DE2555966C3 - Signalisierungsvorrichtung - Google Patents
SignalisierungsvorrichtungInfo
- Publication number
- DE2555966C3 DE2555966C3 DE2555966A DE2555966A DE2555966C3 DE 2555966 C3 DE2555966 C3 DE 2555966C3 DE 2555966 A DE2555966 A DE 2555966A DE 2555966 A DE2555966 A DE 2555966A DE 2555966 C3 DE2555966 C3 DE 2555966C3
- Authority
- DE
- Germany
- Prior art keywords
- signaling device
- base plate
- card
- signaling
- information
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000011664 signaling Effects 0.000 title claims description 31
- 239000004033 plastic Substances 0.000 claims description 10
- 229920003023 plastic Polymers 0.000 claims description 10
- 238000004806 packaging method and process Methods 0.000 claims description 8
- 239000000463 material Substances 0.000 claims description 6
- 229920002457 flexible plastic Polymers 0.000 claims 1
- 238000005452 bending Methods 0.000 description 3
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical group [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 description 2
- 239000011888 foil Substances 0.000 description 2
- 230000006870 function Effects 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 101150064138 MAP1 gene Proteins 0.000 description 1
- 230000005534 acoustic noise Effects 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 230000009977 dual effect Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000005389 magnetism Effects 0.000 description 1
- 206010025482 malaise Diseases 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- JFRJCQJVFMHZOO-QZHHGCDDSA-N n-(2-aminoethyl)-2-[4-[[2-[4-[[9-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]phenyl]acetyl]amino]phenyl]acetamide Chemical compound C1=CC(CC(=O)NCCN)=CC=C1NC(=O)CC(C=C1)=CC=C1NC1=NC=NC2=C1N=CN2[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 JFRJCQJVFMHZOO-QZHHGCDDSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000002985 plastic film Substances 0.000 description 1
- 229920006255 plastic film Polymers 0.000 description 1
- 238000010008 shearing Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G09—EDUCATION; CRYPTOGRAPHY; DISPLAY; ADVERTISING; SEALS
- G09F—DISPLAYING; ADVERTISING; SIGNS; LABELS OR NAME-PLATES; SEALS
- G09F1/00—Cardboard or like show-cards of foldable or flexible material
- G09F1/10—Supports or holders for show-cards
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B60—VEHICLES IN GENERAL
- B60Q—ARRANGEMENT OF SIGNALLING OR LIGHTING DEVICES, THE MOUNTING OR SUPPORTING THEREOF OR CIRCUITS THEREFOR, FOR VEHICLES IN GENERAL
- B60Q7/00—Arrangement or adaptation of portable emergency signal devices on vehicles
- B60Q7/005—Devices without lamps
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Theoretical Computer Science (AREA)
- Credit Cards Or The Like (AREA)
- Details Of Rigid Or Semi-Rigid Containers (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2555966A DE2555966C3 (de) | 1975-12-12 | 1975-12-12 | Signalisierungsvorrichtung |
| NL7613847A NL7613847A (nl) | 1975-12-12 | 1976-12-13 | Inrichting voor het signaleren van noodgevallen in het gemotoriseerde wegverkeer. |
| FR7637526A FR2335011A1 (fr) | 1975-12-12 | 1976-12-13 | Dispositif de signalisation |
| US05/750,645 US4182063A (en) | 1975-12-12 | 1976-12-13 | Signal display |
| GB51990/76A GB1538208A (en) | 1975-12-12 | 1976-12-13 | Signalling devices |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2555966A DE2555966C3 (de) | 1975-12-12 | 1975-12-12 | Signalisierungsvorrichtung |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2555966A1 DE2555966A1 (de) | 1977-06-23 |
| DE2555966B2 DE2555966B2 (de) | 1978-07-20 |
| DE2555966C3 true DE2555966C3 (de) | 1979-03-22 |
Family
ID=5964188
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2555966A Expired DE2555966C3 (de) | 1975-12-12 | 1975-12-12 | Signalisierungsvorrichtung |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4182063A (enExample) |
| DE (1) | DE2555966C3 (enExample) |
| FR (1) | FR2335011A1 (enExample) |
| GB (1) | GB1538208A (enExample) |
| NL (1) | NL7613847A (enExample) |
Families Citing this family (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4270291A (en) * | 1980-05-14 | 1981-06-02 | Rapid Mounting & Finishing Company | Sign construction |
| US4374376A (en) * | 1981-07-06 | 1983-02-15 | Pillifant Jr Harold E | Vehicle warning device |
| GB8400977D0 (en) * | 1984-01-13 | 1984-02-15 | Edmund White B E | Property sales sign case |
| US4541190A (en) * | 1984-01-25 | 1985-09-17 | Harold M. Hodgkins | Multifaced, foldable traffic display |
| GB2171831B (en) * | 1985-02-28 | 1989-06-14 | Kord Designers Ltd | Display device |
| GB8607434D0 (en) * | 1986-03-25 | 1986-04-30 | Owen G | Display systems |
| GB8702218D0 (en) * | 1987-02-02 | 1987-03-11 | Kitson M I | Display |
| CH673625A5 (enExample) * | 1988-01-07 | 1990-03-30 | Joerg Maetzener | |
| US5226792A (en) * | 1989-02-03 | 1993-07-13 | Darago Joanne R | Distress flag for automobile window |
| WO1990009652A1 (en) * | 1989-02-15 | 1990-08-23 | Anthony Victor Reynolds | Accessories for use by motorists and others such as ramblers, walkers, climbers and skiers |
| IT216573Z2 (it) * | 1989-05-12 | 1991-09-16 | Auxilium Line Srl | Accessorio automobilistico a schede segnaletiche per la richiesta di soccorso. |
| DE4021848A1 (de) * | 1990-07-09 | 1992-01-16 | Thomas Tenzler | Faltkoerper |
| US5263272A (en) * | 1991-04-30 | 1993-11-23 | The Wise Child Inc. | Highway emergency safety sign |
| US5315777A (en) * | 1991-04-30 | 1994-05-31 | The Wise Child Inc. | Highway emergency safety sign |
| GB2259295A (en) * | 1991-09-06 | 1993-03-10 | Mcdonald George W | Producing folded articles, e.g. maps |
| DE9112604U1 (de) * | 1991-10-10 | 1991-12-05 | Neuberger, Manfred, 6455 Erlensee | Informationsträger |
| US5156274A (en) * | 1991-12-23 | 1992-10-20 | Williams Jr John M | Emergency breakdown assistance kit |
| GB2269040A (en) * | 1992-06-19 | 1994-01-26 | Swintex | Safety sign. |
| US5506020A (en) * | 1992-08-27 | 1996-04-09 | Haberkorn; Robert W. | Insulated freight container quilt |
| DE9310397U1 (de) * | 1993-07-13 | 1994-11-17 | Bartling, Ludwig, 33617 Bielefeld | Rettungs-Signal |
| ES1044824Y (es) * | 1999-10-28 | 2000-11-16 | Ediciones Gavia S A | Soporte publicitario. |
| DE29922507U1 (de) | 1999-12-22 | 2000-04-20 | Fye, Thomas, 53123 Bonn | Informationsträger mit Schutzumschlag und Aufnahmefächer im Visitenkartenformat |
| GB0112742D0 (en) * | 2001-05-24 | 2001-07-18 | Whitworth Douglas A | Cardboard cut-out |
| US6890183B2 (en) * | 2002-12-24 | 2005-05-10 | Noble Logos | Collapsible educational chart |
| USD503645S1 (en) * | 2003-02-10 | 2005-04-05 | Safety Mowstor, Inc. | Guidance wand |
| US20040231203A1 (en) * | 2003-05-23 | 2004-11-25 | Peter Dobelbower | Presentation apparatus |
| US7444774B1 (en) | 2005-03-30 | 2008-11-04 | Traffix Devices, Inc. | Foldable traffic sign |
| US20060236569A1 (en) * | 2005-04-25 | 2006-10-26 | Charla F. Puryear | Business cardfolio |
| USD536037S1 (en) * | 2005-06-13 | 2007-01-30 | Eric Kudimi | Master student training records |
| US7571561B1 (en) | 2005-11-15 | 2009-08-11 | Worldwide Safety Of Nevada, Inc. | Deployable traffic sign |
| US8832981B2 (en) * | 2011-04-18 | 2014-09-16 | Rescued In Time, Llc | Rescue locator signal |
| USD748202S1 (en) | 2013-10-16 | 2016-01-26 | Feltro Inc. | Modular construction panel |
| US9238180B2 (en) * | 2013-10-16 | 2016-01-19 | Feltro Inc. | Modular construction panel |
| US9898938B1 (en) * | 2016-09-30 | 2018-02-20 | Candas Perrin | Trifold letter card display |
| US10160381B1 (en) * | 2017-08-11 | 2018-12-25 | GM Global Technology Operations LLC | Vehicle cargo canopy with hazard warning sign |
| USD917263S1 (en) | 2019-02-05 | 2021-04-27 | Feltro Inc. | Fastener assembly |
| US10926187B2 (en) | 2019-02-05 | 2021-02-23 | Feltro Inc. | Modular construction panels and fasteners therefor |
| USD997246S1 (en) | 2020-07-20 | 2023-08-29 | Expandable Sports, Inc. | Foldable sign |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1128136A (en) * | 1914-02-26 | 1915-02-09 | Philip Hano | Ticket-case. |
| US2690624A (en) * | 1949-09-15 | 1954-10-05 | Ollie W Phillips | Sign |
| US2768457A (en) * | 1953-05-21 | 1956-10-30 | Biek George | Tubular identification tag holder |
| US3059362A (en) * | 1961-09-18 | 1962-10-23 | Einson Freeman Co Inc | Collapsible cardboard display device |
| US3203125A (en) * | 1963-02-21 | 1965-08-31 | Stoessel Henry Kurt | Display structure and method of forming the same |
-
1975
- 1975-12-12 DE DE2555966A patent/DE2555966C3/de not_active Expired
-
1976
- 1976-12-13 GB GB51990/76A patent/GB1538208A/en not_active Expired
- 1976-12-13 FR FR7637526A patent/FR2335011A1/fr active Granted
- 1976-12-13 US US05/750,645 patent/US4182063A/en not_active Expired - Lifetime
- 1976-12-13 NL NL7613847A patent/NL7613847A/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| DE2555966B2 (de) | 1978-07-20 |
| DE2555966A1 (de) | 1977-06-23 |
| FR2335011B3 (enExample) | 1979-08-24 |
| GB1538208A (en) | 1979-01-10 |
| US4182063A (en) | 1980-01-08 |
| FR2335011A1 (fr) | 1977-07-08 |
| NL7613847A (nl) | 1977-06-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2555966C3 (de) | Signalisierungsvorrichtung | |
| DE69327801T2 (de) | Aufnahme und projektionshülle für retroprojektionstransparente | |
| DE3322036A1 (de) | Traegerplatte fuer strassenkarten und infos in kraftfahrzeugen | |
| DE7539629U (de) | Signalisierungsvorrichtung | |
| DE3302102A1 (de) | Faltbarer stadtplan | |
| EP0791479B1 (de) | Sichthülle für Papierbilder und Filmstücke | |
| DE19843833C1 (de) | Halte-, Aufbewahrungs- und Schauvorrichtung für Kraftfahrzeugausweise, -berechtigungskarten u. ä. | |
| EP0616310B1 (de) | Rechteckiger Faltbogen mit Diagonalfalzen für grossflächige Abbildungen | |
| AT398408B (de) | Ordner | |
| DE7536870U (de) | Aufklappbare Mappe oder dergleichen zum Signalisieren von Notfällen im Kraftfahrzeug-Verkehr | |
| DE8210525U1 (de) | Konzepthalter zur aufstellung an bildschirmen von edv-anlagen, schreibmaschinen, schreibautomaten und dergleichen | |
| EP0761474A2 (de) | Fotoalbum | |
| DE8317774U1 (de) | Trägerplatte für Straßenkarten und Infos in Kraftfahrzeugen | |
| DE7324442U (de) | Hinweisschild, insbesondere fur Kraftfahrzeuge | |
| DE9109054U1 (de) | Lernmittel | |
| DE19526432C2 (de) | Prospekthülle | |
| DE29810774U1 (de) | Handatlas | |
| DE8707201U1 (de) | Aufnahmetasche | |
| DE1547433A1 (de) | Geraet zum Betrachten von Landkarten,Tabellen u.dgl. | |
| DE29505902U1 (de) | Geographische Karte mit integrierter Lupe | |
| EP1531447A2 (de) | Geographische Karte mit integrierter Lupe | |
| DE1959338U (de) | Geraet zum betrachten von landkarten, tabellen u. dgl. | |
| DE9202139U1 (de) | Mappe zur Aufbewahrung von Blattmaterial | |
| DE7218856U (de) | Autokarte | |
| DE9309668U1 (de) | Autoinfotasche |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |