1,3-diene Chemical compound CC(=C)C(C)=C SDJHPPZKZZWAKF-UHFFFAOYSA-N 0.000 description 1
- PJKUVJSPRYXAFR-UHFFFAOYSA-N 2-[phenyl-(2-sulfophenyl)phosphanyl]benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1P(C=1C(=CC=CC=1)S(O)(=O)=O)C1=CC=CC=C1 PJKUVJSPRYXAFR-UHFFFAOYSA-N 0.000 description 1
- BTVVFMGRXHONDV-UHFFFAOYSA-N 2-bis(2-sulfophenyl)phosphorylbenzenesulfonic acid Chemical class OS(=O)(=O)C1=CC=CC=C1P(=O)(C=1C(=CC=CC=1)S(O)(=O)=O)C1=CC=CC=C1S(O)(=O)=O BTVVFMGRXHONDV-UHFFFAOYSA-N 0.000 description 1
- HXVJDHROZFWXHT-UHFFFAOYSA-N 2-diphenylphosphanylbenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 HXVJDHROZFWXHT-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- VHQVWVBUIMMANM-UHFFFAOYSA-N 3-[phenyl-(3-sulfophenyl)phosphanyl]benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC(P(C=2C=CC=CC=2)C=2C=C(C=CC=2)S(O)(=O)=O)=C1 VHQVWVBUIMMANM-UHFFFAOYSA-N 0.000 description 1
- YAGLDXRWOXHUCL-UHFFFAOYSA-N 3-diphenylphosphanylbenzenesulfonic acid;dihydrate Chemical compound O.O.OS(=O)(=O)C1=CC=CC(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 YAGLDXRWOXHUCL-UHFFFAOYSA-N 0.000 description 1
- SVNRDPVQDFIPSD-UHFFFAOYSA-N 3-phosphanylbenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC(P)=C1 SVNRDPVQDFIPSD-UHFFFAOYSA-N 0.000 description 1
- BBDKZWKEPDTENS-UHFFFAOYSA-N 4-Vinylcyclohexene Chemical compound C=CC1CCC=CC1 BBDKZWKEPDTENS-UHFFFAOYSA-N 0.000 description 1
- SKRNRTUXOAPCPG-UHFFFAOYSA-N 4-bis(4-sulfophenyl)phosphanylbenzenesulfonic acid Chemical compound C1=CC(S(=O)(=O)O)=CC=C1P(C=1C=CC(=CC=1)S(O)(=O)=O)C1=CC=C(S(O)(=O)=O)C=C1 SKRNRTUXOAPCPG-UHFFFAOYSA-N 0.000 description 1
- CXSBHBSHUOGOLX-UHFFFAOYSA-N 4-octa-1,3-dienylmorpholine Chemical compound CCCCC=CC=CN1CCOCC1 CXSBHBSHUOGOLX-UHFFFAOYSA-N 0.000 description 1
- 101710200896 Acyl-CoA thioesterase 2 Proteins 0.000 description 1
- DJHGAFSJWGLOIV-UHFFFAOYSA-K Arsenate3- Chemical class [O-][As]([O-])([O-])=O DJHGAFSJWGLOIV-UHFFFAOYSA-K 0.000 description 1
- 229920001342 Bakelite® Polymers 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 229910014033 C-OH Inorganic materials 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 229910052684 Cerium Inorganic materials 0.000 description 1
- 229910014570 C—OH Inorganic materials 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- KMTRUDSVKNLOMY-UHFFFAOYSA-N Ethylene carbonate Chemical compound O=C1OCCO1 KMTRUDSVKNLOMY-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methylaniline Chemical compound CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 1
- 229910021586 Nickel(II) chloride Inorganic materials 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- 230000001133 acceleration Effects 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- TWKVUTXHANJYGH-UHFFFAOYSA-L allyl palladium chloride Chemical group Cl[Pd]CC=C.Cl[Pd]CC=C TWKVUTXHANJYGH-UHFFFAOYSA-L 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 239000004637 bakelite Substances 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 229920001429 chelating resin Polymers 0.000 description 1
- 239000007809 chemical reaction catalyst Substances 0.000 description 1
- 239000013065 commercial product Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 150000001896 cresols Chemical class 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000000378 dietary effect Effects 0.000 description 1
- 150000004683 dihydrates Chemical class 0.000 description 1
- CJSBUWDGPXGFGA-UHFFFAOYSA-N dimethyl-butadiene Natural products CC(C)=CC=C CJSBUWDGPXGFGA-UHFFFAOYSA-N 0.000 description 1
- IYDMNMSJMUMQBP-UHFFFAOYSA-N dipotassium;palladium(2+);tetracyanide Chemical compound [K+].[K+].[Pd+2].N#[C-].N#[C-].N#[C-].N#[C-] IYDMNMSJMUMQBP-UHFFFAOYSA-N 0.000 description 1
- POLCUAVZOMRGSN-UHFFFAOYSA-N dipropyl ether Chemical compound CCCOCCC POLCUAVZOMRGSN-UHFFFAOYSA-N 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 238000009713 electroplating Methods 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- HLOLVQSTCUVLJD-UHFFFAOYSA-N ethyl 3-oxobutanoate 3-oxohexanoic acid Chemical compound CCCC(=O)CC(O)=O.CCOC(=O)CC(C)=O HLOLVQSTCUVLJD-UHFFFAOYSA-N 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- LHGVFZTZFXWLCP-UHFFFAOYSA-N guaiacol Chemical compound COC1=CC=CC=C1O LHGVFZTZFXWLCP-UHFFFAOYSA-N 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 235000011475 lollipops Nutrition 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- QMMRZOWCJAIUJA-UHFFFAOYSA-L nickel dichloride Chemical compound Cl[Ni]Cl QMMRZOWCJAIUJA-UHFFFAOYSA-L 0.000 description 1
- ZODDGFAZWTZOSI-UHFFFAOYSA-N nitric acid;sulfuric acid Chemical compound O[N+]([O-])=O.OS(O)(=O)=O ZODDGFAZWTZOSI-UHFFFAOYSA-N 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 210000004940 nucleus Anatomy 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- MPQXHAGKBWFSNV-UHFFFAOYSA-N oxidophosphanium Chemical class [PH3]=O MPQXHAGKBWFSNV-UHFFFAOYSA-N 0.000 description 1
- AUONHKJOIZSQGR-UHFFFAOYSA-N oxophosphane Chemical compound P=O AUONHKJOIZSQGR-UHFFFAOYSA-N 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 229940127557 pharmaceutical product Drugs 0.000 description 1
- 150000004707 phenolate Chemical class 0.000 description 1
- XEXNFJQJTXAQKI-UHFFFAOYSA-N phenylphosphane;dihydrate Chemical compound O.O.PC1=CC=CC=C1 XEXNFJQJTXAQKI-UHFFFAOYSA-N 0.000 description 1
- RPGWZZNNEUHDAQ-UHFFFAOYSA-N phenylphosphine Chemical class PC1=CC=CC=C1 RPGWZZNNEUHDAQ-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 1
- PMJHHCWVYXUKFD-UHFFFAOYSA-N piperylene Natural products CC=CC=C PMJHHCWVYXUKFD-UHFFFAOYSA-N 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 1
- 150000003139 primary aliphatic amines Chemical class 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 230000004043 responsiveness Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- XLKHCFJHGIAKFX-UHFFFAOYSA-M sodium;4-chlorobenzenesulfonate Chemical compound [Na+].[O-]S(=O)(=O)C1=CC=C(Cl)C=C1 XLKHCFJHGIAKFX-UHFFFAOYSA-M 0.000 description 1
- CHLCPTJLUJHDBO-UHFFFAOYSA-M sodium;benzenesulfinate Chemical compound [Na+].[O-]S(=O)C1=CC=CC=C1 CHLCPTJLUJHDBO-UHFFFAOYSA-M 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 102000055501 telomere Human genes 0.000 description 1
- 108091035539 telomere Proteins 0.000 description 1
- 210000003411 telomere Anatomy 0.000 description 1
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical class C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 description 1
- 150000003509 tertiary alcohols Chemical class 0.000 description 1
- DZLFLBLQUQXARW-UHFFFAOYSA-N tetrabutylammonium Chemical compound CCCC[N+](CCCC)(CCCC)CCCC DZLFLBLQUQXARW-UHFFFAOYSA-N 0.000 description 1
- 229940073455 tetraethylammonium hydroxide Drugs 0.000 description 1
- LRGJRHZIDJQFCL-UHFFFAOYSA-M tetraethylazanium;hydroxide Chemical compound [OH-].CC[N+](CC)(CC)CC LRGJRHZIDJQFCL-UHFFFAOYSA-M 0.000 description 1
- OSBSFAARYOCBHB-UHFFFAOYSA-N tetrapropylammonium Chemical compound CCC[N+](CCC)(CCC)CCC OSBSFAARYOCBHB-UHFFFAOYSA-N 0.000 description 1
- SOBHUZYZLFQYFK-UHFFFAOYSA-K trisodium;hydroxy-[[phosphonatomethyl(phosphonomethyl)amino]methyl]phosphinate Chemical class [Na+].[Na+].[Na+].OP(O)(=O)CN(CP(O)([O-])=O)CP([O-])([O-])=O SOBHUZYZLFQYFK-UHFFFAOYSA-K 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
- 150000003739 xylenols Chemical class 0.000 description 1
- 238000004383 yellowing Methods 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C41/00—Preparation of ethers; Preparation of compounds having groups, groups or groups
- C07C41/01—Preparation of ethers
- C07C41/05—Preparation of ethers by addition of compounds to unsaturated compounds
- C07C41/06—Preparation of ethers by addition of compounds to unsaturated compounds by addition of organic compounds only
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C209/00—Preparation of compounds containing amino groups bound to a carbon skeleton
- C07C209/60—Preparation of compounds containing amino groups bound to a carbon skeleton by condensation or addition reactions, e.g. Mannich reaction, addition of ammonia or amines to alkenes or to alkynes or addition of compounds containing an active hydrogen atom to Schiff's bases, quinone imines, or aziranes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C29/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring
- C07C29/44—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring increasing the number of carbon atoms by addition reactions, i.e. reactions involving at least one carbon-to-carbon double or triple bond
- C07C29/46—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring increasing the number of carbon atoms by addition reactions, i.e. reactions involving at least one carbon-to-carbon double or triple bond by diene-synthesis
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
- C07C67/04—Preparation of carboxylic acid esters by reacting carboxylic acids or symmetrical anhydrides onto unsaturated carbon-to-carbon bonds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/28—Phosphorus compounds with one or more P—C bonds
- C07F9/50—Organo-phosphines
- C07F9/5022—Aromatic phosphines (P-C aromatic linkage)
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Polymerisation Methods In General (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7622824A FR2366237A1 (fr) | 1976-07-27 | 1976-07-27 | Procede de telomerisation de dienes |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2733516A1 DE2733516A1 (de) | 1978-02-02 |
| DE2733516B2 DE2733516B2 (de) | 1980-01-31 |
| DE2733516C3 true DE2733516C3 (de) | 1980-10-16 |
Family
ID=9176180
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2733516A Expired DE2733516C3 (de) | 1976-07-27 | 1977-07-25 | Verfahren zum Telomerisieren von Dienen durch Umsetzung eines Diens mit einer Verbindung mit beweglichem Wasserstoffatom |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4142060A (enExample) |
| JP (1) | JPS5314787A (enExample) |
| BE (1) | BE857169A (enExample) |
| BR (1) | BR7704895A (enExample) |
| CA (1) | CA1094066A (enExample) |
| DE (1) | DE2733516C3 (enExample) |
| ES (1) | ES461070A1 (enExample) |
| FR (1) | FR2366237A1 (enExample) |
| GB (1) | GB1553002A (enExample) |
| IT (1) | IT1090453B (enExample) |
| NL (1) | NL183758C (enExample) |
Families Citing this family (41)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4219677A (en) * | 1976-07-27 | 1980-08-26 | Rhone-Poulenc Industries | Telomerization process |
| FR2464934A1 (fr) * | 1979-09-14 | 1981-03-20 | Rhone Poulenc Ind | Nouveaux alcools gras insatures et leur procede de preparation |
| GB2074156B (en) * | 1980-03-28 | 1984-02-29 | Kuraray Co | Preparation of n-octadienol |
| EP0044771B1 (fr) * | 1980-07-10 | 1984-05-02 | Rhone-Poulenc Sante | Procédé d'addition sélective d'un composé ayant un atome de carbone activé sur un diène conjugué substitué |
| JPS57134427A (en) * | 1981-02-16 | 1982-08-19 | Kuraray Co Ltd | Preparation of n-octanol |
| DE3201665A1 (de) * | 1982-01-21 | 1983-09-08 | Ruhrchemie Ag, 4200 Oberhausen | Verfahren zur herstellung von ethanol und n-propanol aus methanol und synthesegas |
| DE3420493A1 (de) * | 1984-06-01 | 1985-12-05 | Ruhrchemie Ag, 4200 Oberhausen | Quartaere ammoniumsalze sulfonierter triarylphosphine |
| US4642392A (en) * | 1985-09-30 | 1987-02-10 | National Distillers And Chemical Corporation | Conjugated alkadiene telomerization to organo-oxyalkadienes |
| US4831183A (en) * | 1987-03-09 | 1989-05-16 | National Distillers And Chemical Corporation | Conjugated alkadiene telomerization to organooxyalkadienes |
| EP0287066B1 (en) * | 1987-04-16 | 1993-09-22 | Kuraray Co., Ltd. | Process for continuous production of octa -2,7-dien-1-ol |
| EP0296550B1 (en) * | 1987-06-24 | 1993-12-29 | Kuraray Co., Ltd. | Phosphonium salts and processes for production of and uses for the same |
| US4965404A (en) * | 1989-03-09 | 1990-10-23 | Kuraray Company, Ltd. | Process for the preparation of lithium diphenylphosphinobenzene-m-monosulfonate |
| US5043510A (en) * | 1989-03-27 | 1991-08-27 | E. I. Du Pont De Nemours And Company | Aqueous alkylation process |
| FR2652514A1 (fr) * | 1989-06-22 | 1991-04-05 | Rhone Poulenc Sante | Nouveau catalyseur a base de palladium et son emploi. |
| ES2081469T5 (es) * | 1989-12-29 | 2001-09-01 | Dow Chemical Co | Procedimiento continuo para la telomerizacion de dienos conjugados. |
| DE4006112A1 (de) * | 1990-02-27 | 1991-08-29 | Hoechst Ag | Verfahren zur herstellung von aminen |
| US5206396A (en) * | 1990-07-25 | 1993-04-27 | Henkel Research Corporation | Telomerization of 1,3-butadiene |
| US5236909A (en) * | 1990-07-25 | 1993-08-17 | Henkel Research Corporation | Octyl ethers and octadienyl ethers |
| FR2666250A1 (fr) * | 1990-09-05 | 1992-03-06 | Rhone Poulenc Nutrition Animal | Nouveaux catalyseurs, procede de preparation et leur utilisation. |
| US5264646A (en) * | 1991-03-28 | 1993-11-23 | The Dow Chemical Company | Process for preparing vinylically-unsaturated compounds |
| US5349109A (en) * | 1991-06-04 | 1994-09-20 | The Board Of Regents Of The University Of Oklahoma | Molybdenum-catalyzed amination of olefins |
| US5198598A (en) * | 1991-07-19 | 1993-03-30 | Henkel Kommanditgesellschaft Auf Aktien | Telomerization process of a conjugated alkadiene with a polyol |
| US5169981A (en) * | 1991-12-06 | 1992-12-08 | Union Carbide Chemicals & Plastics Technology Corporation | Synthesis of alpha-substituted alkadienes |
| US5243099A (en) * | 1991-12-06 | 1993-09-07 | Union Carbide Chemicals & Plastics Technology Corporation | Synthesis of alpha-substituted alkadienes |
| US5248645A (en) * | 1992-09-01 | 1993-09-28 | Phillips Petroleum Company | Ethylene oligomerization |
| US5210360A (en) * | 1992-09-01 | 1993-05-11 | Phillips Petroleum Company | Ethylene oligomerization |
| FR2697836B1 (fr) * | 1992-11-06 | 1995-01-06 | Atochem Elf Sa | Procédé de préparation d'octadienols. |
| IT1271428B (it) * | 1993-03-03 | 1997-05-28 | Snam Progetti | Procedimento per la telomerizzazione di dieni coniugati e catalizzatore adatto allo scopo. |
| FR2718131B1 (fr) * | 1994-04-01 | 1996-08-02 | Atochem Elf Sa | Procédé de préparation d'octadiénols. |
| FR2719580B1 (fr) * | 1994-05-05 | 1996-05-31 | Atochem Elf Sa | Procédé de préparation d'octadiénols. |
| DE59604167D1 (de) * | 1995-11-13 | 2000-02-17 | Bayer Ag | Verfahren zur Herstellung von primären Octadienylaminen |
| DE19619528A1 (de) * | 1996-05-15 | 1997-11-20 | Hoechst Ag | Substituierte Diphosphine und ein Verfahren zu ihrer Herstellung |
| DE19625783A1 (de) * | 1996-06-27 | 1998-01-02 | Bayer Ag | Komplexe, die Tris-(hydroxyalkyl)-phosphane als Liganden enthalten, für Telomerisationen, als Katalysatoren und neue Tris-(hydroxyalkyl)-phosphane enthaltende Komplexe |
| DE59703813D1 (de) * | 1996-08-27 | 2001-07-19 | Celanese Chem Europe Gmbh | Verfahren zur telomerisierung von dienen |
| ZA200108461B (en) | 2000-10-27 | 2002-06-06 | Celanese Chem Europe Gmbh | Process of telomerizing conjugated dienes. |
| EP1201634A1 (en) * | 2000-10-27 | 2002-05-02 | Celanese Chemicals Europe GmbH | Process of telomerizing conjugated dienes |
| SG93931A1 (en) * | 2001-04-13 | 2003-01-21 | Kuraray Co | Phosphonium salts and processes for production of and uses for the same, and phosphines deriving the same and processes for production of the phosphines |
| FR2833593B1 (fr) * | 2001-12-18 | 2004-10-29 | Centre Nat Rech Scient | Procede de preparation de composes tensio-actifs a partir de polyols |
| DE102005036040A1 (de) | 2004-08-28 | 2006-03-02 | Oxeno Olefinchemie Gmbh | Verfahren zur Telomerisation von nicht cyclischen Olefinen |
| JP4794293B2 (ja) * | 2005-07-14 | 2011-10-19 | 株式会社クラレ | 金属化合物、それを用いたビニル系モノマー重合用触媒組成物および該組成物を用いたビニル系モノマーの重合への使用 |
| FR3075790B1 (fr) | 2017-12-27 | 2020-03-20 | Technologies Moleculaires Tecmo | Procede de preparation de 2,7-octadiene-1-ol |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3670029A (en) * | 1969-03-19 | 1972-06-13 | Exxon Research Engineering Co | Preparation of unsaturated ethers |
| US3887627A (en) * | 1969-03-19 | 1975-06-03 | Exxon Research Engineering Co | Preparation of unsaturated alcohols and ethers |
| US3992456A (en) * | 1969-04-16 | 1976-11-16 | Union Carbide Corporation | Synthesis of alkadienols |
-
1976
- 1976-07-27 FR FR7622824A patent/FR2366237A1/fr active Granted
-
1977
- 1977-06-13 NL NLAANVRAGE7706463,A patent/NL183758C/xx not_active IP Right Cessation
- 1977-07-21 US US05/817,800 patent/US4142060A/en not_active Expired - Lifetime
- 1977-07-22 IT IT50407/77A patent/IT1090453B/it active
- 1977-07-25 DE DE2733516A patent/DE2733516C3/de not_active Expired
- 1977-07-26 GB GB31442/77A patent/GB1553002A/en not_active Expired
- 1977-07-26 BR BR7704895A patent/BR7704895A/pt unknown
- 1977-07-26 BE BE179651A patent/BE857169A/xx not_active IP Right Cessation
- 1977-07-26 JP JP8970077A patent/JPS5314787A/ja active Granted
- 1977-07-26 CA CA283,550A patent/CA1094066A/fr not_active Expired
- 1977-07-27 ES ES461070A patent/ES461070A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2733516B2 (de) | 1980-01-31 |
| JPS546270B2 (enExample) | 1979-03-27 |
| IT1090453B (it) | 1985-06-26 |
| FR2366237A1 (fr) | 1978-04-28 |
| BE857169A (fr) | 1978-01-26 |
| NL7706463A (nl) | 1978-01-31 |
| CA1094066A (fr) | 1981-01-20 |
| ES461070A1 (es) | 1978-06-01 |
| JPS5314787A (en) | 1978-02-09 |
| BR7704895A (pt) | 1978-06-13 |
| DE2733516A1 (de) | 1978-02-02 |
| FR2366237B1 (enExample) | 1979-03-23 |
| GB1553002A (en) | 1979-09-19 |
| US4142060A (en) | 1979-02-27 |
| NL183758C (nl) | 1993-02-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2733516C3 (de) | Verfahren zum Telomerisieren von Dienen durch Umsetzung eines Diens mit einer Verbindung mit beweglichem Wasserstoffatom | |
| DE2700904C2 (de) | Verfahren zur Anlagerung von Cyanwasserstoff an eine ungesättigte organische Verbindung mit mindestens einer äthylenischen Doppelbindung | |
| DE2627354C3 (de) | Verfahren zur Herstellung von Aldehyden | |
| EP1472201B1 (de) | Verfahren zur abtrennung von säuren aus chemischen reaktions gemischen mit hilfe von ionischen flüssigkeiten | |
| DE60109844T2 (de) | Katalysatorzusammensetzung zur Dimerisierung, Kodimerisierung und Oligomerisierung von Olefinen | |
| DE3338340C2 (de) | Verfahren zur Hydroformylierung einer olefinischen Verbindung | |
| DE3112213C2 (de) | Verfahren zur Herstellung von 2,7-Octadien-(1)-ol | |
| DE3886596T2 (de) | Phosphoniumsalze und Verfahren zu ihrer Herstellung und Verwendung. | |
| DE2848335C2 (de) | Zweiatomiger Rhodiumkomplex und dessen Verwendung als Katalysator zur Hydroformylierung und Hydrierung | |
| DE2703802A1 (de) | Verfahren zur kontinuierlichen herstellung von organischen phosphinen | |
| DE19964298C2 (de) | Verfahren zur Herstellung von substituierten Arylhalophosphinen | |
| DE69931186T2 (de) | Herstellung von wasserlöslichen sulfonierten organophosphor-verbindungen | |
| DE3925217A1 (de) | Verfahren zur herstellung von octadienolen | |
| DE4410746A1 (de) | Verfahren zur Herstellung von Alkadienolen | |
| EP0971868A1 (de) | Verfahren zur herstellung von n-butyraldehyd und/oder n-butanol | |
| DE60202977T2 (de) | Phosphorhaltige Moleküle und Verfahren zur Herstellung und Verwendung derselben, und davon abgeleitete Phosphine und Verfahren zur Herstellung der Phosphine | |
| DE1955933C3 (de) | Verfahren zur Herstellung von 1-Alkoxyoctadienen-(2,7) | |
| DE1909620C3 (de) | Verfahren zur Herstellung von Aldehyden und/oder Alkoholen durch die Oxosynthese | |
| DE3034098C2 (de) | Verfahren zur Herstellung von Alkadienen | |
| DE2902203A1 (de) | Verfahren zur herstellung von tertiaeren 2-carboxiethyl- und carboximethylphosphinen sowie deren salze und verwendung derselben | |
| DE2708590A1 (de) | Verfahren zur herstellung von benzylestern mit pestizidwirkung | |
| DE19859590B4 (de) | Acetale, deren Herstellung sowie deren Verwendung | |
| EP0258693B1 (de) | Verfahren zur Herstellung von tertiären Alkylphosphanen | |
| DE19808260A1 (de) | Verbessertes Verfahren zur Herstellung von Octa-2,7-dienyl-1-amin aus Butadien und Ammoniak, neue Triphenylphosphanmono- und -dimethoxytrinatriumsulfonate und die Verwendung von Triphenylphosphantrimethoxytrinatriumsulfonaten, Triphenylphosphantrimethyltrinatriumsulfonaten und Triphenylphosphantrifluordinatrium- und trinatriumsulfonaten als Liganden zur Herstellung von Palladium-Komplexen | |
| DE3447030A1 (de) | Verfahren zur herstellung von 8- und 9-formyl-tricyclo (5,2,1,0(pfeil hoch)2(pfeil hoch)(pfeil hoch),(pfeil hoch)(pfeil hoch)6(pfeil hoch))-decen-8 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OAP | Request for examination filed | ||
| OD | Request for examination | ||
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |