DE2733107A1 - Hexakisazoverbindungen, verfahren zur herstellung und verwendung - Google Patents
Hexakisazoverbindungen, verfahren zur herstellung und verwendungInfo
- Publication number
- DE2733107A1 DE2733107A1 DE19772733107 DE2733107A DE2733107A1 DE 2733107 A1 DE2733107 A1 DE 2733107A1 DE 19772733107 DE19772733107 DE 19772733107 DE 2733107 A DE2733107 A DE 2733107A DE 2733107 A1 DE2733107 A1 DE 2733107A1
- Authority
- DE
- Germany
- Prior art keywords
- compound
- mixture
- compounds
- parts
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 150000001875 compounds Chemical class 0.000 title claims description 81
- 238000004519 manufacturing process Methods 0.000 title description 6
- 239000000203 mixture Substances 0.000 claims description 39
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 33
- 238000004043 dyeing Methods 0.000 claims description 18
- 238000002360 preparation method Methods 0.000 claims description 18
- 150000003839 salts Chemical group 0.000 claims description 15
- 239000011734 sodium Substances 0.000 claims description 14
- 229910052739 hydrogen Inorganic materials 0.000 claims description 12
- 239000001257 hydrogen Substances 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 11
- 229920000742 Cotton Polymers 0.000 claims description 9
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims description 9
- 150000001768 cations Chemical class 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- -1 Sulpho groups Chemical group 0.000 claims description 7
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 claims description 6
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 6
- 239000008187 granular material Substances 0.000 claims description 6
- 229910052744 lithium Inorganic materials 0.000 claims description 6
- 159000000000 sodium salts Chemical class 0.000 claims description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 5
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 5
- 239000004202 carbamide Substances 0.000 claims description 5
- 229910052708 sodium Inorganic materials 0.000 claims description 5
- 229910001413 alkali metal ion Inorganic materials 0.000 claims description 4
- 239000007787 solid Substances 0.000 claims description 4
- 239000000758 substrate Substances 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 150000004985 diamines Chemical class 0.000 claims description 3
- 150000002431 hydrogen Chemical class 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 229910017053 inorganic salt Inorganic materials 0.000 claims description 2
- 239000002245 particle Substances 0.000 claims description 2
- 229910001415 sodium ion Inorganic materials 0.000 claims 2
- HBBGRARXTFLTSG-UHFFFAOYSA-N Lithium ion Chemical compound [Li+] HBBGRARXTFLTSG-UHFFFAOYSA-N 0.000 claims 1
- 229910001416 lithium ion Inorganic materials 0.000 claims 1
- 150000002790 naphthalenes Chemical class 0.000 claims 1
- 239000000975 dye Substances 0.000 description 45
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 22
- 239000000243 solution Substances 0.000 description 21
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 18
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 238000005859 coupling reaction Methods 0.000 description 12
- 229910000029 sodium carbonate Inorganic materials 0.000 description 11
- 238000010168 coupling process Methods 0.000 description 9
- 230000008878 coupling Effects 0.000 description 8
- 239000000843 powder Substances 0.000 description 8
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 8
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical class [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 4
- 239000003086 colorant Substances 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 4
- 235000010288 sodium nitrite Nutrition 0.000 description 4
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 229920002678 cellulose Polymers 0.000 description 3
- 239000001913 cellulose Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 229910052979 sodium sulfide Inorganic materials 0.000 description 3
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 3
- REJHVSOVQBJEBF-OWOJBTEDSA-N 5-azaniumyl-2-[(e)-2-(4-azaniumyl-2-sulfonatophenyl)ethenyl]benzenesulfonate Chemical compound OS(=O)(=O)C1=CC(N)=CC=C1\C=C\C1=CC=C(N)C=C1S(O)(=O)=O REJHVSOVQBJEBF-OWOJBTEDSA-N 0.000 description 2
- REJHVSOVQBJEBF-UHFFFAOYSA-N DSD-acid Natural products OS(=O)(=O)C1=CC(N)=CC=C1C=CC1=CC=C(N)C=C1S(O)(=O)=O REJHVSOVQBJEBF-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 125000000129 anionic group Chemical group 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 238000004040 coloring Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 150000008049 diazo compounds Chemical class 0.000 description 2
- 238000006193 diazotization reaction Methods 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- KVBGVZZKJNLNJU-UHFFFAOYSA-N naphthalene-2-sulfonic acid Chemical compound C1=CC=CC2=CC(S(=O)(=O)O)=CC=C21 KVBGVZZKJNLNJU-UHFFFAOYSA-N 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- GIAFURWZWWWBQT-UHFFFAOYSA-N 2-(2-aminoethoxy)ethanol Chemical compound NCCOCCO GIAFURWZWWWBQT-UHFFFAOYSA-N 0.000 description 1
- CWLKGDAVCFYWJK-UHFFFAOYSA-N 3-aminophenol Chemical compound NC1=CC=CC(O)=C1 CWLKGDAVCFYWJK-UHFFFAOYSA-N 0.000 description 1
- 229940018563 3-aminophenol Drugs 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical class [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 235000018185 Betula X alpestris Nutrition 0.000 description 1
- 235000018212 Betula X uliginosa Nutrition 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 238000004026 adhesive bonding Methods 0.000 description 1
- 235000013334 alcoholic beverage Nutrition 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000007857 degradation product Substances 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- 235000015203 fruit juice Nutrition 0.000 description 1
- 239000000976 ink Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- VVNXEADCOVSAER-UHFFFAOYSA-N lithium sodium Chemical compound [Li].[Na] VVNXEADCOVSAER-UHFFFAOYSA-N 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000009938 salting Methods 0.000 description 1
- 238000005185 salting out Methods 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
- 239000011122 softwood Substances 0.000 description 1
- 238000001694 spray drying Methods 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical compound C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-O triethanolammonium Chemical compound OCC[NH+](CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-O 0.000 description 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-O triethylammonium ion Chemical compound CC[NH+](CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-O 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 1
- 239000002351 wastewater Substances 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B35/00—Disazo and polyazo dyes of the type A<-D->B prepared by diazotising and coupling
- C09B35/64—Higher polyazo dyes, e.g. of the types
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B43/00—Preparation of azo dyes from other azo compounds
- C09B43/08—Preparation of azo dyes from other azo compounds by reduction
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Paper (AREA)
- Photoreceptors In Electrophotography (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH983276A CH619477A5 (enExample) | 1976-08-02 | 1976-08-02 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2733107A1 true DE2733107A1 (de) | 1978-02-09 |
Family
ID=4356130
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19772733107 Withdrawn DE2733107A1 (de) | 1976-08-02 | 1977-07-22 | Hexakisazoverbindungen, verfahren zur herstellung und verwendung |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4141889A (enExample) |
| JP (1) | JPS5317639A (enExample) |
| CH (1) | CH619477A5 (enExample) |
| DE (1) | DE2733107A1 (enExample) |
| FR (1) | FR2360635A1 (enExample) |
| GB (1) | GB1567667A (enExample) |
| IT (1) | IT1079387B (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3512836A1 (de) * | 1984-04-10 | 1985-10-24 | Ricoh Co., Ltd., Tokio/Tokyo | Waessrige tinte |
| DE3445225A1 (de) * | 1984-12-12 | 1986-06-19 | Fa. J.S. Staedtler, 8500 Nürnberg | Verwendung eines waessrigen farbstoffkonzentrats und daraus hergestellte aufzeichnungstinte |
| WO1998041581A1 (de) * | 1997-03-18 | 1998-09-24 | Basf Aktiengesellschaft | Oligomere azofarbstoffe |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2745777A1 (de) * | 1977-10-12 | 1979-04-26 | Bayer Ag | Dis- und polyazofarbstofffe |
| US4295889A (en) * | 1978-12-01 | 1981-10-20 | Canon Kabushiki Kaisha | Recording liquid composition |
| DE2910458A1 (de) * | 1979-03-16 | 1980-09-25 | Bayer Ag | Polyazofarbstoffe |
| US4325735A (en) * | 1979-06-22 | 1982-04-20 | Canon Kabushiki Kaisha | Recording liquid composition |
| CH647796A5 (de) * | 1981-05-18 | 1985-02-15 | Ciba Geigy Ag | Verfahren zur herstellung von azo-stilbenfarbstoffen. |
| CH654588A5 (de) * | 1981-12-31 | 1986-02-28 | Sandoz Ag | Metallisierte stilbenazoverbindungen, verfahren zur herstellung und verwendung. |
| US4617381A (en) * | 1984-09-11 | 1986-10-14 | Ciba-Geigy Corporation | Process for the preparation of concentrated stable liquid dye solutions of CI Direct Yellow 11 utilizing an alkanol/water solvent in a desalting procedure |
| JPH0623322B2 (ja) * | 1985-08-01 | 1994-03-30 | オリヱント化学工業株式会社 | 黒色水性インキ組成物 |
| DE4319439C1 (de) * | 1993-06-11 | 1994-06-16 | Freudenberg Carl Fa | Biologisch abbaubare, thermoplastische Polyurethan-Filamente |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2204230A (en) * | 1939-03-29 | 1940-06-11 | Du Pont | Azo dyes |
| US2871230A (en) * | 1954-05-21 | 1959-01-27 | Hoechst Ag | Polyazo-dyestuffs |
| GB1465889A (en) * | 1972-12-21 | 1977-03-02 | Ici Ltd | Trisazo dyes |
| IT1002076B (it) * | 1973-02-07 | 1976-05-20 | Du Pont | Coloranti e procedimento per la loro preparazione |
-
1976
- 1976-08-02 CH CH983276A patent/CH619477A5/de not_active IP Right Cessation
-
1977
- 1977-07-22 DE DE19772733107 patent/DE2733107A1/de not_active Withdrawn
- 1977-07-27 US US05/819,241 patent/US4141889A/en not_active Expired - Lifetime
- 1977-07-27 IT IT50458/77A patent/IT1079387B/it active
- 1977-07-29 GB GB31932/77A patent/GB1567667A/en not_active Expired
- 1977-08-01 JP JP9149777A patent/JPS5317639A/ja active Pending
- 1977-08-02 FR FR7723728A patent/FR2360635A1/fr active Granted
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3512836A1 (de) * | 1984-04-10 | 1985-10-24 | Ricoh Co., Ltd., Tokio/Tokyo | Waessrige tinte |
| DE3445225A1 (de) * | 1984-12-12 | 1986-06-19 | Fa. J.S. Staedtler, 8500 Nürnberg | Verwendung eines waessrigen farbstoffkonzentrats und daraus hergestellte aufzeichnungstinte |
| DE3445225C2 (enExample) * | 1984-12-12 | 1989-03-16 | J. S. Staedtler Gmbh & Co, 8500 Nuernberg, De | |
| WO1998041581A1 (de) * | 1997-03-18 | 1998-09-24 | Basf Aktiengesellschaft | Oligomere azofarbstoffe |
Also Published As
| Publication number | Publication date |
|---|---|
| CH619477A5 (enExample) | 1980-09-30 |
| US4141889A (en) | 1979-02-27 |
| JPS5317639A (en) | 1978-02-17 |
| GB1567667A (en) | 1980-05-21 |
| IT1079387B (it) | 1985-05-08 |
| FR2360635B1 (enExample) | 1981-12-18 |
| FR2360635A1 (fr) | 1978-03-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2915323C2 (enExample) | ||
| DE751343C (de) | Verfahren zur Herstellung von Disazofarbstoffen | |
| EP0357560B1 (de) | Anionische Triazinylamino-Disazofarbstoffe | |
| DE3236238A1 (de) | Metallkomplexe sulfogruppenhaltiger disazoverbindungen, verfahren zur herstellung und verwendung | |
| DE2733107A1 (de) | Hexakisazoverbindungen, verfahren zur herstellung und verwendung | |
| DE2555533C2 (de) | Verfahren zum Färben von Papier | |
| DE19629238B4 (de) | Basische Azoverbindungen, deren Herstellung und Verwendung | |
| DE2206551A1 (de) | Azofarbstoffe, ihre Herstellung und Verwendung | |
| DE60215918T2 (de) | Azofarbstoffe | |
| DE2142947C3 (de) | Wasserlösliche 2-Phenylbenzthiazol-Monoazofarbstoffe und deren Verwendung zum Färben von Papier | |
| CH663614A5 (de) | Basische und/oder kationische gruppen enthaltende heterocyclische verbindungen. | |
| DE2154942A1 (de) | Neue monoazo-reaktivfarbstoffe, ihre verwendung und verfahren zu ihrer herstellung | |
| EP0043792B1 (de) | Färben von Papier | |
| EP0851004B1 (de) | Disazofarbstoffe zum Färben von cellulosehaltigen Materialien | |
| EP0005449B1 (de) | Wasserlösliche Monoazofarbstoffe, ihre Herstellung, konzentrierte wässrige Lösungen, welche die Monoazofarbstoffe enthalten, die Herstellung der Lösungen,die Verwendung der Farbstoffe und konzentrierten Lösungen und damit gefärbte und bedruckte Materialien | |
| EP0262095B1 (de) | Anionische Disazoverbindungen | |
| CH667663A5 (de) | Anionische disazoverbindungen. | |
| DE2541007A1 (de) | Wasserloesliche trisazofarbstoffe, ihre herstellung und verwendung | |
| CH614458A5 (en) | Process for preparing new anionic disazo compounds | |
| DE2103756C3 (de) | Disazofarbstoffe, ihre Herstellung und Verwendung | |
| DE4315031B4 (de) | Basische sulfogruppenhaltige Disazoverbindungen | |
| DE849287C (de) | Verfahren zur Herstellung von Trisazofarbstoffen | |
| CH678431A5 (enExample) | ||
| DE19500203A1 (de) | Kationisch verbrückte Tetrakisazofarbstoffe mit unterschiedlichen Kupplern, ihre Herstellung und Verwendung | |
| DE849736C (de) | Verfahren zur Herstellung direktziehender Azofarbstoffe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8141 | Disposal/no request for examination |