DE2633734C2 - Elektromagnetisches Miniaturrelais - Google Patents
Elektromagnetisches MiniaturrelaisInfo
- Publication number
- DE2633734C2 DE2633734C2 DE2633734A DE2633734A DE2633734C2 DE 2633734 C2 DE2633734 C2 DE 2633734C2 DE 2633734 A DE2633734 A DE 2633734A DE 2633734 A DE2633734 A DE 2633734A DE 2633734 C2 DE2633734 C2 DE 2633734C2
- Authority
- DE
- Germany
- Prior art keywords
- relay according
- contact
- armature
- base body
- relay
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000003780 insertion Methods 0.000 claims description 15
- 230000037431 insertion Effects 0.000 claims description 15
- 230000004907 flux Effects 0.000 claims description 12
- 238000004804 winding Methods 0.000 claims description 11
- 239000011810 insulating material Substances 0.000 claims description 8
- 238000005520 cutting process Methods 0.000 claims description 4
- 230000005284 excitation Effects 0.000 claims description 4
- 206010000496 acne Diseases 0.000 claims description 3
- 230000000284 resting effect Effects 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims 1
- 238000000926 separation method Methods 0.000 claims 1
- 230000001681 protective effect Effects 0.000 description 5
- 239000000969 carrier Substances 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 2
- 230000013011 mating Effects 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 2
- 238000004382 potting Methods 0.000 description 2
- 230000000717 retained effect Effects 0.000 description 2
- TVTJUIAKQFIXCE-HUKYDQBMSA-N 2-amino-9-[(2R,3S,4S,5R)-4-fluoro-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-prop-2-ynyl-1H-purine-6,8-dione Chemical compound NC=1NC(C=2N(C(N(C=2N=1)[C@@H]1O[C@@H]([C@H]([C@H]1O)F)CO)=O)CC#C)=O TVTJUIAKQFIXCE-HUKYDQBMSA-N 0.000 description 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical group [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
- 235000014676 Phragmites communis Nutrition 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 229940125851 compound 27 Drugs 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 238000005304 joining Methods 0.000 description 1
- 238000005192 partition Methods 0.000 description 1
- 230000000149 penetrating effect Effects 0.000 description 1
- 125000006850 spacer group Chemical group 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 238000003466 welding Methods 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H51/00—Electromagnetic relays
- H01H51/22—Polarised relays
- H01H51/2272—Polarised relays comprising rockable armature, rocking movement around central axis parallel to the main plane of the armature
Landscapes
- Physics & Mathematics (AREA)
- Electromagnetism (AREA)
- Switch Cases, Indication, And Locking (AREA)
- Electromagnets (AREA)
- Arc-Extinguishing Devices That Are Switches (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2633734A DE2633734C2 (de) | 1976-07-27 | 1976-07-27 | Elektromagnetisches Miniaturrelais |
| FR7720862A FR2360169A1 (fr) | 1976-07-27 | 1977-07-06 | Relais electromagnetique miniature |
| US05/816,965 US4159455A (en) | 1976-07-27 | 1977-07-19 | Electromagnetic miniature relay |
| AT0527177A AT370557B (de) | 1976-07-27 | 1977-07-20 | Elektromagnetisches miniaturrelais |
| GB30588/77A GB1553471A (en) | 1976-07-27 | 1977-07-21 | Electromagnetic relaiys |
| JP52090233A JPS5843844B2 (ja) | 1976-07-27 | 1977-07-27 | 電磁継電器 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2633734A DE2633734C2 (de) | 1976-07-27 | 1976-07-27 | Elektromagnetisches Miniaturrelais |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2633734A1 DE2633734A1 (de) | 1978-02-02 |
| DE2633734C2 true DE2633734C2 (de) | 1982-10-28 |
Family
ID=5984057
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2633734A Expired DE2633734C2 (de) | 1976-07-27 | 1976-07-27 | Elektromagnetisches Miniaturrelais |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4159455A (Direct) |
| JP (1) | JPS5843844B2 (Direct) |
| AT (1) | AT370557B (Direct) |
| DE (1) | DE2633734C2 (Direct) |
| FR (1) | FR2360169A1 (Direct) |
| GB (1) | GB1553471A (Direct) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH614068A5 (en) * | 1977-03-30 | 1979-10-31 | Standard Telephon & Radio Ag | Electromagnetic relay |
| DE3303666A1 (de) * | 1983-02-03 | 1984-08-09 | Hans 8024 Deisenhofen Sauer | Relais mit wenigstens einem, innerhalb des spulenkoerpers schwenkbeweglich gelagerten anker |
| GB2166595B (en) * | 1984-11-07 | 1988-06-08 | Stc Plc | Polarised relay of high sensitivity |
| GB8717083D0 (en) * | 1987-07-20 | 1987-08-26 | Gen Electric Co Plc | Electric switches |
| US4788516A (en) * | 1987-08-17 | 1988-11-29 | Beta Mfg. Co. | Enclosed electromagnetic relay |
| US4879536A (en) * | 1987-09-30 | 1989-11-07 | Anritsu Corporation | Electromagnetic relay |
| JPH0791432B2 (ja) * | 1989-12-22 | 1995-10-04 | 昭和高分子株式会社 | 防錆性水分散性樹脂組成物 |
| DE102010017872B4 (de) * | 2010-04-21 | 2012-06-06 | Saia-Burgess Dresden Gmbh | Bistabiles Kleinrelais großer Leistung |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB894463A (en) * | 1959-07-21 | 1962-04-26 | Zd Y Jana Svermy | Improvements in and relating to polarized electromagnetic relays |
| DE1190103B (de) * | 1962-09-28 | 1965-04-01 | Siemens Ag | Gekapselte, magnetisch steuerbare Schaltvorrichtung |
| FR1392114A (fr) * | 1963-04-11 | 1965-03-12 | Siemens Ag | élément électro-magnétique miniaturisé, notamment pour relais |
| US3335376A (en) * | 1965-12-13 | 1967-08-08 | Charles E Gutentag P B A Publi | Micro-miniature relay |
| FR1567309A (Direct) * | 1967-04-07 | 1969-05-16 | ||
| AT290655B (de) * | 1968-02-26 | 1971-06-11 | Rau Swf Autozubehoer | Steck- und lötbares elektromagnetisches Kleinrelais |
| DE1639417B1 (de) * | 1968-02-29 | 1970-11-12 | Hans Sauer | Elektromagnetisches Mehrkontaktrelais |
| CH514930A (de) * | 1969-09-22 | 1971-10-31 | Elesta Ag Elektronik | Kleinschütz und Verfahren zur Herstellung desselben |
| FR2071519A5 (Direct) * | 1969-12-31 | 1971-09-17 | Telic | |
| DE2035062C3 (de) * | 1970-07-15 | 1974-03-28 | Wolfgang 2210 Itzehoe Priesemuth | Überwachungsrelais zur Kontrolle der Beleuchtung von Kraftfahrzeugen |
| US3800251A (en) * | 1970-08-31 | 1974-03-26 | Matsushita Electric Works Ltd | Small electro-magnetic contactor |
| DE2256044B2 (de) * | 1972-11-15 | 1980-09-25 | Bunker Ramo Corp., Oak Brook, Ill. (V.St.A.) | Umschaltkontakt |
| DE2318812B1 (de) * | 1973-04-13 | 1974-01-10 | Hans Sauer | Elektromagnetisches Relais |
| DE2345471A1 (de) * | 1973-09-08 | 1975-04-10 | Erni & Co Elektro Ind | Elektromagnetisches relais |
| DE2454967C3 (de) * | 1974-05-15 | 1981-12-24 | Hans 8024 Deisenhofen Sauer | Gepoltes elektromagnetisches Relais |
| ZA757910B (en) * | 1974-12-13 | 1976-12-29 | Matsushita Electric Works Ltd | Electromagnetic relay |
-
1976
- 1976-07-27 DE DE2633734A patent/DE2633734C2/de not_active Expired
-
1977
- 1977-07-06 FR FR7720862A patent/FR2360169A1/fr active Granted
- 1977-07-19 US US05/816,965 patent/US4159455A/en not_active Expired - Lifetime
- 1977-07-20 AT AT0527177A patent/AT370557B/de not_active IP Right Cessation
- 1977-07-21 GB GB30588/77A patent/GB1553471A/en not_active Expired
- 1977-07-27 JP JP52090233A patent/JPS5843844B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2633734A1 (de) | 1978-02-02 |
| FR2360169B1 (Direct) | 1982-11-05 |
| JPS5315555A (en) | 1978-02-13 |
| AT370557B (de) | 1983-04-11 |
| US4159455A (en) | 1979-06-26 |
| ATA527177A (de) | 1982-08-15 |
| GB1553471A (en) | 1979-09-26 |
| JPS5843844B2 (ja) | 1983-09-29 |
| FR2360169A1 (fr) | 1978-02-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2454967C3 (de) | Gepoltes elektromagnetisches Relais | |
| EP0118715B1 (de) | Polarisiertes elektromagnetisches Relais | |
| DE3320000C2 (de) | Elektromagnetisches Relais | |
| DE2633734C2 (de) | Elektromagnetisches Miniaturrelais | |
| DE3347602A1 (de) | Polarisiertes elektromagnetisches relais | |
| DE2632126C2 (de) | Polarisiertes Miniaturrelais | |
| DE4333302C2 (de) | Elektrischer Schalter mit federnd abgestützter Schaltbrücke | |
| EP0320686A2 (de) | Elektromagnetisches Schaltgerät | |
| EP0214469B1 (de) | Elektromagnetisches Relais | |
| DE2811378C2 (Direct) | ||
| EP0074577B1 (de) | Polarisiertes elektromagnetisches Relais | |
| DE3025814C2 (de) | Elektromagnetisches Relais | |
| EP0198492B1 (de) | Polarisiertes elektromagnetisches Relais | |
| DE3338208A1 (de) | Elektromagnetisches relais und verfahren zu dessen herstellung | |
| DE3124412C1 (de) | Polarisiertes elektromagnetisches Kleinrelais | |
| DE3043811A1 (de) | Endschalter | |
| EP0077017A2 (de) | Polarisiertes elektromagnetisches Relais | |
| DE3508795C2 (Direct) | ||
| DE2711480A1 (de) | Elektromagnetisches miniaturrelais | |
| DE2647203A1 (de) | Elektromagnetisches miniaturrelais | |
| DE3232380C2 (Direct) | ||
| DE2703584C2 (de) | Elektromagnetisches Relais | |
| DE3224070C2 (de) | Polarisiertes Relais | |
| EP0272409A1 (de) | Gepoltes Flachrelais | |
| EP0192928A1 (de) | Elektromagnetisches Relais |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OAP | Request for examination filed | ||
| OD | Request for examination | ||
| AG | Has addition no. |
Ref country code: DE Ref document number: 2711480 Format of ref document f/p: P |
|
| D2 | Grant after examination | ||
| AG | Has addition no. |
Ref country code: DE Ref document number: 2711480 Format of ref document f/p: P |
|
| 8339 | Ceased/non-payment of the annual fee |