DE2520526C2 - Neue Chromkomplexfarbstoffe, deren Herstellung und Verwendung - Google Patents
Neue Chromkomplexfarbstoffe, deren Herstellung und VerwendungInfo
- Publication number
- DE2520526C2 DE2520526C2 DE2520526A DE2520526A DE2520526C2 DE 2520526 C2 DE2520526 C2 DE 2520526C2 DE 2520526 A DE2520526 A DE 2520526A DE 2520526 A DE2520526 A DE 2520526A DE 2520526 C2 DE2520526 C2 DE 2520526C2
- Authority
- DE
- Germany
- Prior art keywords
- groups
- formula
- sulfonamido
- substituted
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000975 dye Substances 0.000 title claims description 129
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 title claims description 41
- 229910052804 chromium Inorganic materials 0.000 title claims description 40
- 239000011651 chromium Substances 0.000 title claims description 40
- -1 phenoxy, sulfo- Chemical class 0.000 claims description 61
- 239000000460 chlorine Substances 0.000 claims description 47
- 125000005420 sulfonamido group Chemical group S(=O)(=O)(N*)* 0.000 claims description 45
- 229910052801 chlorine Inorganic materials 0.000 claims description 30
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 26
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 24
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 20
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 19
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 19
- 229910052794 bromium Inorganic materials 0.000 claims description 19
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims description 19
- 125000003545 alkoxy group Chemical group 0.000 claims description 18
- 125000004442 acylamino group Chemical group 0.000 claims description 16
- 125000000217 alkyl group Chemical group 0.000 claims description 16
- 239000010985 leather Substances 0.000 claims description 14
- 238000004043 dyeing Methods 0.000 claims description 13
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 10
- 230000008878 coupling Effects 0.000 claims description 10
- 238000010168 coupling process Methods 0.000 claims description 10
- 238000005859 coupling reaction Methods 0.000 claims description 10
- 239000000463 material Substances 0.000 claims description 10
- 150000003254 radicals Chemical class 0.000 claims description 10
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 9
- 239000004952 Polyamide Substances 0.000 claims description 8
- 229920002647 polyamide Polymers 0.000 claims description 8
- 125000000565 sulfonamide group Chemical group 0.000 claims description 8
- 125000001174 sulfone group Chemical group 0.000 claims description 8
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 150000003457 sulfones Chemical group 0.000 claims description 7
- 125000003118 aryl group Chemical group 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 6
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims description 6
- 150000001412 amines Chemical class 0.000 claims description 5
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims description 5
- XRZDIHADHZSFBB-UHFFFAOYSA-N 3-oxo-n,3-diphenylpropanamide Chemical class C=1C=CC=CC=1NC(=O)CC(=O)C1=CC=CC=C1 XRZDIHADHZSFBB-UHFFFAOYSA-N 0.000 claims description 4
- DYRDKSSFIWVSNM-UHFFFAOYSA-N acetoacetanilide Chemical class CC(=O)CC(=O)NC1=CC=CC=C1 DYRDKSSFIWVSNM-UHFFFAOYSA-N 0.000 claims description 4
- 125000002252 acyl group Chemical group 0.000 claims description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 150000001768 cations Chemical class 0.000 claims description 4
- ZRHUHDUEXWHZMA-UHFFFAOYSA-N 1,4-dihydropyrazol-5-one Chemical class O=C1CC=NN1 ZRHUHDUEXWHZMA-UHFFFAOYSA-N 0.000 claims description 3
- 150000003931 anilides Chemical group 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical group 0.000 claims description 3
- 239000000203 mixture Substances 0.000 claims description 3
- 150000004780 naphthols Chemical class 0.000 claims description 3
- 150000002989 phenols Chemical class 0.000 claims description 3
- 125000006678 phenoxycarbonyl group Chemical group 0.000 claims description 3
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- WLFXSECCHULRRO-UHFFFAOYSA-N pyridine-2,6-diol Chemical compound OC1=CC=CC(O)=N1 WLFXSECCHULRRO-UHFFFAOYSA-N 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical group [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 2
- VRAKDAYLTPMBAW-UHFFFAOYSA-N [O-][N+](=O)ClC#N Chemical compound [O-][N+](=O)ClC#N VRAKDAYLTPMBAW-UHFFFAOYSA-N 0.000 claims description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 2
- 125000002668 chloroacetyl group Chemical group ClCC(=O)* 0.000 claims description 2
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 3
- 150000002431 hydrogen Chemical class 0.000 claims 2
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 claims 1
- 125000001624 naphthyl group Chemical group 0.000 claims 1
- 238000010422 painting Methods 0.000 claims 1
- 239000000243 solution Substances 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- 229910052757 nitrogen Inorganic materials 0.000 description 9
- JWAZRIHNYRIHIV-UHFFFAOYSA-N 2-naphthol Chemical compound C1=CC=CC2=CC(O)=CC=C21 JWAZRIHNYRIHIV-UHFFFAOYSA-N 0.000 description 8
- SMQUZDBALVYZAC-UHFFFAOYSA-N salicylaldehyde Chemical compound OC1=CC=CC=C1C=O SMQUZDBALVYZAC-UHFFFAOYSA-N 0.000 description 8
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 7
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 7
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 6
- 230000002378 acidificating effect Effects 0.000 description 6
- 150000001299 aldehydes Chemical class 0.000 description 6
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 6
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 6
- 240000007817 Olea europaea Species 0.000 description 5
- 125000004429 atom Chemical group 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 125000001424 substituent group Chemical group 0.000 description 5
- 239000004753 textile Substances 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 238000007792 addition Methods 0.000 description 4
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 4
- 229950011260 betanaphthol Drugs 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- LJAOOBNHPFKCDR-UHFFFAOYSA-K chromium(3+) trichloride hexahydrate Chemical compound O.O.O.O.O.O.[Cl-].[Cl-].[Cl-].[Cr+3] LJAOOBNHPFKCDR-UHFFFAOYSA-K 0.000 description 4
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 229940124530 sulfonamide Drugs 0.000 description 4
- 210000002268 wool Anatomy 0.000 description 4
- VLZVIIYRNMWPSN-UHFFFAOYSA-N 2-Amino-4-nitrophenol Chemical compound NC1=CC([N+]([O-])=O)=CC=C1O VLZVIIYRNMWPSN-UHFFFAOYSA-N 0.000 description 3
- BATBWCBBYMPOPE-UHFFFAOYSA-N 3-[(4-aminophenyl)diazenyl]benzenesulfonic acid Chemical compound C1=CC(N)=CC=C1N=NC1=CC=CC(S(O)(=O)=O)=C1 BATBWCBBYMPOPE-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 3
- 125000003710 aryl alkyl group Chemical group 0.000 description 3
- 238000004040 coloring Methods 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 229960003742 phenol Drugs 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 2
- YCOXTKKNXUZSKD-UHFFFAOYSA-N 3,4-xylenol Chemical compound CC1=CC=C(O)C=C1C YCOXTKKNXUZSKD-UHFFFAOYSA-N 0.000 description 2
- HVBSAKJJOYLTQU-UHFFFAOYSA-N 4-aminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1 HVBSAKJJOYLTQU-UHFFFAOYSA-N 0.000 description 2
- DSTPUJAJSXTJHM-UHFFFAOYSA-N 4-methyl-2-propan-2-ylphenol Chemical compound CC(C)C1=CC(C)=CC=C1O DSTPUJAJSXTJHM-UHFFFAOYSA-N 0.000 description 2
- DQIVFTJHYKDOMZ-UHFFFAOYSA-N 96-67-3 Chemical compound NC1=CC([N+]([O-])=O)=CC(S(O)(=O)=O)=C1O DQIVFTJHYKDOMZ-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- ADVGKWPZRIDURE-UHFFFAOYSA-N N-Ac-2-Aminophenol Natural products CC(=O)NC1=CC=CC=C1O ADVGKWPZRIDURE-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000004104 aryloxy group Chemical group 0.000 description 2
- 239000000987 azo dye Substances 0.000 description 2
- 125000001589 carboacyl group Chemical group 0.000 description 2
- 150000001845 chromium compounds Chemical class 0.000 description 2
- QFSKIUZTIHBWFR-UHFFFAOYSA-N chromium;hydrate Chemical compound O.[Cr] QFSKIUZTIHBWFR-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 150000002790 naphthalenes Chemical class 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical compound COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 description 2
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 229950000244 sulfanilic acid Drugs 0.000 description 2
- 150000003456 sulfonamides Chemical class 0.000 description 2
- JWQYZECMEPOAPF-UHFFFAOYSA-N 1,2,3,4-tetrahydronaphthalen-2-ol Chemical compound C1=CC=C2CC(O)CCC2=C1 JWQYZECMEPOAPF-UHFFFAOYSA-N 0.000 description 1
- BOKGTLAJQHTOKE-UHFFFAOYSA-N 1,5-dihydroxynaphthalene Chemical compound C1=CC=C2C(O)=CC=CC2=C1O BOKGTLAJQHTOKE-UHFFFAOYSA-N 0.000 description 1
- LLSNTRRAZWBTCK-UHFFFAOYSA-N 1-(3-hydroxynaphthalen-1-yl)ethanone Chemical compound C1=CC=C2C(C(=O)C)=CC(O)=CC2=C1 LLSNTRRAZWBTCK-UHFFFAOYSA-N 0.000 description 1
- IWRHUCBSLVVLJD-UHFFFAOYSA-N 1-(6-hydroxynaphthalen-2-yl)ethanone Chemical compound C1=C(O)C=CC2=CC(C(=O)C)=CC=C21 IWRHUCBSLVVLJD-UHFFFAOYSA-N 0.000 description 1
- GJKZJNZHHXWKCH-UHFFFAOYSA-N 1-[4-(4-chlorophenyl)-1-[3-(4-methylpiperazin-1-yl)propyl]piperidin-3-yl]ethanone;trihydrochloride Chemical compound Cl.Cl.Cl.C1CN(C)CCN1CCCN1CC(C(C)=O)C(C=2C=CC(Cl)=CC=2)CC1 GJKZJNZHHXWKCH-UHFFFAOYSA-N 0.000 description 1
- AIDFJGKWTOULTC-UHFFFAOYSA-N 1-butylsulfonylbutane Chemical compound CCCCS(=O)(=O)CCCC AIDFJGKWTOULTC-UHFFFAOYSA-N 0.000 description 1
- KUFFULVDNCHOFZ-UHFFFAOYSA-N 2,4-xylenol Chemical compound CC1=CC=C(O)C(C)=C1 KUFFULVDNCHOFZ-UHFFFAOYSA-N 0.000 description 1
- NAZDVUBIEPVUKE-UHFFFAOYSA-N 2,5-dimethoxyaniline Chemical compound COC1=CC=C(OC)C(N)=C1 NAZDVUBIEPVUKE-UHFFFAOYSA-N 0.000 description 1
- DOPJTDJKZNWLRB-UHFFFAOYSA-N 2-Amino-5-nitrophenol Chemical compound NC1=CC=C([N+]([O-])=O)C=C1O DOPJTDJKZNWLRB-UHFFFAOYSA-N 0.000 description 1
- QQDKXJSYZGJGKJ-UHFFFAOYSA-N 2-amino-3,4,6-trichlorophenol Chemical compound NC1=C(O)C(Cl)=CC(Cl)=C1Cl QQDKXJSYZGJGKJ-UHFFFAOYSA-N 0.000 description 1
- WASQBNCGNUTVNI-UHFFFAOYSA-N 2-amino-4,6-dichlorophenol Chemical compound NC1=CC(Cl)=CC(Cl)=C1O WASQBNCGNUTVNI-UHFFFAOYSA-N 0.000 description 1
- KABYHLDOADPLEI-UHFFFAOYSA-N 2-amino-4-[(4-phenyldiazenylphenyl)diazenyl]phenol Chemical compound C1=C(O)C(N)=CC(N=NC=2C=CC(=CC=2)N=NC=2C=CC=CC=2)=C1 KABYHLDOADPLEI-UHFFFAOYSA-N 0.000 description 1
- ZMXYNJXDULEQCK-UHFFFAOYSA-N 2-amino-p-cresol Chemical compound CC1=CC=C(O)C(N)=C1 ZMXYNJXDULEQCK-UHFFFAOYSA-N 0.000 description 1
- ZMCHBSMFKQYNKA-UHFFFAOYSA-N 2-aminobenzenesulfonic acid Chemical compound NC1=CC=CC=C1S(O)(=O)=O ZMCHBSMFKQYNKA-UHFFFAOYSA-N 0.000 description 1
- NTCCNERMXRIPTR-UHFFFAOYSA-N 2-hydroxy-1-naphthaldehyde Chemical compound C1=CC=CC2=C(C=O)C(O)=CC=C21 NTCCNERMXRIPTR-UHFFFAOYSA-N 0.000 description 1
- DSXKMMAQDSAZAC-UHFFFAOYSA-N 2-hydroxy-3,5-dimethylbenzaldehyde Chemical compound CC1=CC(C)=C(O)C(C=O)=C1 DSXKMMAQDSAZAC-UHFFFAOYSA-N 0.000 description 1
- YRGYYQCOWUULNF-UHFFFAOYSA-N 2-hydroxy-4-methyl-6-oxo-1h-pyridine-3-carbonitrile Chemical compound CC1=CC(=O)NC(O)=C1C#N YRGYYQCOWUULNF-UHFFFAOYSA-N 0.000 description 1
- ILEIUTCVWLYZOM-UHFFFAOYSA-N 2-hydroxy-5-methylbenzaldehyde Chemical compound CC1=CC=C(O)C(C=O)=C1 ILEIUTCVWLYZOM-UHFFFAOYSA-N 0.000 description 1
- VZLLZDZTQPBHAZ-UHFFFAOYSA-N 2-nitroaniline-4-sulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1[N+]([O-])=O VZLLZDZTQPBHAZ-UHFFFAOYSA-N 0.000 description 1
- FABVMBDCVAJXMB-UHFFFAOYSA-N 3,5-dichloro-2-hydroxybenzaldehyde Chemical compound OC1=C(Cl)C=C(Cl)C=C1C=O FABVMBDCVAJXMB-UHFFFAOYSA-N 0.000 description 1
- WAVOOWVINKGEHS-UHFFFAOYSA-N 3-(diethylamino)phenol Chemical compound CCN(CC)C1=CC=CC(O)=C1 WAVOOWVINKGEHS-UHFFFAOYSA-N 0.000 description 1
- MESJRHHDBDCQTH-UHFFFAOYSA-N 3-(dimethylamino)phenol Chemical group CN(C)C1=CC=CC(O)=C1 MESJRHHDBDCQTH-UHFFFAOYSA-N 0.000 description 1
- ZEWCASRNRWXXSO-UHFFFAOYSA-N 3-amino-4-hydroxybenzonitrile Chemical compound NC1=CC(C#N)=CC=C1O ZEWCASRNRWXXSO-UHFFFAOYSA-N 0.000 description 1
- QGTXBWMKRGHPDD-UHFFFAOYSA-N 3-amino-5-chloro-4-hydroxybenzenesulfonic acid Chemical compound NC1=CC(S(O)(=O)=O)=CC(Cl)=C1O QGTXBWMKRGHPDD-UHFFFAOYSA-N 0.000 description 1
- ZAJAQTYSTDTMCU-UHFFFAOYSA-N 3-aminobenzenesulfonic acid Chemical compound NC1=CC=CC(S(O)(=O)=O)=C1 ZAJAQTYSTDTMCU-UHFFFAOYSA-N 0.000 description 1
- OEUMLWRWURKDRL-UHFFFAOYSA-N 3-chloro-2-hydroxy-5-methylbenzaldehyde Chemical compound CC1=CC(Cl)=C(O)C(C=O)=C1 OEUMLWRWURKDRL-UHFFFAOYSA-N 0.000 description 1
- KQLRFWVNJUCXQT-UHFFFAOYSA-N 3-formyl-4-hydroxybenzenesulfonic acid Chemical compound OC1=CC=C(S(O)(=O)=O)C=C1C=O KQLRFWVNJUCXQT-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- BOTGCZBEERTTDQ-UHFFFAOYSA-N 4-Methoxy-1-naphthol Chemical compound C1=CC=C2C(OC)=CC=C(O)C2=C1 BOTGCZBEERTTDQ-UHFFFAOYSA-N 0.000 description 1
- RXCMFQDTWCCLBL-UHFFFAOYSA-N 4-amino-3-hydroxynaphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(N)=C(O)C=C(S(O)(=O)=O)C2=C1 RXCMFQDTWCCLBL-UHFFFAOYSA-N 0.000 description 1
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 description 1
- MNVMYTVDDOXZLS-UHFFFAOYSA-N 4-methoxyguaiacol Natural products COC1=CC=C(O)C(OC)=C1 MNVMYTVDDOXZLS-UHFFFAOYSA-N 0.000 description 1
- CYYZDBDROVLTJU-UHFFFAOYSA-N 4-n-Butylphenol Chemical compound CCCCC1=CC=C(O)C=C1 CYYZDBDROVLTJU-UHFFFAOYSA-N 0.000 description 1
- ZNPSUQQXTRRSBM-UHFFFAOYSA-N 4-n-Pentylphenol Chemical compound CCCCCC1=CC=C(O)C=C1 ZNPSUQQXTRRSBM-UHFFFAOYSA-N 0.000 description 1
- TYMLOMAKGOJONV-UHFFFAOYSA-N 4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1 TYMLOMAKGOJONV-UHFFFAOYSA-N 0.000 description 1
- KEGNUIZNBCHWLZ-UHFFFAOYSA-N 5,8-dichloronaphthalen-1-ol Chemical compound C1=CC(Cl)=C2C(O)=CC=CC2=C1Cl KEGNUIZNBCHWLZ-UHFFFAOYSA-N 0.000 description 1
- VPXCXBHLKDPWQV-UHFFFAOYSA-N 5-amino-2-chlorobenzenesulfonic acid Chemical compound NC1=CC=C(Cl)C(S(O)(=O)=O)=C1 VPXCXBHLKDPWQV-UHFFFAOYSA-N 0.000 description 1
- RMXFTNYYIDMHAB-UHFFFAOYSA-N 5-butyl-2-hydroxybenzaldehyde Chemical compound CCCCC1=CC=C(O)C(C=O)=C1 RMXFTNYYIDMHAB-UHFFFAOYSA-N 0.000 description 1
- NSKZAOKQZDLHGO-UHFFFAOYSA-N 5-chloro-2-hydroxy-3-methylbenzaldehyde Chemical compound CC1=CC(Cl)=CC(C=O)=C1O NSKZAOKQZDLHGO-UHFFFAOYSA-N 0.000 description 1
- WBSMIPLNPSCJFS-UHFFFAOYSA-N 5-chloro-2-methoxyaniline Chemical compound COC1=CC=C(Cl)C=C1N WBSMIPLNPSCJFS-UHFFFAOYSA-N 0.000 description 1
- IPZJPYHEVWLBNH-UHFFFAOYSA-N 5-chloronaphthalen-1-ol Chemical compound C1=CC=C2C(O)=CC=CC2=C1Cl IPZJPYHEVWLBNH-UHFFFAOYSA-N 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229920000297 Rayon Polymers 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 238000007259 addition reaction Methods 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 125000005236 alkanoylamino group Chemical group 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 description 1
- 125000005036 alkoxyphenyl group Chemical group 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- ZAMOJKJKCBOKFV-UHFFFAOYSA-N aniline;sulfamide Chemical compound NS(N)(=O)=O.NC1=CC=CC=C1 ZAMOJKJKCBOKFV-UHFFFAOYSA-N 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 125000003435 aroyl group Chemical group 0.000 description 1
- 150000007860 aryl ester derivatives Chemical class 0.000 description 1
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 description 1
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 1
- DMLAVOWQYNRWNQ-UHFFFAOYSA-N azobenzene Chemical compound C1=CC=CC=C1N=NC1=CC=CC=C1 DMLAVOWQYNRWNQ-UHFFFAOYSA-N 0.000 description 1
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000005586 carbonic acid group Chemical group 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000005018 casein Substances 0.000 description 1
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 description 1
- 235000021240 caseins Nutrition 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- ZCDOYSPFYFSLEW-UHFFFAOYSA-N chromate(2-) Chemical compound [O-][Cr]([O-])(=O)=O ZCDOYSPFYFSLEW-UHFFFAOYSA-N 0.000 description 1
- 150000001844 chromium Chemical class 0.000 description 1
- 229910021563 chromium fluoride Inorganic materials 0.000 description 1
- QOWZHEWZFLTYQP-UHFFFAOYSA-K chromium(3+);triformate Chemical compound [Cr+3].[O-]C=O.[O-]C=O.[O-]C=O QOWZHEWZFLTYQP-UHFFFAOYSA-K 0.000 description 1
- GRWVQDDAKZFPFI-UHFFFAOYSA-H chromium(III) sulfate Chemical compound [Cr+3].[Cr+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O GRWVQDDAKZFPFI-UHFFFAOYSA-H 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000009918 complex formation Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 125000004966 cyanoalkyl group Chemical group 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- CQSTUUWALVCPIS-UHFFFAOYSA-N dithiaziridine 1,1,2,2-tetraoxide Chemical class S1(=O)(=O)NS1(=O)=O CQSTUUWALVCPIS-UHFFFAOYSA-N 0.000 description 1
- QELUYTUMUWHWMC-UHFFFAOYSA-N edaravone Chemical compound O=C1CC(C)=NN1C1=CC=CC=C1 QELUYTUMUWHWMC-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000001465 metallisation Methods 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- FXHSLXPCKVVSLS-UHFFFAOYSA-N methyl n-(2-hydroxy-5-methylphenyl)carbamate Chemical compound COC(=O)NC1=CC(C)=CC=C1O FXHSLXPCKVVSLS-UHFFFAOYSA-N 0.000 description 1
- DZNFLGGCJZUMEM-UHFFFAOYSA-N methyl n-(7-hydroxynaphthalen-1-yl)carbamate Chemical compound C1=C(O)C=C2C(NC(=O)OC)=CC=CC2=C1 DZNFLGGCJZUMEM-UHFFFAOYSA-N 0.000 description 1
- RDOXTESZEPMUJZ-UHFFFAOYSA-N methyl phenyl ether Natural products COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 1
- HGVIAKXYAZRSEG-UHFFFAOYSA-N n-(2,4-dimethylphenyl)-3-oxobutanamide Chemical compound CC(=O)CC(=O)NC1=CC=C(C)C=C1C HGVIAKXYAZRSEG-UHFFFAOYSA-N 0.000 description 1
- BFVHBHKMLIBQNN-UHFFFAOYSA-N n-(2-chlorophenyl)-3-oxobutanamide Chemical compound CC(=O)CC(=O)NC1=CC=CC=C1Cl BFVHBHKMLIBQNN-UHFFFAOYSA-N 0.000 description 1
- KYYRTDXOHQYZPO-UHFFFAOYSA-N n-(2-methoxyphenyl)-3-oxobutanamide Chemical compound COC1=CC=CC=C1NC(=O)CC(C)=O KYYRTDXOHQYZPO-UHFFFAOYSA-N 0.000 description 1
- TVZIWRMELPWPPR-UHFFFAOYSA-N n-(2-methylphenyl)-3-oxobutanamide Chemical compound CC(=O)CC(=O)NC1=CC=CC=C1C TVZIWRMELPWPPR-UHFFFAOYSA-N 0.000 description 1
- IYGXQHCKSGMPRG-UHFFFAOYSA-N n-(3-amino-4-hydroxy-5-nitrophenyl)acetamide Chemical compound CC(=O)NC1=CC(N)=C(O)C([N+]([O-])=O)=C1 IYGXQHCKSGMPRG-UHFFFAOYSA-N 0.000 description 1
- MHQYNOHBRKPLGX-UHFFFAOYSA-N n-(5-hydroxy-2-methylphenyl)acetamide Chemical compound CC(=O)NC1=CC(O)=CC=C1C MHQYNOHBRKPLGX-UHFFFAOYSA-N 0.000 description 1
- UFWIBTONFRDIAS-UHFFFAOYSA-N naphthalene-acid Natural products C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 1
- 150000005002 naphthylamines Chemical class 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- VMPITZXILSNTON-UHFFFAOYSA-N o-anisidine Chemical compound COC1=CC=CC=C1N VMPITZXILSNTON-UHFFFAOYSA-N 0.000 description 1
- 238000005580 one pot reaction Methods 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- NRZWYNLTFLDQQX-UHFFFAOYSA-N p-tert-Amylphenol Chemical compound CCC(C)(C)C1=CC=C(O)C=C1 NRZWYNLTFLDQQX-UHFFFAOYSA-N 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 239000000123 paper Substances 0.000 description 1
- WXWCDTXEKCVRRO-UHFFFAOYSA-N para-Cresidine Chemical compound COC1=CC=C(C)C=C1N WXWCDTXEKCVRRO-UHFFFAOYSA-N 0.000 description 1
- QXYMVUZOGFVPGH-UHFFFAOYSA-N picramic acid Chemical compound NC1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O QXYMVUZOGFVPGH-UHFFFAOYSA-N 0.000 description 1
- 229920006306 polyurethane fiber Polymers 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- HHVIBTZHLRERCL-UHFFFAOYSA-N sulfonyldimethane Chemical group CS(C)(=O)=O HHVIBTZHLRERCL-UHFFFAOYSA-N 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 150000004992 toluidines Chemical class 0.000 description 1
- FTBATIJJKIIOTP-UHFFFAOYSA-K trifluorochromium Chemical compound F[Cr](F)F FTBATIJJKIIOTP-UHFFFAOYSA-K 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B55/00—Azomethine dyes
- C09B55/001—Azomethine dyes forming a 1,2 complex metal compound, e.g. with Co or Cr, with an other dye, e.g. with an azo or azomethine dye
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B45/00—Complex metal compounds of azo dyes
- C09B45/02—Preparation from dyes containing in o-position a hydroxy group and in o'-position hydroxy, alkoxy, carboxyl, amino or keto groups
- C09B45/04—Azo compounds in general
- C09B45/06—Chromium compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH636974A CH599307A5 (enExample) | 1974-05-09 | 1974-05-09 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2520526A1 DE2520526A1 (de) | 1975-11-20 |
| DE2520526C2 true DE2520526C2 (de) | 1986-03-13 |
Family
ID=4308497
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2520526A Expired DE2520526C2 (de) | 1974-05-09 | 1975-05-07 | Neue Chromkomplexfarbstoffe, deren Herstellung und Verwendung |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4331596A (enExample) |
| JP (1) | JPS5839185B2 (enExample) |
| AR (1) | AR228828A1 (enExample) |
| BR (1) | BR7502780A (enExample) |
| CA (1) | CA1059997A (enExample) |
| CH (1) | CH599307A5 (enExample) |
| DE (1) | DE2520526C2 (enExample) |
| ES (1) | ES437447A1 (enExample) |
| FR (1) | FR2270302B1 (enExample) |
| GB (1) | GB1503000A (enExample) |
| ZA (1) | ZA752951B (enExample) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4116952A (en) * | 1975-05-14 | 1978-09-26 | Ciba-Geigy Corporation | Unsymmetrical azo - azo methine 1:2 chromium complex dyes |
| CH624979A5 (enExample) * | 1975-05-14 | 1981-08-31 | Ciba Geigy Ag | |
| US4145339A (en) * | 1976-04-24 | 1979-03-20 | Hoechst Aktiengesellschaft | Water-soluble 1:2-cobalt complex dyestuffs of an azomethine and of an azo compound |
| DE2735287C2 (de) * | 1977-08-05 | 1985-03-28 | Basf Ag, 6700 Ludwigshafen | 1:2-Chromkomplexfarbstoffe, deren Herstellung und Verwendung |
| IT1096366B (it) * | 1977-05-23 | 1985-08-26 | Basf Ag | Coloranti complessi del cromo 1:2" |
| DE2735286A1 (de) * | 1977-08-05 | 1979-02-22 | Basf Ag | Metallkomplexfarbstoffe |
| US4256633A (en) * | 1978-04-25 | 1981-03-17 | Ciba-Geigy Corporation | Chromium complex compounds, process for their manufacture and use thereof |
| DE3034002A1 (de) | 1980-09-10 | 1982-04-22 | Basf Ag, 6700 Ludwigshafen | Sulfonsaeuregruppenhaltige 1 zu 2-chromkomplexfarbstoffe |
| US4493798A (en) * | 1980-09-19 | 1985-01-15 | Ciba Geigy Corporation | Metal complexes of disazo dyes |
| US4507124A (en) * | 1982-07-02 | 1985-03-26 | Ciba-Geigy Corporation | 1:2 Metal complexes of azomethine dyes having arylazo groups |
| US4502860A (en) * | 1982-07-02 | 1985-03-05 | Ciba-Geigy Corporation | Bis-1:2-chromium complexes of disazo dyes, and their preparation and use |
| JPS5975850U (ja) * | 1982-11-12 | 1984-05-23 | 日立化成工業株式会社 | 設備ユニツト |
| DE3370813D1 (en) * | 1982-11-16 | 1987-05-14 | Ciba Geigy Ag | Assymmetrical 1:2 chromium complex dyestuffs containing one azo and one azomethine compound |
| US4514559A (en) * | 1984-04-27 | 1985-04-30 | Nippon Kayaku Kabushiki Kaisha | Water soluble disazo compound, copper salt thereof, and sheet or film colored therewith |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2855393A (en) * | 1953-11-26 | 1958-10-07 | Geigy Ag J R | Chromium containing dyestuffs |
| US2985646A (en) * | 1957-03-14 | 1961-05-23 | Geigy Ag J R | Chromium-containing dyestuffs |
| DE1079247B (de) * | 1957-03-14 | 1960-04-07 | Geigy Ag J R | Verfahren zur Herstellung von wasserloeslichen chromhaltigen Farbstoffen |
| NL246115A (enExample) * | 1958-12-05 | 1964-02-10 | ||
| DE1106013B (de) * | 1958-12-10 | 1961-05-04 | Basf Ag | Verfahren zur Herstellung von Chromkomplexfarbstoffen |
| GB899714A (en) * | 1959-06-12 | 1962-06-27 | Ici Ltd | New metal-complexes of monoazo dyestuffs containing unsaturated acylamino groups |
| US3185676A (en) * | 1960-08-12 | 1965-05-25 | Gen Aniline & Film Corp | Method of azo dye chromation |
| FR1442837A (fr) * | 1964-07-31 | 1966-06-17 | Geigy Ag J R | Nouveaux colorants azoïques, leur préparation et leurs applications |
| CH443518A (de) * | 1964-07-31 | 1967-09-15 | Geigy Ag J R | Verfahren zur Herstellung wasserlöslicher chromhaltiger Farbstoffe |
| NL130114C (enExample) * | 1964-10-29 | |||
| CH427095A (de) * | 1965-10-01 | 1966-12-31 | Sandoz Ag | Verfahren zur Herstellung von Mischkomplexverbindungen |
| CH492002A (de) * | 1967-11-29 | 1970-06-15 | Geigy Ag J R | Verfahren zur Herstellung von Chromkomplexfarbstoffen |
-
1974
- 1974-05-09 CH CH636974A patent/CH599307A5/xx not_active IP Right Cessation
-
1975
- 1975-05-05 ES ES437447A patent/ES437447A1/es not_active Expired
- 1975-05-06 FR FR7514064A patent/FR2270302B1/fr not_active Expired
- 1975-05-07 BR BR3546/75A patent/BR7502780A/pt unknown
- 1975-05-07 AR AR258672A patent/AR228828A1/es active
- 1975-05-07 DE DE2520526A patent/DE2520526C2/de not_active Expired
- 1975-05-07 CA CA226,468A patent/CA1059997A/en not_active Expired
- 1975-05-07 ZA ZA00752951A patent/ZA752951B/xx unknown
- 1975-05-08 GB GB19519/75A patent/GB1503000A/en not_active Expired
- 1975-05-09 JP JP50055932A patent/JPS5839185B2/ja not_active Expired
-
1979
- 1979-12-11 US US06/102,498 patent/US4331596A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| FR2270302A1 (enExample) | 1975-12-05 |
| AU8095475A (en) | 1976-11-11 |
| GB1503000A (en) | 1978-03-08 |
| CA1059997A (en) | 1979-08-07 |
| FR2270302B1 (enExample) | 1977-07-08 |
| BR7502780A (pt) | 1976-03-16 |
| JPS50154323A (enExample) | 1975-12-12 |
| CH599307A5 (enExample) | 1978-05-31 |
| US4331596A (en) | 1982-05-25 |
| JPS5839185B2 (ja) | 1983-08-27 |
| AR228828A1 (es) | 1983-04-29 |
| DE2520526A1 (de) | 1975-11-20 |
| ES437447A1 (es) | 1976-12-01 |
| ZA752951B (en) | 1976-04-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2520526C2 (de) | Neue Chromkomplexfarbstoffe, deren Herstellung und Verwendung | |
| DE2620981A1 (de) | Neue chromkomplexfarbstoffe, deren herstellung und verwendung | |
| DE2722855A1 (de) | 1 zu 2-metallkomplexe, deren herstellung und verwendung | |
| EP0005207B1 (de) | Bis-1:2-chrom-disazo-bisazomethinfarbstoffe, deren Herstellung und deren Verwendung zum Färben von Leder | |
| EP0009466B1 (de) | 1 : 2-Bis-chromkomplexfarbstoffe aus Polyazo- oder Disazo-azomethinverbindungen, deren Herstellung und Verwendung | |
| EP0110825B1 (de) | Unsymmetrische 1:2-Chromkomplexfarbstoffe, enthaltend eine Azo- und eine Azomethinverbindung | |
| DE2236299C2 (de) | Azoverbindungen, deren Herstellung und Verwendung | |
| EP0260561B1 (de) | Verfahren zum Färben von Leder mit Farbstoffmischungen | |
| EP0082117A1 (de) | Chromkomplexe von Polyazofarbstoffen | |
| DE1012007B (de) | Verfahren zur Herstellung chromhaltiger Azofarbstoffe | |
| EP0019851B1 (de) | 1:2 Chromkomplexfarbstoffe der Azomethin- und/oder Azoreihe, deren Herstellung und Verwendung beim Färben und Bedrucken von Polyamid- oder Cellulosematerialien | |
| DE2457590C2 (de) | Neue Metallkomplexe, deren Herstellung und Verwendung | |
| EP0079858B1 (de) | Azofarbstoffe, Metallkomplexe dieser Farbstoffe, deren Herstellung und Verwendung | |
| CH319237A (de) | Verfahren zur Herstellung neuer kobalthaltiger Azofarbstoffe | |
| DE1079247B (de) | Verfahren zur Herstellung von wasserloeslichen chromhaltigen Farbstoffen | |
| EP0148120B1 (de) | Unsymmetrische 1:2-Chromkoplexfarbstoffe | |
| EP0037377B1 (de) | Metallkomplexfarbstoffe, deren Herstellung und Verwendung | |
| DE3631753A1 (de) | Asymmetrische 1:2-metallkomplexfarbstoffe | |
| DE920750C (de) | Verfahren zur Herstellung neuer chromhaltiger Azofarbstoffe | |
| DE1444605C3 (de) | Verfahren zur Herstellung chromhaltiger 2:1-Azokomplexfarbstoffe | |
| DE1644356C3 (de) | 1 zu 2-Chrom- oder Kobalt-Mischkomplexfarbstoffe, ihre Herstellung und Verwendung zum Färben, Klotzen oder Bedrucken von natürlichen und synthetischen Polyamiden oder Leder | |
| EP0151369B1 (de) | Unsymmetrische 1:2-Chromkomplexe, enthaltend eine Azo- und eine Azomethinverbindung | |
| DE2540588C2 (de) | Neue Lederfarbstoffe, deren Herstellung und Verwendung | |
| DE3703361A1 (de) | Unsymmetrische 1:2-chromkomplexfarbstoffe | |
| DE2805243A1 (de) | 1 zu 2-metallkomplexe, deren herstellung und verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8128 | New person/name/address of the agent |
Representative=s name: SCHWABE, H., DIPL.-ING. SANDMAIR, K., DIPL.-CHEM. |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |