DE2602340C3 - 5-Benzylpicolinsäurederivate - Google Patents
5-BenzylpicolinsäurederivateInfo
- Publication number
- DE2602340C3 DE2602340C3 DE19762602340 DE2602340A DE2602340C3 DE 2602340 C3 DE2602340 C3 DE 2602340C3 DE 19762602340 DE19762602340 DE 19762602340 DE 2602340 A DE2602340 A DE 2602340A DE 2602340 C3 DE2602340 C3 DE 2602340C3
- Authority
- DE
- Germany
- Prior art keywords
- general formula
- acid
- compounds
- molecular weight
- low molecular
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- MSNWMTGDQGJSNP-UHFFFAOYSA-N 5-benzylpyridine-2-carboxylic acid Chemical class C1=NC(C(=O)O)=CC=C1CC1=CC=CC=C1 MSNWMTGDQGJSNP-UHFFFAOYSA-N 0.000 title claims description 13
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 17
- 125000003545 alkoxy group Chemical group 0.000 claims description 15
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 claims description 6
- 150000001875 compounds Chemical class 0.000 description 51
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 32
- 239000013078 crystal Substances 0.000 description 25
- 238000000034 method Methods 0.000 description 24
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 23
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 21
- 125000000217 alkyl group Chemical group 0.000 description 20
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 17
- 238000002844 melting Methods 0.000 description 16
- 230000008018 melting Effects 0.000 description 16
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- -1 nitro, amino, acetylamino Chemical group 0.000 description 10
- 239000000203 mixture Substances 0.000 description 9
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- DGMPVYSXXIOGJY-UHFFFAOYSA-N Fusaric acid Chemical compound CCCCC1=CC=C(C(O)=O)N=C1 DGMPVYSXXIOGJY-UHFFFAOYSA-N 0.000 description 8
- 239000002253 acid Substances 0.000 description 8
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 8
- GVRTVQFVPRJZMM-UHFFFAOYSA-N 5-[(4-nitrophenyl)methyl]pyridine-2-carboxylic acid Chemical compound C1=NC(C(=O)O)=CC=C1CC1=CC=C([N+]([O-])=O)C=C1 GVRTVQFVPRJZMM-UHFFFAOYSA-N 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 7
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 7
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 7
- 235000011114 ammonium hydroxide Nutrition 0.000 description 7
- 238000001816 cooling Methods 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 6
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 6
- 229910052801 chlorine Inorganic materials 0.000 description 6
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical compound OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 5
- SJBFZHNCSGBLEK-UHFFFAOYSA-N phenopicolinic acid Chemical compound C1=NC(C(=O)O)=CC=C1CC1=CC=C(O)C=C1 SJBFZHNCSGBLEK-UHFFFAOYSA-N 0.000 description 5
