DE2553932C3 - Verfahren zur Herstellung von N,N'-Bis-trimethylsilylharnstoff - Google Patents
Verfahren zur Herstellung von N,N'-Bis-trimethylsilylharnstoffInfo
- Publication number
- DE2553932C3 DE2553932C3 DE2553932A DE2553932A DE2553932C3 DE 2553932 C3 DE2553932 C3 DE 2553932C3 DE 2553932 A DE2553932 A DE 2553932A DE 2553932 A DE2553932 A DE 2553932A DE 2553932 C3 DE2553932 C3 DE 2553932C3
- Authority
- DE
- Germany
- Prior art keywords
- reaction
- hexamethyldisilazane
- bis
- trimethylsilylurea
- ammonia
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 17
- 238000002360 preparation method Methods 0.000 title claims description 4
- MASDFXZJIDNRTR-UHFFFAOYSA-N 1,3-bis(trimethylsilyl)urea Chemical compound C[Si](C)(C)NC(=O)N[Si](C)(C)C MASDFXZJIDNRTR-UHFFFAOYSA-N 0.000 title description 4
- FFUAGWLWBBFQJT-UHFFFAOYSA-N hexamethyldisilazane Chemical compound C[Si](C)(C)N[Si](C)(C)C FFUAGWLWBBFQJT-UHFFFAOYSA-N 0.000 claims description 60
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 34
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 29
- 238000006243 chemical reaction Methods 0.000 claims description 28
- 229910021529 ammonia Inorganic materials 0.000 claims description 17
- 239000004202 carbamide Substances 0.000 claims description 15
- 239000002253 acid Substances 0.000 claims description 5
- 150000007513 acids Chemical class 0.000 claims description 5
- 230000008030 elimination Effects 0.000 claims description 3
- 238000003379 elimination reaction Methods 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 230000000737 periodic effect Effects 0.000 claims description 2
- 239000000047 product Substances 0.000 description 19
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 14
- 230000000694 effects Effects 0.000 description 13
- UQEAIHBTYFGYIE-UHFFFAOYSA-N hexamethyldisiloxane Chemical compound C[Si](C)(C)O[Si](C)(C)C UQEAIHBTYFGYIE-UHFFFAOYSA-N 0.000 description 10
- 238000010992 reflux Methods 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- 238000009835 boiling Methods 0.000 description 9
- 239000003054 catalyst Substances 0.000 description 9
- 238000006884 silylation reaction Methods 0.000 description 9
- -1 hydrogen ions Chemical class 0.000 description 8
- 238000002844 melting Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- NIZHERJWXFHGGU-UHFFFAOYSA-N isocyanato(trimethyl)silane Chemical compound C[Si](C)(C)N=C=O NIZHERJWXFHGGU-UHFFFAOYSA-N 0.000 description 7
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 6
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 6
- 229930182555 Penicillin Natural products 0.000 description 5
- 238000010438 heat treatment Methods 0.000 description 5
- 230000035484 reaction time Effects 0.000 description 5
- 238000000859 sublimation Methods 0.000 description 5
- 230000008022 sublimation Effects 0.000 description 5
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 4
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 4
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 4
- 239000003153 chemical reaction reagent Substances 0.000 description 4
- 239000000498 cooling water Substances 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 229940049954 penicillin Drugs 0.000 description 4
- 238000004448 titration Methods 0.000 description 4
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 239000006096 absorbing agent Substances 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 238000005755 formation reaction Methods 0.000 description 3
- 238000004817 gas chromatography Methods 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 235000011007 phosphoric acid Nutrition 0.000 description 3
- 125000006239 protecting group Chemical group 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000005051 trimethylchlorosilane Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 239000005711 Benzoic acid Substances 0.000 description 2
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 239000002841 Lewis acid Substances 0.000 description 2
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 229910052796 boron Inorganic materials 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- 238000004140 cleaning Methods 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- MTZQAGJQAFMTAQ-UHFFFAOYSA-N ethyl benzoate Chemical compound CCOC(=O)C1=CC=CC=C1 MTZQAGJQAFMTAQ-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 2
- 238000011835 investigation Methods 0.000 description 2
- 150000007517 lewis acids Chemical class 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- 229910052719 titanium Inorganic materials 0.000 description 2
- 239000010936 titanium Substances 0.000 description 2
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 2
- KFUSEUYYWQURPO-OWOJBTEDSA-N trans-1,2-dichloroethene Chemical group Cl\C=C\Cl KFUSEUYYWQURPO-OWOJBTEDSA-N 0.000 description 2
- FAQYAMRNWDIXMY-UHFFFAOYSA-N trichloroborane Chemical compound ClB(Cl)Cl FAQYAMRNWDIXMY-UHFFFAOYSA-N 0.000 description 2
- OJAJJFGMKAZGRZ-UHFFFAOYSA-N trimethyl(phenoxy)silane Chemical compound C[Si](C)(C)OC1=CC=CC=C1 OJAJJFGMKAZGRZ-UHFFFAOYSA-N 0.000 description 2
- 229910052726 zirconium Inorganic materials 0.000 description 2
- OIQUKGQXFXBODS-UHFFFAOYSA-L 2-ethoxyethylaluminum(2+);dichloride Chemical compound [Cl-].[Cl-].CCOCC[Al+2] OIQUKGQXFXBODS-UHFFFAOYSA-L 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- VXEGSRKPIUDPQT-UHFFFAOYSA-N 4-[4-(4-methoxyphenyl)piperazin-1-yl]aniline Chemical compound C1=CC(OC)=CC=C1N1CCN(C=2C=CC(N)=CC=2)CC1 VXEGSRKPIUDPQT-UHFFFAOYSA-N 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- 229930186147 Cephalosporin Natural products 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 230000008033 biological extinction Effects 0.000 description 1
- 229940124587 cephalosporin Drugs 0.000 description 1
- 150000001780 cephalosporins Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 230000002860 competitive effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000001934 delay Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- LIKFHECYJZWXFJ-UHFFFAOYSA-N dimethyldichlorosilane Chemical compound C[Si](C)(Cl)Cl LIKFHECYJZWXFJ-UHFFFAOYSA-N 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 239000005055 methyl trichlorosilane Substances 0.000 description 1
- JLUFWMXJHAVVNN-UHFFFAOYSA-N methyltrichlorosilane Chemical compound C[Si](Cl)(Cl)Cl JLUFWMXJHAVVNN-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 150000002926 oxygen Chemical class 0.000 description 1
- 150000002960 penicillins Chemical class 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 150000003377 silicon compounds Chemical class 0.000 description 1
- FDNAPBUWERUEDA-UHFFFAOYSA-N silicon tetrachloride Chemical compound Cl[Si](Cl)(Cl)Cl FDNAPBUWERUEDA-UHFFFAOYSA-N 0.000 description 1
- 239000005049 silicon tetrachloride Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 235000011044 succinic acid Nutrition 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- YONPGGFAJWQGJC-UHFFFAOYSA-K titanium(iii) chloride Chemical compound Cl[Ti](Cl)Cl YONPGGFAJWQGJC-UHFFFAOYSA-K 0.000 description 1
- VIGRJDWPNTXJSQ-UHFFFAOYSA-N triethyl(isocyanato)silane Chemical compound CC[Si](CC)(CC)N=C=O VIGRJDWPNTXJSQ-UHFFFAOYSA-N 0.000 description 1
- DUNKXUFBGCUVQW-UHFFFAOYSA-J zirconium tetrachloride Chemical compound Cl[Zr](Cl)(Cl)Cl DUNKXUFBGCUVQW-UHFFFAOYSA-J 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Priority Applications (11)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2553932A DE2553932C3 (de) | 1975-12-01 | 1975-12-01 | Verfahren zur Herstellung von N,N'-Bis-trimethylsilylharnstoff |
| GB49311/76A GB1562414A (en) | 1975-12-01 | 1976-11-25 | Process for producing n,n'-bis-trimethylsilylurea |
| NL7613342A NL7613342A (nl) | 1975-12-01 | 1976-11-30 | Werkwijze voor het bereiden van n,n'-bis-trime- thylsilylureum. |
| ES453775A ES453775A1 (es) | 1975-12-01 | 1976-11-30 | Procedimiento para la preparacion de n,n'-bis-trimetilsili- lurea. |
| SE7613411A SE421130B (sv) | 1975-12-01 | 1976-11-30 | Forfarande for framstellning av n,n?721-bis-triemetylsilylkarbamid |
| CH1507176A CH623827A5 (enExample) | 1975-12-01 | 1976-11-30 | |
| FR7636107A FR2333805A1 (fr) | 1975-12-01 | 1976-11-30 | Procede de preparation de n,n'-bis-trimethylsilyluree |
| IT52398/76A IT1066714B (it) | 1975-12-01 | 1976-11-30 | Procedimento per la produzione di n n bis trimetil sililurea |
| US05/746,023 US4060536A (en) | 1975-12-01 | 1976-11-30 | Method of preparing N,N'-bis-trimethylsilylurea |
| JP51144584A JPS6034558B2 (ja) | 1975-12-01 | 1976-12-01 | N,n′‐ビス‐トリメチルシリル尿素の製造法 |
| HU76DI289A HU178507B (en) | 1975-12-01 | 1976-12-01 | Process for producing n,n-comma above-bis-trimethyl-silil-urea |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2553932A DE2553932C3 (de) | 1975-12-01 | 1975-12-01 | Verfahren zur Herstellung von N,N'-Bis-trimethylsilylharnstoff |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2553932A1 DE2553932A1 (de) | 1977-06-02 |
| DE2553932B2 DE2553932B2 (de) | 1977-09-22 |
| DE2553932C3 true DE2553932C3 (de) | 1986-10-02 |
Family
ID=5963137
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2553932A Expired DE2553932C3 (de) | 1975-12-01 | 1975-12-01 | Verfahren zur Herstellung von N,N'-Bis-trimethylsilylharnstoff |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4060536A (enExample) |
| JP (1) | JPS6034558B2 (enExample) |
| CH (1) | CH623827A5 (enExample) |
| DE (1) | DE2553932C3 (enExample) |
| ES (1) | ES453775A1 (enExample) |
| FR (1) | FR2333805A1 (enExample) |
| GB (1) | GB1562414A (enExample) |
| HU (1) | HU178507B (enExample) |
| IT (1) | IT1066714B (enExample) |
| NL (1) | NL7613342A (enExample) |
| SE (1) | SE421130B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH02119928U (enExample) * | 1989-03-14 | 1990-09-27 | ||
| DE19654556A1 (de) | 1996-12-27 | 1998-07-02 | Wacker Chemie Gmbh | Harnstoffgruppen aufweisende Organosiliciumverbindungen, deren Herstellung sowie deren Verwendung |
| WO2008115190A1 (en) * | 2007-03-21 | 2008-09-25 | Momentive Performance Materials Inc. | Improved process for producing bis-(aminoalkyl)-polysiloxanes |
| CN101665507B (zh) * | 2009-09-08 | 2012-03-21 | 吉林新亚强生物化工有限公司 | 六甲基二硅脲的制备工艺 |
| CN109232632B (zh) * | 2018-10-18 | 2021-07-06 | 江苏食品药品职业技术学院 | 一种六甲基二硅脲的制备方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2507882C3 (de) * | 1975-02-24 | 1980-01-24 | Wacker-Chemie Gmbh, 8000 Muenchen | Verfahren zur Herstellung von Bis-(trimethylsilyl)-harnstoff |
-
1975
- 1975-12-01 DE DE2553932A patent/DE2553932C3/de not_active Expired
-
1976
- 1976-11-25 GB GB49311/76A patent/GB1562414A/en not_active Expired
- 1976-11-30 CH CH1507176A patent/CH623827A5/de not_active IP Right Cessation
- 1976-11-30 FR FR7636107A patent/FR2333805A1/fr active Granted
- 1976-11-30 ES ES453775A patent/ES453775A1/es not_active Expired
- 1976-11-30 IT IT52398/76A patent/IT1066714B/it active
- 1976-11-30 NL NL7613342A patent/NL7613342A/xx not_active Application Discontinuation
- 1976-11-30 US US05/746,023 patent/US4060536A/en not_active Expired - Lifetime
- 1976-11-30 SE SE7613411A patent/SE421130B/xx unknown
- 1976-12-01 JP JP51144584A patent/JPS6034558B2/ja not_active Expired
- 1976-12-01 HU HU76DI289A patent/HU178507B/hu unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE2553932B2 (de) | 1977-09-22 |
| JPS5268132A (en) | 1977-06-06 |
| DE2553932A1 (de) | 1977-06-02 |
| FR2333805A1 (fr) | 1977-07-01 |
| CH623827A5 (enExample) | 1981-06-30 |
| GB1562414A (en) | 1980-03-12 |
| FR2333805B1 (enExample) | 1982-12-31 |
| NL7613342A (nl) | 1977-06-03 |
| HU178507B (en) | 1982-05-28 |
| SE421130B (sv) | 1981-11-30 |
| SE7613411L (sv) | 1977-06-02 |
| ES453775A1 (es) | 1977-11-16 |
| IT1066714B (it) | 1985-03-12 |
| US4060536A (en) | 1977-11-29 |
| JPS6034558B2 (ja) | 1985-08-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE68902770T2 (de) | Verfahren zur herstellung von phenol. | |
| CH615684A5 (enExample) | ||
| DE69819948T2 (de) | Verfahren zur Herstellung von Monosilanen | |
| DE2553932C3 (de) | Verfahren zur Herstellung von N,N'-Bis-trimethylsilylharnstoff | |
| EP0003317B1 (de) | Verfahren zum Herstellen von Acyloxysilanen und gegebenenfalls Acyloxysiloxanen | |
| EP0806427B1 (de) | Verfahren zur Herstellung von vinylierten Silicium-organischen Verbindungen | |
| DE2807230C3 (de) | Verfahren zur Herstellung von Alkoxymethylsilazanen | |
| EP0031436B1 (de) | Verfahren zur Spaltung von Siloxanen | |
| DE1156809B (de) | Verfahren zur Herstellung von Cyanalkylfluorsilanen | |
| DE2542425B2 (de) | Verfahren zur Herstellung von Hexasiloxycyclosiloxanen | |
| EP0250823B1 (de) | Verfahren zur Herstellung von Organooxyhalogensilanen | |
| EP0017832B1 (de) | Verfahren zur Herstellung von 5-Brom-5-nitro-1,3-dioxan | |
| DE2645792A1 (de) | Verfahren zur herstellung von hexamethyldisilazan | |
| EP0533068B1 (de) | Verfahren zur Abtrennung von Alkenen bei der Methylchlorsilan-Destillation | |
| DE2824558C3 (de) | Verfahren zur Herstellung von Quadratsäure | |
| DE1965741A1 (de) | Verfahren zur Herstellung von Silanderivaten | |
| DE3900917A1 (de) | Verfahren zur herstellung von 4,5,6-trichlorpyrimidin | |
| DE2156203A1 (de) | Verfahren zur herstellung von dialkylphosphinoxiden | |
| DE2106877C3 (de) | Verfahren zur Herstellung von substituierten Imidazolen | |
| DE1768217B1 (de) | Verfahren zur Herstellung von Cyclohexylammonium-N-cyclohexylsulfamat | |
| DE896943C (de) | Verfahren zur Herstellung von Acetoxymethylsilanen | |
| DE613402C (de) | Verfahren zur Darstellung von 4-Pyridylpyridiniumdichlorid | |
| DE803834C (de) | Verfahren zur Herstellung von Acetalen des Acetaldehyds | |
| DE2135674B2 (de) | Verfahren zur Herstellung von Tris-(trimethylsüoxy)-phe nylsilan | |
| EP0048396A1 (de) | Verfahren zur Herstellung von 2-Methoxyalkansäuren |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8281 | Inventor (new situation) |
Free format text: KOETZSCH, HANS-JOACHIM, DIPL.-CHEM. DR., 7888 RHEINFELDEN, DE VAHLENSIECK, HANS-JOACHIM, DIPL.-CHEM. DR., 7867 WEHR, DE |
|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: HUELS TROISDORF AG, 5210 TROISDORF, DE |
|
| 8327 | Change in the person/name/address of the patent owner |
Owner name: HUELS AG, 4370 MARL, DE |