DE2642461A1 - Permanent stabilisierte polymere - Google Patents
Permanent stabilisierte polymereInfo
- Publication number
- DE2642461A1 DE2642461A1 DE19762642461 DE2642461A DE2642461A1 DE 2642461 A1 DE2642461 A1 DE 2642461A1 DE 19762642461 DE19762642461 DE 19762642461 DE 2642461 A DE2642461 A DE 2642461A DE 2642461 A1 DE2642461 A1 DE 2642461A1
- Authority
- DE
- Germany
- Prior art keywords
- group
- carbon atoms
- radical
- hydrogen
- colorless
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 229920000642 polymer Polymers 0.000 title claims description 70
- 125000004432 carbon atom Chemical group C* 0.000 claims description 124
- -1 alkyl radical Chemical class 0.000 claims description 119
- 239000003381 stabilizer Substances 0.000 claims description 115
- 229910052739 hydrogen Inorganic materials 0.000 claims description 59
- 239000001257 hydrogen Substances 0.000 claims description 57
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical group CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 40
- 150000001875 compounds Chemical class 0.000 claims description 37
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 34
- 229910052757 nitrogen Inorganic materials 0.000 claims description 25
- 150000003254 radicals Chemical class 0.000 claims description 22
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 21
- 238000006243 chemical reaction Methods 0.000 claims description 19
- 238000000034 method Methods 0.000 claims description 19
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 19
- 230000000087 stabilizing effect Effects 0.000 claims description 18
- 125000002947 alkylene group Chemical group 0.000 claims description 14
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 14
- 239000011888 foil Substances 0.000 claims description 13
- 125000003545 alkoxy group Chemical group 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 125000000732 arylene group Chemical group 0.000 claims description 10
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 10
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- 150000005840 aryl radicals Chemical class 0.000 claims description 9
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 9
- 238000004519 manufacturing process Methods 0.000 claims description 9
- 239000004814 polyurethane Substances 0.000 claims description 9
- 239000003054 catalyst Substances 0.000 claims description 8
- 229920001577 copolymer Chemical class 0.000 claims description 8
- 229920002635 polyurethane Polymers 0.000 claims description 8
- 230000002378 acidificating effect Effects 0.000 claims description 6
- 229910052799 carbon Inorganic materials 0.000 claims description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 6
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 4
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical compound C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 claims description 4
- 239000004952 Polyamide Substances 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 239000005038 ethylene vinyl acetate Substances 0.000 claims description 2
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 claims description 2
- 229920002647 polyamide Polymers 0.000 claims description 2
- 229920000515 polycarbonate Polymers 0.000 claims description 2
- 239000004417 polycarbonate Substances 0.000 claims description 2
- 239000000243 solution Substances 0.000 description 76
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 52
- 239000010408 film Substances 0.000 description 43
- 150000002431 hydrogen Chemical class 0.000 description 35
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical group OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 23
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 22
- 239000000203 mixture Substances 0.000 description 22
- 238000000605 extraction Methods 0.000 description 21
- 230000006641 stabilisation Effects 0.000 description 21
- 238000011105 stabilization Methods 0.000 description 21
- 238000009835 boiling Methods 0.000 description 18
- 239000012948 isocyanate Substances 0.000 description 18
- 125000001261 isocyanato group Chemical group *N=C=O 0.000 description 16
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 15
- 238000002360 preparation method Methods 0.000 description 15
- 229920001971 elastomer Polymers 0.000 description 14
- 239000000806 elastomer Substances 0.000 description 14
- 238000001035 drying Methods 0.000 description 13
- 239000007787 solid Substances 0.000 description 13
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- 238000007792 addition Methods 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- 238000002844 melting Methods 0.000 description 12
- 230000008018 melting Effects 0.000 description 12
- 239000002904 solvent Substances 0.000 description 12
- 239000000654 additive Substances 0.000 description 11
- HTVHSOYSKFBUGY-UHFFFAOYSA-N isocyanato(methoxy)methane Chemical compound COCN=C=O HTVHSOYSKFBUGY-UHFFFAOYSA-N 0.000 description 11
- 239000000126 substance Substances 0.000 description 11
- 238000012360 testing method Methods 0.000 description 11
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 9
- XITRBUPOXXBIJN-UHFFFAOYSA-N bis(2,2,6,6-tetramethylpiperidin-4-yl) decanedioate Chemical compound C1C(C)(C)NC(C)(C)CC1OC(=O)CCCCCCCCC(=O)OC1CC(C)(C)NC(C)(C)C1 XITRBUPOXXBIJN-UHFFFAOYSA-N 0.000 description 9
- 238000002845 discoloration Methods 0.000 description 9
- 239000000975 dye Substances 0.000 description 9
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 9
- 229920000728 polyester Polymers 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 8
- 230000000694 effects Effects 0.000 description 8
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 7
- MCSXGCZMEPXKIW-UHFFFAOYSA-N 3-hydroxy-4-[(4-methyl-2-nitrophenyl)diazenyl]-N-(3-nitrophenyl)naphthalene-2-carboxamide Chemical compound Cc1ccc(N=Nc2c(O)c(cc3ccccc23)C(=O)Nc2cccc(c2)[N+]([O-])=O)c(c1)[N+]([O-])=O MCSXGCZMEPXKIW-UHFFFAOYSA-N 0.000 description 7
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 7
- 238000005299 abrasion Methods 0.000 description 7
- 239000004202 carbamide Substances 0.000 description 7
- 238000000576 coating method Methods 0.000 description 7
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 7
- 238000004043 dyeing Methods 0.000 description 7
- 238000002474 experimental method Methods 0.000 description 7
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 7
- 230000002829 reductive effect Effects 0.000 description 7
- 238000009987 spinning Methods 0.000 description 7
- 229950011008 tetrachloroethylene Drugs 0.000 description 7
- 238000011282 treatment Methods 0.000 description 7
- UPMLOUAZCHDJJD-UHFFFAOYSA-N 4,4'-Diphenylmethane Diisocyanate Chemical compound C1=CC(N=C=O)=CC=C1CC1=CC=C(N=C=O)C=C1 UPMLOUAZCHDJJD-UHFFFAOYSA-N 0.000 description 6
- 239000006096 absorbing agent Substances 0.000 description 6
- 239000000980 acid dye Substances 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 230000000052 comparative effect Effects 0.000 description 6
- 239000013078 crystal Substances 0.000 description 6
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 6
- XSQUKJJJFZCRTK-UHFFFAOYSA-N urea group Chemical group NC(=O)N XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 6
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 6
- UWSMKYBKUPAEJQ-UHFFFAOYSA-N 5-Chloro-2-(3,5-di-tert-butyl-2-hydroxyphenyl)-2H-benzotriazole Chemical compound CC(C)(C)C1=CC(C(C)(C)C)=CC(N2N=C3C=C(Cl)C=CC3=N2)=C1O UWSMKYBKUPAEJQ-UHFFFAOYSA-N 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 230000000996 additive effect Effects 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- ARZLUCYKIWYSHR-UHFFFAOYSA-N hydroxymethoxymethanol Chemical group OCOCO ARZLUCYKIWYSHR-UHFFFAOYSA-N 0.000 description 5
- 239000003208 petroleum Substances 0.000 description 5
- 229920003225 polyurethane elastomer Polymers 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- 210000002268 wool Anatomy 0.000 description 5
- YAXWOADCWUUUNX-UHFFFAOYSA-N 1,2,2,3-tetramethylpiperidine Chemical class CC1CCCN(C)C1(C)C YAXWOADCWUUUNX-UHFFFAOYSA-N 0.000 description 4
- RKMGAJGJIURJSJ-UHFFFAOYSA-N 2,2,6,6-Tetramethylpiperidine Substances CC1(C)CCCC(C)(C)N1 RKMGAJGJIURJSJ-UHFFFAOYSA-N 0.000 description 4
- 239000004970 Chain extender Substances 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 229910010413 TiO 2 Inorganic materials 0.000 description 4
- BGYHLZZASRKEJE-UHFFFAOYSA-N [3-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]-2,2-bis[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxymethyl]propyl] 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate Chemical compound CC(C)(C)C1=C(O)C(C(C)(C)C)=CC(CCC(=O)OCC(COC(=O)CCC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)(COC(=O)CCC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)COC(=O)CCC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)=C1 BGYHLZZASRKEJE-UHFFFAOYSA-N 0.000 description 4
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 4
- 125000001931 aliphatic group Chemical group 0.000 description 4
- 235000013877 carbamide Nutrition 0.000 description 4
- 238000005520 cutting process Methods 0.000 description 4
- XLJMAIOERFSOGZ-UHFFFAOYSA-N cyanic acid Chemical compound OC#N XLJMAIOERFSOGZ-UHFFFAOYSA-N 0.000 description 4
- 150000004985 diamines Chemical class 0.000 description 4
- 239000000835 fiber Substances 0.000 description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 4
- 229920005989 resin Polymers 0.000 description 4
- 239000011347 resin Substances 0.000 description 4
- 238000007127 saponification reaction Methods 0.000 description 4
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 4
- DUIOPKIIICUYRZ-UHFFFAOYSA-N semicarbazide Chemical compound NNC(N)=O DUIOPKIIICUYRZ-UHFFFAOYSA-N 0.000 description 4
- NQRYJNQNLNOLGT-UHFFFAOYSA-N tetrahydropyridine hydrochloride Natural products C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 4
- CGXOAAMIQPDTPE-UHFFFAOYSA-N 1,2,2,6,6-pentamethylpiperidin-4-amine Chemical compound CN1C(C)(C)CC(N)CC1(C)C CGXOAAMIQPDTPE-UHFFFAOYSA-N 0.000 description 3
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000001361 adipic acid Substances 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 238000004040 coloring Methods 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 238000004132 cross linking Methods 0.000 description 3
- ROORDVPLFPIABK-UHFFFAOYSA-N diphenyl carbonate Chemical compound C=1C=CC=CC=1OC(=O)OC1=CC=CC=C1 ROORDVPLFPIABK-UHFFFAOYSA-N 0.000 description 3
- 238000000578 dry spinning Methods 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 description 3
- 239000002649 leather substitute Substances 0.000 description 3
- 239000004611 light stabiliser Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 229920003226 polyurethane urea Polymers 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- 238000012545 processing Methods 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 238000010186 staining Methods 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 230000002195 synergetic effect Effects 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- XKQMKMVTDKYWOX-UHFFFAOYSA-N 1-[2-hydroxypropyl(methyl)amino]propan-2-ol Chemical compound CC(O)CN(C)CC(C)O XKQMKMVTDKYWOX-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- VCYBSQKYFOVMPG-UHFFFAOYSA-N 2-aminopropanehydrazide Chemical compound CC(N)C(=O)NN VCYBSQKYFOVMPG-UHFFFAOYSA-N 0.000 description 2
- XOUQAVYLRNOXDO-UHFFFAOYSA-N 2-tert-butyl-5-methylphenol Chemical compound CC1=CC=C(C(C)(C)C)C(O)=C1 XOUQAVYLRNOXDO-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- 241000282376 Panthera tigris Species 0.000 description 2
- 239000004721 Polyphenylene oxide Substances 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- 239000012963 UV stabilizer Substances 0.000 description 2
- 235000011037 adipic acid Nutrition 0.000 description 2
- 150000001414 amino alcohols Chemical class 0.000 description 2
- 125000001204 arachidyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 2
- XEVRDFDBXJMZFG-UHFFFAOYSA-N carbonyl dihydrazine Chemical compound NNC(=O)NN XEVRDFDBXJMZFG-UHFFFAOYSA-N 0.000 description 2
- 230000015556 catabolic process Effects 0.000 description 2
- 230000015271 coagulation Effects 0.000 description 2
- 238000005345 coagulation Methods 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000006731 degradation reaction Methods 0.000 description 2
- 125000005442 diisocyanate group Chemical group 0.000 description 2
- 229940113088 dimethylacetamide Drugs 0.000 description 2
- 238000005108 dry cleaning Methods 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- LBKPGNUOUPTQKA-UHFFFAOYSA-N ethyl n-phenylcarbamate Chemical compound CCOC(=O)NC1=CC=CC=C1 LBKPGNUOUPTQKA-UHFFFAOYSA-N 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000005842 heteroatom Chemical group 0.000 description 2
- RRAMGCGOFNQTLD-UHFFFAOYSA-N hexamethylene diisocyanate Chemical compound O=C=NCCCCCCN=C=O RRAMGCGOFNQTLD-UHFFFAOYSA-N 0.000 description 2
- XXMIOPMDWAUFGU-UHFFFAOYSA-N hexane-1,6-diol Chemical compound OCCCCCCO XXMIOPMDWAUFGU-UHFFFAOYSA-N 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- 238000000465 moulding Methods 0.000 description 2
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- 229920001281 polyalkylene Polymers 0.000 description 2
- 229920000570 polyether Polymers 0.000 description 2
- 239000011527 polyurethane coating Substances 0.000 description 2
- 239000002243 precursor Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 229920001059 synthetic polymer Polymers 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- 235000012222 talc Nutrition 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N titanium dioxide Inorganic materials O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- DVKJHBMWWAPEIU-UHFFFAOYSA-N toluene 2,4-diisocyanate Chemical compound CC1=CC=C(N=C=O)C=C1N=C=O DVKJHBMWWAPEIU-UHFFFAOYSA-N 0.000 description 2
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 2
- 230000001960 triggered effect Effects 0.000 description 2
- HVLLSGMXQDNUAL-UHFFFAOYSA-N triphenyl phosphite Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)OC1=CC=CC=C1 HVLLSGMXQDNUAL-UHFFFAOYSA-N 0.000 description 2
- 239000000052 vinegar Substances 0.000 description 2
- 235000021419 vinegar Nutrition 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 238000002166 wet spinning Methods 0.000 description 2
- RLXQIDNEIUKWPC-UHFFFAOYSA-N (2,2,6,6-tetramethylpiperidin-4-yl)urea Chemical compound CC1(C)CC(NC(N)=O)CC(C)(C)N1 RLXQIDNEIUKWPC-UHFFFAOYSA-N 0.000 description 1
- KEEKMOIRJUWKNK-CABZTGNLSA-N (2S)-2-[[2-[(4R)-4-(difluoromethyl)-2-oxo-1,3-thiazolidin-3-yl]-5,6-dihydroimidazo[1,2-d][1,4]benzoxazepin-9-yl]amino]propanamide Chemical compound FC([C@H]1N(C(SC1)=O)C=1N=C2N(CCOC3=C2C=CC(=C3)N[C@H](C(=O)N)C)C=1)F KEEKMOIRJUWKNK-CABZTGNLSA-N 0.000 description 1
- XVCKCCODMHCXJD-UHFFFAOYSA-N (4-aminophenyl)urea Chemical compound NC(=O)NC1=CC=C(N)C=C1 XVCKCCODMHCXJD-UHFFFAOYSA-N 0.000 description 1
- UCTWMZQNUQWSLP-VIFPVBQESA-N (R)-adrenaline Chemical compound CNC[C@H](O)C1=CC=C(O)C(O)=C1 UCTWMZQNUQWSLP-VIFPVBQESA-N 0.000 description 1
- XULIXFLCVXWHRF-UHFFFAOYSA-N 1,2,2,6,6-pentamethylpiperidine Chemical compound CN1C(C)(C)CCCC1(C)C XULIXFLCVXWHRF-UHFFFAOYSA-N 0.000 description 1
- RTTZISZSHSCFRH-UHFFFAOYSA-N 1,3-bis(isocyanatomethyl)benzene Chemical compound O=C=NCC1=CC=CC(CN=C=O)=C1 RTTZISZSHSCFRH-UHFFFAOYSA-N 0.000 description 1
- MOVMIHLYYQMNSS-UHFFFAOYSA-N 1-(2-aminoethyl)-1-methylurea Chemical compound NC(=O)N(C)CCN MOVMIHLYYQMNSS-UHFFFAOYSA-N 0.000 description 1
- HPCQLWPKJHHCKH-UHFFFAOYSA-N 1-(hydroxymethyl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)urea Chemical compound CC1(C)CC(N(CO)C(N)=O)CC(C)(C)N1 HPCQLWPKJHHCKH-UHFFFAOYSA-N 0.000 description 1
- CTKXYQMUGQCAQH-UHFFFAOYSA-N 1-ethyl-2,2,6,6-tetramethylpiperidin-4-amine Chemical compound CCN1C(C)(C)CC(N)CC1(C)C CTKXYQMUGQCAQH-UHFFFAOYSA-N 0.000 description 1
- KGRVJHAUYBGFFP-UHFFFAOYSA-N 2,2'-Methylenebis(4-methyl-6-tert-butylphenol) Chemical compound CC(C)(C)C1=CC(C)=CC(CC=2C(=C(C=C(C)C=2)C(C)(C)C)O)=C1O KGRVJHAUYBGFFP-UHFFFAOYSA-N 0.000 description 1
- XRMDCWJNPDVAFI-UHFFFAOYSA-N 2,2,6,6-tetramethyl-1-oxopiperidin-1-ium-4-ol Chemical compound CC1(C)CC(O)CC(C)(C)[N+]1=O XRMDCWJNPDVAFI-UHFFFAOYSA-N 0.000 description 1
- VDVUCLWJZJHFAV-UHFFFAOYSA-N 2,2,6,6-tetramethylpiperidin-4-ol Chemical compound CC1(C)CC(O)CC(C)(C)N1 VDVUCLWJZJHFAV-UHFFFAOYSA-N 0.000 description 1
- QPYKYDBKQYZEKG-UHFFFAOYSA-N 2,2-dimethylpropane-1,1-diol Chemical compound CC(C)(C)C(O)O QPYKYDBKQYZEKG-UHFFFAOYSA-N 0.000 description 1
- FJGQBLRYBUAASW-UHFFFAOYSA-N 2-(benzotriazol-2-yl)phenol Chemical compound OC1=CC=CC=C1N1N=C2C=CC=CC2=N1 FJGQBLRYBUAASW-UHFFFAOYSA-N 0.000 description 1
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 1
- FEXBEKLLSUWSIM-UHFFFAOYSA-N 2-Butyl-4-methylphenol Chemical compound CCCCC1=CC(C)=CC=C1O FEXBEKLLSUWSIM-UHFFFAOYSA-N 0.000 description 1
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 1
- IJVRPNIWWODHHA-UHFFFAOYSA-N 2-cyanoprop-2-enoic acid Chemical class OC(=O)C(=C)C#N IJVRPNIWWODHHA-UHFFFAOYSA-N 0.000 description 1
- AKNMPWVTPUHKCG-UHFFFAOYSA-N 2-cyclohexyl-6-[(3-cyclohexyl-2-hydroxy-5-methylphenyl)methyl]-4-methylphenol Chemical compound OC=1C(C2CCCCC2)=CC(C)=CC=1CC(C=1O)=CC(C)=CC=1C1CCCCC1 AKNMPWVTPUHKCG-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- XWQVFDPBNJTKQY-UHFFFAOYSA-N 3-(3-amino-1,2,2,6,6-pentamethylpiperidin-4-yl)propanenitrile Chemical compound CN1C(C)(C)CC(CCC#N)C(N)C1(C)C XWQVFDPBNJTKQY-UHFFFAOYSA-N 0.000 description 1
- RNLHGQLZWXBQNY-UHFFFAOYSA-N 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine Chemical compound CC1(C)CC(N)CC(C)(CN)C1 RNLHGQLZWXBQNY-UHFFFAOYSA-N 0.000 description 1
- PRWJPWSKLXYEPD-UHFFFAOYSA-N 4-[4,4-bis(5-tert-butyl-4-hydroxy-2-methylphenyl)butan-2-yl]-2-tert-butyl-5-methylphenol Chemical compound C=1C(C(C)(C)C)=C(O)C=C(C)C=1C(C)CC(C=1C(=CC(O)=C(C=1)C(C)(C)C)C)C1=CC(C(C)(C)C)=C(O)C=C1C PRWJPWSKLXYEPD-UHFFFAOYSA-N 0.000 description 1
- NGKNMHFWZMHABQ-UHFFFAOYSA-N 4-chloro-2h-benzotriazole Chemical compound ClC1=CC=CC2=NNN=C12 NGKNMHFWZMHABQ-UHFFFAOYSA-N 0.000 description 1
- 125000004920 4-methyl-2-pentyl group Chemical group CC(CC(C)*)C 0.000 description 1
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 1
- VIMBLARLVJZNMV-UHFFFAOYSA-N COCN(CCCCCCNC(N)=O)COC Chemical compound COCN(CCCCCCNC(N)=O)COC VIMBLARLVJZNMV-UHFFFAOYSA-N 0.000 description 1
- GCFZACQOBPIPPK-UHFFFAOYSA-N COCN(CCCCN)C(N)=O Chemical compound COCN(CCCCN)C(N)=O GCFZACQOBPIPPK-UHFFFAOYSA-N 0.000 description 1
- NCEOGYXUTADQKQ-UHFFFAOYSA-N COCN(CCN)C(N)=O Chemical compound COCN(CCN)C(N)=O NCEOGYXUTADQKQ-UHFFFAOYSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical class NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 101150065749 Churc1 gene Proteins 0.000 description 1
- 229920001634 Copolyester Polymers 0.000 description 1
- 239000004971 Cross linker Substances 0.000 description 1
- GHKOFFNLGXMVNJ-UHFFFAOYSA-N Didodecyl thiobispropanoate Chemical compound CCCCCCCCCCCCOC(=O)CCSCCC(=O)OCCCCCCCCCCCC GHKOFFNLGXMVNJ-UHFFFAOYSA-N 0.000 description 1
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 1
- 239000003508 Dilauryl thiodipropionate Substances 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 238000001321 HNCO Methods 0.000 description 1
- 239000005057 Hexamethylene diisocyanate Substances 0.000 description 1
- OWIKHYCFFJSOEH-UHFFFAOYSA-N Isocyanic acid Chemical compound N=C=O OWIKHYCFFJSOEH-UHFFFAOYSA-N 0.000 description 1
- 239000005058 Isophorone diisocyanate Substances 0.000 description 1
- 240000005265 Lupinus mutabilis Species 0.000 description 1
- 235000008755 Lupinus mutabilis Nutrition 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- YHTIHZIGVHXTRV-UHFFFAOYSA-N NC(=O)N(C)CC1=CC=C(CN)C=C1 Chemical compound NC(=O)N(C)CC1=CC=C(CN)C=C1 YHTIHZIGVHXTRV-UHFFFAOYSA-N 0.000 description 1
- SJEYSFABYSGQBG-UHFFFAOYSA-M Patent blue Chemical compound [Na+].C1=CC(N(CC)CC)=CC=C1C(C=1C(=CC(=CC=1)S([O-])(=O)=O)S([O-])(=O)=O)=C1C=CC(=[N+](CC)CC)C=C1 SJEYSFABYSGQBG-UHFFFAOYSA-M 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 229930182556 Polyacetal Natural products 0.000 description 1
- 229920005830 Polyurethane Foam Polymers 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 102100038239 Protein Churchill Human genes 0.000 description 1
- 206010037867 Rash macular Diseases 0.000 description 1
- 235000019095 Sechium edule Nutrition 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- WTTFHNWOGBHKOT-UHFFFAOYSA-N [(3-hydrazinyl-3-oxopropyl)amino]urea Chemical compound NNC(=O)CCNNC(N)=O WTTFHNWOGBHKOT-UHFFFAOYSA-N 0.000 description 1
- BDYUTQVUAZPVEI-UHFFFAOYSA-N [(4-hydroxy-2,2,6,6-tetramethylpiperidine-4-carbonyl)-(methoxymethyl)amino]urea Chemical compound COCN(NC(N)=O)C(=O)C1(O)CC(C)(C)NC(C)(C)C1 BDYUTQVUAZPVEI-UHFFFAOYSA-N 0.000 description 1
- VAORHVLSVHUMMT-UHFFFAOYSA-N [1,3-bis(3,5-ditert-butyl-4-hydroxyphenyl)-2,2-bis[(3,5-ditert-butyl-4-hydroxyphenyl)-propanoyloxymethyl]-3-propanoyloxypropyl] propanoate Chemical compound C=1C(C(C)(C)C)=C(O)C(C(C)(C)C)=CC=1C(OC(=O)CC)C(C(OC(=O)CC)C=1C=C(C(O)=C(C=1)C(C)(C)C)C(C)(C)C)(C(OC(=O)CC)C=1C=C(C(O)=C(C=1)C(C)(C)C)C(C)(C)C)C(OC(=O)CC)C1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 VAORHVLSVHUMMT-UHFFFAOYSA-N 0.000 description 1
- BWVAOONFBYYRHY-UHFFFAOYSA-N [4-(hydroxymethyl)phenyl]methanol Chemical class OCC1=CC=C(CO)C=C1 BWVAOONFBYYRHY-UHFFFAOYSA-N 0.000 description 1
- YUDRVAHLXDBKSR-UHFFFAOYSA-N [CH]1CCCCC1 Chemical compound [CH]1CCCCC1 YUDRVAHLXDBKSR-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000003926 acrylamides Chemical class 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 238000004873 anchoring Methods 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- IUKQLMGVFMDQDP-UHFFFAOYSA-N azane;piperidine Chemical compound N.C1CCNCC1 IUKQLMGVFMDQDP-UHFFFAOYSA-N 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 1
- 239000012964 benzotriazole Substances 0.000 description 1
- 230000001588 bifunctional effect Effects 0.000 description 1
- CDQSJQSWAWPGKG-UHFFFAOYSA-N butane-1,1-diol Chemical compound CCCC(O)O CDQSJQSWAWPGKG-UHFFFAOYSA-N 0.000 description 1
- 235000010354 butylated hydroxytoluene Nutrition 0.000 description 1
- LSORXHREUHEHMA-UHFFFAOYSA-N carbonic acid;3-methoxypropanenitrile Chemical compound OC(O)=O.COCCC#N LSORXHREUHEHMA-UHFFFAOYSA-N 0.000 description 1
- 238000012512 characterization method Methods 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000013329 compounding Methods 0.000 description 1
- 238000010411 cooking Methods 0.000 description 1
- 238000005336 cracking Methods 0.000 description 1
- DMSZORWOGDLWGN-UHFFFAOYSA-N ctk1a3526 Chemical compound NP(N)(N)=O DMSZORWOGDLWGN-UHFFFAOYSA-N 0.000 description 1
- VKIRRGRTJUUZHS-UHFFFAOYSA-N cyclohexane-1,4-diamine Chemical compound NC1CCC(N)CC1 VKIRRGRTJUUZHS-UHFFFAOYSA-N 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- KORSJDCBLAPZEQ-UHFFFAOYSA-N dicyclohexylmethane-4,4'-diisocyanate Chemical compound C1CC(N=C=O)CCC1CC1CCC(N=C=O)CC1 KORSJDCBLAPZEQ-UHFFFAOYSA-N 0.000 description 1
- 235000019304 dilauryl thiodipropionate Nutrition 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- MCPKSFINULVDNX-UHFFFAOYSA-N drometrizole Chemical compound CC1=CC=C(O)C(N2N=C3C=CC=CC3=N2)=C1 MCPKSFINULVDNX-UHFFFAOYSA-N 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- SWRGUMCEJHQWEE-UHFFFAOYSA-N ethanedihydrazide Chemical compound NNC(=O)C(=O)NN SWRGUMCEJHQWEE-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000003925 fat Substances 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000009998 heat setting Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- VUGKRGOUQYGVIR-UHFFFAOYSA-N hydrazinylurea Chemical class NNNC(N)=O VUGKRGOUQYGVIR-UHFFFAOYSA-N 0.000 description 1
- 125000005462 imide group Chemical group 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- NIMLQBUJDJZYEJ-UHFFFAOYSA-N isophorone diisocyanate Chemical compound CC1(C)CC(N=C=O)CC(C)(CN=C=O)C1 NIMLQBUJDJZYEJ-UHFFFAOYSA-N 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 235000021190 leftovers Nutrition 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- HJYNGRZUBXMFGB-UHFFFAOYSA-N methoxymethylurea Chemical class COCNC(N)=O HJYNGRZUBXMFGB-UHFFFAOYSA-N 0.000 description 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 1
- XJPIXRZHLVHSLM-UHFFFAOYSA-N methyl 4-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylate Chemical compound COC(=O)C1(O)CC(C)(C)NC(C)(C)C1 XJPIXRZHLVHSLM-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 238000003541 multi-stage reaction Methods 0.000 description 1
- SSDCNKUOPGRABO-UHFFFAOYSA-N n-(1,2,2,6,6-pentamethylpiperidin-4-yl)benzamide Chemical compound C1C(C)(C)N(C)C(C)(C)CC1NC(=O)C1=CC=CC=C1 SSDCNKUOPGRABO-UHFFFAOYSA-N 0.000 description 1
- MRTIVNIBNVMDEB-UHFFFAOYSA-N n-(1-ethyl-2,2,6,6-tetramethylpiperidin-4-yl)benzamide Chemical compound C1C(C)(C)N(CC)C(C)(C)CC1NC(=O)C1=CC=CC=C1 MRTIVNIBNVMDEB-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- QUAMTGJKVDWJEQ-UHFFFAOYSA-N octabenzone Chemical compound OC1=CC(OCCCCCCCC)=CC=C1C(=O)C1=CC=CC=C1 QUAMTGJKVDWJEQ-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229920006280 packaging film Polymers 0.000 description 1
- 239000012785 packaging film Substances 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 229940031826 phenolate Drugs 0.000 description 1
- 239000002530 phenolic antioxidant Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 230000019612 pigmentation Effects 0.000 description 1
- LWMPFIOTEAXAGV-UHFFFAOYSA-N piperidin-1-amine Chemical compound NN1CCCCC1 LWMPFIOTEAXAGV-UHFFFAOYSA-N 0.000 description 1
- BCIIMDOZSUCSEN-UHFFFAOYSA-N piperidin-4-amine Chemical class NC1CCNCC1 BCIIMDOZSUCSEN-UHFFFAOYSA-N 0.000 description 1
- HDOWRFHMPULYOA-UHFFFAOYSA-N piperidin-4-ol Chemical class OC1CCNCC1 HDOWRFHMPULYOA-UHFFFAOYSA-N 0.000 description 1
- 150000003053 piperidines Chemical class 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 239000005056 polyisocyanate Substances 0.000 description 1
- 229920001228 polyisocyanate Polymers 0.000 description 1
- 229920006254 polymer film Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 229920006324 polyoxymethylene Polymers 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 239000011496 polyurethane foam Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- GKKCIDNWFBPDBW-UHFFFAOYSA-M potassium cyanate Chemical compound [K]OC#N GKKCIDNWFBPDBW-UHFFFAOYSA-M 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- AOHJOMMDDJHIJH-UHFFFAOYSA-N propylenediamine Chemical compound CC(N)CN AOHJOMMDDJHIJH-UHFFFAOYSA-N 0.000 description 1
- 239000003223 protective agent Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000001044 red dye Substances 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 238000012216 screening Methods 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 150000003384 small molecules Chemical class 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 230000037072 sun protection Effects 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000010409 thin film Substances 0.000 description 1
- MGMXGCZJYUCMGY-UHFFFAOYSA-N tris(4-nonylphenyl) phosphite Chemical compound C1=CC(CCCCCCCCC)=CC=C1OP(OC=1C=CC(CCCCCCCCC)=CC=1)OC1=CC=C(CCCCCCCCC)C=C1 MGMXGCZJYUCMGY-UHFFFAOYSA-N 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- PAPBSGBWRJIAAV-UHFFFAOYSA-N ε-Caprolactone Chemical compound O=C1CCCCCO1 PAPBSGBWRJIAAV-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/34—Heterocyclic compounds having nitrogen in the ring
- C08K5/3412—Heterocyclic compounds having nitrogen in the ring having one nitrogen atom in the ring
- C08K5/3432—Six-membered rings
- C08K5/3435—Piperidines
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F8/00—Chemical modification by after-treatment
- C08F8/30—Introducing nitrogen atoms or nitrogen-containing groups
- C08F8/32—Introducing nitrogen atoms or nitrogen-containing groups by reaction with amines
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/83—Chemically modified polymers
- C08G18/833—Chemically modified polymers by nitrogen containing compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- General Chemical & Material Sciences (AREA)
- Hydrogenated Pyridines (AREA)
- Other Resins Obtained By Reactions Not Involving Carbon-To-Carbon Unsaturated Bonds (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19762642461 DE2642461A1 (de) | 1976-09-21 | 1976-09-21 | Permanent stabilisierte polymere |
| NL7710263A NL7710263A (nl) | 1976-09-21 | 1977-09-19 | Permanent gestabiliseerde polymeren. |
| CA286,985A CA1109587A (en) | 1976-09-21 | 1977-09-19 | Permanently stabilized polymers |
| US05/834,764 US4153596A (en) | 1976-09-21 | 1977-09-19 | Permanently stabilized polymers produced by after-treatment with piperidine compounds |
| GB39105/77A GB1587436A (en) | 1976-09-21 | 1977-09-20 | Permanently stabilized polymers |
| JP11278177A JPS5339385A (en) | 1976-09-21 | 1977-09-21 | Permanently stabilized polymer |
| FR7728493A FR2364943A1 (fr) | 1976-09-21 | 1977-09-21 | Polymeres stabilises de facon permanente |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19762642461 DE2642461A1 (de) | 1976-09-21 | 1976-09-21 | Permanent stabilisierte polymere |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2642461A1 true DE2642461A1 (de) | 1978-03-30 |
Family
ID=5988461
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19762642461 Withdrawn DE2642461A1 (de) | 1976-09-21 | 1976-09-21 | Permanent stabilisierte polymere |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4153596A (enExample) |
| JP (1) | JPS5339385A (enExample) |
| CA (1) | CA1109587A (enExample) |
| DE (1) | DE2642461A1 (enExample) |
| FR (1) | FR2364943A1 (enExample) |
| GB (1) | GB1587436A (enExample) |
| NL (1) | NL7710263A (enExample) |
Cited By (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0008084A1 (de) * | 1978-08-05 | 1980-02-20 | Hoechst Aktiengesellschaft | Neue Harnstoffderivate, ihre Herstellung und ihre Verwendung als Lichtschutzmittel für Polymere |
| EP0022079A1 (de) * | 1979-06-21 | 1981-01-07 | Ciba-Geigy Ag | Polyalkylpiperidyl-harnstoffe, ihre Verwendung als Stabilisatoren und die damit stabilisierten Polymeren |
| DE3408948A1 (de) * | 1983-03-21 | 1984-09-27 | Sandoz-Patent-GmbH, 7850 Lörrach | Neue 4-amino-polyalkylpiperidinverbindungen |
| DE3630762A1 (de) * | 1985-09-13 | 1987-03-19 | Sandoz Ag | 2,2,6,6-tetraalkylpiperidin-oxalsaeureamide |
| US5814107A (en) * | 1996-07-31 | 1998-09-29 | Basf Corporation | Photochemically stabilized polyamide compositions |
| US6136433A (en) * | 1997-05-01 | 2000-10-24 | Basf Corporation | Spinning and stability of solution-dyed nylon fibers |
| WO2002094921A1 (de) * | 2001-05-22 | 2002-11-28 | Basf Aktiengesellschaft | Amidpolymermasse |
| US6492518B1 (en) | 2001-10-30 | 2002-12-10 | Council Of Scientific And Industrial Research | Tinuvin P-hindred amine light stabilizer and derivatives thereof |
| WO2003035642A1 (en) * | 2001-10-23 | 2003-05-01 | Council Of Scientific And Industrial Research | Tinuvin p-hindred amine light stabilizer and derivatives thereof, and a process for the preparation thereof |
| EP2202260A1 (de) | 2008-12-23 | 2010-06-30 | Ems-Patent Ag | Inhärent stabilisiertes Polyamid-Elastomer sowie Verfahren zu dessen Herstellung |
Families Citing this family (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH626109A5 (enExample) * | 1976-05-11 | 1981-10-30 | Ciba Geigy Ag | |
| DE2862332D1 (en) | 1977-12-30 | 1983-11-10 | Ciba Geigy Ag | Stabilisation of heat-curable metallic enamel paints against the action of light, humidity and oxygen by the addition of polyalkylpiperidine derivatives |
| US4265805A (en) * | 1980-04-01 | 1981-05-05 | American Cyanamid Company | Polymeric light stabilizers containing tetralkyl piperidine moieties |
| JPS5832642A (ja) * | 1981-08-20 | 1983-02-25 | Adeka Argus Chem Co Ltd | 安定化された合成樹脂組成物 |
| US4895901A (en) * | 1987-05-28 | 1990-01-23 | Ferro Corporation | Polymetic hindered amine light stabilizers |
| US4804717A (en) * | 1987-05-28 | 1989-02-14 | Ferro Corporation | Polymeric hindered amine light stabilizers |
| US4824884A (en) * | 1987-08-12 | 1989-04-25 | Pennwalt Corporation | Cyclic anhydride derivatives of hydrazide functionalized hindered amine light stabilizers |
| US5300545A (en) * | 1987-08-12 | 1994-04-05 | Elf Atochem North America, Inc. | Process for stabilizing polymer compositions against heat or light effects |
| US4983738A (en) * | 1987-08-12 | 1991-01-08 | Atochem North America, Inc. | Reactive hindered amine light stabilizers |
| US5214147A (en) * | 1987-08-12 | 1993-05-25 | Elf Atochem North America, Inc. | Process for preparing reactive hindered amine light stabilizers |
| US4981915A (en) * | 1987-08-12 | 1991-01-01 | Atochem North America, Inc. | Multipurpose polymer bound stabilizers |
| US5101033A (en) * | 1987-08-12 | 1992-03-31 | Atochem North America, Inc. | Process for preparing reactive hindered amine light stabilizers |
| US4863999A (en) * | 1987-08-12 | 1989-09-05 | Pennwalt Corporation | Multipurpose polymer bound stabilizers |
| US5096974A (en) * | 1987-08-12 | 1992-03-17 | Atochem North America, Inc. | Process for preparing multipurpose polymer bound stabilizers and polymer bound stabilizer produced thereby |
| US4882412A (en) * | 1987-11-30 | 1989-11-21 | Eastman Kodak Company | Polyester polymer containing the residue of the UV absorbing benzopyran compound and shaped articles produced therefrom |
| US4892923A (en) * | 1988-02-22 | 1990-01-09 | Eastman Kodak Company | Polyester compositions containing the residue of a naphthopyran compound and shaped articles produced therefrom |
| KR890014686A (ko) * | 1988-03-08 | 1989-10-25 | 나가이 야다로 | 열가소성 메타크릴이미드 그룹-함유 수지 조성물 |
| US4978699A (en) * | 1988-10-24 | 1990-12-18 | Atochem North America, Inc. | Light stabilizing flame retardants |
| US5043372A (en) * | 1989-12-22 | 1991-08-27 | Atochem North America, Inc. | N,N'-hydrocarbylenebis[N-hals-substituted amic acid hydrazides] and their derivatives |
| US5116976A (en) * | 1990-07-17 | 1992-05-26 | Atochem North America, Inc | Hindered amine light stabilizer hydrazides |
| US5132387A (en) * | 1991-01-07 | 1992-07-21 | Elf Atochem North America, Inc. | Hindered amine light stabilizer hydrazides for stabilizing polyurethane, polyurea and polyurethane-polyurea polymers |
| JP3218771B2 (ja) * | 1992-05-13 | 2001-10-15 | 住友化学工業株式会社 | ヒンダードピペリジン化合物による有機材料の安定化および該化合物の製造 |
| US5380828A (en) * | 1993-10-05 | 1995-01-10 | Ciba-Geigy Corporation | Azodicarboxylic acid derivatives containing hindered amine moieties as polymer stabilizers |
| NZ284802A (en) | 1994-04-15 | 1998-01-26 | Basf Ag | Use of 4-amino-2,2,6,6-tetramethyl piperidine derivatives in a process for producing inherently light- and heat-stabilised polyamides |
| US5994264A (en) * | 1995-06-07 | 1999-11-30 | American Trim, Llc | Transfer printing of metal using protective overcoat |
| US5976296A (en) * | 1998-04-27 | 1999-11-02 | American Trim, Llc | Transfer printing of complex objects |
| CN100374881C (zh) * | 1999-12-16 | 2008-03-12 | 旭化成爱美株式会社 | 可长期配戴的软性隐形镜片 |
| EP1184442A1 (en) * | 2000-08-30 | 2002-03-06 | Clariant International Ltd. | Liquid crystal mixture |
| US6620208B2 (en) | 2001-03-30 | 2003-09-16 | Honeywell International Inc. | Wetfast polyamide fiber with high amino end group content |
| US6761974B1 (en) * | 2001-05-04 | 2004-07-13 | Seagate Technology Llc | Polymeric lubricants with improved stability and thin film recording media comprising same |
| US9322958B2 (en) | 2004-08-27 | 2016-04-26 | Coopervision International Holding Company, Lp | Silicone hydrogel contact lenses |
| KR101367538B1 (ko) | 2004-08-27 | 2014-02-26 | 쿠퍼비젼 인터내셔날 홀딩 캄파니, 엘피 | 실리콘 히드로겔 콘택트 렌즈 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3640928A (en) * | 1968-06-12 | 1972-02-08 | Sankyo Co | Stabilization of synthetic polymers |
| US3992390A (en) * | 1971-11-30 | 1976-11-16 | Brian Holt | Esters of piperidinols |
| JPS4962543A (enExample) * | 1972-10-20 | 1974-06-18 |
-
1976
- 1976-09-21 DE DE19762642461 patent/DE2642461A1/de not_active Withdrawn
-
1977
- 1977-09-19 NL NL7710263A patent/NL7710263A/xx not_active Application Discontinuation
- 1977-09-19 US US05/834,764 patent/US4153596A/en not_active Expired - Lifetime
- 1977-09-19 CA CA286,985A patent/CA1109587A/en not_active Expired
- 1977-09-20 GB GB39105/77A patent/GB1587436A/en not_active Expired
- 1977-09-21 JP JP11278177A patent/JPS5339385A/ja active Pending
- 1977-09-21 FR FR7728493A patent/FR2364943A1/fr active Granted
Cited By (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0008084A1 (de) * | 1978-08-05 | 1980-02-20 | Hoechst Aktiengesellschaft | Neue Harnstoffderivate, ihre Herstellung und ihre Verwendung als Lichtschutzmittel für Polymere |
| EP0022079A1 (de) * | 1979-06-21 | 1981-01-07 | Ciba-Geigy Ag | Polyalkylpiperidyl-harnstoffe, ihre Verwendung als Stabilisatoren und die damit stabilisierten Polymeren |
| DE3408948A1 (de) * | 1983-03-21 | 1984-09-27 | Sandoz-Patent-GmbH, 7850 Lörrach | Neue 4-amino-polyalkylpiperidinverbindungen |
| DE3630762A1 (de) * | 1985-09-13 | 1987-03-19 | Sandoz Ag | 2,2,6,6-tetraalkylpiperidin-oxalsaeureamide |
| US5814107A (en) * | 1996-07-31 | 1998-09-29 | Basf Corporation | Photochemically stabilized polyamide compositions |
| US5851238A (en) * | 1996-07-31 | 1998-12-22 | Basf Corporation | Photochemically stabilized polyamide compositions |
| US6136433A (en) * | 1997-05-01 | 2000-10-24 | Basf Corporation | Spinning and stability of solution-dyed nylon fibers |
| US6358458B1 (en) | 1997-05-01 | 2002-03-19 | Basf Corporation | Spinning and stability of solution-dyed nylon fibers |
| WO2002094921A1 (de) * | 2001-05-22 | 2002-11-28 | Basf Aktiengesellschaft | Amidpolymermasse |
| CZ297935B6 (cs) * | 2001-05-22 | 2007-05-02 | Basf Aktiengesellschaft | Amidová polymerová hmota |
| WO2003035642A1 (en) * | 2001-10-23 | 2003-05-01 | Council Of Scientific And Industrial Research | Tinuvin p-hindred amine light stabilizer and derivatives thereof, and a process for the preparation thereof |
| US6492518B1 (en) | 2001-10-30 | 2002-12-10 | Council Of Scientific And Industrial Research | Tinuvin P-hindred amine light stabilizer and derivatives thereof |
| US6610856B2 (en) | 2001-10-30 | 2003-08-26 | Council Of Scientific And Industrial Research | Tinuvin P-hindred amine light stabilizer and derivatives thereof |
| US6936717B2 (en) | 2001-10-30 | 2005-08-30 | Council Of Scientific & Industrial Research | Tinuvin P-hindred amine light stabilizer and derivatives thereof |
| EP2202260A1 (de) | 2008-12-23 | 2010-06-30 | Ems-Patent Ag | Inhärent stabilisiertes Polyamid-Elastomer sowie Verfahren zu dessen Herstellung |
| WO2010072392A2 (de) | 2008-12-23 | 2010-07-01 | Ems-Patent Ag | Inhärent stabilisiertes polyamid-elastomer sowie verfahren zu dessen herstellung |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2364943A1 (fr) | 1978-04-14 |
| NL7710263A (nl) | 1978-03-23 |
| GB1587436A (en) | 1981-04-01 |
| CA1109587A (en) | 1981-09-22 |
| JPS5339385A (en) | 1978-04-11 |
| FR2364943B1 (enExample) | 1984-03-02 |
| US4153596A (en) | 1979-05-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2642461A1 (de) | Permanent stabilisierte polymere | |
| DE2642446A1 (de) | Methylolderivate von 2,2,6,6-tetraalkylpiperidin, deren herstellung und verwendung | |
| US4178279A (en) | Permanently stabilized polyurethanes | |
| US4145512A (en) | Permanently stabilized polyurethanes | |
| DE2520814A1 (de) | Lichtstabilisierung von polyurethanen | |
| DE1902931A1 (de) | Semicarbazid-alkylamin-Elastomerfaeden | |
| DE1929928A1 (de) | Stabilisierung sythetischer Polymere | |
| DE1770591A1 (de) | Lineare,segmentierte Polyurethanelastomere | |
| DE1918504A1 (de) | Segmentierte Polyurethanelastomere | |
| DE2719132A1 (de) | Modifizierte polyurethane mit erhoehter lichtbestaendigkeit | |
| DE2221798B2 (de) | Verfahren zur herstellung von polyurethanharnstoff-loesungen | |
| DE2930397C2 (enExample) | ||
| DE2707659A1 (de) | Selbstvernetzbare polyurethane | |
| DE1229288B (de) | Verfahren zur Herstellung von Polyurethan-elastomeren aus der Loesung | |
| DE2545647C3 (de) | Stabilisierung synthetischer Polymerer | |
| CH632746A5 (de) | Verfahren zur herstellung von 2.2.6.6-tetramethyl-piperidin-verbindungen. | |
| DE2707660C2 (de) | Abspalter- und Diolrest enthaltende Diisocyanat-Addukte, ihre Herstellung und Verwendung | |
| DE1595699C3 (de) | Stabilisierte Polyurethane | |
| EP0072009A2 (de) | Polytriazinylalkohole, -ester und -urethane, ein Verfahren zu ihrer Herstellung und ihre Verwendung als Stabilisatoren | |
| DE1694093A1 (de) | Stabilisierung von Polyurethanen | |
| DE2545645C2 (de) | Thiazolinylamino-piperidin-Derivate | |
| CH626609A5 (enExample) | ||
| EP0984084A2 (de) | Verfahren zur Herstellung von Cellulosefasern | |
| DE2058502A1 (de) | Polyurethan-Elastomere | |
| DE1494610A1 (de) | Verfahren zur Herstellung gummielastischer Faeden und Fasern mit verbesserter Anfaerbbarkeit |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8130 | Withdrawal |