- SIOXPEMLGUPBBT-UHFFFAOYSA-M picolinate Chemical compound [O-]C(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-M 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- ADYRFORPBGKSCJ-UHFFFAOYSA-N 5-[(4-methoxyphenyl)methyl]pyridine-2-carboxylic acid Chemical compound C1=CC(OC)=CC=C1CC1=CC=C(C(O)=O)N=C1 ADYRFORPBGKSCJ-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- VYFYYTLLBUKUHU-UHFFFAOYSA-N dopamine Chemical compound NCCC1=CC=C(O)C(O)=C1 VYFYYTLLBUKUHU-UHFFFAOYSA-N 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 229940081066 picolinic acid Drugs 0.000 description 4
- JPJALAQPGMAKDF-UHFFFAOYSA-N selenium dioxide Chemical compound O=[Se]=O JPJALAQPGMAKDF-UHFFFAOYSA-N 0.000 description 4
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- 208000001953 Hypotension Diseases 0.000 description 3
- 150000001204 N-oxides Chemical class 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- SGDQROPMLMMPCW-UHFFFAOYSA-N ethyl 5-[(4-hydroxyphenyl)methyl]pyridine-2-carboxylate Chemical compound C1=NC(C(=O)OCC)=CC=C1CC1=CC=C(O)C=C1 SGDQROPMLMMPCW-UHFFFAOYSA-N 0.000 description 3
- UAQKQKBSDSDOTD-UHFFFAOYSA-N ethyl 5-benzylpyridine-2-carboxylate Chemical compound C1=NC(C(=O)OCC)=CC=C1CC1=CC=CC=C1 UAQKQKBSDSDOTD-UHFFFAOYSA-N 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 208000021822 hypotensive Diseases 0.000 description 3
- 230000001077 hypotensive effect Effects 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- KUQJEWHUAZXBIK-UHFFFAOYSA-N methyl 5-[(4-acetamidophenyl)methyl]pyridine-2-carboxylate Chemical compound C1=NC(C(=O)OC)=CC=C1CC1=CC=C(NC(C)=O)C=C1 KUQJEWHUAZXBIK-UHFFFAOYSA-N 0.000 description 3
- VIXPNRHTFAWLMZ-UHFFFAOYSA-N methyl 5-[(4-nitrophenyl)methyl]pyridine-2-carboxylate Chemical compound C1=NC(C(=O)OC)=CC=C1CC1=CC=C([N+]([O-])=O)C=C1 VIXPNRHTFAWLMZ-UHFFFAOYSA-N 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- OPQUZFWRRYTGRW-UHFFFAOYSA-N 5-[(3,4-dihydroxyphenyl)methyl]pyridine-2-carboxylic acid Chemical compound C1=NC(C(=O)O)=CC=C1CC1=CC=C(O)C(O)=C1 OPQUZFWRRYTGRW-UHFFFAOYSA-N 0.000 description 2
- FUEYGZAFSQQNFD-UHFFFAOYSA-N 5-[(4-acetyloxyphenyl)methyl]pyridine-2-carboxylic acid Chemical compound C1=CC(OC(=O)C)=CC=C1CC1=CC=C(C(O)=O)N=C1 FUEYGZAFSQQNFD-UHFFFAOYSA-N 0.000 description 2
- GRESTHKRPUCCBQ-UHFFFAOYSA-N 5-[(4-aminophenyl)methyl]pyridine-2-carboxylic acid Chemical compound C1=CC(N)=CC=C1CC1=CC=C(C(O)=O)N=C1 GRESTHKRPUCCBQ-UHFFFAOYSA-N 0.000 description 2
- CQVZYLARVDDLIN-UHFFFAOYSA-N 5-[(4-aminophenyl)methyl]pyridine-2-carboxylic acid;dihydrochloride Chemical compound Cl.Cl.C1=CC(N)=CC=C1CC1=CC=C(C(O)=O)N=C1 CQVZYLARVDDLIN-UHFFFAOYSA-N 0.000 description 2
- NGRIVMFOKRGBNV-UHFFFAOYSA-N 5-[(4-chlorophenyl)methyl]pyridine-2-carboxylic acid Chemical compound C1=NC(C(=O)O)=CC=C1CC1=CC=C(Cl)C=C1 NGRIVMFOKRGBNV-UHFFFAOYSA-N 0.000 description 2
- CWPICLMURDARIE-UHFFFAOYSA-N 5-benzyl-n-ethylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NCC)=CC=C1CC1=CC=CC=C1 CWPICLMURDARIE-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 230000007059 acute toxicity Effects 0.000 description 2
- 231100000403 acute toxicity Toxicity 0.000 description 2
- 230000009435 amidation Effects 0.000 description 2
- 238000007112 amidation reaction Methods 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 229960003638 dopamine Drugs 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 238000007912 intraperitoneal administration Methods 0.000 description 2
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 2
- HOWCYLHKGYZBKT-UHFFFAOYSA-N methyl 5-[(4-hydroxyphenyl)methyl]pyridine-2-carboxylate Chemical compound C1=NC(C(=O)OC)=CC=C1CC1=CC=C(O)C=C1 HOWCYLHKGYZBKT-UHFFFAOYSA-N 0.000 description 2
- FSKQTJMCUPYLRZ-UHFFFAOYSA-N methyl 5-benzylpyridine-2-carboxylate Chemical compound C1=NC(C(=O)OC)=CC=C1CC1=CC=CC=C1 FSKQTJMCUPYLRZ-UHFFFAOYSA-N 0.000 description 2
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 2
- 229910003446 platinum oxide Inorganic materials 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000006722 reduction reaction Methods 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000004317 sodium nitrate Substances 0.000 description 2
- 235000010344 sodium nitrate Nutrition 0.000 description 2
- YCWRFIYBUQBHJI-UHFFFAOYSA-N 2-(4-aminophenyl)acetonitrile Chemical group NC1=CC=C(CC#N)C=C1 YCWRFIYBUQBHJI-UHFFFAOYSA-N 0.000 description 1
- 125000003143 4-hydroxybenzyl group Chemical group [H]C([*])([H])C1=C([H])C([H])=C(O[H])C([H])=C1[H] 0.000 description 1
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- IYRYUOFRIVFDGD-UHFFFAOYSA-N 5-[(2-chlorophenyl)methyl]pyridine-2-carboxylic acid Chemical compound C1=NC(C(=O)O)=CC=C1CC1=CC=CC=C1Cl IYRYUOFRIVFDGD-UHFFFAOYSA-N 0.000 description 1
- ZPINQGVCVGHKBB-UHFFFAOYSA-N 5-[(2-hydroxyphenyl)methyl]pyridine-2-carboxylic acid Chemical compound C1=NC(C(=O)O)=CC=C1CC1=CC=CC=C1O ZPINQGVCVGHKBB-UHFFFAOYSA-N 0.000 description 1
- DHQOMMIDYJQTCS-UHFFFAOYSA-N 5-[(2-methoxyphenyl)methyl]pyridine-2-carboxylic acid Chemical compound COC1=CC=CC=C1CC1=CC=C(C(O)=O)N=C1 DHQOMMIDYJQTCS-UHFFFAOYSA-N 0.000 description 1
- AMWAQQDAHFEZPW-UHFFFAOYSA-N 5-[(3,4-dimethoxyphenyl)methyl]pyridine-2-carboxylic acid Chemical compound C1=C(OC)C(OC)=CC=C1CC1=CC=C(C(O)=O)N=C1 AMWAQQDAHFEZPW-UHFFFAOYSA-N 0.000 description 1
- FAGSSTSCWAQFDL-UHFFFAOYSA-N 5-[(4-acetamidophenyl)methyl]pyridine-2-carboxylic acid Chemical class C1=CC(NC(=O)C)=CC=C1CC1=CC=C(C(O)=O)N=C1 FAGSSTSCWAQFDL-UHFFFAOYSA-N 0.000 description 1
- NZSQYGFLAGSVGN-UHFFFAOYSA-N 5-[(4-bromophenyl)methyl]pyridine-2-carboxylic acid Chemical compound C1=NC(C(=O)O)=CC=C1CC1=CC=C(Br)C=C1 NZSQYGFLAGSVGN-UHFFFAOYSA-N 0.000 description 1
- ZRHIWQPAJDXICG-UHFFFAOYSA-N 5-[(4-ethoxyphenyl)methyl]pyridine-2-carboxylic acid Chemical compound C1=CC(OCC)=CC=C1CC1=CC=C(C(O)=O)N=C1 ZRHIWQPAJDXICG-UHFFFAOYSA-N 0.000 description 1
- ZGHJVGCWJJYASE-UHFFFAOYSA-N 5-[(4-methoxyphenyl)methyl]-2-methylpyridine Chemical compound C1=CC(OC)=CC=C1CC1=CC=C(C)N=C1 ZGHJVGCWJJYASE-UHFFFAOYSA-N 0.000 description 1
- PTVVLFLEGJNGBR-UHFFFAOYSA-N 5-[(4-methylphenyl)methyl]pyridine-2-carboxylic acid Chemical compound C1=CC(C)=CC=C1CC1=CC=C(C(O)=O)N=C1 PTVVLFLEGJNGBR-UHFFFAOYSA-N 0.000 description 1
- RXKHEBJUSZNIQI-UHFFFAOYSA-N 5-benzyl-2-methylpyridine Chemical compound C1=NC(C)=CC=C1CC1=CC=CC=C1 RXKHEBJUSZNIQI-UHFFFAOYSA-N 0.000 description 1
- HNMMXIJEHHSHHI-UHFFFAOYSA-N 5-benzylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)N)=CC=C1CC1=CC=CC=C1 HNMMXIJEHHSHHI-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- 108010015720 Dopamine beta-Hydroxylase Proteins 0.000 description 1
- 102100033156 Dopamine beta-hydroxylase Human genes 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- GWNHQTILCGPPHY-UHFFFAOYSA-N [5-[(4-methoxyphenyl)methyl]pyridin-2-yl]methanol Chemical compound C1=CC(OC)=CC=C1CC1=CC=C(CO)N=C1 GWNHQTILCGPPHY-UHFFFAOYSA-N 0.000 description 1
- ZCQHZYYIXMQQQG-UHFFFAOYSA-N [5-[(4-methoxyphenyl)methyl]pyridin-2-yl]methyl acetate Chemical compound C1=CC(OC)=CC=C1CC1=CC=C(COC(C)=O)N=C1 ZCQHZYYIXMQQQG-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- FFBHFFJDDLITSX-UHFFFAOYSA-N benzyl N-[2-hydroxy-4-(3-oxomorpholin-4-yl)phenyl]carbamate Chemical compound OC1=C(NC(=O)OCC2=CC=CC=C2)C=CC(=C1)N1CCOCC1=O FFBHFFJDDLITSX-UHFFFAOYSA-N 0.000 description 1
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- HDITUCONWLWUJR-UHFFFAOYSA-N diethylazanium;chloride Chemical compound [Cl-].CC[NH2+]CC HDITUCONWLWUJR-UHFFFAOYSA-N 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- DPEIQXXMKYTBOE-UHFFFAOYSA-N methyl 5-[(4-aminophenyl)methyl]pyridine-2-carboxylate Chemical compound C1=NC(C(=O)OC)=CC=C1CC1=CC=C(N)C=C1 DPEIQXXMKYTBOE-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 230000000802 nitrating effect Effects 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000013558 reference substance Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 238000011699 spontaneously hypertensive rat Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/79—Acids; Esters
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/81—Amides; Imides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP999975A JPS5186469A (en) | 1975-01-22 | 1975-01-22 | 55 benjirupikorinsanjudotaino seiho |
| JP999875A JPS5186468A (en) | 1975-01-22 | 1975-01-22 | 55 benjirupikorinsanjudotainoseiho |
| JP1000075A JPS5186467A (en) | 1975-01-22 | 1975-01-22 | 55 benjirupikorinsanjudotaino seiho |
| JP1000375A JPS5186472A (en) | 1975-01-22 | 1975-01-22 | 55 benjirupikorinsanjudotaino seiho |
| JP1000275A JPS5186471A (en) | 1975-01-22 | 1975-01-22 | 55 benjirupikorinsanjudotaino seiho |
| JP1000175A JPS5186470A (en) | 1975-01-22 | 1975-01-22 | 55 benjirupikorinsanjudotaino seiho |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2602340A1 DE2602340A1 (de) | 1976-07-29 |
| DE2602340B2 DE2602340B2 (de) | 1977-12-29 |
| DE2602340C3 true DE2602340C3 (de) | 1978-08-31 |
Family
ID=27548239
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19762602340 Expired DE2602340C3 (de) | 1975-01-22 | 1976-01-22 | 5-Benzylpicolinsäurederivate |
Country Status (3)
| Country | Link |
|---|---|
| DE (1) | DE2602340C3 (Direct) |
| FR (1) | FR2298331A1 (Direct) |
| GB (1) | GB1471276A (Direct) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1134828A (en) * | 1978-12-28 | 1982-11-02 | Tadao Tanouchi | Pyridine derivatives |
| US6586475B1 (en) | 1998-11-20 | 2003-07-01 | Takeda Chemical Industries, Ltd. | β-amyloid protein production/secretion inhibitors |
| CA2592442A1 (en) | 2004-12-23 | 2006-06-29 | Glaxo Group Limited | Pyridine compounds for the treatment of prostaglandin mediated diseases |
-
1976
- 1976-01-12 GB GB96376A patent/GB1471276A/en not_active Expired
- 1976-01-21 FR FR7601613A patent/FR2298331A1/fr active Granted
- 1976-01-22 DE DE19762602340 patent/DE2602340C3/de not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2298331A1 (fr) | 1976-08-20 |
| FR2298331B1 (Direct) | 1979-09-21 |
| GB1471276A (en) | 1977-04-21 |
| DE2602340B2 (de) | 1977-12-29 |
| DE2602340A1 (de) | 1976-07-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1493536B1 (de) | Neue gamma-Amino-beta-phenyl-buttersaeuren | |
| DE2419970B2 (Direct) | ||
| DE2147023C3 (de) | Verfahren zur Herstellung von 1H- Tetrazol-Verbindungen | |
| DE1670522C3 (de) | Neue Benzylaminopyridine | |
| DE1236510B (de) | Verfahren zur Herstellung von Acylaminotetramsaeuren | |
| DE2446100C3 (de) | Phenoxyalkancarbonsäureamide von Thiazolidincarbonsäuren, Verfahren zu ihrer Herstellung und Arzneimittel | |
| DE2229223B2 (de) | 2-Nitro-5-imidazol-Derivate und Verfahren zu deren Herstellung | |
| EP0001144B1 (de) | N-Substituierte 2-Hydrazono-Propionsäure-Derivate, Verfahren zur Herstellung derselben und Arzneimittel, die diese enthalten | |
| DE2602340B2 (de) | 5-benzylpikolinsaeurederivate | |
| DE2005959A1 (de) | 7-Nitro-8-hydroxychinolinester, ihre Verwendung und Verfahren zur Herstellung derselben | |
| DE2757057A1 (de) | Daunomycinderivate, verfahren zu ihrer herstellung und ihre verwendung | |
| DE2013729A1 (Direct) | ||
| DE1620140C3 (de) | In 1-Stellung substituierte 4-SuIfanilamido-2(lH)-pyrimidone, deren pharmazeutisch verträgliche Alkalisalze und Verfahren zu ihrer Herstellung | |
| DE1235929B (de) | Verfahren zur Herstellung von 2-(2'-Pyrazinyl)-benzimidazol und seinen Salzen | |
| DE2026040A1 (de) | Imidazolnbosylcyclophosphate | |
| DE1620479C3 (de) | Xylitpentanicotinat und dessen Säureadditionssalze | |
| DE2600537A1 (de) | Ver0ren zur herstellung von 2- aminoimidazol-derivaten | |
| DE1768787C3 (de) | (o-Carboxy-phenyl)-acetamidine, Verfahren zu deren Herstellung und (o-CarboxyphenyO-acetamidine enthaltende Präparate | |
| AT373588B (de) | Verfahren zur herstellung von neuen substituierten 1-benzoyl-2-phenylimino-imidazolidinen und von deren salzen | |
| DE2340815A1 (de) | Cyclische sulfoximide | |
| DE1695794C3 (de) | 4-Acyl-3,4-dihydro-2(1 H) -chinoxalinon-Derivate | |
| DE1543519C (de) | Verfahren zur Herstellung von p-Aminobenzoesäureaniliden | |
| DE1620190C (de) | 4-(2-Carbo-alpha-glyceryloxyphenylamino)-8-chlorchinolin, seine Salze und ein Verfahren zu ihrer Herstellung | |
| AT213864B (de) | Verfahren zur Herstellung von neuen analgetisch wirksamen α-Amino-β-oxybuttersäureamiden | |
| AT215996B (de) | Verfahren zur Herstellung von neuen Pyridinderivaten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8328 | Change in the person/name/address of the agent |
Free format text: MUELLER-BOERNER, R., DIPL.-ING., 1000 BERLIN WEY, H., DIPL.-ING., PAT.-ANW., 8000 MUENCHEN |
|
| 8339 | Ceased/non-payment of the annual fee |