DE2543033C2 - Verfahren zur Herstellung einer beschichteten Elektrode und ihre Verwendung - Google Patents
Verfahren zur Herstellung einer beschichteten Elektrode und ihre VerwendungInfo
- Publication number
- DE2543033C2 DE2543033C2 DE2543033A DE2543033A DE2543033C2 DE 2543033 C2 DE2543033 C2 DE 2543033C2 DE 2543033 A DE2543033 A DE 2543033A DE 2543033 A DE2543033 A DE 2543033A DE 2543033 C2 DE2543033 C2 DE 2543033C2
- Authority
- DE
- Germany
- Prior art keywords
- oxide
- coating
- electrode
- ruthenium
- titanium
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 20
- 238000004519 manufacturing process Methods 0.000 title claims description 10
- 238000000576 coating method Methods 0.000 claims description 64
- 239000011248 coating agent Substances 0.000 claims description 62
- 229910001925 ruthenium oxide Inorganic materials 0.000 claims description 46
- WOCIAKWEIIZHES-UHFFFAOYSA-N ruthenium(iv) oxide Chemical compound O=[Ru]=O WOCIAKWEIIZHES-UHFFFAOYSA-N 0.000 claims description 42
- 239000006104 solid solution Substances 0.000 claims description 39
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 claims description 33
- 239000000243 solution Substances 0.000 claims description 31
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 claims description 30
- 239000000203 mixture Substances 0.000 claims description 28
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 27
- 239000001301 oxygen Substances 0.000 claims description 27
- 229910052760 oxygen Inorganic materials 0.000 claims description 27
- 150000004706 metal oxides Chemical class 0.000 claims description 23
- 238000005868 electrolysis reaction Methods 0.000 claims description 22
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 claims description 20
- 238000005260 corrosion Methods 0.000 claims description 18
- 230000007797 corrosion Effects 0.000 claims description 18
- 239000004020 conductor Substances 0.000 claims description 17
- 229910000510 noble metal Inorganic materials 0.000 claims description 17
- 239000011787 zinc oxide Substances 0.000 claims description 10
- 238000010438 heat treatment Methods 0.000 claims description 9
- 239000010410 layer Substances 0.000 claims description 8
- 239000010970 precious metal Substances 0.000 claims description 7
- HTXDPTMKBJXEOW-UHFFFAOYSA-N dioxoiridium Chemical compound O=[Ir]=O HTXDPTMKBJXEOW-UHFFFAOYSA-N 0.000 claims description 5
- 229910000457 iridium oxide Inorganic materials 0.000 claims description 5
- 150000002736 metal compounds Chemical class 0.000 claims description 3
- 230000001590 oxidative effect Effects 0.000 claims description 3
- SJLOMQIUPFZJAN-UHFFFAOYSA-N oxorhodium Chemical compound [Rh]=O SJLOMQIUPFZJAN-UHFFFAOYSA-N 0.000 claims description 3
- 229910003450 rhodium oxide Inorganic materials 0.000 claims description 3
- 239000012298 atmosphere Substances 0.000 claims description 2
- 239000011247 coating layer Substances 0.000 claims description 2
- HBEQXAKJSGXAIQ-UHFFFAOYSA-N oxopalladium Chemical compound [Pd]=O HBEQXAKJSGXAIQ-UHFFFAOYSA-N 0.000 claims description 2
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 claims description 2
- 229910003445 palladium oxide Inorganic materials 0.000 claims description 2
- 229910003446 platinum oxide Inorganic materials 0.000 claims description 2
- 150000003609 titanium compounds Chemical class 0.000 claims description 2
- 150000003755 zirconium compounds Chemical class 0.000 claims description 2
- 229910001508 alkali metal halide Inorganic materials 0.000 claims 1
- 150000008045 alkali metal halides Chemical class 0.000 claims 1
- 239000013078 crystal Substances 0.000 description 24
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 21
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 19
- 239000010936 titanium Substances 0.000 description 19
- 229910001928 zirconium oxide Inorganic materials 0.000 description 19
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 16
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 16
- RVTZCBVAJQQJTK-UHFFFAOYSA-N oxygen(2-);zirconium(4+) Chemical compound [O-2].[O-2].[Zr+4] RVTZCBVAJQQJTK-UHFFFAOYSA-N 0.000 description 16
- RKTYLMNFRDHKIL-UHFFFAOYSA-N copper;5,10,15,20-tetraphenylporphyrin-22,24-diide Chemical compound [Cu+2].C1=CC(C(=C2C=CC([N-]2)=C(C=2C=CC=CC=2)C=2C=CC(N=2)=C(C=2C=CC=CC=2)C2=CC=C3[N-]2)C=2C=CC=CC=2)=NC1=C3C1=CC=CC=C1 RKTYLMNFRDHKIL-UHFFFAOYSA-N 0.000 description 15
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 14
- 239000000460 chlorine Substances 0.000 description 14
- 229910052801 chlorine Inorganic materials 0.000 description 14
- 238000002441 X-ray diffraction Methods 0.000 description 13
- 229910052719 titanium Inorganic materials 0.000 description 11
- 238000011282 treatment Methods 0.000 description 11
- 239000011780 sodium chloride Substances 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 229910052751 metal Inorganic materials 0.000 description 9
- 239000002184 metal Substances 0.000 description 9
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 8
- 229910044991 metal oxide Inorganic materials 0.000 description 8
- 239000000758 substrate Substances 0.000 description 8
- 238000002474 experimental method Methods 0.000 description 7
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- 239000000843 powder Substances 0.000 description 6
- 229910010413 TiO 2 Inorganic materials 0.000 description 5
- 238000010586 diagram Methods 0.000 description 5
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 5
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 4
- 230000000052 comparative effect Effects 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- 229910052707 ruthenium Inorganic materials 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 150000001805 chlorine compounds Chemical class 0.000 description 3
- 239000003792 electrolyte Substances 0.000 description 3
- 239000010948 rhodium Substances 0.000 description 3
- YBCAZPLXEGKKFM-UHFFFAOYSA-K ruthenium(iii) chloride Chemical compound [Cl-].[Cl-].[Cl-].[Ru+3] YBCAZPLXEGKKFM-UHFFFAOYSA-K 0.000 description 3
- 229910052710 silicon Inorganic materials 0.000 description 3
- 239000010703 silicon Substances 0.000 description 3
- 235000011121 sodium hydroxide Nutrition 0.000 description 3
- 230000003595 spectral effect Effects 0.000 description 3
- 229910052726 zirconium Inorganic materials 0.000 description 3
- QNRATNLHPGXHMA-XZHTYLCXSA-N (r)-(6-ethoxyquinolin-4-yl)-[(2s,4s,5r)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]methanol;hydrochloride Chemical compound Cl.C([C@H]([C@H](C1)CC)C2)CN1[C@@H]2[C@H](O)C1=CC=NC2=CC=C(OCC)C=C21 QNRATNLHPGXHMA-XZHTYLCXSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical compound [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- 229910045601 alloy Inorganic materials 0.000 description 2
- 239000000956 alloy Substances 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 239000010953 base metal Substances 0.000 description 2
- 229910021538 borax Inorganic materials 0.000 description 2
- 229910002804 graphite Inorganic materials 0.000 description 2
- 239000010439 graphite Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 229910000464 lead oxide Inorganic materials 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- 239000012528 membrane Substances 0.000 description 2
- YEXPOXQUZXUXJW-UHFFFAOYSA-N oxolead Chemical compound [Pb]=O YEXPOXQUZXUXJW-UHFFFAOYSA-N 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 238000005498 polishing Methods 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000013558 reference substance Substances 0.000 description 2
- 229910052703 rhodium Inorganic materials 0.000 description 2
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- 238000004513 sizing Methods 0.000 description 2
- 235000010339 sodium tetraborate Nutrition 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 229910052715 tantalum Inorganic materials 0.000 description 2
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 2
- 239000011592 zinc chloride Substances 0.000 description 2
- 235000005074 zinc chloride Nutrition 0.000 description 2
- DUNKXUFBGCUVQW-UHFFFAOYSA-J zirconium tetrachloride Chemical compound Cl[Zr](Cl)(Cl)Cl DUNKXUFBGCUVQW-UHFFFAOYSA-J 0.000 description 2
- IVORCBKUUYGUOL-UHFFFAOYSA-N 1-ethynyl-2,4-dimethoxybenzene Chemical compound COC1=CC=C(C#C)C(OC)=C1 IVORCBKUUYGUOL-UHFFFAOYSA-N 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 229910002483 Cu Ka Inorganic materials 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- -1 Nloboxld Chemical compound 0.000 description 1
- 244000078856 Prunus padus Species 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 229910001069 Ti alloy Inorganic materials 0.000 description 1
- WBLXMRIMSGHSAC-UHFFFAOYSA-N [Cl].[Cl] Chemical compound [Cl].[Cl] WBLXMRIMSGHSAC-UHFFFAOYSA-N 0.000 description 1
- NTBRLDWLSWZHSS-UHFFFAOYSA-N [Zr].[Cl] Chemical compound [Zr].[Cl] NTBRLDWLSWZHSS-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000008186 active pharmaceutical agent Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 229910000416 bismuth oxide Inorganic materials 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 229910052810 boron oxide Inorganic materials 0.000 description 1
- 235000008429 bread Nutrition 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 238000012937 correction Methods 0.000 description 1
- 238000005238 degreasing Methods 0.000 description 1
- TYIXMATWDRGMPF-UHFFFAOYSA-N dibismuth;oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Bi+3].[Bi+3] TYIXMATWDRGMPF-UHFFFAOYSA-N 0.000 description 1
- JKWMSGQKBLHBQQ-UHFFFAOYSA-N diboron trioxide Chemical compound O=BOB=O JKWMSGQKBLHBQQ-UHFFFAOYSA-N 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- ZOMNIUBKTOKEHS-UHFFFAOYSA-L dimercury dichloride Chemical class Cl[Hg][Hg]Cl ZOMNIUBKTOKEHS-UHFFFAOYSA-L 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- 235000019441 ethanol Nutrition 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000009499 grossing Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000003014 ion exchange membrane Substances 0.000 description 1
- 229910052741 iridium Inorganic materials 0.000 description 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- MJGFBOZCAJSGQW-UHFFFAOYSA-N mercury sodium Chemical compound [Na].[Hg] MJGFBOZCAJSGQW-UHFFFAOYSA-N 0.000 description 1
- 229910001510 metal chloride Inorganic materials 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 229910052758 niobium Inorganic materials 0.000 description 1
- 239000010955 niobium Substances 0.000 description 1
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 description 1
- QGLKJKCYBOYXKC-UHFFFAOYSA-N nonaoxidotritungsten Chemical compound O=[W]1(=O)O[W](=O)(=O)O[W](=O)(=O)O1 QGLKJKCYBOYXKC-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- BPUBBGLMJRNUCC-UHFFFAOYSA-N oxygen(2-);tantalum(5+) Chemical compound [O-2].[O-2].[O-2].[O-2].[O-2].[Ta+5].[Ta+5] BPUBBGLMJRNUCC-UHFFFAOYSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- SONJTKJMTWTJCT-UHFFFAOYSA-K rhodium(iii) chloride Chemical compound [Cl-].[Cl-].[Cl-].[Rh+3] SONJTKJMTWTJCT-UHFFFAOYSA-K 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910001023 sodium amalgam Inorganic materials 0.000 description 1
- 239000004328 sodium tetraborate Substances 0.000 description 1
- 229910001936 tantalum oxide Inorganic materials 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- LLZRNZOLAXHGLL-UHFFFAOYSA-J titanic acid Chemical compound O[Ti](O)(O)O LLZRNZOLAXHGLL-UHFFFAOYSA-J 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- BSVBQGMMJUBVOD-UHFFFAOYSA-N trisodium borate Chemical compound [Na+].[Na+].[Na+].[O-]B([O-])[O-] BSVBQGMMJUBVOD-UHFFFAOYSA-N 0.000 description 1
- 229910001930 tungsten oxide Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B11/00—Electrodes; Manufacture thereof not otherwise provided for
- C25B11/04—Electrodes; Manufacture thereof not otherwise provided for characterised by the material
- C25B11/051—Electrodes formed of electrocatalysts on a substrate or carrier
- C25B11/073—Electrodes formed of electrocatalysts on a substrate or carrier characterised by the electrocatalyst material
- C25B11/091—Electrodes formed of electrocatalysts on a substrate or carrier characterised by the electrocatalyst material consisting of at least one catalytic element and at least one catalytic compound; consisting of two or more catalytic elements or catalytic compounds
- C25B11/093—Electrodes formed of electrocatalysts on a substrate or carrier characterised by the electrocatalyst material consisting of at least one catalytic element and at least one catalytic compound; consisting of two or more catalytic elements or catalytic compounds at least one noble metal or noble metal oxide and at least one non-noble metal oxide
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- Materials Engineering (AREA)
- Metallurgy (AREA)
- Organic Chemistry (AREA)
- Electrodes For Compound Or Non-Metal Manufacture (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP49111056A JPS5137877A (en) | 1974-09-27 | 1974-09-27 | Denkaiyodenkyoku oyobi sonoseizoho |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2543033A1 DE2543033A1 (de) | 1976-04-15 |
| DE2543033C2 true DE2543033C2 (de) | 1982-09-02 |
Family
ID=14551273
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2543033A Expired DE2543033C2 (de) | 1974-09-27 | 1975-09-26 | Verfahren zur Herstellung einer beschichteten Elektrode und ihre Verwendung |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4005004A (enExample) |
| JP (1) | JPS5137877A (enExample) |
| DE (1) | DE2543033C2 (enExample) |
| FR (1) | FR2286209A1 (enExample) |
| GB (1) | GB1481767A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4426263A (en) | 1981-04-23 | 1984-01-17 | Diamond Shamrock Corporation | Method and electrocatalyst for making chlorine dioxide |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH597371A5 (enExample) * | 1975-04-25 | 1978-03-31 | Battelle Memorial Institute | |
| JPS53150593U (enExample) * | 1977-05-02 | 1978-11-27 | ||
| US4100049A (en) * | 1977-07-11 | 1978-07-11 | Diamond Shamrock Corporation | Coated cathode for electrolysis cells |
| JPS5573884A (en) * | 1978-11-24 | 1980-06-03 | Asahi Chem Ind Co Ltd | Preparation of electrode |
| JPS5610377A (en) * | 1979-07-05 | 1981-02-02 | Matsushita Electric Industrial Co Ltd | Ultrasonic wave generating element |
| IT1127303B (it) * | 1979-12-20 | 1986-05-21 | Oronzio De Nora Impianti | Tprocedimento per la preparazione di ossidi misti catalitici |
| US4430188A (en) | 1980-09-17 | 1984-02-07 | Engelhard Corporation | Electrodes for use in an electrolytic process |
| US4323092A (en) * | 1980-09-19 | 1982-04-06 | Corvinus & Roth Gmbh | Apparatus and process for detecting free chlorine |
| US4879013A (en) * | 1986-03-03 | 1989-11-07 | Ppg Industries, Inc. | Method of cationic electrodeposition using dissolution resistant anodes |
| JPH0319380U (enExample) * | 1989-07-07 | 1991-02-26 | ||
| US5230780A (en) * | 1989-12-08 | 1993-07-27 | Eltech Systems Corporation | Electrolyzing halogen-containing solution in a membrane cell |
| CA2030092C (en) * | 1989-12-08 | 1998-11-03 | Richard C. Carlson | Electrocatalytic coating |
| FR2775486B1 (fr) * | 1998-03-02 | 2000-04-07 | Atochem Elf Sa | Cathode specifique, utilisable pour la preparation d'un chlorate de metal alcalin et son procede de fabrication |
| US6120659A (en) * | 1998-11-09 | 2000-09-19 | Hee Jung Kim | Dimensionally stable electrode for treating hard-resoluble waste water |
| CA2522900C (en) * | 2003-05-07 | 2013-04-30 | Eltech Systems Corporation | Smooth surface morphology anode coatings |
| GB2469265B8 (en) * | 2009-04-06 | 2015-06-17 | Re Hydrogen Ltd | Electrode configuration of electrolysers to protect catalyst from oxidation |
| JP5522484B2 (ja) * | 2011-09-13 | 2014-06-18 | 学校法人同志社 | 電解めっき用陽極および該陽極を用いる電解めっき法 |
| DE102013202144A1 (de) * | 2013-02-08 | 2014-08-14 | Bayer Materialscience Ag | Elektrokatalysator, Elektrodenbeschichtung und Elektrode zur Herstellung von Chlor |
| KR20180058702A (ko) * | 2015-09-28 | 2018-06-01 | 가부시키가이샤 오사카소다 | 염소 발생용 전극 및 그 제조방법 |
| EP4353866A1 (en) * | 2022-10-13 | 2024-04-17 | Titanium Technology S.L. | Mixed metal oxide coatings for titanium alloys |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3778307A (en) * | 1967-02-10 | 1973-12-11 | Chemnor Corp | Electrode and coating therefor |
| GB1195871A (en) * | 1967-02-10 | 1970-06-24 | Chemnor Ag | Improvements in or relating to the Manufacture of Electrodes. |
| US3562008A (en) * | 1968-10-14 | 1971-02-09 | Ppg Industries Inc | Method for producing a ruthenium coated titanium electrode |
| GB1327760A (en) * | 1969-12-22 | 1973-08-22 | Imp Metal Ind Kynoch Ltd | Electrodes |
| GB1294373A (en) * | 1970-03-18 | 1972-10-25 | Ici Ltd | Electrodes for electrochemical processes |
| US3852175A (en) * | 1972-06-08 | 1974-12-03 | Ppg Industries Inc | Electrodes having silicon base members |
| US3677917A (en) * | 1970-09-08 | 1972-07-18 | Ppg Industries Inc | Electrode coatings |
| US3711385A (en) * | 1970-09-25 | 1973-01-16 | Chemnor Corp | Electrode having platinum metal oxide coating thereon,and method of use thereof |
| GB1352872A (en) * | 1971-03-18 | 1974-05-15 | Ici Ltd | Electrodes for electrochemical processes |
| IN143553B (enExample) * | 1973-10-26 | 1977-12-24 | Ici Ltd |
-
1974
- 1974-09-27 JP JP49111056A patent/JPS5137877A/ja active Granted
-
1975
- 1975-09-10 GB GB37261/75A patent/GB1481767A/en not_active Expired
- 1975-09-10 US US05/611,889 patent/US4005004A/en not_active Expired - Lifetime
- 1975-09-26 DE DE2543033A patent/DE2543033C2/de not_active Expired
- 1975-09-26 FR FR7529561A patent/FR2286209A1/fr active Granted
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4426263A (en) | 1981-04-23 | 1984-01-17 | Diamond Shamrock Corporation | Method and electrocatalyst for making chlorine dioxide |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5220440B2 (enExample) | 1977-06-03 |
| GB1481767A (en) | 1977-08-03 |
| JPS5137877A (en) | 1976-03-30 |
| FR2286209A1 (fr) | 1976-04-23 |
| DE2543033A1 (de) | 1976-04-15 |
| FR2286209B1 (enExample) | 1979-03-30 |
| US4005004A (en) | 1977-01-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2543033C2 (de) | Verfahren zur Herstellung einer beschichteten Elektrode und ihre Verwendung | |
| DE1814576C2 (de) | Elektrode zur Verwendung in elektrolytischen Prozessen und Verfahren zu deren Herstellung | |
| DE1952484C3 (de) | Ventilmetall-Elektrode | |
| DE1571721C3 (de) | Elektrode zur Verwendung in elektrolytischen Prozessen | |
| DE2936033C2 (enExample) | ||
| DE69218075T2 (de) | Elektrode für Elektrolyse | |
| DE2636447C2 (de) | Mangandioxidelektroden | |
| DE2729272C2 (de) | Verfahren zur Herstellung einer Metallanode für wäßrige Elektrolyten enthaltende Elektrolysezellen | |
| DE2304380C3 (de) | Elektroden mit einer Delafossit- Oberfläche | |
| DE60019256T2 (de) | Kathode für die elektrolyse von wässrigen lösungen | |
| DE1951484A1 (de) | Verfahren zur Herstellung elektrisch leitfaehiger Anoden fuer die Elektrolyse von waessrigem Alkalichlorid | |
| DE3507071C2 (de) | Elektrode für die Elektrolyse und Verfahren zu ihrer Herstellung | |
| EP2581971A1 (de) | Katalysatorbeschichtung und Verfahren zu ihrer Herstellung | |
| DE102010043085A1 (de) | Elektrode für die elektrolytische Chlorherstellung | |
| DE2010169C2 (de) | Elektrochemisches Verfahren zum Einbringen von Spurenmengen eines Materials in die Oberflächenschicht eines Trägers | |
| DE2419021A1 (de) | Elektrode mit mehrkomponentenueberzug | |
| DE3715444A1 (de) | Dauerhafte elektrode fuer elektrolysen und verfahren zu deren herstellung | |
| DE2014746C2 (de) | Dimensionsstabile Anode, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE69521588T2 (de) | Stabile Beschichtungslösungen zur Bildung von elektrokatalytischen Beschichtungen aus gemischten Oxyden auf Metall oder metallisierten Trägern und Verfahren zur Herstellung von dimensionstabilen Anoden unter Verwendung dieser Lösungen | |
| DE3689059T2 (de) | Oberflächenaktivierte amorphe Legierungen und übersättigte Legierungen für Elektroden, verwendbar zur Elektrolyse von Lösungen und Verfahren zur Aktivierung der Oberflächen. | |
| DE69019424T2 (de) | Elektrode für elektrolytische Verfahren und Verfahren zur Herstellung der Elektrode. | |
| DE1962860C3 (de) | Elektroden für elektrochemische Zellen | |
| DE2909593C2 (enExample) | ||
| DE2625820C2 (de) | Elektrode | |
| EP2397579A1 (de) | Elektrode für die elektrolytische Chlorgewinnung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| D2 | Grant after examination | ||
| 8363 | Opposition against the patent | ||
| 8331 | Complete revocation |