DE2522169A1 - 3-pyridylmethyl-phenylharnstoffe und sie enthaltende mittel - Google Patents
3-pyridylmethyl-phenylharnstoffe und sie enthaltende mittelInfo
- Publication number
- DE2522169A1 DE2522169A1 DE19752522169 DE2522169A DE2522169A1 DE 2522169 A1 DE2522169 A1 DE 2522169A1 DE 19752522169 DE19752522169 DE 19752522169 DE 2522169 A DE2522169 A DE 2522169A DE 2522169 A1 DE2522169 A1 DE 2522169A1
- Authority
- DE
- Germany
- Prior art keywords
- pyridylmethyl
- urea
- zinc
- group
- calcium
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000001875 compounds Chemical class 0.000 claims description 20
- -1 halide anion Chemical class 0.000 claims description 17
- JIAARYAFYJHUJI-UHFFFAOYSA-L Zinc chloride Inorganic materials [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 claims description 12
- 239000011592 zinc chloride Substances 0.000 claims description 7
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 6
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 6
- PTFCDOFLOPIGGS-UHFFFAOYSA-N Zinc dication Chemical compound [Zn+2] PTFCDOFLOPIGGS-UHFFFAOYSA-N 0.000 claims description 6
- 229910052791 calcium Inorganic materials 0.000 claims description 6
- 239000011575 calcium Substances 0.000 claims description 6
- 239000011701 zinc Substances 0.000 claims description 6
- 229940006486 zinc cation Drugs 0.000 claims description 6
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 5
- 235000005074 zinc chloride Nutrition 0.000 claims description 5
- 239000010949 copper Substances 0.000 claims description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 3
- 229910052793 cadmium Inorganic materials 0.000 claims description 3
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 229910017052 cobalt Inorganic materials 0.000 claims description 2
- 239000010941 cobalt Substances 0.000 claims description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 2
- 229910052802 copper Inorganic materials 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 229910052759 nickel Inorganic materials 0.000 claims description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 125000004801 4-cyanophenyl group Chemical group [H]C1=C([H])C(C#N)=C([H])C([H])=C1* 0.000 claims 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 claims 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims 1
- DIWDAASHAULFKP-UHFFFAOYSA-L calcium;1-(4-nitrophenyl)-3-(pyridin-3-ylmethyl)urea;dichloride Chemical compound [Cl-].[Cl-].[Ca+2].C1=CC([N+](=O)[O-])=CC=C1NC(=O)NCC1=CC=CN=C1 DIWDAASHAULFKP-UHFFFAOYSA-L 0.000 claims 1
- 239000012876 carrier material Substances 0.000 claims 1
- 239000003337 fertilizer Substances 0.000 claims 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims 1
- 229910052725 zinc Inorganic materials 0.000 claims 1
- CCUGTJOYKIHQOC-UHFFFAOYSA-L zinc;1-(4-nitrophenyl)-3-(pyridin-3-ylmethyl)urea;dichloride Chemical compound [Cl-].[Cl-].[Zn+2].C1=CC([N+](=O)[O-])=CC=C1NC(=O)NCC1=CC=CN=C1 CCUGTJOYKIHQOC-UHFFFAOYSA-L 0.000 claims 1
- 241000700159 Rattus Species 0.000 description 25
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 24
- 150000003839 salts Chemical class 0.000 description 20
- 239000002184 metal Substances 0.000 description 19
- 229910052751 metal Inorganic materials 0.000 description 19
- 241000699666 Mus <mouse, genus> Species 0.000 description 14
- 235000013877 carbamide Nutrition 0.000 description 9
- 231100000614 poison Toxicity 0.000 description 9
- 239000002574 poison Substances 0.000 description 9
- 241000699670 Mus sp. Species 0.000 description 8
- 239000004202 carbamide Substances 0.000 description 8
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical group [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 7
- 239000000843 powder Substances 0.000 description 7
- XSQUKJJJFZCRTK-UHFFFAOYSA-N urea group Chemical group NC(=O)N XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 7
- 238000000354 decomposition reaction Methods 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 239000003128 rodenticide Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 235000000346 sugar Nutrition 0.000 description 4
- DAQORUWIEXJXFU-UHFFFAOYSA-N 1-phenyl-3-(pyridin-3-ylmethyl)urea Chemical class C=1C=CC=CC=1NC(=O)NCC1=CC=CN=C1 DAQORUWIEXJXFU-UHFFFAOYSA-N 0.000 description 3
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 3
- YKYOUMDCQGMQQO-UHFFFAOYSA-L Cadmium chloride Inorganic materials Cl[Cd]Cl YKYOUMDCQGMQQO-UHFFFAOYSA-L 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- YHKGJSJVWPYMPN-UHFFFAOYSA-N 1-phenyl-1-(pyridin-3-ylmethyl)urea Chemical compound C=1C=CC=CC=1N(C(=O)N)CC1=CC=CN=C1 YHKGJSJVWPYMPN-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- 235000007319 Avena orientalis Nutrition 0.000 description 2
- 244000075850 Avena orientalis Species 0.000 description 2
- 235000019733 Fish meal Nutrition 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 240000008042 Zea mays Species 0.000 description 2
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 2
- 239000011149 active material Substances 0.000 description 2
- 239000010868 animal carcass Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 2
- 231100000517 death Toxicity 0.000 description 2
- 230000034994 death Effects 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000004467 fishmeal Substances 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 231100000636 lethal dose Toxicity 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 235000012054 meals Nutrition 0.000 description 2
- 239000000575 pesticide Substances 0.000 description 2
- 150000003672 ureas Chemical class 0.000 description 2
- 210000002700 urine Anatomy 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- 229910021592 Copper(II) chloride Inorganic materials 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 description 1
- VEQPNABPJHWNSG-UHFFFAOYSA-N Nickel(2+) Chemical compound [Ni+2] VEQPNABPJHWNSG-UHFFFAOYSA-N 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 241000700157 Rattus norvegicus Species 0.000 description 1
- 241000283984 Rodentia Species 0.000 description 1
- 241000209140 Triticum Species 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- YSVZGWAJIHWNQK-UHFFFAOYSA-N [3-(hydroxymethyl)-2-bicyclo[2.2.1]heptanyl]methanol Chemical compound C1CC2C(CO)C(CO)C1C2 YSVZGWAJIHWNQK-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- 235000012216 bentonite Nutrition 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 229940006463 cadmium cation Drugs 0.000 description 1
- WLZRMCYVCSSEQC-UHFFFAOYSA-N cadmium(2+) Chemical compound [Cd+2] WLZRMCYVCSSEQC-UHFFFAOYSA-N 0.000 description 1
- KSOKJLQIVPGEAC-UHFFFAOYSA-L cadmium(2+);1-(4-nitrophenyl)-3-(pyridin-3-ylmethyl)urea;dichloride Chemical compound [Cl-].[Cl-].[Cd+2].C1=CC([N+](=O)[O-])=CC=C1NC(=O)NCC1=CC=CN=C1 KSOKJLQIVPGEAC-UHFFFAOYSA-L 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- XLJKHNWPARRRJB-UHFFFAOYSA-N cobalt(2+) Chemical compound [Co+2] XLJKHNWPARRRJB-UHFFFAOYSA-N 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 229940108928 copper Drugs 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 235000005687 corn oil Nutrition 0.000 description 1
- 239000002285 corn oil Substances 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 235000013399 edible fruits Nutrition 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 231100000566 intoxication Toxicity 0.000 description 1
- 230000035987 intoxication Effects 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 231100000518 lethal Toxicity 0.000 description 1
- 230000001665 lethal effect Effects 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 235000013372 meat Nutrition 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- 235000013379 molasses Nutrition 0.000 description 1
- 239000004570 mortar (masonry) Substances 0.000 description 1
- 230000031942 natural killer cell mediated cytotoxicity Effects 0.000 description 1
- 229940006444 nickel cation Drugs 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 231100000572 poisoning Toxicity 0.000 description 1
- 230000000607 poisoning effect Effects 0.000 description 1
- 229920000058 polyacrylate Polymers 0.000 description 1
- CLKZWXHKFXZIMA-UHFFFAOYSA-N pyrinuron Chemical compound C1=CC([N+](=O)[O-])=CC=C1NC(=O)NCC1=CC=CN=C1 CLKZWXHKFXZIMA-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000005871 repellent Substances 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 235000002639 sodium chloride Nutrition 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 239000003053 toxin Substances 0.000 description 1
- 231100000765 toxin Toxicity 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 239000002435 venom Substances 0.000 description 1
- 231100000611 venom Toxicity 0.000 description 1
- 210000001048 venom Anatomy 0.000 description 1
- VZFVJBKLFQYOHZ-UHFFFAOYSA-L zinc;1-(4-butanoylphenyl)-3-(pyridin-3-ylmethyl)urea;dichloride Chemical compound [Cl-].[Cl-].[Zn+2].C1=CC(C(=O)CCC)=CC=C1NC(=O)NCC1=CC=CN=C1 VZFVJBKLFQYOHZ-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/28—Radicals substituted by singly-bound oxygen or sulphur atoms
- C07D213/30—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/36—Radicals substituted by singly-bound nitrogen atoms
- C07D213/40—Acylated substituent nitrogen atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/473,594 US3969357A (en) | 1974-05-28 | 1974-05-28 | 3-Pyridylmethyl phenyl urea metal salt complexes |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2522169A1 true DE2522169A1 (de) | 1975-12-18 |
Family
ID=23880208
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752522169 Pending DE2522169A1 (de) | 1974-05-28 | 1975-05-17 | 3-pyridylmethyl-phenylharnstoffe und sie enthaltende mittel |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3969357A (enExample) |
| JP (1) | JPS50155619A (enExample) |
| BE (1) | BE829548A (enExample) |
| CH (1) | CH603048A5 (enExample) |
| DE (1) | DE2522169A1 (enExample) |
| FR (1) | FR2272992B1 (enExample) |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3128280A (en) * | 1959-10-23 | 1964-04-07 | Searle & Co | 1-(alkoxylated/halogenated phenyl)-3-pyridylmethylureas |
| US3700678A (en) * | 1971-04-30 | 1972-10-24 | Stauffer Chemical Co | 1-picolyl-3-phenyl ureas |
| US3931203A (en) * | 1973-03-19 | 1976-01-06 | Rohm And Haas Company | 3-Pyridylmethyl aryl urea rodenticides |
-
1974
- 1974-05-28 US US05/473,594 patent/US3969357A/en not_active Expired - Lifetime
-
1975
- 1975-04-28 JP JP50052004A patent/JPS50155619A/ja active Pending
- 1975-05-17 DE DE19752522169 patent/DE2522169A1/de active Pending
- 1975-05-26 FR FR7516316A patent/FR2272992B1/fr not_active Expired
- 1975-05-27 BE BE156759A patent/BE829548A/xx unknown
- 1975-05-27 CH CH677375A patent/CH603048A5/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| CH603048A5 (enExample) | 1978-08-15 |
| FR2272992A1 (enExample) | 1975-12-26 |
| FR2272992B1 (enExample) | 1977-04-15 |
| JPS50155619A (enExample) | 1975-12-16 |
| US3969357A (en) | 1976-07-13 |
| BE829548A (fr) | 1975-11-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69901290T2 (de) | Verstärkung von Metall-Molluskiziden durch Ethylendiamindibernsteinsäure (EDDS) | |
| DE60318259T3 (de) | Pestizide Zusammensetzungen und Verfahren | |
| DE69504295T2 (de) | Einnehmbare molluskengifte | |
| DE2212268B2 (de) | N-Halogenacetylanilinoessigsäureester, Verfahren zu deren Herstellung und diese enthaltende herbicide Massen | |
| DE2425713C3 (de) | Insektizides Mittel auf Basis von Benzylphenolderivaten | |
| DD286099A5 (de) | Mittel, um voegel im zaum zu halten | |
| DE1170707B (de) | Nagetiergiftmassen und -koeder | |
| CH621041A5 (en) | Rodenticidal composition. | |
| DD160270A5 (de) | Zusammensetzung zur bekaempfung von warmbluetigem ungeziefer | |
| DE2522169A1 (de) | 3-pyridylmethyl-phenylharnstoffe und sie enthaltende mittel | |
| DE1010778B (de) | Nagetierbekaempfungsmittel und Verfahren zu seiner Herstellung | |
| WO2008138552A1 (de) | Schneckenköder | |
| DE2757111A1 (de) | Phthalamid- und nikotinsaeuren und ihre verwendung in pflanzenwuchsregulierenden mitteln | |
| DE2421821A1 (de) | Metallsalze von 1,1,5,5-tetrasubstituierten dithiobiuretverbindungen, ihre herstellung und verwendung | |
| DE2536192A1 (de) | 3-pyridylmethyl-phenylcarbamate | |
| AT258033B (de) | Mittel zur Vertilgung von Nagetieren | |
| DE2422316A1 (de) | Insecticide und acaricide zusammensetzung, verfahren zu deren herstellung und deren verwendung | |
| DE1542972C3 (de) | Herbicide Mittel | |
| DE2244939C3 (de) | Verwendung von Phenylthioharnstoffderivaten als Rodenticide und diese Verbindungen enthaltende rodenticide Mittel | |
| CA1076578A (en) | 3-pyridylmethyl-n-phenyl thiocarbamate compounds | |
| US3800040A (en) | Methods for controlling rodent populations using substituted diquinolydisulfides | |
| AT388916B (de) | Verfahren zur herstellung von neuen phenylpropargylaminderivaten und deren saeureadditionssalzen | |
| DD235554A5 (de) | Zusammensetzung zum toeten von warmblutschaedlingen | |
| US4233289A (en) | 3-Pyridylmethylthiocarbamates | |
| DE2753183A1 (de) | Rodenticide mittel und verfahren zur herstellung derselben |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHN | Withdrawal |