DE2612155A1 - Nitrofurylpyrazolderivate, verfahren zu deren herstellung und sie enthaltende arzneimittel - Google Patents
Nitrofurylpyrazolderivate, verfahren zu deren herstellung und sie enthaltende arzneimittelInfo
- Publication number
- DE2612155A1 DE2612155A1 DE19762612155 DE2612155A DE2612155A1 DE 2612155 A1 DE2612155 A1 DE 2612155A1 DE 19762612155 DE19762612155 DE 19762612155 DE 2612155 A DE2612155 A DE 2612155A DE 2612155 A1 DE2612155 A1 DE 2612155A1
- Authority
- DE
- Germany
- Prior art keywords
- group
- nitro
- furyl
- pyrazole
- carboxaldehyde
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 34
- JPIPRHICKKLMOR-UHFFFAOYSA-N 5-(furan-2-yl)-4-nitro-1h-pyrazole Chemical class [O-][N+](=O)C1=CNN=C1C1=CC=CO1 JPIPRHICKKLMOR-UHFFFAOYSA-N 0.000 title claims description 19
- 238000004519 manufacturing process Methods 0.000 title description 5
- 229940126601 medicinal product Drugs 0.000 title 1
- -1 alicyclic hydrocarbon radical Chemical class 0.000 claims description 461
- 150000001875 compounds Chemical class 0.000 claims description 144
- 125000004432 carbon atom Chemical group C* 0.000 claims description 93
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 53
- 125000000217 alkyl group Chemical group 0.000 claims description 51
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 49
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 32
- 125000005843 halogen group Chemical group 0.000 claims description 31
- 125000003172 aldehyde group Chemical group 0.000 claims description 28
- 125000004076 pyridyl group Chemical group 0.000 claims description 28
- 125000002252 acyl group Chemical group 0.000 claims description 26
- 239000002253 acid Substances 0.000 claims description 25
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 21
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 21
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 21
- 125000002843 carboxylic acid group Chemical group 0.000 claims description 20
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 20
- 125000003545 alkoxy group Chemical group 0.000 claims description 19
- 125000003118 aryl group Chemical group 0.000 claims description 19
- 239000000460 chlorine Chemical group 0.000 claims description 19
- 229910052801 chlorine Inorganic materials 0.000 claims description 19
- 125000001072 heteroaryl group Chemical group 0.000 claims description 19
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 18
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims description 16
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 claims description 16
- 238000002360 preparation method Methods 0.000 claims description 16
- 229910052717 sulfur Chemical group 0.000 claims description 16
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 15
- 239000003814 drug Substances 0.000 claims description 14
- 229910052757 nitrogen Inorganic materials 0.000 claims description 14
- 150000003839 salts Chemical class 0.000 claims description 13
- 125000004434 sulfur atom Chemical group 0.000 claims description 13
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 12
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 11
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 11
- 239000002904 solvent Substances 0.000 claims description 11
- ORQQKSZUXNAWAX-UHFFFAOYSA-N 1-(5-nitrofuran-2-yl)ethanone Chemical compound CC(=O)C1=CC=C([N+]([O-])=O)O1 ORQQKSZUXNAWAX-UHFFFAOYSA-N 0.000 claims description 10
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 10
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 10
- 150000007513 acids Chemical class 0.000 claims description 10
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 10
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 claims description 10
- 239000011737 fluorine Substances 0.000 claims description 10
- 229910052731 fluorine Inorganic materials 0.000 claims description 10
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 10
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 claims description 9
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 8
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 7
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical class [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 7
- 125000004423 acyloxy group Chemical group 0.000 claims description 7
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 7
- 150000004820 halides Chemical class 0.000 claims description 7
- 229910052760 oxygen Inorganic materials 0.000 claims description 7
- 239000001301 oxygen Substances 0.000 claims description 7
- 239000000126 substance Substances 0.000 claims description 7
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 7
- 239000004215 Carbon black (E152) Substances 0.000 claims description 6
- 229930195733 hydrocarbon Natural products 0.000 claims description 6
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 5
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 claims description 5
- 125000001931 aliphatic group Chemical group 0.000 claims description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 5
- 125000001246 bromo group Chemical group Br* 0.000 claims description 5
- 125000000623 heterocyclic group Chemical group 0.000 claims description 5
- 150000007522 mineralic acids Chemical class 0.000 claims description 5
- 125000002560 nitrile group Chemical group 0.000 claims description 5
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 5
- 150000007524 organic acids Chemical class 0.000 claims description 5
- 125000004043 oxo group Chemical group O=* 0.000 claims description 5
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 5
- 125000005493 quinolyl group Chemical group 0.000 claims description 5
- SMPGHLDYRMDGCB-UHFFFAOYSA-N 1-methyl-3-(5-nitrofuran-2-yl)pyrazole-4-carbonitrile Chemical compound CN1C=C(C#N)C(C=2OC(=CC=2)[N+]([O-])=O)=N1 SMPGHLDYRMDGCB-UHFFFAOYSA-N 0.000 claims description 4
- NQURNQGVKIVJEC-UHFFFAOYSA-N 3-(5-nitrofuran-2-yl)-1-pyridin-2-ylpyrazole-4-carboxamide Chemical compound NC(=O)C1=CN(C=2N=CC=CC=2)N=C1C1=CC=C([N+]([O-])=O)O1 NQURNQGVKIVJEC-UHFFFAOYSA-N 0.000 claims description 4
- 125000002947 alkylene group Chemical group 0.000 claims description 4
- 150000007854 aminals Chemical class 0.000 claims description 4
- 125000004104 aryloxy group Chemical group 0.000 claims description 4
- 125000004429 atom Chemical group 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 4
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 4
- 125000005646 oximino group Chemical group 0.000 claims description 4
- 125000004817 pentamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 claims description 4
- 229920006395 saturated elastomer Polymers 0.000 claims description 4
- 125000003107 substituted aryl group Chemical group 0.000 claims description 4
- 125000004174 2-benzimidazolyl group Chemical group [H]N1C(*)=NC2=C([H])C([H])=C([H])C([H])=C12 0.000 claims description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 3
- 125000003277 amino group Chemical group 0.000 claims description 3
- 150000001450 anions Chemical class 0.000 claims description 3
- FNEFPDXUFCXUCT-UHFFFAOYSA-N ethyl n-[[1-methyl-3-(5-nitrofuran-2-yl)pyrazol-4-yl]methylideneamino]carbamate Chemical compound CCOC(=O)NN=CC1=CN(C)N=C1C1=CC=C([N+]([O-])=O)O1 FNEFPDXUFCXUCT-UHFFFAOYSA-N 0.000 claims description 3
- 125000005842 heteroatom Chemical group 0.000 claims description 3
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 3
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 3
- 125000002206 pyridazin-3-yl group Chemical group [H]C1=C([H])C([H])=C(*)N=N1 0.000 claims description 3
- 239000011593 sulfur Substances 0.000 claims description 3
- AWKSJJYZMGNETH-UHFFFAOYSA-N 1-(4-chlorophenyl)-3-(5-nitrofuran-2-yl)pyrazole-4-carboxamide Chemical compound NC(=O)C1=CN(C=2C=CC(Cl)=CC=2)N=C1C1=CC=C([N+]([O-])=O)O1 AWKSJJYZMGNETH-UHFFFAOYSA-N 0.000 claims description 2
- HWEIFVMAHRMEHU-UHFFFAOYSA-N 1-(4-fluorophenyl)-3-(5-nitrofuran-2-yl)pyrazole-4-carboxamide Chemical compound NC(=O)C1=CN(C=2C=CC(F)=CC=2)N=C1C1=CC=C([N+]([O-])=O)O1 HWEIFVMAHRMEHU-UHFFFAOYSA-N 0.000 claims description 2
- NPZKOPCJZPWFKU-UHFFFAOYSA-N 1-methyl-5-(5-nitrofuran-2-yl)pyrazole-4-carboxamide Chemical compound CN1N=CC(C(N)=O)=C1C1=CC=C([N+]([O-])=O)O1 NPZKOPCJZPWFKU-UHFFFAOYSA-N 0.000 claims description 2
- YOLKZLPRRFNYKB-UHFFFAOYSA-N 3-(furan-2-yl)-5-methyl-4-nitro-1h-pyrazole Chemical class [O-][N+](=O)C1=C(C)NN=C1C1=CC=CO1 YOLKZLPRRFNYKB-UHFFFAOYSA-N 0.000 claims description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 125000000717 hydrazino group Chemical group [H]N([*])N([H])[H] 0.000 claims description 2
- 125000005638 hydrazono group Chemical group 0.000 claims description 2
- 125000001841 imino group Chemical group [H]N=* 0.000 claims description 2
- 238000011065 in-situ storage Methods 0.000 claims description 2
- 125000003396 thiol group Chemical group [H]S* 0.000 claims description 2
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 claims 7
- LPAMJTNZXOSWDG-UHFFFAOYSA-N 5-(furan-2-yl)-4-nitro-1H-pyrazole methanamine Chemical class NC.C1=NNC(C=2OC=CC=2)=C1[N+](=O)[O-] LPAMJTNZXOSWDG-UHFFFAOYSA-N 0.000 claims 1
- 235000008331 Pinus X rigitaeda Nutrition 0.000 claims 1
- 235000011613 Pinus brutia Nutrition 0.000 claims 1
- 241000018646 Pinus brutia Species 0.000 claims 1
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 claims 1
- 125000003368 amide group Chemical group 0.000 claims 1
- 150000001540 azides Chemical class 0.000 claims 1
- BBBFJLBPOGFECG-VJVYQDLKSA-N calcitonin Chemical group N([C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)NCC(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H]([C@@H](C)O)C(=O)N1[C@@H](CCC1)C(N)=O)C(C)C)C(=O)[C@@H]1CSSC[C@H](N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H]([C@@H](C)O)C(=O)N1 BBBFJLBPOGFECG-VJVYQDLKSA-N 0.000 claims 1
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical compound C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 claims 1
- WIEFWGREYKJINA-UHFFFAOYSA-N ethyl n-[[3-(5-nitrofuran-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]carbamate Chemical compound CCOC(=O)NN=CC1=CN(C=2C=CC=CC=2)N=C1C1=CC=C([N+]([O-])=O)O1 WIEFWGREYKJINA-UHFFFAOYSA-N 0.000 claims 1
- 125000005597 hydrazone group Chemical group 0.000 claims 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 claims 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 189
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 168
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 122
- 238000000354 decomposition reaction Methods 0.000 description 95
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 69
- 239000000203 mixture Substances 0.000 description 60
- 239000000243 solution Substances 0.000 description 58
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 54
- 239000002244 precipitate Substances 0.000 description 42
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 39
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 38
- 150000007857 hydrazones Chemical class 0.000 description 34
- 239000004480 active ingredient Substances 0.000 description 33
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 32
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 29
- 229960000583 acetic acid Drugs 0.000 description 28
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 27
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 24
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- WFDIJRYMOXRFFG-UHFFFAOYSA-N acetic acid anhydride Natural products CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 24
- 238000006243 chemical reaction Methods 0.000 description 24
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 24
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 22
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 22
- XMAKCHDGDPVFPB-UHFFFAOYSA-N 5-(5-nitrofuran-2-yl)-1h-pyrazole-4-carbaldehyde Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NNC=C1C=O XMAKCHDGDPVFPB-UHFFFAOYSA-N 0.000 description 21
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 20
- 239000012362 glacial acetic acid Substances 0.000 description 20
- 238000003756 stirring Methods 0.000 description 20
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 19
- 150000001299 aldehydes Chemical class 0.000 description 19
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 17
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 16
- 239000000725 suspension Substances 0.000 description 16
- DICJXPWWJZEDCX-UHFFFAOYSA-N 5-(5-nitrofuran-2-yl)-1h-pyrazole Chemical compound O1C([N+](=O)[O-])=CC=C1C1=CC=NN1 DICJXPWWJZEDCX-UHFFFAOYSA-N 0.000 description 15
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- LELOWRISYMNNSU-UHFFFAOYSA-N Hydrocyanic acid Natural products N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 15
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 15
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 14
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 14
- 150000001298 alcohols Chemical class 0.000 description 14
- 239000003826 tablet Substances 0.000 description 14
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 12
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 12
- 239000000741 silica gel Substances 0.000 description 12
- 229910002027 silica gel Inorganic materials 0.000 description 12
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 12
- 239000008187 granular material Substances 0.000 description 11
- QDURSWCHUGIFBU-UHFFFAOYSA-N 1-methyl-3-(5-nitrofuran-2-yl)pyrazole-4-carbaldehyde Chemical compound CN1C=C(C=O)C(C=2OC(=CC=2)[N+]([O-])=O)=N1 QDURSWCHUGIFBU-UHFFFAOYSA-N 0.000 description 10
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 10
- 150000001408 amides Chemical class 0.000 description 10
- 230000009089 cytolysis Effects 0.000 description 10
- 125000002541 furyl group Chemical group 0.000 description 10
- 229910052740 iodine Inorganic materials 0.000 description 10
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 10
- 239000003960 organic solvent Substances 0.000 description 10
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 10
- 239000001632 sodium acetate Substances 0.000 description 10
- 235000017281 sodium acetate Nutrition 0.000 description 10
- 125000001424 substituent group Chemical group 0.000 description 10
- LAIHVWPHVRFVKH-UHFFFAOYSA-N 1-methyl-3-(5-nitrofuran-2-yl)pyrazole Chemical compound CN1C=CC(C=2OC(=CC=2)[N+]([O-])=O)=N1 LAIHVWPHVRFVKH-UHFFFAOYSA-N 0.000 description 9
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 9
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 9
- BWUSFAHFEGVLGA-UHFFFAOYSA-N 3-(5-nitrofuran-2-yl)-1-phenylpyrazole-4-carbaldehyde Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NN(C=2C=CC=CC=2)C=C1C=O BWUSFAHFEGVLGA-UHFFFAOYSA-N 0.000 description 9
- JBEAMYSRTVXNRL-UHFFFAOYSA-N 3-(5-nitrofuran-2-yl)-1-phenylpyrazole-4-carbonitrile Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NN(C=2C=CC=CC=2)C=C1C#N JBEAMYSRTVXNRL-UHFFFAOYSA-N 0.000 description 9
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 9
- 150000001241 acetals Chemical class 0.000 description 9
- 229910021529 ammonia Inorganic materials 0.000 description 9
- 229940079593 drug Drugs 0.000 description 9
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- 239000000454 talc Substances 0.000 description 9
- 229910052623 talc Inorganic materials 0.000 description 9
- 239000005977 Ethylene Substances 0.000 description 8
- 241000282414 Homo sapiens Species 0.000 description 8
- 230000002378 acidificating effect Effects 0.000 description 8
- 238000009835 boiling Methods 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 8
- 239000003795 chemical substances by application Substances 0.000 description 8
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 8
- 208000015181 infectious disease Diseases 0.000 description 8
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 8
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 8
- OPVSRISJIZYTJT-UHFFFAOYSA-N 3-(5-nitrofuran-2-yl)-1-pyridin-2-ylpyrazole-4-carbonitrile Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NN(C=2N=CC=CC=2)C=C1C#N OPVSRISJIZYTJT-UHFFFAOYSA-N 0.000 description 7
- NUEZLWGFOGGXHN-UHFFFAOYSA-N 3-(5-nitrofuran-2-yl)-1-pyridin-3-ylpyrazole-4-carbaldehyde Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NN(C=2C=NC=CC=2)C=C1C=O NUEZLWGFOGGXHN-UHFFFAOYSA-N 0.000 description 7
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 7
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 7
- 235000011114 ammonium hydroxide Nutrition 0.000 description 7
- 238000001816 cooling Methods 0.000 description 7
- 239000000543 intermediate Substances 0.000 description 7
- 238000002844 melting Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- 150000002825 nitriles Chemical class 0.000 description 7
- 230000003647 oxidation Effects 0.000 description 7
- 238000007254 oxidation reaction Methods 0.000 description 7
- 150000002923 oximes Chemical class 0.000 description 7
- NUGZBVBZIDWZAD-UHFFFAOYSA-N 1h-pyrazole-4-carbonitrile Chemical compound N#CC=1C=NNC=1 NUGZBVBZIDWZAD-UHFFFAOYSA-N 0.000 description 6
- NEQIMUMCLKZWRK-UHFFFAOYSA-N 3-(5-nitrofuran-2-yl)-1-pyridin-2-ylpyrazole-4-carbaldehyde Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NN(C=2N=CC=CC=2)C=C1C=O NEQIMUMCLKZWRK-UHFFFAOYSA-N 0.000 description 6
- WTKOBTSCVNBVOY-UHFFFAOYSA-N 5-(5-nitrofuran-2-yl)-1h-pyrazole-4-carbonitrile Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NNC=C1C#N WTKOBTSCVNBVOY-UHFFFAOYSA-N 0.000 description 6
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 6
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 6
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 6
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 6
- 230000000845 anti-microbial effect Effects 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- VYSYZMNJHYOXGN-UHFFFAOYSA-N ethyl n-aminocarbamate Chemical compound CCOC(=O)NN VYSYZMNJHYOXGN-UHFFFAOYSA-N 0.000 description 6
- 150000002429 hydrazines Chemical class 0.000 description 6
- 239000012442 inert solvent Substances 0.000 description 6
- 230000007935 neutral effect Effects 0.000 description 6
- 239000000825 pharmaceutical preparation Substances 0.000 description 6
- HKOOXMFOFWEVGF-UHFFFAOYSA-N phenylhydrazine Chemical compound NNC1=CC=CC=C1 HKOOXMFOFWEVGF-UHFFFAOYSA-N 0.000 description 6
- 229940067157 phenylhydrazine Drugs 0.000 description 6
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 6
- HIQTWSGCRKZLIA-UHFFFAOYSA-N 1-methyl-5-(5-nitrofuran-2-yl)pyrazole-4-carbaldehyde Chemical compound CN1N=CC(C=O)=C1C1=CC=C([N+]([O-])=O)O1 HIQTWSGCRKZLIA-UHFFFAOYSA-N 0.000 description 5
- JSFUFEDKVPFDHB-UHFFFAOYSA-N 3-(5-nitrofuran-2-yl)-1-phenylpyrazole-4-carbonyl chloride Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NN(C=2C=CC=CC=2)C=C1C(Cl)=O JSFUFEDKVPFDHB-UHFFFAOYSA-N 0.000 description 5
- MBVFRSJFKMJRHA-UHFFFAOYSA-N 4-fluoro-1-benzofuran-7-carbaldehyde Chemical compound FC1=CC=C(C=O)C2=C1C=CO2 MBVFRSJFKMJRHA-UHFFFAOYSA-N 0.000 description 5
- 241000283690 Bos taurus Species 0.000 description 5
- 241001465754 Metazoa Species 0.000 description 5
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 5
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 5
- 229920002472 Starch Polymers 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- 235000003599 food sweetener Nutrition 0.000 description 5
- 238000010438 heat treatment Methods 0.000 description 5
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 5
- QRXWMOHMRWLFEY-UHFFFAOYSA-N isoniazide Chemical compound NNC(=O)C1=CC=NC=C1 QRXWMOHMRWLFEY-UHFFFAOYSA-N 0.000 description 5
- QAXUHZRUJQOXFI-UHFFFAOYSA-N methyl n-[1-(5-nitrofuran-2-yl)ethylideneamino]carbamate Chemical compound COC(=O)NN=C(C)C1=CC=C([N+]([O-])=O)O1 QAXUHZRUJQOXFI-UHFFFAOYSA-N 0.000 description 5
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 238000007873 sieving Methods 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 239000012312 sodium hydride Substances 0.000 description 5
- 229910000104 sodium hydride Inorganic materials 0.000 description 5
- 239000008107 starch Substances 0.000 description 5
- 235000019698 starch Nutrition 0.000 description 5
- 239000003765 sweetening agent Substances 0.000 description 5
- 150000003573 thiols Chemical class 0.000 description 5
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 4
- FYGDYMZCAWYEHU-UHFFFAOYSA-N 1-hexyl-3-(5-nitrofuran-2-yl)pyrazole-4-carbonitrile Chemical compound CCCCCCN1C=C(C#N)C(C=2OC(=CC=2)[N+]([O-])=O)=N1 FYGDYMZCAWYEHU-UHFFFAOYSA-N 0.000 description 4
- GKEUJZWWIZVJLO-UHFFFAOYSA-N 1-methyl-5-(5-nitrofuran-2-yl)pyrazole-4-carbonitrile Chemical compound CN1N=CC(C#N)=C1C1=CC=C([N+]([O-])=O)O1 GKEUJZWWIZVJLO-UHFFFAOYSA-N 0.000 description 4
- LRGBDJBDJXZTTD-UHFFFAOYSA-N 1h-pyrazole-4-carbaldehyde Chemical compound O=CC=1C=NNC=1 LRGBDJBDJXZTTD-UHFFFAOYSA-N 0.000 description 4
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 description 4
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 4
- PMTHZRSVBOSPQI-UHFFFAOYSA-N 3-(5-nitrofuran-2-yl)-1-phenylpyrazole-4-carboxamide Chemical compound NC(=O)C1=CN(C=2C=CC=CC=2)N=C1C1=CC=C([N+]([O-])=O)O1 PMTHZRSVBOSPQI-UHFFFAOYSA-N 0.000 description 4
- UAEGXJCWNKQXFG-UHFFFAOYSA-N 3-(5-nitrofuran-2-yl)-1-phenylpyrazole-4-carboxylic acid Chemical compound OC(=O)C1=CN(C=2C=CC=CC=2)N=C1C1=CC=C([N+]([O-])=O)O1 UAEGXJCWNKQXFG-UHFFFAOYSA-N 0.000 description 4
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 4
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 4
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 4
- 241001553178 Arachis glabrata Species 0.000 description 4
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- 229920002261 Corn starch Polymers 0.000 description 4
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- 239000005662 Paraffin oil Substances 0.000 description 4
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 4
- 150000008065 acid anhydrides Chemical class 0.000 description 4
- 230000000844 anti-bacterial effect Effects 0.000 description 4
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 4
- 239000001768 carboxy methyl cellulose Substances 0.000 description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 4
- 239000000969 carrier Substances 0.000 description 4
- 239000008120 corn starch Substances 0.000 description 4
- SOCTUWSJJQCPFX-UHFFFAOYSA-N dichromate(2-) Chemical compound [O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O SOCTUWSJJQCPFX-UHFFFAOYSA-N 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000004312 hexamethylene tetramine Substances 0.000 description 4
- 235000010299 hexamethylene tetramine Nutrition 0.000 description 4
- WJRBRSLFGCUECM-UHFFFAOYSA-N hydantoin Chemical compound O=C1CNC(=O)N1 WJRBRSLFGCUECM-UHFFFAOYSA-N 0.000 description 4
- 229940091173 hydantoin Drugs 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- 235000019359 magnesium stearate Nutrition 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- PABMWBMKSNKBRP-UHFFFAOYSA-N n-[1-(5-nitrofuran-2-yl)ethylideneamino]aniline Chemical compound C=1C=C([N+]([O-])=O)OC=1C(C)=NNC1=CC=CC=C1 PABMWBMKSNKBRP-UHFFFAOYSA-N 0.000 description 4
- 229910017604 nitric acid Inorganic materials 0.000 description 4
- 150000007530 organic bases Chemical class 0.000 description 4
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 4
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 4
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 4
- NWELCUKYUCBVKK-UHFFFAOYSA-N pyridin-2-ylhydrazine Chemical compound NNC1=CC=CC=N1 NWELCUKYUCBVKK-UHFFFAOYSA-N 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 230000035484 reaction time Effects 0.000 description 4
- 150000003335 secondary amines Chemical class 0.000 description 4
- 230000001225 therapeutic effect Effects 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- RPPBQOCBRNVXGE-UHFFFAOYSA-N 1-(2-methoxyethyl)-3-(5-nitrofuran-2-yl)pyrazole-4-carbonitrile Chemical compound COCCN1C=C(C#N)C(C=2OC(=CC=2)[N+]([O-])=O)=N1 RPPBQOCBRNVXGE-UHFFFAOYSA-N 0.000 description 3
- AUOITYKATCKDDO-UHFFFAOYSA-N 1-(4-bromophenyl)-3-(5-nitrofuran-2-yl)pyrazole-4-carbaldehyde Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NN(C=2C=CC(Br)=CC=2)C=C1C=O AUOITYKATCKDDO-UHFFFAOYSA-N 0.000 description 3
- SULHTHXWWOBOOW-UHFFFAOYSA-N 1-(4-chlorophenyl)-3-(5-nitrofuran-2-yl)pyrazole-4-carbaldehyde Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NN(C=2C=CC(Cl)=CC=2)C=C1C=O SULHTHXWWOBOOW-UHFFFAOYSA-N 0.000 description 3
- SBMCYVFXLCXUAJ-UHFFFAOYSA-N 1-(4-chlorophenyl)-3-(5-nitrofuran-2-yl)pyrazole-4-carbonitrile Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NN(C=2C=CC(Cl)=CC=2)C=C1C#N SBMCYVFXLCXUAJ-UHFFFAOYSA-N 0.000 description 3
- VWFMPWLOKWDVPA-UHFFFAOYSA-N 1-(4-fluorophenyl)-3-(5-nitrofuran-2-yl)pyrazole-4-carbaldehyde Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NN(C=2C=CC(F)=CC=2)C=C1C=O VWFMPWLOKWDVPA-UHFFFAOYSA-N 0.000 description 3
- IDNURENANJUUBZ-UHFFFAOYSA-N 1-(4-fluorophenyl)-3-(5-nitrofuran-2-yl)pyrazole-4-carbonitrile Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NN(C=2C=CC(F)=CC=2)C=C1C#N IDNURENANJUUBZ-UHFFFAOYSA-N 0.000 description 3
- ZHXNFCZZXRJIHS-UHFFFAOYSA-N 1-(4-methoxyphenyl)-3-(5-nitrofuran-2-yl)pyrazole-4-carbaldehyde Chemical compound C1=CC(OC)=CC=C1N1N=C(C=2OC(=CC=2)[N+]([O-])=O)C(C=O)=C1 ZHXNFCZZXRJIHS-UHFFFAOYSA-N 0.000 description 3
- SRTVUKBUSSZSQQ-UHFFFAOYSA-N 1-(4-methylphenyl)-3-(5-nitrofuran-2-yl)pyrazole-4-carbonitrile Chemical compound C1=CC(C)=CC=C1N1N=C(C=2OC(=CC=2)[N+]([O-])=O)C(C#N)=C1 SRTVUKBUSSZSQQ-UHFFFAOYSA-N 0.000 description 3
- AXTGDCSMTYGJND-UHFFFAOYSA-N 1-dodecylazepan-2-one Chemical compound CCCCCCCCCCCCN1CCCCCC1=O AXTGDCSMTYGJND-UHFFFAOYSA-N 0.000 description 3
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 3
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 3
- KFXLXEQCRFGDRU-UHFFFAOYSA-N 2-methylbenzohydrazide Chemical compound CC1=CC=CC=C1C(=O)NN KFXLXEQCRFGDRU-UHFFFAOYSA-N 0.000 description 3
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 3
- YICGOEGAXVURRZ-UHFFFAOYSA-N 3-(5-nitrofuran-2-yl)-1-phenylpyrazole-4-carbonyl azide Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NN(C=2C=CC=CC=2)C=C1C(=O)N=[N+]=[N-] YICGOEGAXVURRZ-UHFFFAOYSA-N 0.000 description 3
- ROZKXVNPPVLIHC-UHFFFAOYSA-N 4-(1,3-dioxolan-2-yl)-5-(5-nitrofuran-2-yl)-1h-pyrazole Chemical compound O1C([N+](=O)[O-])=CC=C1C1=C(C2OCCO2)C=NN1 ROZKXVNPPVLIHC-UHFFFAOYSA-N 0.000 description 3
- PKBGHORNUFQAAW-UHFFFAOYSA-N 4-chlorobenzohydrazide Chemical compound NNC(=O)C1=CC=C(Cl)C=C1 PKBGHORNUFQAAW-UHFFFAOYSA-N 0.000 description 3
- REKQLYUAUXYJSZ-UHFFFAOYSA-N 4-methoxybenzohydrazide Chemical compound COC1=CC=C(C(=O)NN)C=C1 REKQLYUAUXYJSZ-UHFFFAOYSA-N 0.000 description 3
- HRTJQZRPQLAFKK-UHFFFAOYSA-N 5-(furan-2-yl)-1-methylpyrazole-4-carbonitrile Chemical compound CN1N=CC(C#N)=C1C1=CC=CO1 HRTJQZRPQLAFKK-UHFFFAOYSA-N 0.000 description 3
- OEDUIFSDODUDRK-UHFFFAOYSA-N 5-phenyl-1h-pyrazole Chemical compound N1N=CC=C1C1=CC=CC=C1 OEDUIFSDODUDRK-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 3
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 3
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 229920000084 Gum arabic Polymers 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 3
- AHDKARBDBBTISB-UHFFFAOYSA-N N-(1H-pyrazol-4-ylmethylidene)hydroxylamine Chemical compound ON=CC=1C=NNC=1 AHDKARBDBBTISB-UHFFFAOYSA-N 0.000 description 3
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 3
- PKBVYMIHLVZWMP-UHFFFAOYSA-N N-[[5-(5-nitrofuran-2-yl)-1H-pyrazol-4-yl]methylidene]hydroxylamine Chemical compound ON=CC1=CNN=C1C1=CC=C([N+]([O-])=O)O1 PKBVYMIHLVZWMP-UHFFFAOYSA-N 0.000 description 3
- 240000007817 Olea europaea Species 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- WYNCHZVNFNFDNH-UHFFFAOYSA-N Oxazolidine Chemical compound C1COCN1 WYNCHZVNFNFDNH-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 229920001615 Tragacanth Polymers 0.000 description 3
- GOPYZMJAIPBUGX-UHFFFAOYSA-N [O-2].[O-2].[Mn+4] Chemical class [O-2].[O-2].[Mn+4] GOPYZMJAIPBUGX-UHFFFAOYSA-N 0.000 description 3
- 235000010489 acacia gum Nutrition 0.000 description 3
- 239000000205 acacia gum Substances 0.000 description 3
- 230000010933 acylation Effects 0.000 description 3
- 238000005917 acylation reaction Methods 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 125000004414 alkyl thio group Chemical group 0.000 description 3
- 239000004599 antimicrobial Substances 0.000 description 3
- 239000007900 aqueous suspension Substances 0.000 description 3
- 150000005840 aryl radicals Chemical class 0.000 description 3
- WARCRYXKINZHGQ-UHFFFAOYSA-N benzohydrazide Chemical compound NNC(=O)C1=CC=CC=C1 WARCRYXKINZHGQ-UHFFFAOYSA-N 0.000 description 3
- 230000037396 body weight Effects 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 3
- 150000001735 carboxylic acids Chemical class 0.000 description 3
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 125000004093 cyano group Chemical group *C#N 0.000 description 3
- 230000018044 dehydration Effects 0.000 description 3
- 238000006297 dehydration reaction Methods 0.000 description 3
- 238000006356 dehydrogenation reaction Methods 0.000 description 3
- MAASKVFTFIRVSJ-UHFFFAOYSA-O dimethyl(1h-pyrazol-4-ylmethylidene)azanium Chemical class C[N+](C)=CC=1C=NNC=1 MAASKVFTFIRVSJ-UHFFFAOYSA-O 0.000 description 3
- 239000002270 dispersing agent Substances 0.000 description 3
- 239000003937 drug carrier Substances 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- 210000001035 gastrointestinal tract Anatomy 0.000 description 3
- 229920000159 gelatin Polymers 0.000 description 3
- 235000019322 gelatine Nutrition 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 3
- 239000008101 lactose Substances 0.000 description 3
- HDZGCSFEDULWCS-UHFFFAOYSA-N monomethylhydrazine Chemical compound CNN HDZGCSFEDULWCS-UHFFFAOYSA-N 0.000 description 3
- 239000012452 mother liquor Substances 0.000 description 3
- KBJCFBBPRODWKK-UHFFFAOYSA-N n-[[1-(4-fluorophenyl)-3-(5-nitrofuran-2-yl)pyrazol-4-yl]methylidene]hydroxylamine Chemical compound ON=CC1=CN(C=2C=CC(F)=CC=2)N=C1C1=CC=C([N+]([O-])=O)O1 KBJCFBBPRODWKK-UHFFFAOYSA-N 0.000 description 3
- UAUOANROMIUOJO-UHFFFAOYSA-N n-[[3-(5-nitrofuran-2-yl)-1-phenylpyrazol-4-yl]methylidene]hydroxylamine Chemical compound ON=CC1=CN(C=2C=CC=CC=2)N=C1C1=CC=C([N+]([O-])=O)O1 UAUOANROMIUOJO-UHFFFAOYSA-N 0.000 description 3
- 238000006396 nitration reaction Methods 0.000 description 3
- 239000004006 olive oil Substances 0.000 description 3
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 3
- 239000003755 preservative agent Substances 0.000 description 3
- 150000003217 pyrazoles Chemical class 0.000 description 3
- KFUSANSHCADHNJ-UHFFFAOYSA-N pyridine-3-carbohydrazide Chemical compound NNC(=O)C1=CC=CN=C1 KFUSANSHCADHNJ-UHFFFAOYSA-N 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 230000000630 rising effect Effects 0.000 description 3
- 239000004317 sodium nitrate Substances 0.000 description 3
- 235000010344 sodium nitrate Nutrition 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 238000004659 sterilization and disinfection Methods 0.000 description 3
- 239000000080 wetting agent Substances 0.000 description 3
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- MGMPBCRYCFBCJO-UHFFFAOYSA-N 1-(2,3-dihydro-1h-inden-5-yl)-3-(5-nitrofuran-2-yl)pyrazole-4-carbaldehyde Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NN(C=2C=C3CCCC3=CC=2)C=C1C=O MGMPBCRYCFBCJO-UHFFFAOYSA-N 0.000 description 2
- YQEOMYOEMKODAA-UHFFFAOYSA-N 1-(2,3-dihydro-1h-inden-5-yl)-3-(5-nitrofuran-2-yl)pyrazole-4-carbonitrile Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NN(C=2C=C3CCCC3=CC=2)C=C1C#N YQEOMYOEMKODAA-UHFFFAOYSA-N 0.000 description 2
- LYNOPBUBFSLGBU-UHFFFAOYSA-N 1-(2-chloro-4-methylphenyl)-3-(5-nitrofuran-2-yl)pyrazole-4-carbonitrile Chemical compound ClC1=CC(C)=CC=C1N1N=C(C=2OC(=CC=2)[N+]([O-])=O)C(C#N)=C1 LYNOPBUBFSLGBU-UHFFFAOYSA-N 0.000 description 2
- KWRAVIYMDFEDQY-UHFFFAOYSA-N 1-(2-chlorophenyl)-3-(5-nitrofuran-2-yl)pyrazole-4-carbaldehyde Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NN(C=2C(=CC=CC=2)Cl)C=C1C=O KWRAVIYMDFEDQY-UHFFFAOYSA-N 0.000 description 2
- GCZMMNSYRKORDR-UHFFFAOYSA-N 1-(3,4-dichlorophenyl)-3-(5-nitrofuran-2-yl)pyrazole-4-carbaldehyde Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NN(C=2C=C(Cl)C(Cl)=CC=2)C=C1C=O GCZMMNSYRKORDR-UHFFFAOYSA-N 0.000 description 2
- WMBFLAYJIXJSHS-UHFFFAOYSA-N 1-(4-bromophenyl)-3-(5-nitrofuran-2-yl)pyrazole-4-carboxamide Chemical compound NC(=O)C1=CN(C=2C=CC(Br)=CC=2)N=C1C1=CC=C([N+]([O-])=O)O1 WMBFLAYJIXJSHS-UHFFFAOYSA-N 0.000 description 2
- XRUQQRYBTMGPEE-UHFFFAOYSA-N 1-(4-methoxyphenyl)-3-(5-nitrofuran-2-yl)pyrazole-4-carbonitrile Chemical compound C1=CC(OC)=CC=C1N1N=C(C=2OC(=CC=2)[N+]([O-])=O)C(C#N)=C1 XRUQQRYBTMGPEE-UHFFFAOYSA-N 0.000 description 2
- JZCNKVQJECHFKA-UHFFFAOYSA-N 1-(4-methylphenyl)-3-(5-nitrofuran-2-yl)pyrazole-4-carbaldehyde Chemical compound C1=CC(C)=CC=C1N1N=C(C=2OC(=CC=2)[N+]([O-])=O)C(C=O)=C1 JZCNKVQJECHFKA-UHFFFAOYSA-N 0.000 description 2
- FEWLNYSYJNLUOO-UHFFFAOYSA-N 1-Piperidinecarboxaldehyde Chemical compound O=CN1CCCCC1 FEWLNYSYJNLUOO-UHFFFAOYSA-N 0.000 description 2
- PXFARLHMGNAORZ-UHFFFAOYSA-N 1-benzyl-3-(5-nitrofuran-2-yl)pyrazole-4-carbonitrile Chemical compound O1C([N+](=O)[O-])=CC=C1C(C(=C1)C#N)=NN1CC1=CC=CC=C1 PXFARLHMGNAORZ-UHFFFAOYSA-N 0.000 description 2
- YXZFFTJAHVMMLF-UHFFFAOYSA-N 1-bromo-3-methylbutane Chemical compound CC(C)CCBr YXZFFTJAHVMMLF-UHFFFAOYSA-N 0.000 description 2
- MNDIARAMWBIKFW-UHFFFAOYSA-N 1-bromohexane Chemical compound CCCCCCBr MNDIARAMWBIKFW-UHFFFAOYSA-N 0.000 description 2
- XTIGGAHUZJWQMD-UHFFFAOYSA-N 1-chloro-2-methoxyethane Chemical compound COCCCl XTIGGAHUZJWQMD-UHFFFAOYSA-N 0.000 description 2
- JQZAEUFPPSRDOP-UHFFFAOYSA-N 1-chloro-4-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Cl)C=C1 JQZAEUFPPSRDOP-UHFFFAOYSA-N 0.000 description 2
- QLNFKVFUZHBVHT-UHFFFAOYSA-N 1-methyl-1-pyridin-2-ylhydrazine Chemical compound CN(N)C1=CC=CC=N1 QLNFKVFUZHBVHT-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 2
- NEAQRZUHTPSBBM-UHFFFAOYSA-N 2-hydroxy-3,3-dimethyl-7-nitro-4h-isoquinolin-1-one Chemical class C1=C([N+]([O-])=O)C=C2C(=O)N(O)C(C)(C)CC2=C1 NEAQRZUHTPSBBM-UHFFFAOYSA-N 0.000 description 2
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 2
- FVCCJHWQXNOJHT-UHFFFAOYSA-N 3-(5-nitrofuran-2-yl)-1-(4-nitrophenyl)pyrazole-4-carbaldehyde Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NN(C=2C=CC(=CC=2)[N+]([O-])=O)C=C1C=O FVCCJHWQXNOJHT-UHFFFAOYSA-N 0.000 description 2
- XLHLKHXZSUPSGS-UHFFFAOYSA-N 3-(5-nitrofuran-2-yl)-1-propan-2-ylpyrazole Chemical compound CC(C)N1C=CC(C=2OC(=CC=2)[N+]([O-])=O)=N1 XLHLKHXZSUPSGS-UHFFFAOYSA-N 0.000 description 2
- CLCFWTJORYOPHZ-UHFFFAOYSA-N 3-(5-nitrofuran-2-yl)-1-pyridin-3-ylpyrazole-4-carbonitrile Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NN(C=2C=NC=CC=2)C=C1C#N CLCFWTJORYOPHZ-UHFFFAOYSA-N 0.000 description 2
- KXCDKPOFAZCLRV-UHFFFAOYSA-N 3-(5-nitrofuran-2-yl)-n',1-diphenylpyrazole-4-carbohydrazide Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NN(C=2C=CC=CC=2)C=C1C(=O)NNC1=CC=CC=C1 KXCDKPOFAZCLRV-UHFFFAOYSA-N 0.000 description 2
- IHKUYPHONDNXHA-UHFFFAOYSA-N 3-ethoxy-2-(furan-2-carbonyl)prop-2-enenitrile Chemical compound CCOC=C(C#N)C(=O)C1=CC=CO1 IHKUYPHONDNXHA-UHFFFAOYSA-N 0.000 description 2
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- BMESUKRAFRLQJY-UHFFFAOYSA-N 4-chloro-n-[1-(5-nitrofuran-2-yl)ethylideneamino]aniline Chemical compound C=1C=C([N+]([O-])=O)OC=1C(C)=NNC1=CC=C(Cl)C=C1 BMESUKRAFRLQJY-UHFFFAOYSA-N 0.000 description 2
- JRSBGHUNQFGRRJ-UHFFFAOYSA-N 5-(furan-2-yl)-1-methylpyrazole-4-carboxamide Chemical compound CN1N=CC(C(N)=O)=C1C1=CC=CO1 JRSBGHUNQFGRRJ-UHFFFAOYSA-N 0.000 description 2
- XHTWJTDNZKWQON-UHFFFAOYSA-N 5-(furan-2-yl)-1h-pyrazole Chemical class C1=COC(C=2NN=CC=2)=C1 XHTWJTDNZKWQON-UHFFFAOYSA-N 0.000 description 2
- RXQNKKRGJJRMKD-UHFFFAOYSA-N 5-bromo-2-methylaniline Chemical compound CC1=CC=C(Br)C=C1N RXQNKKRGJJRMKD-UHFFFAOYSA-N 0.000 description 2
- HJCUTNIGJHJGCF-UHFFFAOYSA-N 9,10-dihydroacridine Chemical compound C1=CC=C2CC3=CC=CC=C3NC2=C1 HJCUTNIGJHJGCF-UHFFFAOYSA-N 0.000 description 2
- 208000000230 African Trypanosomiasis Diseases 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- 235000017060 Arachis glabrata Nutrition 0.000 description 2
- 244000105624 Arachis hypogaea Species 0.000 description 2
- 235000010777 Arachis hypogaea Nutrition 0.000 description 2
- 235000018262 Arachis monticola Nutrition 0.000 description 2
- 241000416162 Astragalus gummifer Species 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- 101100387923 Caenorhabditis elegans dos-1 gene Proteins 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- 239000001828 Gelatine Substances 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- WRYCSMQKUKOKBP-UHFFFAOYSA-N Imidazolidine Chemical compound C1CNCN1 WRYCSMQKUKOKBP-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 239000002841 Lewis acid Substances 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- 206010065764 Mucosal infection Diseases 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- BXDZOYLPNAIDOC-UHFFFAOYSA-N N-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]-1-[2-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethylamino]-2-oxoethyl]piperidine-4-carboxamide Chemical compound CC(C)(C)c1cnc(CSc2cnc(NC(=O)C3CCN(CC(=O)NCCOCCOCCOCCNc4cccc5C(=O)N(C6CCC(=O)NC6=O)C(=O)c45)CC3)s2)o1 BXDZOYLPNAIDOC-UHFFFAOYSA-N 0.000 description 2
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 241000588769 Proteus <enterobacteria> Species 0.000 description 2
- 208000006311 Pyoderma Diseases 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 241000282887 Suidae Species 0.000 description 2
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- PYTHWUYLDLKZFF-UHFFFAOYSA-N [3-(5-nitrofuran-2-yl)-1-phenylpyrazol-4-yl]-pyrrolidin-1-ylmethanone Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NN(C=2C=CC=CC=2)C=C1C(=O)N1CCCC1 PYTHWUYLDLKZFF-UHFFFAOYSA-N 0.000 description 2
- YBGJZYCWGNYUMA-UHFFFAOYSA-M [Cl-].[P+]=O Chemical compound [Cl-].[P+]=O YBGJZYCWGNYUMA-UHFFFAOYSA-M 0.000 description 2
- 206010000269 abscess Diseases 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- OFLXLNCGODUUOT-UHFFFAOYSA-N acetohydrazide Chemical compound C\C(O)=N\N OFLXLNCGODUUOT-UHFFFAOYSA-N 0.000 description 2
- 239000012190 activator Substances 0.000 description 2
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 2
- 125000003282 alkyl amino group Chemical group 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- HIMXGTXNXJYFGB-UHFFFAOYSA-N alloxan Chemical compound O=C1NC(=O)C(=O)C(=O)N1 HIMXGTXNXJYFGB-UHFFFAOYSA-N 0.000 description 2
- 150000001414 amino alcohols Chemical class 0.000 description 2
- 239000003242 anti bacterial agent Substances 0.000 description 2
- 229940088710 antibiotic agent Drugs 0.000 description 2
- 229940121375 antifungal agent Drugs 0.000 description 2
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- AQNQQHJNRPDOQV-UHFFFAOYSA-N bromocyclohexane Chemical compound BrC1CCCCC1 AQNQQHJNRPDOQV-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 150000001734 carboxylic acid salts Chemical class 0.000 description 2
- 125000000068 chlorophenyl group Chemical group 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 235000008504 concentrate Nutrition 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 238000013461 design Methods 0.000 description 2
- 150000004985 diamines Chemical class 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- YADSGOSSYOOKMP-UHFFFAOYSA-N dioxolead Chemical compound O=[Pb]=O YADSGOSSYOOKMP-UHFFFAOYSA-N 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 239000003651 drinking water Substances 0.000 description 2
- 235000020188 drinking water Nutrition 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 2
- TYXZHWRREXPILF-UHFFFAOYSA-N ethyl N-[[5-(5-nitrofuran-2-yl)-1H-pyrazol-4-yl]methylideneamino]carbamate Chemical compound CCOC(=O)NN=CC1=CNN=C1C1=CC=C([N+]([O-])=O)O1 TYXZHWRREXPILF-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 150000003948 formamides Chemical class 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 125000004997 halocarbonyl group Chemical group 0.000 description 2
- 150000002366 halogen compounds Chemical class 0.000 description 2
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 2
- JYGXADMDTFJGBT-VWUMJDOOSA-N hydrocortisone Chemical compound O=C1CC[C@]2(C)[C@H]3[C@@H](O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 JYGXADMDTFJGBT-VWUMJDOOSA-N 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 150000002443 hydroxylamines Chemical class 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 150000002466 imines Chemical class 0.000 description 2
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- JXDYKVIHCLTXOP-UHFFFAOYSA-N isatin Chemical compound C1=CC=C2C(=O)C(=O)NC2=C1 JXDYKVIHCLTXOP-UHFFFAOYSA-N 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 150000007517 lewis acids Chemical class 0.000 description 2
- 235000012054 meals Nutrition 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- LCEDQNDDFOCWGG-UHFFFAOYSA-N morpholine-4-carbaldehyde Chemical compound O=CN1CCOCC1 LCEDQNDDFOCWGG-UHFFFAOYSA-N 0.000 description 2
- COSWHTZQDCRMLW-UHFFFAOYSA-N n-[1-(5-nitrofuran-2-yl)ethylideneamino]pyridin-2-amine Chemical compound C=1C=C([N+]([O-])=O)OC=1C(C)=NNC1=CC=CC=N1 COSWHTZQDCRMLW-UHFFFAOYSA-N 0.000 description 2
- LUIVULBLPKKUAS-UHFFFAOYSA-N n-[1-(5-nitrofuran-2-yl)ethylideneamino]pyridin-3-amine Chemical compound C=1C=C([N+]([O-])=O)OC=1C(C)=NNC1=CC=CN=C1 LUIVULBLPKKUAS-UHFFFAOYSA-N 0.000 description 2
- DYLWJYQBVQHTHS-UHFFFAOYSA-N n-[[1-(4-methylphenyl)-3-(5-nitrofuran-2-yl)pyrazol-4-yl]methylidene]hydroxylamine Chemical compound C1=CC(C)=CC=C1N1N=C(C=2OC(=CC=2)[N+]([O-])=O)C(C=NO)=C1 DYLWJYQBVQHTHS-UHFFFAOYSA-N 0.000 description 2
- XUFJBLZWWRKCDK-UHFFFAOYSA-N n-[[1-methyl-3-(5-nitrofuran-2-yl)pyrazol-4-yl]methylidene]hydroxylamine Chemical compound CN1C=C(C=NO)C(C=2OC(=CC=2)[N+]([O-])=O)=N1 XUFJBLZWWRKCDK-UHFFFAOYSA-N 0.000 description 2
- PYQYWSMNQICJJY-UHFFFAOYSA-N n-[[3-(5-nitrofuran-2-yl)-1-(4-nitrophenyl)pyrazol-4-yl]methylidene]hydroxylamine Chemical compound ON=CC1=CN(C=2C=CC(=CC=2)[N+]([O-])=O)N=C1C1=CC=C([N+]([O-])=O)O1 PYQYWSMNQICJJY-UHFFFAOYSA-N 0.000 description 2
- OXIORKCIKDOHCO-UHFFFAOYSA-N n-[[3-(5-nitrofuran-2-yl)-1-propan-2-ylpyrazol-4-yl]methylidene]hydroxylamine Chemical compound CC(C)N1C=C(C=NO)C(C=2OC(=CC=2)[N+]([O-])=O)=N1 OXIORKCIKDOHCO-UHFFFAOYSA-N 0.000 description 2
- 230000000802 nitrating effect Effects 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- NXFQHRVNIOXGAQ-YCRREMRBSA-N nitrofurantoin Chemical compound O1C([N+](=O)[O-])=CC=C1\C=N\N1C(=O)NC(=O)C1 NXFQHRVNIOXGAQ-YCRREMRBSA-N 0.000 description 2
- 229960000564 nitrofurantoin Drugs 0.000 description 2
- 238000005580 one pot reaction Methods 0.000 description 2
- 239000011368 organic material Substances 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 238000007911 parenteral administration Methods 0.000 description 2
- 244000052769 pathogen Species 0.000 description 2
- 235000020232 peanut Nutrition 0.000 description 2
- 239000000312 peanut oil Substances 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 2
- 239000000244 polyoxyethylene sorbitan monooleate Substances 0.000 description 2
- 229920000053 polysorbate 80 Polymers 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- DXGIRFAFSFKYCF-UHFFFAOYSA-N propanehydrazide Chemical compound CCC(=O)NN DXGIRFAFSFKYCF-UHFFFAOYSA-N 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 2
- 125000000168 pyrrolyl group Chemical group 0.000 description 2
- MCJGNVYPOGVAJF-UHFFFAOYSA-N quinolin-8-ol Chemical compound C1=CN=C2C(O)=CC=CC2=C1 MCJGNVYPOGVAJF-UHFFFAOYSA-N 0.000 description 2
- JPJALAQPGMAKDF-UHFFFAOYSA-N selenium dioxide Chemical compound O=[Se]=O JPJALAQPGMAKDF-UHFFFAOYSA-N 0.000 description 2
- 150000007659 semicarbazones Chemical class 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- NDVLTYZPCACLMA-UHFFFAOYSA-N silver oxide Chemical compound [O-2].[Ag+].[Ag+] NDVLTYZPCACLMA-UHFFFAOYSA-N 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- 239000000375 suspending agent Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- 210000002229 urogenital system Anatomy 0.000 description 2
- 239000000003 vaginal tablet Substances 0.000 description 2
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 1
- UGRIORRVCWZOFX-UHFFFAOYSA-N (2-chloro-4-methylphenyl)hydrazine Chemical compound CC1=CC=C(NN)C(Cl)=C1 UGRIORRVCWZOFX-UHFFFAOYSA-N 0.000 description 1
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- YMJSQPNVQRHZDW-UHFFFAOYSA-N (3,4-dichlorophenyl)hydrazine Chemical compound NNC1=CC=C(Cl)C(Cl)=C1 YMJSQPNVQRHZDW-UHFFFAOYSA-N 0.000 description 1
- ZXBMIRYQUFQQNX-UHFFFAOYSA-N (4-fluorophenyl)hydrazine Chemical compound NNC1=CC=C(F)C=C1 ZXBMIRYQUFQQNX-UHFFFAOYSA-N 0.000 description 1
- HQDAJGNZGNZGCO-UHFFFAOYSA-N (propan-2-ylideneamino)urea Chemical compound CC(C)=NNC(N)=O HQDAJGNZGNZGCO-UHFFFAOYSA-N 0.000 description 1
- QMMOXUPEWRXHJS-HYXAFXHYSA-N (z)-pent-2-ene Chemical compound CC\C=C/C QMMOXUPEWRXHJS-HYXAFXHYSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- VYMPLPIFKRHAAC-UHFFFAOYSA-N 1,2-ethanedithiol Chemical compound SCCS VYMPLPIFKRHAAC-UHFFFAOYSA-N 0.000 description 1
- 125000004521 1,3,4-thiadiazol-2-yl group Chemical group S1C(=NN=C1)* 0.000 description 1
- 125000000355 1,3-benzoxazolyl group Chemical class O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- ZHDIBLDTPZDGMW-UHFFFAOYSA-N 1-(2,3-dihydro-1h-inden-5-yl)-3-(5-nitrofuran-2-yl)pyrazole-4-carboxamide Chemical compound NC(=O)C1=CN(C=2C=C3CCCC3=CC=2)N=C1C1=CC=C([N+]([O-])=O)O1 ZHDIBLDTPZDGMW-UHFFFAOYSA-N 0.000 description 1
- YYWIZLAGEXIINW-UHFFFAOYSA-N 1-(2-chloro-4-methylphenyl)-3-(5-nitrofuran-2-yl)pyrazole-4-carbaldehyde Chemical compound ClC1=CC(C)=CC=C1N1N=C(C=2OC(=CC=2)[N+]([O-])=O)C(C=O)=C1 YYWIZLAGEXIINW-UHFFFAOYSA-N 0.000 description 1
- PXHLURTZOVAMIA-UHFFFAOYSA-N 1-(2-chlorophenyl)-3-(5-nitrofuran-2-yl)pyrazole-4-carbonitrile Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NN(C=2C(=CC=CC=2)Cl)C=C1C#N PXHLURTZOVAMIA-UHFFFAOYSA-N 0.000 description 1
- PLERFUSZGQIIHX-UHFFFAOYSA-N 1-(2-methoxyethyl)-3-(5-nitrofuran-2-yl)pyrazole-4-carbaldehyde Chemical compound COCCN1C=C(C=O)C(C=2OC(=CC=2)[N+]([O-])=O)=N1 PLERFUSZGQIIHX-UHFFFAOYSA-N 0.000 description 1
- LNDJSMFAMMNOIJ-UHFFFAOYSA-N 1-(3-chlorophenyl)-3-(5-nitrofuran-2-yl)pyrazole-4-carbaldehyde Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NN(C=2C=C(Cl)C=CC=2)C=C1C=O LNDJSMFAMMNOIJ-UHFFFAOYSA-N 0.000 description 1
- IDNOSXKAMPGGKI-UHFFFAOYSA-N 1-(4-bromophenyl)-3-(5-nitrofuran-2-yl)pyrazole-4-carbonitrile Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NN(C=2C=CC(Br)=CC=2)C=C1C#N IDNOSXKAMPGGKI-UHFFFAOYSA-N 0.000 description 1
- HDZNGLDPGJRDHF-UHFFFAOYSA-N 1-(4-fluorophenyl)pyrazole-4-carboxamide Chemical compound C1=C(C(=O)N)C=NN1C1=CC=C(F)C=C1 HDZNGLDPGJRDHF-UHFFFAOYSA-N 0.000 description 1
- GQEFLIJAYODHMN-UHFFFAOYSA-N 1-(4-methylphenyl)-3-(5-nitrofuran-2-yl)pyrazole-4-carboxamide Chemical compound C1=CC(C)=CC=C1N1N=C(C=2OC(=CC=2)[N+]([O-])=O)C(C(N)=O)=C1 GQEFLIJAYODHMN-UHFFFAOYSA-N 0.000 description 1
- QHFVYOOJFPNSRS-UHFFFAOYSA-N 1-(4-nitrophenyl)pyrazole-4-carbaldehyde Chemical compound C1=CC([N+](=O)[O-])=CC=C1N1N=CC(C=O)=C1 QHFVYOOJFPNSRS-UHFFFAOYSA-N 0.000 description 1
- JCQIYZIAEDYXBT-UHFFFAOYSA-N 1-[(4-chlorophenyl)methyl]-3-(5-nitrofuran-2-yl)pyrazole-4-carbaldehyde Chemical compound O1C([N+](=O)[O-])=CC=C1C(C(=C1)C=O)=NN1CC1=CC=C(Cl)C=C1 JCQIYZIAEDYXBT-UHFFFAOYSA-N 0.000 description 1
- JYXVQAVKGIBATI-UHFFFAOYSA-N 1-benzyl-3-(5-nitrofuran-2-yl)pyrazole-4-carbaldehyde Chemical compound O1C([N+](=O)[O-])=CC=C1C(C(=C1)C=O)=NN1CC1=CC=CC=C1 JYXVQAVKGIBATI-UHFFFAOYSA-N 0.000 description 1
- LBJCLISCOIHJOX-UHFFFAOYSA-N 1-cyclohexyl-3-(5-nitrofuran-2-yl)pyrazole-4-carbaldehyde Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NN(C2CCCCC2)C=C1C=O LBJCLISCOIHJOX-UHFFFAOYSA-N 0.000 description 1
- KZQVDCRJOYVBFU-UHFFFAOYSA-N 1-cyclohexyl-3-(5-nitrofuran-2-yl)pyrazole-4-carbonitrile Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NN(C2CCCCC2)C=C1C#N KZQVDCRJOYVBFU-UHFFFAOYSA-N 0.000 description 1
- DDMVXXGXJPMMPR-UHFFFAOYSA-N 1-ethyl-3-(5-nitrofuran-2-yl)pyrazole Chemical compound CCN1C=CC(C=2OC(=CC=2)[N+]([O-])=O)=N1 DDMVXXGXJPMMPR-UHFFFAOYSA-N 0.000 description 1
- UXXZVHXITJCALL-UHFFFAOYSA-N 1-ethyl-3-(5-nitrofuran-2-yl)pyrazole-4-carbonitrile Chemical compound CCN1C=C(C#N)C(C=2OC(=CC=2)[N+]([O-])=O)=N1 UXXZVHXITJCALL-UHFFFAOYSA-N 0.000 description 1
- WBUPBUIHAZGODA-UHFFFAOYSA-N 1-hexyl-3-(5-nitrofuran-2-yl)pyrazole-4-carbaldehyde Chemical compound CCCCCCN1C=C(C=O)C(C=2OC(=CC=2)[N+]([O-])=O)=N1 WBUPBUIHAZGODA-UHFFFAOYSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- ISEKXMRUOUYZBW-UHFFFAOYSA-N 1-methyl-3-(5-nitrofuran-2-yl)pyrazole-4-carboxamide Chemical compound CN1C=C(C(N)=O)C(C=2OC(=CC=2)[N+]([O-])=O)=N1 ISEKXMRUOUYZBW-UHFFFAOYSA-N 0.000 description 1
- MXIOEZSVDSFNOS-UHFFFAOYSA-N 1-methyl-3-(5-nitrofuran-2-yl)pyrazole-4-carboxylic acid Chemical compound CN1C=C(C(O)=O)C(C=2OC(=CC=2)[N+]([O-])=O)=N1 MXIOEZSVDSFNOS-UHFFFAOYSA-N 0.000 description 1
- JUJWIKTYJGSADT-UHFFFAOYSA-N 1-naphthalen-2-yl-3-(5-nitrofuran-2-yl)pyrazole-4-carbonitrile Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NN(C=2C=C3C=CC=CC3=CC=2)C=C1C#N JUJWIKTYJGSADT-UHFFFAOYSA-N 0.000 description 1
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 1
- UTTXEYODTTZTMS-UHFFFAOYSA-N 1-piperidin-1-yl-2-pyrrolidin-1-ylazepane Chemical compound C1CCCN1C1N(N2CCCCC2)CCCCC1 UTTXEYODTTZTMS-UHFFFAOYSA-N 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- WNRHSVTUMLIWCB-UHFFFAOYSA-N 1H-pyrazol-4-ylmethanimine Chemical class N=Cc1cn[nH]c1 WNRHSVTUMLIWCB-UHFFFAOYSA-N 0.000 description 1
- ZVXKYWHJBYIYNI-UHFFFAOYSA-N 1h-pyrazole-4-carboxamide Chemical compound NC(=O)C=1C=NNC=1 ZVXKYWHJBYIYNI-UHFFFAOYSA-N 0.000 description 1
- AKWIAIDKXNKXDI-UHFFFAOYSA-N 1h-pyrrole-3-carboxamide Chemical compound NC(=O)C=1C=CNC=1 AKWIAIDKXNKXDI-UHFFFAOYSA-N 0.000 description 1
- 125000004825 2,2-dimethylpropylene group Chemical group [H]C([H])([H])C(C([H])([H])[H])(C([H])([H])[*:1])C([H])([H])[*:2] 0.000 description 1
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- IEMMBWWQXVXBEU-UHFFFAOYSA-N 2-acetylfuran Chemical compound CC(=O)C1=CC=CO1 IEMMBWWQXVXBEU-UHFFFAOYSA-N 0.000 description 1
- PQNLAYLOCZKPIY-UHFFFAOYSA-N 2-bromobenzohydrazide Chemical compound NNC(=O)C1=CC=CC=C1Br PQNLAYLOCZKPIY-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- GNTARUIZNIWBCN-UHFFFAOYSA-N 2-chloro-5-nitrobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC([N+]([O-])=O)=CC=C1Cl GNTARUIZNIWBCN-UHFFFAOYSA-N 0.000 description 1
- HFFZNXCRCOQATI-UHFFFAOYSA-N 2-chloro-7-iodoquinolin-8-ol Chemical compound C1=C(Cl)N=C2C(O)=C(I)C=CC2=C1 HFFZNXCRCOQATI-UHFFFAOYSA-N 0.000 description 1
- OQGVPMLSRAEBHT-UHFFFAOYSA-N 2-chloro-n-[1-(5-nitrofuran-2-yl)ethylideneamino]aniline Chemical compound C=1C=C([N+]([O-])=O)OC=1C(C)=NNC1=CC=CC=C1Cl OQGVPMLSRAEBHT-UHFFFAOYSA-N 0.000 description 1
- OKDGRDCXVWSXDC-UHFFFAOYSA-N 2-chloropyridine Chemical compound ClC1=CC=CC=N1 OKDGRDCXVWSXDC-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- 229940093475 2-ethoxyethanol Drugs 0.000 description 1
- 125000004847 2-fluorobenzyl group Chemical group [H]C1=C([H])C(F)=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- LUSJVHHCMUAKTR-UHFFFAOYSA-N 2-methyl-n-[[1-methyl-3-(5-nitrofuran-2-yl)pyrazol-4-yl]methylideneamino]benzamide Chemical compound CC1=CC=CC=C1C(=O)NN=CC1=CN(C)N=C1C1=CC=C([N+]([O-])=O)O1 LUSJVHHCMUAKTR-UHFFFAOYSA-N 0.000 description 1
- BKOOMYPCSUNDGP-UHFFFAOYSA-N 2-methylbut-2-ene Chemical group CC=C(C)C BKOOMYPCSUNDGP-UHFFFAOYSA-N 0.000 description 1
- 125000005916 2-methylpentyl group Chemical group 0.000 description 1
- ALNUOSXDMYFQNQ-UHFFFAOYSA-N 2-nitro-1,3-thiazole Chemical class [O-][N+](=O)C1=NC=CS1 ALNUOSXDMYFQNQ-UHFFFAOYSA-N 0.000 description 1
- FUBFWTUFPGFHOJ-UHFFFAOYSA-N 2-nitrofuran Chemical class [O-][N+](=O)C1=CC=CO1 FUBFWTUFPGFHOJ-UHFFFAOYSA-N 0.000 description 1
- UQOKRDJILZMZKU-UHFFFAOYSA-N 2-nitropyrimidine Chemical class [O-][N+](=O)C1=NC=CC=N1 UQOKRDJILZMZKU-UHFFFAOYSA-N 0.000 description 1
- 125000006024 2-pentenyl group Chemical group 0.000 description 1
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 1
- IPLBUYWSMXNRFC-UHFFFAOYSA-N 3-(5-nitrofuran-2-yl)-1-(2-phenylphenyl)pyrazole-4-carbonitrile Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NN(C=2C(=CC=CC=2)C=2C=CC=CC=2)C=C1C#N IPLBUYWSMXNRFC-UHFFFAOYSA-N 0.000 description 1
- BIBVENKJTTVELK-UHFFFAOYSA-N 3-(5-nitrofuran-2-yl)-1-(4-nitrophenyl)pyrazole-4-carbonitrile Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NN(C=2C=CC(=CC=2)[N+]([O-])=O)C=C1C#N BIBVENKJTTVELK-UHFFFAOYSA-N 0.000 description 1
- RTHKCUQAGIOACP-UHFFFAOYSA-N 3-(5-nitrofuran-2-yl)-1-(4-nitrophenyl)pyrazole-4-carboxamide Chemical compound NC(=O)C1=CN(C=2C=CC(=CC=2)[N+]([O-])=O)N=C1C1=CC=C([N+]([O-])=O)O1 RTHKCUQAGIOACP-UHFFFAOYSA-N 0.000 description 1
- QEYBUCFVUHEGPQ-UHFFFAOYSA-N 3-(5-nitrofuran-2-yl)-1-phenylpyrazole-4-carbohydrazide Chemical compound NNC(=O)C1=CN(C=2C=CC=CC=2)N=C1C1=CC=C([N+]([O-])=O)O1 QEYBUCFVUHEGPQ-UHFFFAOYSA-N 0.000 description 1
- SZJJFHMSFBZIAW-UHFFFAOYSA-N 3-(5-nitrofuran-2-yl)-1-propan-2-ylpyrazole-4-carbaldehyde Chemical compound CC(C)N1C=C(C=O)C(C=2OC(=CC=2)[N+]([O-])=O)=N1 SZJJFHMSFBZIAW-UHFFFAOYSA-N 0.000 description 1
- MMNATQOTPCRNGG-UHFFFAOYSA-N 3-(5-nitrofuran-2-yl)-1-propan-2-ylpyrazole-4-carbonitrile Chemical compound CC(C)N1C=C(C#N)C(C=2OC(=CC=2)[N+]([O-])=O)=N1 MMNATQOTPCRNGG-UHFFFAOYSA-N 0.000 description 1
- ZKBNFJIVUFCELX-UHFFFAOYSA-N 3-(5-nitrofuran-2-yl)-1-pyridin-2-ylpyrazole-4-carboxylic acid Chemical compound OC(=O)C1=CN(C=2N=CC=CC=2)N=C1C1=CC=C([N+]([O-])=O)O1 ZKBNFJIVUFCELX-UHFFFAOYSA-N 0.000 description 1
- RZNSHBXVTAHWPP-UHFFFAOYSA-N 3-(furan-2-yl)-3-oxopropanenitrile Chemical compound N#CCC(=O)C1=CC=CO1 RZNSHBXVTAHWPP-UHFFFAOYSA-N 0.000 description 1
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 description 1
- IBYJIRMKSZHGDA-UHFFFAOYSA-N 3-chloro-n-[1-(5-nitrofuran-2-yl)ethylideneamino]aniline Chemical compound C=1C=C([N+]([O-])=O)OC=1C(C)=NNC1=CC=CC(Cl)=C1 IBYJIRMKSZHGDA-UHFFFAOYSA-N 0.000 description 1
- 125000003852 3-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(Cl)=C1[H])C([H])([H])* 0.000 description 1
- NXHDRDLEIJSZKU-UHFFFAOYSA-N 3-nitro-n-[1-(5-nitrofuran-2-yl)ethylideneamino]aniline Chemical compound C=1C=C([N+]([O-])=O)OC=1C(C)=NNC1=CC=CC([N+]([O-])=O)=C1 NXHDRDLEIJSZKU-UHFFFAOYSA-N 0.000 description 1
- ZRARWEYWMABCLC-UHFFFAOYSA-N 4-(1,3-dioxolan-2-yl)-3-(5-nitrofuran-2-yl)-1-phenylpyrazole Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NN(C=2C=CC=CC=2)C=C1C1OCCO1 ZRARWEYWMABCLC-UHFFFAOYSA-N 0.000 description 1
- IMBBXSASDSZJSX-UHFFFAOYSA-N 4-Carboxypyrazole Chemical class OC(=O)C=1C=NNC=1 IMBBXSASDSZJSX-UHFFFAOYSA-N 0.000 description 1
- JRMKJOOJKCAEJK-UHFFFAOYSA-N 4-Hydroxymethylpyrazole Chemical class OCC=1C=NNC=1 JRMKJOOJKCAEJK-UHFFFAOYSA-N 0.000 description 1
- KJTRXVXWSSPHRV-UHFFFAOYSA-N 4-benzoyl-5-methyl-2-phenyl-1h-pyrazol-3-one Chemical compound O=C1C(C(=O)C=2C=CC=CC=2)=C(C)NN1C1=CC=CC=C1 KJTRXVXWSSPHRV-UHFFFAOYSA-N 0.000 description 1
- 125000006281 4-bromobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Br)C([H])([H])* 0.000 description 1
- XXNOGQJZAOXWAQ-UHFFFAOYSA-N 4-chlorophenylhydrazine Chemical compound NNC1=CC=C(Cl)C=C1 XXNOGQJZAOXWAQ-UHFFFAOYSA-N 0.000 description 1
- AEUVSCKRGPDBTC-UHFFFAOYSA-N 4-fluoro-n-[1-(5-nitrofuran-2-yl)ethylideneamino]aniline Chemical compound C=1C=C([N+]([O-])=O)OC=1C(C)=NNC1=CC=C(F)C=C1 AEUVSCKRGPDBTC-UHFFFAOYSA-N 0.000 description 1
- 125000004176 4-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1F)C([H])([H])* 0.000 description 1
- ZMZGIVVRBMFZSG-UHFFFAOYSA-N 4-hydroxybenzohydrazide Chemical compound NNC(=O)C1=CC=C(O)C=C1 ZMZGIVVRBMFZSG-UHFFFAOYSA-N 0.000 description 1
- 229940090248 4-hydroxybenzoic acid Drugs 0.000 description 1
- FAYITFHNWSZKKF-UHFFFAOYSA-N 4-isocyanato-3-(5-nitrofuran-2-yl)-1-phenylpyrazole Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NN(C=2C=CC=CC=2)C=C1N=C=O FAYITFHNWSZKKF-UHFFFAOYSA-N 0.000 description 1
- CKAHZHUKQQEPMS-UHFFFAOYSA-N 4-methoxy-n-[1-(5-nitrofuran-2-yl)ethylideneamino]aniline Chemical compound C1=CC(OC)=CC=C1NN=C(C)C1=CC=C([N+]([O-])=O)O1 CKAHZHUKQQEPMS-UHFFFAOYSA-N 0.000 description 1
- JAQAZPUOQGCSRF-UHFFFAOYSA-N 4-methoxy-n-[[3-(5-nitrofuran-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]benzamide Chemical compound C1=CC(OC)=CC=C1C(=O)NN=CC1=CN(C=2C=CC=CC=2)N=C1C1=CC=C([N+]([O-])=O)O1 JAQAZPUOQGCSRF-UHFFFAOYSA-N 0.000 description 1
- DZOJNGAWPALJPE-UHFFFAOYSA-N 4-methyl-n-[1-(5-nitrofuran-2-yl)ethylideneamino]aniline Chemical compound C=1C=C([N+]([O-])=O)OC=1C(C)=NNC1=CC=C(C)C=C1 DZOJNGAWPALJPE-UHFFFAOYSA-N 0.000 description 1
- NSHXSONGROCLKM-UHFFFAOYSA-N 4-nitro-n-[1-(5-nitrofuran-2-yl)ethylideneamino]aniline Chemical compound C=1C=C([N+]([O-])=O)OC=1C(C)=NNC1=CC=C([N+]([O-])=O)C=C1 NSHXSONGROCLKM-UHFFFAOYSA-N 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- YTCWCEFBUBWVFU-UHFFFAOYSA-N 5-(5-nitrofuran-2-yl)-1h-pyrazole-4-carboxamide Chemical compound NC(=O)C1=CNN=C1C1=CC=C([N+]([O-])=O)O1 YTCWCEFBUBWVFU-UHFFFAOYSA-N 0.000 description 1
- DMWLQMYOBOOAFQ-UHFFFAOYSA-N 5-(furan-2-yl)-1h-pyrazole-4-carbaldehyde Chemical compound O=CC1=CNN=C1C1=CC=CO1 DMWLQMYOBOOAFQ-UHFFFAOYSA-N 0.000 description 1
- SXINBFXPADXIEY-UHFFFAOYSA-N 5-Nitrofurfural Chemical compound [O-][N+](=O)C1=CC=C(C=O)O1 SXINBFXPADXIEY-UHFFFAOYSA-N 0.000 description 1
- 239000005725 8-Hydroxyquinoline Substances 0.000 description 1
- UCDBLYHPJMMFMY-UHFFFAOYSA-N 8-bromoquinoline-4-carbonitrile Chemical compound C1=CN=C2C(Br)=CC=CC2=C1C#N UCDBLYHPJMMFMY-UHFFFAOYSA-N 0.000 description 1
- UJTTUOLQLCQZEA-UHFFFAOYSA-N 9h-fluoren-9-ylmethyl n-(4-hydroxybutyl)carbamate Chemical compound C1=CC=C2C(COC(=O)NCCCCO)C3=CC=CC=C3C2=C1 UJTTUOLQLCQZEA-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 206010001935 American trypanosomiasis Diseases 0.000 description 1
- 240000002470 Amphicarpaea bracteata Species 0.000 description 1
- APKFDSVGJQXUKY-KKGHZKTASA-N Amphotericin-B Natural products O[C@H]1[C@@H](N)[C@H](O)[C@@H](C)O[C@H]1O[C@H]1C=CC=CC=CC=CC=CC=CC=C[C@H](C)[C@@H](O)[C@@H](C)[C@H](C)OC(=O)C[C@H](O)C[C@H](O)CC[C@@H](O)[C@H](O)C[C@H](O)C[C@](O)(C[C@H](O)[C@H]2C(O)=O)O[C@H]2C1 APKFDSVGJQXUKY-KKGHZKTASA-N 0.000 description 1
- 208000031295 Animal disease Diseases 0.000 description 1
- 241001480043 Arthrodermataceae Species 0.000 description 1
- 241000271566 Aves Species 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- 241001112741 Bacillaceae Species 0.000 description 1
- 244000063299 Bacillus subtilis Species 0.000 description 1
- 235000014469 Bacillus subtilis Nutrition 0.000 description 1
- 108010001478 Bacitracin Proteins 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- UYIFTLBWAOGQBI-BZDYCCQFSA-N Benzhormovarine Chemical compound C([C@@H]1[C@@H](C2=CC=3)CC[C@]4([C@H]1CC[C@@H]4O)C)CC2=CC=3OC(=O)C1=CC=CC=C1 UYIFTLBWAOGQBI-BZDYCCQFSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- DJKTVYDGVXRBEO-UHFFFAOYSA-N C1=CC(OC)=CC=C1N1N=C(C=2OC(=CC=2)[N+]([O-])=O)C(C=NN2CCOCC2)=C1 Chemical compound C1=CC(OC)=CC=C1N1N=C(C=2OC(=CC=2)[N+]([O-])=O)C(C=NN2CCOCC2)=C1 DJKTVYDGVXRBEO-UHFFFAOYSA-N 0.000 description 1
- UTYOSZXIXOASDU-UHFFFAOYSA-N COC1=CC=C(COC(=O)NN=CC=2C(=NNC2)C=2OC(=CC2)[N+](=O)[O-])C=C1 Chemical compound COC1=CC=C(COC(=O)NN=CC=2C(=NNC2)C=2OC(=CC2)[N+](=O)[O-])C=C1 UTYOSZXIXOASDU-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 229930186147 Cephalosporin Natural products 0.000 description 1
- HOKIDJSKDBPKTQ-GLXFQSAKSA-N Cephalosporin C Natural products S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)[C@@H](NC(=O)CCC[C@@H](N)C(O)=O)[C@@H]12 HOKIDJSKDBPKTQ-GLXFQSAKSA-N 0.000 description 1
- 241000224483 Coccidia Species 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- 208000003322 Coinfection Diseases 0.000 description 1
- 241000186031 Corynebacteriaceae Species 0.000 description 1
- UDIPTWFVPPPURJ-UHFFFAOYSA-M Cyclamate Chemical compound [Na+].[O-]S(=O)(=O)NC1CCCCC1 UDIPTWFVPPPURJ-UHFFFAOYSA-M 0.000 description 1
- VYZAHLCBVHPDDF-UHFFFAOYSA-N Dinitrochlorobenzene Chemical compound [O-][N+](=O)C1=CC=C(Cl)C([N+]([O-])=O)=C1 VYZAHLCBVHPDDF-UHFFFAOYSA-N 0.000 description 1
- 238000006364 Duff aldehyde synthesis reaction Methods 0.000 description 1
- 241000223924 Eimeria Species 0.000 description 1
- 241000224432 Entamoeba histolytica Species 0.000 description 1
- 241000588921 Enterobacteriaceae Species 0.000 description 1
- 241000194033 Enterococcus Species 0.000 description 1
- 241000194032 Enterococcus faecalis Species 0.000 description 1
- 241000283086 Equidae Species 0.000 description 1
- 241000588722 Escherichia Species 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 1
- 241000588747 Klebsiella pneumoniae Species 0.000 description 1
- 241000222722 Leishmania <genus> Species 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- RLAHWVDQYNDAGG-UHFFFAOYSA-N Methanetriol Chemical class OC(O)O RLAHWVDQYNDAGG-UHFFFAOYSA-N 0.000 description 1
- 241000192017 Micrococcaceae Species 0.000 description 1
- 241000187479 Mycobacterium tuberculosis Species 0.000 description 1
- SUAKHGWARZSWIH-UHFFFAOYSA-N N,N‐diethylformamide Chemical compound CCN(CC)C=O SUAKHGWARZSWIH-UHFFFAOYSA-N 0.000 description 1
- OGDUPHHSEPKVKS-UHFFFAOYSA-N N-[1-(5-nitrofuran-2-yl)ethylideneamino]methanamine Chemical compound CNN=C(C)C1=CC=C([N+]([O-])=O)O1 OGDUPHHSEPKVKS-UHFFFAOYSA-N 0.000 description 1
- YZERXSUGKCVWLS-UHFFFAOYSA-N N-[5-(5-nitrofuran-2-yl)-1H-pyrazol-4-yl]methanimine Chemical class O1C([N+](=O)[O-])=CC=C1C1=C(N=C)C=NN1 YZERXSUGKCVWLS-UHFFFAOYSA-N 0.000 description 1
- ZJFFUOGSERAZOY-UHFFFAOYSA-N N-[[1-(2-chloro-4-methylphenyl)-3-(5-nitrofuran-2-yl)pyrazol-4-yl]methylidene]hydroxylamine Chemical compound ClC=1C=C(C=CC1N1N=C(C(=C1)C=NO)C=1OC(=CC1)[N+](=O)[O-])C ZJFFUOGSERAZOY-UHFFFAOYSA-N 0.000 description 1
- NFHBXLGFOYFGGW-UHFFFAOYSA-N N-[[5-(5-nitrofuran-2-yl)-1H-pyrazol-4-yl]methylideneamino]pyridin-3-amine Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NNC=C1C=NNC1=CC=CN=C1 NFHBXLGFOYFGGW-UHFFFAOYSA-N 0.000 description 1
- RPLYNQCTWPAZMD-UHFFFAOYSA-N N-[[5-(5-nitrofuran-2-yl)-1H-pyrazol-4-yl]methylideneamino]pyridine-3-carboxamide Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NNC=C1C=NNC(=O)C1=CC=CN=C1 RPLYNQCTWPAZMD-UHFFFAOYSA-N 0.000 description 1
- JENFNTAIUWGRNA-UHFFFAOYSA-N N-methyl-N-[[5-(5-nitrofuran-2-yl)-1H-pyrazol-4-yl]methylideneamino]methanamine Chemical compound CN(C)N=CC1=CNN=C1C1=CC=C([N+]([O-])=O)O1 JENFNTAIUWGRNA-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- 241000341511 Nematodes Species 0.000 description 1
- 229930193140 Neomycin Natural products 0.000 description 1
- RDXLYGJSWZYTFJ-UHFFFAOYSA-N Niridazole Chemical compound S1C([N+](=O)[O-])=CN=C1N1C(=O)NCC1 RDXLYGJSWZYTFJ-UHFFFAOYSA-N 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 241001494479 Pecora Species 0.000 description 1
- 229930182555 Penicillin Natural products 0.000 description 1
- 201000007100 Pharyngitis Diseases 0.000 description 1
- 241000286209 Phasianidae Species 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- NCXMLFZGDNKEPB-UHFFFAOYSA-N Pimaricin Natural products OC1C(N)C(O)C(C)OC1OC1C=CC=CC=CC=CCC(C)OC(=O)C=CC2OC2CC(O)CC(O)(CC(O)C2C(O)=O)OC2C1 NCXMLFZGDNKEPB-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- 241000588770 Proteus mirabilis Species 0.000 description 1
- 241000588777 Providencia rettgeri Species 0.000 description 1
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- 241000607142 Salmonella Species 0.000 description 1
- 241001354013 Salmonella enterica subsp. enterica serovar Enteritidis Species 0.000 description 1
- 244000000231 Sesamum indicum Species 0.000 description 1
- 235000003434 Sesamum indicum Nutrition 0.000 description 1
- 241000607768 Shigella Species 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 239000004280 Sodium formate Substances 0.000 description 1
- 244000258044 Solanum gilo Species 0.000 description 1
- 240000006394 Sorghum bicolor Species 0.000 description 1
- 241000191967 Staphylococcus aureus Species 0.000 description 1
- 241000194018 Streptococcaceae Species 0.000 description 1
- 241000193996 Streptococcus pyogenes Species 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- 239000004098 Tetracycline Substances 0.000 description 1
- 241000869417 Trematodes Species 0.000 description 1
- DRUIESSIVFYOMK-UHFFFAOYSA-N Trichloroacetonitrile Chemical compound ClC(Cl)(Cl)C#N DRUIESSIVFYOMK-UHFFFAOYSA-N 0.000 description 1
- 241001502500 Trichomonadida Species 0.000 description 1
- 241000224526 Trichomonas Species 0.000 description 1
- 208000005448 Trichomonas Infections Diseases 0.000 description 1
- 241000224527 Trichomonas vaginalis Species 0.000 description 1
- 206010044620 Trichomoniasis Diseases 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 244000098338 Triticum aestivum Species 0.000 description 1
- 241000186064 Trueperella pyogenes Species 0.000 description 1
- 241000223105 Trypanosoma brucei Species 0.000 description 1
- 241001442399 Trypanosoma brucei gambiense Species 0.000 description 1
- 241001442397 Trypanosoma brucei rhodesiense Species 0.000 description 1
- 241000223109 Trypanosoma cruzi Species 0.000 description 1
- 208000025865 Ulcer Diseases 0.000 description 1
- 241000251539 Vertebrata <Metazoa> Species 0.000 description 1
- 238000005874 Vilsmeier-Haack formylation reaction Methods 0.000 description 1
- 206010048038 Wound infection Diseases 0.000 description 1
- 208000027418 Wounds and injury Diseases 0.000 description 1
- 241001080519 Zera Species 0.000 description 1
- WERKSKAQRVDLDW-ANOHMWSOSA-N [(2s,3r,4r,5r)-2,3,4,5,6-pentahydroxyhexyl] (z)-octadec-9-enoate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO WERKSKAQRVDLDW-ANOHMWSOSA-N 0.000 description 1
- XAHNWAUQKLXYDL-UHFFFAOYSA-N [1-methyl-3-(5-nitrofuran-2-yl)pyrazol-4-yl]methanol Chemical compound CN1C=C(CO)C(C=2OC(=CC=2)[N+]([O-])=O)=N1 XAHNWAUQKLXYDL-UHFFFAOYSA-N 0.000 description 1
- HCSWWOOUMCRHKM-UHFFFAOYSA-N [3-(5-nitrofuran-2-yl)-1-phenylpyrazol-4-yl]methanol Chemical compound OCC1=CN(C=2C=CC=CC=2)N=C1C1=CC=C([N+]([O-])=O)O1 HCSWWOOUMCRHKM-UHFFFAOYSA-N 0.000 description 1
- UOMCYAUKQLBGAF-UHFFFAOYSA-N [3-(5-nitrofuran-2-yl)-1-phenylpyrazole-4-carbonyl] 3-(5-nitrofuran-2-yl)-1-phenylpyrazole-4-carboxylate Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NN(C=2C=CC=CC=2)C=C1C(=O)OC(=O)C1=CN(C=2C=CC=CC=2)N=C1C1=CC=C([N+]([O-])=O)O1 UOMCYAUKQLBGAF-UHFFFAOYSA-N 0.000 description 1
- AQMHNCQZLQUNJI-UHFFFAOYSA-N [CH2]CCCCCC Chemical compound [CH2]CCCCCC AQMHNCQZLQUNJI-UHFFFAOYSA-N 0.000 description 1
- UEUSDMVQEINNEV-UHFFFAOYSA-N [[5-(5-nitrofuran-2-yl)-1H-pyrazol-4-yl]methylideneamino]urea Chemical compound NC(=O)NN=CC1=CNN=C1C1=CC=C([N+]([O-])=O)O1 UEUSDMVQEINNEV-UHFFFAOYSA-N 0.000 description 1
- 239000000370 acceptor Substances 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 125000005598 acylhydrazone group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000004705 aldimines Chemical class 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 125000005278 alkyl sulfonyloxy group Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 229940063655 aluminum stearate Drugs 0.000 description 1
- VAGJQUQWYHFUOX-UHFFFAOYSA-N amino-(4-chlorophenyl)azanium;hydrogen sulfate Chemical compound OS(O)(=O)=O.NNC1=CC=C(Cl)C=C1 VAGJQUQWYHFUOX-UHFFFAOYSA-N 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- APKFDSVGJQXUKY-INPOYWNPSA-N amphotericin B Chemical compound O[C@H]1[C@@H](N)[C@H](O)[C@@H](C)O[C@H]1O[C@H]1/C=C/C=C/C=C/C=C/C=C/C=C/C=C/[C@H](C)[C@@H](O)[C@@H](C)[C@H](C)OC(=O)C[C@H](O)C[C@H](O)CC[C@@H](O)[C@H](O)C[C@H](O)C[C@](O)(C[C@H](O)[C@H]2C(O)=O)O[C@H]2C1 APKFDSVGJQXUKY-INPOYWNPSA-N 0.000 description 1
- 229960003942 amphotericin b Drugs 0.000 description 1
- AVKUERGKIZMTKX-NJBDSQKTSA-N ampicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=CC=C1 AVKUERGKIZMTKX-NJBDSQKTSA-N 0.000 description 1
- 229960000723 ampicillin Drugs 0.000 description 1
- 239000003674 animal food additive Substances 0.000 description 1
- 230000000843 anti-fungal effect Effects 0.000 description 1
- 239000003429 antifungal agent Substances 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000003435 aroyl group Chemical group 0.000 description 1
- 239000000305 astragalus gummifer gum Substances 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- IVRMZWNICZWHMI-UHFFFAOYSA-N azide group Chemical group [N-]=[N+]=[N-] IVRMZWNICZWHMI-UHFFFAOYSA-N 0.000 description 1
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 description 1
- 229960003071 bacitracin Drugs 0.000 description 1
- 229930184125 bacitracin Natural products 0.000 description 1
- CLKOFPXJLQSYAH-ABRJDSQDSA-N bacitracin A Chemical compound C1SC([C@@H](N)[C@@H](C)CC)=N[C@@H]1C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](CCC(O)=O)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H]1C(=O)N[C@H](CCCN)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CC=2N=CNC=2)C(=O)N[C@H](CC(O)=O)C(=O)N[C@@H](CC(N)=O)C(=O)NCCCC1 CLKOFPXJLQSYAH-ABRJDSQDSA-N 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 235000013871 bee wax Nutrition 0.000 description 1
- 235000015278 beef Nutrition 0.000 description 1
- 239000012166 beeswax Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 235000012216 bentonite Nutrition 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 210000000481 breast Anatomy 0.000 description 1
- IAQRGUVFOMOMEM-UHFFFAOYSA-N but-2-ene Chemical group CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- YHASWHZGWUONAO-UHFFFAOYSA-N butanoyl butanoate Chemical compound CCCC(=O)OC(=O)CCC YHASWHZGWUONAO-UHFFFAOYSA-N 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 239000000378 calcium silicate Substances 0.000 description 1
- 229910052918 calcium silicate Inorganic materials 0.000 description 1
- OYACROKNLOSFPA-UHFFFAOYSA-N calcium;dioxido(oxo)silane Chemical compound [Ca+2].[O-][Si]([O-])=O OYACROKNLOSFPA-UHFFFAOYSA-N 0.000 description 1
- 244000309466 calf Species 0.000 description 1
- 150000001720 carbohydrates Chemical class 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 150000003857 carboxamides Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 235000010980 cellulose Nutrition 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 229940124587 cephalosporin Drugs 0.000 description 1
- HOKIDJSKDBPKTQ-GLXFQSAKSA-M cephalosporin C(1-) Chemical compound S1CC(COC(=O)C)=C(C([O-])=O)N2C(=O)[C@@H](NC(=O)CCC[C@@H]([NH3+])C([O-])=O)[C@@H]12 HOKIDJSKDBPKTQ-GLXFQSAKSA-M 0.000 description 1
- 150000001780 cephalosporins Chemical class 0.000 description 1
- 229960000541 cetyl alcohol Drugs 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- 229960005091 chloramphenicol Drugs 0.000 description 1
- WIIZWVCIJKGZOK-RKDXNWHRSA-N chloramphenicol Chemical compound ClC(Cl)C(=O)N[C@H](CO)[C@H](O)C1=CC=C([N+]([O-])=O)C=C1 WIIZWVCIJKGZOK-RKDXNWHRSA-N 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 125000000490 cinnamyl group Chemical group C(C=CC1=CC=CC=C1)* 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 239000007891 compressed tablet Substances 0.000 description 1
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 239000000625 cyclamic acid and its Na and Ca salt Substances 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- HXCKCCRKGXHOBK-UHFFFAOYSA-N cycloheptane Chemical compound [CH]1CCCCCC1 HXCKCCRKGXHOBK-UHFFFAOYSA-N 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 230000037304 dermatophytes Effects 0.000 description 1
- 239000000645 desinfectant Substances 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- PFBUKDPBVNJDEW-UHFFFAOYSA-N dichlorocarbene Chemical class Cl[C]Cl PFBUKDPBVNJDEW-UHFFFAOYSA-N 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- IRUNKQSGDBYUDC-UHFFFAOYSA-N diethoxymethyl acetate Chemical compound CCOC(OCC)OC(C)=O IRUNKQSGDBYUDC-UHFFFAOYSA-N 0.000 description 1
- CVCGMTLZBNZJBG-UHFFFAOYSA-M dimethyl-[[3-(5-nitrofuran-2-yl)-1-phenylpyrazol-4-yl]methylidene]azanium;perchlorate Chemical compound [O-]Cl(=O)(=O)=O.C[N+](C)=CC1=CN(C=2C=CC=CC=2)N=C1C1=CC=C([N+]([O-])=O)O1 CVCGMTLZBNZJBG-UHFFFAOYSA-M 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 229940007078 entamoeba histolytica Drugs 0.000 description 1
- 229950002007 estradiol benzoate Drugs 0.000 description 1
- 229940011871 estrogen Drugs 0.000 description 1
- 239000000262 estrogen Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- SDEUIXOPFTZBBK-UHFFFAOYSA-N ethyl 4-formyl-3-(5-nitrofuran-2-yl)pyrazole-1-carboxylate Chemical compound CCOC(=O)N1C=C(C=O)C(C=2OC(=CC=2)[N+]([O-])=O)=N1 SDEUIXOPFTZBBK-UHFFFAOYSA-N 0.000 description 1
- OKUXNSODWMJUDS-UHFFFAOYSA-N ethyl n-[[1-(4-chlorophenyl)-3-(5-nitrofuran-2-yl)pyrazol-4-yl]methylideneamino]carbamate Chemical compound CCOC(=O)NN=CC1=CN(C=2C=CC(Cl)=CC=2)N=C1C1=CC=C([N+]([O-])=O)O1 OKUXNSODWMJUDS-UHFFFAOYSA-N 0.000 description 1
- QFLHIVSDXOUKAO-UHFFFAOYSA-N ethyl n-[[1-(4-methoxyphenyl)-3-(5-nitrofuran-2-yl)pyrazol-4-yl]methylideneamino]carbamate Chemical compound CCOC(=O)NN=CC1=CN(C=2C=CC(OC)=CC=2)N=C1C1=CC=C([N+]([O-])=O)O1 QFLHIVSDXOUKAO-UHFFFAOYSA-N 0.000 description 1
- MJQGCLJJWDKIEC-UHFFFAOYSA-N ethyl n-[[1-(4-methylphenyl)-3-(5-nitrofuran-2-yl)pyrazol-4-yl]methylideneamino]carbamate Chemical compound CCOC(=O)NN=CC1=CN(C=2C=CC(C)=CC=2)N=C1C1=CC=C([N+]([O-])=O)O1 MJQGCLJJWDKIEC-UHFFFAOYSA-N 0.000 description 1
- YTFDXVULSPNXNT-UHFFFAOYSA-N ethyl n-[[1-benzyl-3-(5-nitrofuran-2-yl)pyrazol-4-yl]methylideneamino]carbamate Chemical compound N1=C(C=2OC(=CC=2)[N+]([O-])=O)C(C=NNC(=O)OCC)=CN1CC1=CC=CC=C1 YTFDXVULSPNXNT-UHFFFAOYSA-N 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 210000003754 fetus Anatomy 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 229960001031 glucose Drugs 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- LEQAOMBKQFMDFZ-UHFFFAOYSA-N glyoxal Chemical compound O=CC=O LEQAOMBKQFMDFZ-UHFFFAOYSA-N 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 125000005059 halophenyl group Chemical group 0.000 description 1
- 239000007902 hard capsule Substances 0.000 description 1
- 230000036074 healthy skin Effects 0.000 description 1
- 244000000013 helminth Species 0.000 description 1
- QKWRNBNHSRYCOE-UHFFFAOYSA-N hexanehydrazide Chemical compound CCCCCC(=O)NN QKWRNBNHSRYCOE-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- BRWIZMBXBAOCCF-UHFFFAOYSA-N hydrazinecarbothioamide Chemical compound NNC(N)=S BRWIZMBXBAOCCF-UHFFFAOYSA-N 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 229960000890 hydrocortisone Drugs 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 1
- 239000001863 hydroxypropyl cellulose Substances 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 229960004903 invert sugar Drugs 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000005956 isoquinolyl group Chemical group 0.000 description 1
- SBUJHOSQTJFQJX-NOAMYHISSA-N kanamycin Chemical class O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O[C@@H]2[C@@H]([C@@H](N)[C@H](O)[C@@H](CO)O2)O)[C@H](N)C[C@@H]1N SBUJHOSQTJFQJX-NOAMYHISSA-N 0.000 description 1
- 229930027917 kanamycin Natural products 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 229960001375 lactose Drugs 0.000 description 1
- RLJMLMKIBZAXJO-UHFFFAOYSA-N lead nitrate Chemical compound [O-][N+](=O)O[Pb]O[N+]([O-])=O RLJMLMKIBZAXJO-UHFFFAOYSA-N 0.000 description 1
- ACKFDYCQCBEDNU-UHFFFAOYSA-J lead(2+);tetraacetate Chemical compound [Pb+2].CC([O-])=O.CC([O-])=O.CC([O-])=O.CC([O-])=O ACKFDYCQCBEDNU-UHFFFAOYSA-J 0.000 description 1
- 235000010445 lecithin Nutrition 0.000 description 1
- 239000000787 lecithin Substances 0.000 description 1
- 229940067606 lecithin Drugs 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 208000004396 mastitis Diseases 0.000 description 1
- GPKUICFDWYEPTK-UHFFFAOYSA-N methoxycyclohexatriene Chemical compound COC1=CC=C=C[CH]1 GPKUICFDWYEPTK-UHFFFAOYSA-N 0.000 description 1
- QABLOFMHHSOFRJ-UHFFFAOYSA-N methyl 2-chloroacetate Chemical compound COC(=O)CCl QABLOFMHHSOFRJ-UHFFFAOYSA-N 0.000 description 1
- VXOSHCSDRXVQRR-UHFFFAOYSA-N methyl N-[[3-(5-nitrofuran-2-yl)-1-pyridin-2-ylpyrazol-4-yl]methylideneamino]carbamate Chemical compound COC(=O)NN=CC1=CN(C=2N=CC=CC=2)N=C1C1=CC=C([N+]([O-])=O)O1 VXOSHCSDRXVQRR-UHFFFAOYSA-N 0.000 description 1
- BBETUSYDYSMJEQ-UHFFFAOYSA-N methyl N-[[5-(5-nitrofuran-2-yl)-1H-pyrazol-4-yl]methylideneamino]carbamate Chemical compound COC(=O)NN=CC1=CNN=C1C1=CC=C([N+]([O-])=O)O1 BBETUSYDYSMJEQ-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 1
- OEDQHDWXNXJMFG-UHFFFAOYSA-N methyl n-[[3-(5-nitrofuran-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]carbamate Chemical compound COC(=O)NN=CC1=CN(C=2C=CC=CC=2)N=C1C1=CC=C([N+]([O-])=O)O1 OEDQHDWXNXJMFG-UHFFFAOYSA-N 0.000 description 1
- DHEOKBRDXVRGFS-UHFFFAOYSA-N methyl n-[[3-(5-nitrofuran-2-yl)-1-pyridin-3-ylpyrazol-4-yl]methylideneamino]carbamate Chemical compound COC(=O)NN=CC1=CN(C=2C=NC=CC=2)N=C1C1=CC=C([N+]([O-])=O)O1 DHEOKBRDXVRGFS-UHFFFAOYSA-N 0.000 description 1
- WFJRIDQGVSJLLH-UHFFFAOYSA-N methyl n-aminocarbamate Chemical compound COC(=O)NN WFJRIDQGVSJLLH-UHFFFAOYSA-N 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 229960000282 metronidazole Drugs 0.000 description 1
- VAOCPAMSLUNLGC-UHFFFAOYSA-N metronidazole Chemical compound CC1=NC=C([N+]([O-])=O)N1CCO VAOCPAMSLUNLGC-UHFFFAOYSA-N 0.000 description 1
- 230000000813 microbial effect Effects 0.000 description 1
- MKQLBNJQQZRQJU-UHFFFAOYSA-N morpholin-4-amine Chemical compound NN1CCOCC1 MKQLBNJQQZRQJU-UHFFFAOYSA-N 0.000 description 1
- 125000001064 morpholinomethyl group Chemical group [H]C([H])(*)N1C([H])([H])C([H])([H])OC([H])([H])C1([H])[H] 0.000 description 1
- KVKFRMCSXWQSNT-UHFFFAOYSA-N n,n'-dimethylethane-1,2-diamine Chemical compound CNCCNC KVKFRMCSXWQSNT-UHFFFAOYSA-N 0.000 description 1
- UNBDDZDKBWPHAX-UHFFFAOYSA-N n,n-di(propan-2-yl)formamide Chemical compound CC(C)N(C=O)C(C)C UNBDDZDKBWPHAX-UHFFFAOYSA-N 0.000 description 1
- REJLCUVAUYGSQE-UHFFFAOYSA-N n-[1-(furan-2-yl)ethylideneamino]aniline Chemical compound C=1C=COC=1C(C)=NNC1=CC=CC=C1 REJLCUVAUYGSQE-UHFFFAOYSA-N 0.000 description 1
- LZXGYOPMPFSOQG-UHFFFAOYSA-N n-[[1-(2-chlorophenyl)-3-(5-nitrofuran-2-yl)pyrazol-4-yl]methylidene]hydroxylamine Chemical compound ON=CC1=CN(C=2C(=CC=CC=2)Cl)N=C1C1=CC=C([N+]([O-])=O)O1 LZXGYOPMPFSOQG-UHFFFAOYSA-N 0.000 description 1
- AEDQSBGMYHTCGI-UHFFFAOYSA-N n-[[1-(4-bromophenyl)-3-(5-nitrofuran-2-yl)pyrazol-4-yl]methylidene]hydroxylamine Chemical compound ON=CC1=CN(C=2C=CC(Br)=CC=2)N=C1C1=CC=C([N+]([O-])=O)O1 AEDQSBGMYHTCGI-UHFFFAOYSA-N 0.000 description 1
- VMGJJVQTLAWBRB-UHFFFAOYSA-N n-[[1-(4-chlorophenyl)-3-(5-nitrofuran-2-yl)pyrazol-4-yl]methylidene]hydroxylamine Chemical compound ON=CC1=CN(C=2C=CC(Cl)=CC=2)N=C1C1=CC=C([N+]([O-])=O)O1 VMGJJVQTLAWBRB-UHFFFAOYSA-N 0.000 description 1
- IRVKKAVFKLPSMT-UHFFFAOYSA-N n-[[1-(4-methoxyphenyl)-3-(5-nitrofuran-2-yl)pyrazol-4-yl]methylidene]hydroxylamine Chemical compound C1=CC(OC)=CC=C1N1N=C(C=2OC(=CC=2)[N+]([O-])=O)C(C=NO)=C1 IRVKKAVFKLPSMT-UHFFFAOYSA-N 0.000 description 1
- VCEPNSDCCPIGFF-UHFFFAOYSA-N n-[[1-methyl-3-(5-nitrofuran-2-yl)pyrazol-4-yl]methylideneamino]-1,3-benzothiazol-2-amine Chemical compound N=1N(C)C=C(C=NNC=2SC3=CC=CC=C3N=2)C=1C1=CC=C([N+]([O-])=O)O1 VCEPNSDCCPIGFF-UHFFFAOYSA-N 0.000 description 1
- APLLIQARBTTZTI-UHFFFAOYSA-N n-[[1-methyl-3-(5-nitrofuran-2-yl)pyrazol-4-yl]methylideneamino]acetamide Chemical compound CC(=O)NN=CC1=CN(C)N=C1C1=CC=C([N+]([O-])=O)O1 APLLIQARBTTZTI-UHFFFAOYSA-N 0.000 description 1
- KKFRRQMWTGOCGF-UHFFFAOYSA-N n-[[3-(5-nitrofuran-2-yl)-1-(3-nitrophenyl)pyrazol-4-yl]methylidene]hydroxylamine Chemical compound ON=CC1=CN(C=2C=C(C=CC=2)[N+]([O-])=O)N=C1C1=CC=C([N+]([O-])=O)O1 KKFRRQMWTGOCGF-UHFFFAOYSA-N 0.000 description 1
- DKHRCNLMRUJJFZ-UHFFFAOYSA-N n-[[3-(5-nitrofuran-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]benzamide Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NN(C=2C=CC=CC=2)C=C1C=NNC(=O)C1=CC=CC=C1 DKHRCNLMRUJJFZ-UHFFFAOYSA-N 0.000 description 1
- YMPCDPPURKMENC-UHFFFAOYSA-N n-[[3-(5-nitrofuran-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]pyridine-3-carboxamide Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NN(C=2C=CC=CC=2)C=C1C=NNC(=O)C1=CC=CN=C1 YMPCDPPURKMENC-UHFFFAOYSA-N 0.000 description 1
- KBDADONJAIXLMX-UHFFFAOYSA-N n-[[3-(5-nitrofuran-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]quinolin-3-amine Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NN(C=2C=CC=CC=2)C=C1C=NNC1=CN=C(C=CC=C2)C2=C1 KBDADONJAIXLMX-UHFFFAOYSA-N 0.000 description 1
- QBWLJUWVZHJGDX-UHFFFAOYSA-N n-[[3-(5-nitrofuran-2-yl)-1-pyridin-2-ylpyrazol-4-yl]methylidene]hydroxylamine Chemical compound ON=CC1=CN(C=2N=CC=CC=2)N=C1C1=CC=C([N+]([O-])=O)O1 QBWLJUWVZHJGDX-UHFFFAOYSA-N 0.000 description 1
- SHJRJBMVHJTGJM-UHFFFAOYSA-N n-ethyl-n-(2-methylphenyl)formamide Chemical compound CCN(C=O)C1=CC=CC=C1C SHJRJBMVHJTGJM-UHFFFAOYSA-N 0.000 description 1
- ICBRSNXJRWPLMU-UHFFFAOYSA-N n-methyl-3-(5-nitrofuran-2-yl)-1-phenylpyrazole-4-carboxamide Chemical compound CNC(=O)C1=CN(C=2C=CC=CC=2)N=C1C1=CC=C([N+]([O-])=O)O1 ICBRSNXJRWPLMU-UHFFFAOYSA-N 0.000 description 1
- VNICRWVQYFRWDK-UHFFFAOYSA-N naphthalen-2-ylhydrazine Chemical compound C1=CC=CC2=CC(NN)=CC=C21 VNICRWVQYFRWDK-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 229960003255 natamycin Drugs 0.000 description 1
- NCXMLFZGDNKEPB-FFPOYIOWSA-N natamycin Chemical compound O[C@H]1[C@@H](N)[C@H](O)[C@@H](C)O[C@H]1O[C@H]1/C=C/C=C/C=C/C=C/C[C@@H](C)OC(=O)/C=C/[C@H]2O[C@@H]2C[C@H](O)C[C@](O)(C[C@H](O)[C@H]2C(O)=O)O[C@H]2C1 NCXMLFZGDNKEPB-FFPOYIOWSA-N 0.000 description 1
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000002547 new drug Substances 0.000 description 1
- 229960002136 nifuratel Drugs 0.000 description 1
- SRQKTCXJCCHINN-NYYWCZLTSA-N nifuratel Chemical compound O=C1OC(CSC)CN1\N=C\C1=CC=C([N+]([O-])=O)O1 SRQKTCXJCCHINN-NYYWCZLTSA-N 0.000 description 1
- YCWSUKQGVSGXJO-NTUHNPAUSA-N nifuroxazide Chemical compound C1=CC(O)=CC=C1C(=O)N\N=C\C1=CC=C([N+]([O-])=O)O1 YCWSUKQGVSGXJO-NTUHNPAUSA-N 0.000 description 1
- 229960003888 nifuroxazide Drugs 0.000 description 1
- 229960005130 niridazole Drugs 0.000 description 1
- 238000005121 nitriding Methods 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 229960000988 nystatin Drugs 0.000 description 1
- VQOXZBDYSJBXMA-NQTDYLQESA-N nystatin A1 Chemical compound O[C@H]1[C@@H](N)[C@H](O)[C@@H](C)O[C@H]1O[C@H]1/C=C/C=C/C=C/C=C/CC/C=C/C=C/[C@H](C)[C@@H](O)[C@@H](C)[C@H](C)OC(=O)C[C@H](O)C[C@H](O)C[C@H](O)CC[C@@H](O)[C@H](O)C[C@](O)(C[C@H](O)[C@H]2C(O)=O)O[C@H]2C1 VQOXZBDYSJBXMA-NQTDYLQESA-N 0.000 description 1
- 125000005441 o-toluyl group Chemical group [H]C1=C([H])C(C(*)=O)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 125000001477 organic nitrogen group Chemical group 0.000 description 1
- 150000002905 orthoesters Chemical class 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000033116 oxidation-reduction process Effects 0.000 description 1
- 150000002926 oxygen Chemical class 0.000 description 1
- 229960003540 oxyquinoline Drugs 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 210000002741 palatine tonsil Anatomy 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 229940056360 penicillin g Drugs 0.000 description 1
- 150000002960 penicillins Chemical class 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000002831 pharmacologic agent Substances 0.000 description 1
- 239000003444 phase transfer catalyst Substances 0.000 description 1
- 150000007965 phenolic acids Chemical class 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 239000002459 polyene antibiotic agent Substances 0.000 description 1
- 239000003910 polypeptide antibiotic agent Substances 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229940072033 potash Drugs 0.000 description 1
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 244000144977 poultry Species 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 1
- LZFIOSVZIQOVFW-UHFFFAOYSA-N propyl 2-hydroxybenzoate Chemical class CCCOC(=O)C1=CC=CC=C1O LZFIOSVZIQOVFW-UHFFFAOYSA-N 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- KOUKXHPPRFNWPP-UHFFFAOYSA-N pyrazine-2,5-dicarboxylic acid;hydrate Chemical compound O.OC(=O)C1=CN=C(C(O)=O)C=N1 KOUKXHPPRFNWPP-UHFFFAOYSA-N 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- IBORBSYHSWWFAU-UHFFFAOYSA-N quinolin-3-ylhydrazine;dihydrochloride Chemical compound Cl.Cl.C1=CC=CC2=CC(NN)=CN=C21 IBORBSYHSWWFAU-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000012048 reactive intermediate Substances 0.000 description 1
- 230000000384 rearing effect Effects 0.000 description 1
- HJYYPODYNSCCOU-ODRIEIDWSA-N rifamycin SV Chemical compound OC1=C(C(O)=C2C)C3=C(O)C=C1NC(=O)\C(C)=C/C=C/[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@H](C)[C@@H](OC)\C=C\O[C@@]1(C)OC2=C3C1=O HJYYPODYNSCCOU-ODRIEIDWSA-N 0.000 description 1
- WKEDVNSFRWHDNR-UHFFFAOYSA-N salicylanilide Chemical compound OC1=CC=CC=C1C(=O)NC1=CC=CC=C1 WKEDVNSFRWHDNR-UHFFFAOYSA-N 0.000 description 1
- 229950000975 salicylanilide Drugs 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- DUIOPKIIICUYRZ-UHFFFAOYSA-N semicarbazide Chemical compound NNC(N)=O DUIOPKIIICUYRZ-UHFFFAOYSA-N 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 229920002545 silicone oil Polymers 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 229940100890 silver compound Drugs 0.000 description 1
- 229910001923 silver oxide Inorganic materials 0.000 description 1
- 235000020374 simple syrup Nutrition 0.000 description 1
- 208000017520 skin disease Diseases 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 229910001467 sodium calcium phosphate Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 229960001462 sodium cyclamate Drugs 0.000 description 1
- HLBBKKJFGFRGMU-UHFFFAOYSA-M sodium formate Chemical compound [Na+].[O-]C=O HLBBKKJFGFRGMU-UHFFFAOYSA-M 0.000 description 1
- 235000019254 sodium formate Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- BAZAXWOYCMUHIX-UHFFFAOYSA-M sodium perchlorate Chemical compound [Na+].[O-]Cl(=O)(=O)=O BAZAXWOYCMUHIX-UHFFFAOYSA-M 0.000 description 1
- 229910001488 sodium perchlorate Inorganic materials 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- KEAYESYHFKHZAL-OUBTZVSYSA-N sodium-24 Chemical compound [24Na] KEAYESYHFKHZAL-OUBTZVSYSA-N 0.000 description 1
- IXGNPUSUVRTQGW-UHFFFAOYSA-M sodium;perchlorate;hydrate Chemical compound O.[Na+].[O-]Cl(=O)(=O)=O IXGNPUSUVRTQGW-UHFFFAOYSA-M 0.000 description 1
- 239000007901 soft capsule Substances 0.000 description 1
- 239000008279 sol Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 150000003431 steroids Chemical class 0.000 description 1
- 229940041022 streptomycins Drugs 0.000 description 1
- 125000005504 styryl group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 229960004793 sucrose Drugs 0.000 description 1
- FDDDEECHVMSUSB-UHFFFAOYSA-N sulfanilamide Chemical compound NC1=CC=C(S(N)(=O)=O)C=C1 FDDDEECHVMSUSB-UHFFFAOYSA-N 0.000 description 1
- GLBQVJGBPFPMMV-UHFFFAOYSA-N sulfilimine Chemical group S=N GLBQVJGBPFPMMV-UHFFFAOYSA-N 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000002700 tablet coating Substances 0.000 description 1
- 238000009492 tablet coating Methods 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- DKACXUFSLUYRFU-UHFFFAOYSA-N tert-butyl n-aminocarbamate Chemical compound CC(C)(C)OC(=O)NN DKACXUFSLUYRFU-UHFFFAOYSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- UGNWTBMOAKPKBL-UHFFFAOYSA-N tetrachloro-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O UGNWTBMOAKPKBL-UHFFFAOYSA-N 0.000 description 1
- 235000019364 tetracycline Nutrition 0.000 description 1
- 150000003522 tetracyclines Chemical class 0.000 description 1
- 229940040944 tetracyclines Drugs 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- SRVJKTDHMYAMHA-WUXMJOGZSA-N thioacetazone Chemical compound CC(=O)NC1=CC=C(\C=N\NC(N)=S)C=C1 SRVJKTDHMYAMHA-WUXMJOGZSA-N 0.000 description 1
- 125000001391 thioamide group Chemical group 0.000 description 1
- 125000000464 thioxo group Chemical group S=* 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 125000005425 toluyl group Chemical group 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 238000012549 training Methods 0.000 description 1
- 238000011282 treatment Methods 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 239000013638 trimer Substances 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 230000036269 ulceration Effects 0.000 description 1
- 229940035893 uracil Drugs 0.000 description 1
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 1
- 235000019871 vegetable fat Nutrition 0.000 description 1
- 239000000052 vinegar Substances 0.000 description 1
- 235000021419 vinegar Nutrition 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 235000013343 vitamin Nutrition 0.000 description 1
- 239000011782 vitamin Substances 0.000 description 1
- 229940088594 vitamin Drugs 0.000 description 1
- 229930003231 vitamin Natural products 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 150000003752 zinc compounds Chemical class 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/56—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/70—Nitro radicals
- C07D307/71—Nitro radicals attached in position 5
- C07D307/72—Nitro radicals attached in position 5 with hydrocarbon radicals, substituted by nitrogen-containing radicals, attached in position 2
- C07D307/74—Nitro radicals attached in position 5 with hydrocarbon radicals, substituted by nitrogen-containing radicals, attached in position 2 by hydrazino or hydrazono or such substituted radicals
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/04—Inotropic agents, i.e. stimulants of cardiac contraction; Drugs for heart failure
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/54—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/56—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/70—Nitro radicals
- C07D307/71—Nitro radicals attached in position 5
- C07D307/72—Nitro radicals attached in position 5 with hydrocarbon radicals, substituted by nitrogen-containing radicals, attached in position 2
- C07D307/74—Nitro radicals attached in position 5 with hydrocarbon radicals, substituted by nitrogen-containing radicals, attached in position 2 by hydrazino or hydrazono or such substituted radicals
- C07D307/76—Nitro radicals attached in position 5 with hydrocarbon radicals, substituted by nitrogen-containing radicals, attached in position 2 by hydrazino or hydrazono or such substituted radicals having carbonic acyl radicals or their thio or nitrogen analogues directly attached to the hydrazino or hydrazono radical, e.g. semicarbazides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Cardiology (AREA)
- Hospice & Palliative Care (AREA)
- Heart & Thoracic Surgery (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| LU72129A LU72129A1 (https=) | 1975-03-25 | 1975-03-25 | |
| LU74400A LU74400A1 (https=) | 1976-02-20 | 1976-02-20 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2612155A1 true DE2612155A1 (de) | 1976-10-14 |
Family
ID=26640174
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19762612155 Pending DE2612155A1 (de) | 1975-03-25 | 1976-03-23 | Nitrofurylpyrazolderivate, verfahren zu deren herstellung und sie enthaltende arzneimittel |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4093812A (https=) |
| JP (2) | JPS51125387A (https=) |
| AT (1) | ATA210876A (https=) |
| BE (1) | BE839932A (https=) |
| DE (1) | DE2612155A1 (https=) |
| DK (1) | DK127876A (https=) |
| FI (1) | FI760765A7 (https=) |
| FR (1) | FR2305181A1 (https=) |
| GB (1) | GB1507957A (https=) |
| NL (1) | NL7603012A (https=) |
| NO (1) | NO760996L (https=) |
| SE (1) | SE7603554L (https=) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2004043951A1 (en) * | 2002-10-24 | 2004-05-27 | Carex S.A. | Pyrazole derivatives as modulators of peroxisome proliferator activated receptors |
| WO2005061462A3 (en) * | 2003-12-19 | 2005-11-17 | Neurogen Corp | Diaryl pyrazole derivatives and their use as neurokinin-3 receptor modulators |
| WO2006106052A1 (en) * | 2005-04-05 | 2006-10-12 | F. Hoffmann-La Roche Ag | Pyrazoles |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE896678A (fr) * | 1982-05-18 | 1983-11-07 | Sandoz Sa | Nouveaux derives de la 2 (1h)-pyridinone, leur preparation et leur utilisation comme medicaments. |
| EP0233287B1 (en) | 1984-10-04 | 1991-01-30 | Zenyaku Kogyo Kabushikikaisha | 1,4-thiazine derivatives, process for their preparation, and cardiotonics containing the same |
| IS4164A (is) * | 1993-06-11 | 1994-12-12 | Ab Astra | Efnasambönd sem hindra flæði magasýru |
| US5556863A (en) * | 1993-06-11 | 1996-09-17 | Astra Aktiebolag | Compound for gastric acid secretion inhibition |
| US6749721B2 (en) * | 2000-12-22 | 2004-06-15 | Kimberly-Clark Worldwide, Inc. | Process for incorporating poorly substantive paper modifying agents into a paper sheet via wet end addition |
| CA2511646A1 (en) * | 2002-12-27 | 2004-07-22 | Chiron Corporation | Thiosemicarbazones as anti-virals and immunopotentiators |
| US7122700B2 (en) * | 2004-07-30 | 2006-10-17 | Xerox Corporation | Arylamine processes |
| US7670459B2 (en) * | 2004-12-29 | 2010-03-02 | Kimberly-Clark Worldwide, Inc. | Soft and durable tissue products containing a softening agent |
| WO2008021088A2 (en) * | 2006-08-08 | 2008-02-21 | The Regents Of The University Of Californina | Salicylanilides enhance oral delivery of therapeutic peptides |
| JP4940999B2 (ja) * | 2007-02-28 | 2012-05-30 | 株式会社タンガロイ | スローアウェイ式切削工具 |
| JP4941082B2 (ja) * | 2007-05-08 | 2012-05-30 | 株式会社タンガロイ | スローアウェイ式切削工具およびこれに装着される切刃チップ |
| WO2013097052A1 (en) | 2011-12-30 | 2013-07-04 | Abbott Laboratories | Bromodomain inhibitors |
| CA3018802A1 (en) | 2016-04-15 | 2017-10-19 | Abbvie Inc. | Bromodomain inhibitors |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE758050A (fr) * | 1969-10-28 | 1971-04-27 | Geigy Ag J R | Derives 5-nitro-furyliques et medicaments contenant de tels composes |
-
1976
- 1976-03-22 NO NO760996A patent/NO760996L/no unknown
- 1976-03-22 AT AT210876A patent/ATA210876A/de not_active Application Discontinuation
- 1976-03-22 GB GB11465/76A patent/GB1507957A/en not_active Expired
- 1976-03-23 DK DK127876A patent/DK127876A/da unknown
- 1976-03-23 SE SE7603554A patent/SE7603554L/xx unknown
- 1976-03-23 NL NL7603012A patent/NL7603012A/xx not_active Application Discontinuation
- 1976-03-23 DE DE19762612155 patent/DE2612155A1/de active Pending
- 1976-03-23 BE BE6045412A patent/BE839932A/xx unknown
- 1976-03-23 US US05/669,611 patent/US4093812A/en not_active Expired - Lifetime
- 1976-03-23 FI FI760765A patent/FI760765A7/fi not_active Application Discontinuation
- 1976-03-24 FR FR7608435A patent/FR2305181A1/fr not_active Withdrawn
- 1976-03-25 JP JP51034143A patent/JPS51125387A/ja active Pending
- 1976-10-14 JP JP51123401A patent/JPS6032630B2/ja not_active Expired
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2004043951A1 (en) * | 2002-10-24 | 2004-05-27 | Carex S.A. | Pyrazole derivatives as modulators of peroxisome proliferator activated receptors |
| WO2005061462A3 (en) * | 2003-12-19 | 2005-11-17 | Neurogen Corp | Diaryl pyrazole derivatives and their use as neurokinin-3 receptor modulators |
| WO2006106052A1 (en) * | 2005-04-05 | 2006-10-12 | F. Hoffmann-La Roche Ag | Pyrazoles |
| US7345058B2 (en) | 2005-04-05 | 2008-03-18 | Hoffmann-La Roche Inc. | Pyrazoles |
| KR100931411B1 (ko) * | 2005-04-05 | 2009-12-10 | 에프. 호프만-라 로슈 아게 | 1h-피라졸 4-카복실아미드, 이의 제조 방법, 및 이의 11베타-하이드록시스테로이드 탈수소효소로서의 용도 |
Also Published As
| Publication number | Publication date |
|---|---|
| US4093812A (en) | 1978-06-06 |
| JPS51125387A (en) | 1976-11-01 |
| FI760765A7 (https=) | 1976-09-26 |
| SE7603554L (sv) | 1976-09-26 |
| FR2305181A1 (fr) | 1976-10-22 |
| GB1507957A (en) | 1978-04-19 |
| JPS6032630B2 (ja) | 1985-07-29 |
| ATA210876A (de) | 1979-01-15 |
| DK127876A (da) | 1976-09-26 |
| NO760996L (https=) | 1976-09-28 |
| JPS5248675A (en) | 1977-04-18 |
| BE839932A (fr) | 1976-09-23 |
| NL7603012A (nl) | 1976-09-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2612155A1 (de) | Nitrofurylpyrazolderivate, verfahren zu deren herstellung und sie enthaltende arzneimittel | |
| EP0049448B1 (de) | Beta-Lactamantibiotika, Verfahren zu deren Herstellung sowie sie enthaltende Mittel | |
| DE2100242A1 (de) | Gegen Trypanosomiasis wirksame, substituierte Nitroimidazole | |
| DE3873127T2 (de) | Therapeutische praeparate. | |
| DE2223375A1 (de) | Antibiotika und Verfahren zu ihrer Herstellung | |
| CH623580A5 (https=) | ||
| DD150002A5 (de) | Verfahren zur herstellung einer pyranon-verbindung | |
| WO1987006132A1 (en) | Anthelmintic quaternaryalkyl acylhydrazones, method of use and compositions | |
| DD155520A5 (de) | Verfahren zur herstellung von cephalosporin-derivaten | |
| DE2204574A1 (de) | Verfahren zur herstellung von 3-aminobenzo-1,2,4-triazin-di-n-oxiden (1,4) | |
| EP0124067A1 (de) | 2-(Aminoalkyl)-pyrrol-Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2224338A1 (de) | Oxadiazol Derivate | |
| US3472864A (en) | 2-carbonyl-5-nitroimidazoles | |
| EP0346683A1 (de) | Pyrrolderivate, ihre Herstellung und ihre Verwendung | |
| DE2717415A1 (de) | Verfahren zur herstellung von phenylpiperazinderivaten, phenylpiperazinderivate und diese enthaltende pharmazeutische zubereitungen | |
| WO2003043983A1 (de) | Androgenrezeptor destabilisierende piperazinderivate | |
| DE1185618B (de) | Verfahren zur Herstellung des bakterizid wirksamen 4, 5-Dihydro-6-(5'-nitro-2'-furyl)-as-triazin-3(2H)-ons | |
| DE3316187A1 (de) | 2-(aminomethyl)-pyrrol-derivate, verfahren zu ihrer herstellung und ihre verwendung | |
| EP0605493B1 (de) | ANTIALLERGISCHE THIADIAZOLO(4,3-a)PYRIDINDERIVATIVE | |
| DE2633317A1 (de) | Beta-lactamantibiotika, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE2140498A1 (de) | Synthetische Cephalosporine und Ver fahren zu deren Herstellung | |
| US3682953A (en) | Substituted 5-nitrofuryl-pyrazoles | |
| US3427387A (en) | Antibacterial composition containing 5-nitro-2-furyl-1,2,4-triazoles | |
| DE1445438C (https=) | ||
| US3277110A (en) | Certain 5-nitro-2-furyl-1, 2, 4-triazoles |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHJ | Non-payment of the annual fee |