DE2507674C2 - - Google Patents
Info
- Publication number
- DE2507674C2 DE2507674C2 DE2507674A DE2507674A DE2507674C2 DE 2507674 C2 DE2507674 C2 DE 2507674C2 DE 2507674 A DE2507674 A DE 2507674A DE 2507674 A DE2507674 A DE 2507674A DE 2507674 C2 DE2507674 C2 DE 2507674C2
- Authority
- DE
- Germany
- Prior art keywords
- mol
- butanediol
- terephthalic acid
- diol component
- catalysts
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 claims description 29
- 229920001634 Copolyester Polymers 0.000 claims description 25
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical group OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 18
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 claims description 17
- 239000003054 catalyst Substances 0.000 claims description 14
- 238000004519 manufacturing process Methods 0.000 claims description 11
- 150000002009 diols Chemical class 0.000 claims description 10
- 238000005886 esterification reaction Methods 0.000 claims description 5
- 230000032050 esterification Effects 0.000 claims description 4
- 239000007795 chemical reaction product Substances 0.000 claims description 3
- 238000005809 transesterification reaction Methods 0.000 claims description 3
- 230000015572 biosynthetic process Effects 0.000 claims description 2
- QPKOBORKPHRBPS-UHFFFAOYSA-N bis(2-hydroxyethyl) terephthalate Chemical compound OCCOC(=O)C1=CC=C(C(=O)OCCO)C=C1 QPKOBORKPHRBPS-UHFFFAOYSA-N 0.000 claims description 2
- 238000002347 injection Methods 0.000 claims description 2
- 239000007924 injection Substances 0.000 claims description 2
- 238000000034 method Methods 0.000 claims description 2
- 229920001169 thermoplastic Polymers 0.000 claims description 2
- 239000004416 thermosoftening plastic Substances 0.000 claims description 2
- 150000003503 terephthalic acid derivatives Chemical class 0.000 claims 1
- -1 Polyethylene terephthalate Polymers 0.000 description 38
- 229920000139 polyethylene terephthalate Polymers 0.000 description 18
- 239000005020 polyethylene terephthalate Substances 0.000 description 15
- 238000002425 crystallisation Methods 0.000 description 14
- 230000008025 crystallization Effects 0.000 description 13
- 239000011521 glass Substances 0.000 description 9
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 8
- 239000000835 fiber Substances 0.000 description 8
- 229920000728 polyester Polymers 0.000 description 8
- 229910052725 zinc Inorganic materials 0.000 description 8
- 239000011701 zinc Substances 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 7
- 229920001707 polybutylene terephthalate Polymers 0.000 description 7
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 6
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 5
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 4
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 239000000654 additive Substances 0.000 description 4
- 229910052787 antimony Inorganic materials 0.000 description 4
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 4
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Chemical compound O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 229910017052 cobalt Inorganic materials 0.000 description 4
- 239000010941 cobalt Substances 0.000 description 4
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 4
- 239000010949 copper Substances 0.000 description 4
- 239000003063 flame retardant Substances 0.000 description 4
- YBMRDBCBODYGJE-UHFFFAOYSA-N germanium dioxide Chemical compound O=[Ge]=O YBMRDBCBODYGJE-UHFFFAOYSA-N 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 150000002739 metals Chemical class 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 239000002667 nucleating agent Substances 0.000 description 4
- 229910052698 phosphorus Inorganic materials 0.000 description 4
- 239000011574 phosphorus Substances 0.000 description 4
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 3
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical class OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 229910052782 aluminium Inorganic materials 0.000 description 3
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 3
- 229910052791 calcium Inorganic materials 0.000 description 3
- 239000011575 calcium Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 150000004675 formic acid derivatives Chemical class 0.000 description 3
- 150000004678 hydrides Chemical class 0.000 description 3
- 239000003112 inhibitor Substances 0.000 description 3
- 229910052742 iron Inorganic materials 0.000 description 3
- 229910052749 magnesium Inorganic materials 0.000 description 3
- 239000011777 magnesium Substances 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 238000000465 moulding Methods 0.000 description 3
- 150000002989 phenols Chemical class 0.000 description 3
- 238000006068 polycondensation reaction Methods 0.000 description 3
- 239000012779 reinforcing material Substances 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 229910052719 titanium Inorganic materials 0.000 description 3
- 239000010936 titanium Substances 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- KPZGRMZPZLOPBS-UHFFFAOYSA-N 1,3-dichloro-2,2-bis(chloromethyl)propane Chemical compound ClCC(CCl)(CCl)CCl KPZGRMZPZLOPBS-UHFFFAOYSA-N 0.000 description 2
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- WAEMQWOKJMHJLA-UHFFFAOYSA-N Manganese(2+) Chemical compound [Mn+2] WAEMQWOKJMHJLA-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 239000004743 Polypropylene Substances 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 150000001242 acetic acid derivatives Chemical class 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical class OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 150000001642 boronic acid derivatives Chemical class 0.000 description 2
- OWBTYPJTUOEWEK-UHFFFAOYSA-N butane-2,3-diol Chemical compound CC(O)C(C)O OWBTYPJTUOEWEK-UHFFFAOYSA-N 0.000 description 2
- RHIAOOMCMLDTKE-UHFFFAOYSA-L butanedioate;cadmium(2+) Chemical class [Cd+2].[O-]C(=O)CCC([O-])=O RHIAOOMCMLDTKE-UHFFFAOYSA-L 0.000 description 2
- 150000004648 butanoic acid derivatives Chemical class 0.000 description 2
- 229910052793 cadmium Inorganic materials 0.000 description 2
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 2
- 229910052804 chromium Inorganic materials 0.000 description 2
- 239000011651 chromium Substances 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- 125000005594 diketone group Chemical group 0.000 description 2
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000011888 foil Substances 0.000 description 2
- 230000004927 fusion Effects 0.000 description 2
- 229910052732 germanium Inorganic materials 0.000 description 2
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 description 2
- 239000003365 glass fiber Substances 0.000 description 2
- 238000001746 injection moulding Methods 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 150000002696 manganese Chemical class 0.000 description 2
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 2
- 150000003018 phosphorus compounds Chemical class 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 229920001155 polypropylene Polymers 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 238000003825 pressing Methods 0.000 description 2
- 125000001453 quaternary ammonium group Chemical group 0.000 description 2
- 150000004760 silicates Chemical class 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 238000004781 supercooling Methods 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- VXUYXOFXAQZZMF-UHFFFAOYSA-N titanium(IV) isopropoxide Chemical compound CC(C)O[Ti](OC(C)C)(OC(C)C)OC(C)C VXUYXOFXAQZZMF-UHFFFAOYSA-N 0.000 description 2
- JCMLRUNDSXARRW-UHFFFAOYSA-N trioxouranium Chemical compound O=[U](=O)=O JCMLRUNDSXARRW-UHFFFAOYSA-N 0.000 description 2
- XZZNDPSIHUTMOC-UHFFFAOYSA-N triphenyl phosphate Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)(=O)OC1=CC=CC=C1 XZZNDPSIHUTMOC-UHFFFAOYSA-N 0.000 description 2
- HVLLSGMXQDNUAL-UHFFFAOYSA-N triphenyl phosphite Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)OC1=CC=CC=C1 HVLLSGMXQDNUAL-UHFFFAOYSA-N 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- VMDYMJSKWCVEEB-UHFFFAOYSA-N 1-[3,5-bis[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyl]-1,3,5-triazinan-1-yl]-3-(3,5-ditert-butyl-4-hydroxyphenyl)propan-1-one Chemical compound CC(C)(C)C1=C(O)C(C(C)(C)C)=CC(CCC(=O)N2CN(CN(C2)C(=O)CCC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)C(=O)CCC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)=C1 VMDYMJSKWCVEEB-UHFFFAOYSA-N 0.000 description 1
- APTGHASZJUAUCP-UHFFFAOYSA-N 1-n,4-n-di(octan-2-yl)benzene-1,4-diamine Chemical compound CCCCCCC(C)NC1=CC=C(NC(C)CCCCCC)C=C1 APTGHASZJUAUCP-UHFFFAOYSA-N 0.000 description 1
- GSOYMOAPJZYXTB-UHFFFAOYSA-N 2,6-ditert-butyl-4-(3,5-ditert-butyl-4-hydroxyphenyl)phenol Chemical compound CC(C)(C)C1=C(O)C(C(C)(C)C)=CC(C=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)=C1 GSOYMOAPJZYXTB-UHFFFAOYSA-N 0.000 description 1
- GJDRKHHGPHLVNI-UHFFFAOYSA-N 2,6-ditert-butyl-4-(diethoxyphosphorylmethyl)phenol Chemical compound CCOP(=O)(OCC)CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 GJDRKHHGPHLVNI-UHFFFAOYSA-N 0.000 description 1
- PFANXOISJYKQRP-UHFFFAOYSA-N 2-tert-butyl-4-[1-(5-tert-butyl-4-hydroxy-2-methylphenyl)butyl]-5-methylphenol Chemical compound C=1C(C(C)(C)C)=C(O)C=C(C)C=1C(CCC)C1=CC(C(C)(C)C)=C(O)C=C1C PFANXOISJYKQRP-UHFFFAOYSA-N 0.000 description 1
- UJAWGGOCYUPCPS-UHFFFAOYSA-N 4-(2-phenylpropan-2-yl)-n-[4-(2-phenylpropan-2-yl)phenyl]aniline Chemical compound C=1C=C(NC=2C=CC(=CC=2)C(C)(C)C=2C=CC=CC=2)C=CC=1C(C)(C)C1=CC=CC=C1 UJAWGGOCYUPCPS-UHFFFAOYSA-N 0.000 description 1
- VSAWBBYYMBQKIK-UHFFFAOYSA-N 4-[[3,5-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2,4,6-trimethylphenyl]methyl]-2,6-ditert-butylphenol Chemical compound CC1=C(CC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)C(C)=C(CC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)C(C)=C1CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 VSAWBBYYMBQKIK-UHFFFAOYSA-N 0.000 description 1
- MNDJKTIGCWCQIG-UHFFFAOYSA-N 4-n-naphthalen-2-ylbenzene-1,4-diamine Chemical compound C1=CC(N)=CC=C1NC1=CC=C(C=CC=C2)C2=C1 MNDJKTIGCWCQIG-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- CMEWLCATCRTSGF-UHFFFAOYSA-N N,N-dimethyl-4-nitrosoaniline Chemical compound CN(C)C1=CC=C(N=O)C=C1 CMEWLCATCRTSGF-UHFFFAOYSA-N 0.000 description 1
- KEQFTVQCIQJIQW-UHFFFAOYSA-N N-Phenyl-2-naphthylamine Chemical compound C=1C=C2C=CC=CC2=CC=1NC1=CC=CC=C1 KEQFTVQCIQJIQW-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- 229930192627 Naphthoquinone Natural products 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 229920001283 Polyalkylene terephthalate Polymers 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- VNDYJBBGRKZCSX-UHFFFAOYSA-L Zinc bromide Inorganic materials Br[Zn]Br VNDYJBBGRKZCSX-UHFFFAOYSA-L 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- ULGYAEQHFNJYML-UHFFFAOYSA-N [AlH3].[Ca] Chemical compound [AlH3].[Ca] ULGYAEQHFNJYML-UHFFFAOYSA-N 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- ZOIORXHNWRGPMV-UHFFFAOYSA-N acetic acid;zinc Chemical compound [Zn].CC(O)=O.CC(O)=O ZOIORXHNWRGPMV-UHFFFAOYSA-N 0.000 description 1
- WNLRTRBMVRJNCN-UHFFFAOYSA-L adipate(2-) Chemical compound [O-]C(=O)CCCCC([O-])=O WNLRTRBMVRJNCN-UHFFFAOYSA-L 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001339 alkali metal compounds Chemical class 0.000 description 1
- 150000001341 alkaline earth metal compounds Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 150000001414 amino alcohols Chemical class 0.000 description 1
- 229940058905 antimony compound for treatment of leishmaniasis and trypanosomiasis Drugs 0.000 description 1
- 150000001463 antimony compounds Chemical class 0.000 description 1
- UCXOJWUKTTTYFB-UHFFFAOYSA-N antimony;heptahydrate Chemical compound O.O.O.O.O.O.O.[Sb].[Sb] UCXOJWUKTTTYFB-UHFFFAOYSA-N 0.000 description 1
- 150000004982 aromatic amines Chemical group 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- NINLDBMTAAKRTR-UHFFFAOYSA-L barium(2+);propanedioate Chemical compound [Ba+2].[O-]C(=O)CC([O-])=O NINLDBMTAAKRTR-UHFFFAOYSA-L 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 239000005388 borosilicate glass Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- YHWCPXVTRSHPNY-UHFFFAOYSA-N butan-1-olate;titanium(4+) Chemical compound [Ti+4].CCCC[O-].CCCC[O-].CCCC[O-].CCCC[O-] YHWCPXVTRSHPNY-UHFFFAOYSA-N 0.000 description 1
- CDQSJQSWAWPGKG-UHFFFAOYSA-N butane-1,1-diol Chemical compound CCCC(O)O CDQSJQSWAWPGKG-UHFFFAOYSA-N 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 229910052729 chemical element Inorganic materials 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 150000001879 copper Chemical class 0.000 description 1
- 229940120693 copper naphthenate Drugs 0.000 description 1
- SEVNKWFHTNVOLD-UHFFFAOYSA-L copper;3-(4-ethylcyclohexyl)propanoate;3-(3-ethylcyclopentyl)propanoate Chemical compound [Cu+2].CCC1CCC(CCC([O-])=O)C1.CCC1CCC(CCC([O-])=O)CC1 SEVNKWFHTNVOLD-UHFFFAOYSA-L 0.000 description 1
- VNZQQAVATKSIBR-UHFFFAOYSA-L copper;octanoate Chemical compound [Cu+2].CCCCCCCC([O-])=O.CCCCCCCC([O-])=O VNZQQAVATKSIBR-UHFFFAOYSA-L 0.000 description 1
- JKWMSGQKBLHBQQ-UHFFFAOYSA-N diboron trioxide Chemical compound O=BOB=O JKWMSGQKBLHBQQ-UHFFFAOYSA-N 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000011152 fibreglass Substances 0.000 description 1
- 229940119177 germanium dioxide Drugs 0.000 description 1
- JEGUKCSWCFPDGT-UHFFFAOYSA-N h2o hydrate Chemical class O.O JEGUKCSWCFPDGT-UHFFFAOYSA-N 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000011256 inorganic filler Substances 0.000 description 1
- 229910003475 inorganic filler Inorganic materials 0.000 description 1
- 239000001023 inorganic pigment Substances 0.000 description 1
- IJHFIVUWUURYJD-UHFFFAOYSA-M lanthanum(3+);oxygen(2-);hydroxide Chemical compound [OH-].[O-2].[La+3] IJHFIVUWUURYJD-UHFFFAOYSA-M 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- 229940071125 manganese acetate Drugs 0.000 description 1
- UOGMEBQRZBEZQT-UHFFFAOYSA-L manganese(2+);diacetate Chemical compound [Mn+2].CC([O-])=O.CC([O-])=O UOGMEBQRZBEZQT-UHFFFAOYSA-L 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- GEMHFKXPOCTAIP-UHFFFAOYSA-N n,n-dimethyl-n'-phenylcarbamimidoyl chloride Chemical compound CN(C)C(Cl)=NC1=CC=CC=C1 GEMHFKXPOCTAIP-UHFFFAOYSA-N 0.000 description 1
- 150000002791 naphthoquinones Chemical class 0.000 description 1
- ATINCSYRHURBSP-UHFFFAOYSA-K neodymium(iii) chloride Chemical compound Cl[Nd](Cl)Cl ATINCSYRHURBSP-UHFFFAOYSA-K 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 229910052755 nonmetal Inorganic materials 0.000 description 1
- 150000002843 nonmetals Chemical class 0.000 description 1
- 230000006911 nucleation Effects 0.000 description 1
- 238000010899 nucleation Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000002896 organic halogen compounds Chemical class 0.000 description 1
- 239000012860 organic pigment Substances 0.000 description 1
- 238000010525 oxidative degradation reaction Methods 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- IIQJBVZYLIIMND-UHFFFAOYSA-J potassium;antimony(3+);2,3-dihydroxybutanedioate Chemical compound [K+].[Sb+3].[O-]C(=O)C(O)C(O)C([O-])=O.[O-]C(=O)C(O)C(O)C([O-])=O IIQJBVZYLIIMND-UHFFFAOYSA-J 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 150000004053 quinones Chemical class 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 230000002787 reinforcement Effects 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000007790 solid phase Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 229910052712 strontium Inorganic materials 0.000 description 1
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 1
- AHBGXTDRMVNFER-UHFFFAOYSA-L strontium dichloride Chemical class [Cl-].[Cl-].[Sr+2] AHBGXTDRMVNFER-UHFFFAOYSA-L 0.000 description 1
- LVZZABGEQTZXHP-UHFFFAOYSA-L strontium;propanedioate Chemical class [Sr+2].[O-]C(=O)CC([O-])=O LVZZABGEQTZXHP-UHFFFAOYSA-L 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-O sulfonium Chemical compound [SH3+] RWSOTUBLDIXVET-UHFFFAOYSA-O 0.000 description 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 1
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- UGNWTBMOAKPKBL-UHFFFAOYSA-N tetrachloro-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O UGNWTBMOAKPKBL-UHFFFAOYSA-N 0.000 description 1
- 229920006344 thermoplastic copolyester Polymers 0.000 description 1
- 150000003609 titanium compounds Chemical class 0.000 description 1
- XROWMBWRMNHXMF-UHFFFAOYSA-J titanium tetrafluoride Chemical compound [F-].[F-].[F-].[F-].[Ti+4] XROWMBWRMNHXMF-UHFFFAOYSA-J 0.000 description 1
- CNHDIAIOKMXOLK-UHFFFAOYSA-N toluquinol Chemical compound CC1=CC(O)=CC=C1O CNHDIAIOKMXOLK-UHFFFAOYSA-N 0.000 description 1
- ILJSQTXMGCGYMG-UHFFFAOYSA-N triacetic acid Chemical compound CC(=O)CC(=O)CC(O)=O ILJSQTXMGCGYMG-UHFFFAOYSA-N 0.000 description 1
- CYTQBVOFDCPGCX-UHFFFAOYSA-N trimethyl phosphite Chemical compound COP(OC)OC CYTQBVOFDCPGCX-UHFFFAOYSA-N 0.000 description 1
- QOPBTFMUVTXWFF-UHFFFAOYSA-N tripropyl phosphite Chemical compound CCCOP(OCCC)OCCC QOPBTFMUVTXWFF-UHFFFAOYSA-N 0.000 description 1
- 239000004246 zinc acetate Substances 0.000 description 1
- 229940102001 zinc bromide Drugs 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/02—Polyesters derived from hydroxycarboxylic acids or from polycarboxylic acids and polyhydroxy compounds
- C08G63/12—Polyesters derived from hydroxycarboxylic acids or from polycarboxylic acids and polyhydroxy compounds derived from polycarboxylic acids and polyhydroxy compounds
- C08G63/16—Dicarboxylic acids and dihydroxy compounds
- C08G63/18—Dicarboxylic acids and dihydroxy compounds the acids or hydroxy compounds containing carbocyclic rings
- C08G63/181—Acids containing aromatic rings
- C08G63/183—Terephthalic acids
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/78—Preparation processes
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyesters Or Polycarbonates (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Priority Applications (15)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19752560492 DE2560492C2 (cg-RX-API-DMAC10.html) | 1975-02-22 | 1975-02-22 | |
| DE19752507674 DE2507674A1 (de) | 1975-02-22 | 1975-02-22 | Schnellkristallisierende poly(aethylen/alkylen)-terephthalate |
| NL7600808.A NL167179C (nl) | 1975-02-22 | 1976-01-27 | Werkwijze voor het bereiden van snel kristalliserende tereftaalzuurcopolyesters, alsmede uit dit soort copo- lyesters vervaardigde spuitgiet-voorwerpen. |
| US05/658,816 US4086212A (en) | 1975-02-22 | 1976-02-17 | Poly(ethylene/alkylene) terephthalates which crystallize rapidly |
| FR7604786A FR2301546A1 (fr) | 1975-02-22 | 1976-02-20 | Poly (terephtalates d'ethylene/alcoylene) a cristallisation rapide |
| GB6793/76A GB1505599A (en) | 1975-02-22 | 1976-02-20 | Preparation of poly(ethylene/alkylene)terephthalates which crystallise rapidly |
| BE164496A BE838778A (fr) | 1975-02-22 | 1976-02-20 | Poly(terephtalates d'ethylene/alcoylene) a cristallisation rapide |
| JP51017186A JPS614842B2 (cg-RX-API-DMAC10.html) | 1975-02-22 | 1976-02-20 | |
| CS761141A CS194235B2 (en) | 1975-02-22 | 1976-02-20 | Method of preparing high crystalline quickly crystallizing,thermoplastic copolyester of terephthalic acid |
| DD191382A DD126600A5 (cg-RX-API-DMAC10.html) | 1975-02-22 | 1976-02-20 | |
| CH210176A CH602819A5 (cg-RX-API-DMAC10.html) | 1975-02-22 | 1976-02-20 | |
| IT48200/76A IT1053880B (it) | 1975-02-22 | 1976-02-20 | Poli etilen alchilen tereftalati rapidamente cristallizzanti e procedimento per produrli |
| CA246,192A CA1076738A (en) | 1975-02-22 | 1976-02-20 | Poly(ethylene/alkylene) terephthalates which crystallise rapidly |
| US05/825,121 US4136089A (en) | 1975-02-22 | 1977-08-16 | Molded articles of crystalline poly (ethylene/alkylene) terephthalates which crystallize rapidly |
| NLAANVRAGE7907674,A NL182084C (nl) | 1975-02-22 | 1979-10-17 | Werkwijze voor het bereiden van snel kristalliserende tereftaalzuurcopolyesters, alsmede uit dit soort copolyesters vervaardigde spuitgiet-voorwerpen. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19752507674 DE2507674A1 (de) | 1975-02-22 | 1975-02-22 | Schnellkristallisierende poly(aethylen/alkylen)-terephthalate |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2507674A1 DE2507674A1 (de) | 1976-09-09 |
| DE2507674C2 true DE2507674C2 (cg-RX-API-DMAC10.html) | 1988-12-01 |
Family
ID=5939534
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752507674 Granted DE2507674A1 (de) | 1975-02-22 | 1975-02-22 | Schnellkristallisierende poly(aethylen/alkylen)-terephthalate |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4086212A (cg-RX-API-DMAC10.html) |
| JP (1) | JPS614842B2 (cg-RX-API-DMAC10.html) |
| BE (1) | BE838778A (cg-RX-API-DMAC10.html) |
| CA (1) | CA1076738A (cg-RX-API-DMAC10.html) |
| CH (1) | CH602819A5 (cg-RX-API-DMAC10.html) |
| CS (1) | CS194235B2 (cg-RX-API-DMAC10.html) |
| DD (1) | DD126600A5 (cg-RX-API-DMAC10.html) |
| DE (1) | DE2507674A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2301546A1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1505599A (cg-RX-API-DMAC10.html) |
| IT (1) | IT1053880B (cg-RX-API-DMAC10.html) |
| NL (1) | NL167179C (cg-RX-API-DMAC10.html) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE102004014590A1 (de) * | 2004-03-23 | 2005-10-20 | Buehler Ag | Teilkristallines Polyethylenterephthalat |
| WO2023110961A1 (en) | 2021-12-17 | 2023-06-22 | Covestro Deutschland Ag | At least partially biobased layered structure with good favourable properties |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2545720A1 (de) * | 1975-10-11 | 1977-04-21 | Bayer Ag | Schnellkristallisierende blockcopolyester |
| US4207230A (en) * | 1977-02-01 | 1980-06-10 | Bayer Aktiengesellschaft | Block copolyesters which crystallize rapidly |
| DE2706123A1 (de) | 1977-02-14 | 1978-08-17 | Bayer Ag | Schnell kristallisierende polyaethylenterephthalate und verfahren zu ihrer herstellung |
| DE2715932A1 (de) | 1977-04-09 | 1978-10-19 | Bayer Ag | Schnellkristallisierende poly(aethylen/alkylen)-terephthalate |
| DE2834438C3 (de) * | 1978-08-05 | 1987-12-03 | Fa. Carl Freudenberg, 6940 Weinheim | Spinnvliesstoff aus Polyester-Filamenten zur Verwendung als Trägermaterial für einen tiefziehfähigen Tufting-Teppich |
| US4425457A (en) | 1980-08-06 | 1984-01-10 | Celanese Corporation | High gloss polyethylene terephthalate reinforced resin compositions |
| US4483955A (en) * | 1980-08-06 | 1984-11-20 | Celanese Corporation | High gloss polyethylene terephthalate reinforced resin compositions |
| US4483948A (en) * | 1980-09-24 | 1984-11-20 | Ppg Industries, Inc. | Antioxidants and reinforced polymers and oil-in-water emulsions of antioxidants |
| US4425470A (en) | 1982-08-06 | 1984-01-10 | E. I. Du Pont De Nemours And Company | Alkali metal salts of low molecular weight polyethylene terephthalate as nucleating agents for polyethylene terephthalates |
| DE3532033A1 (de) * | 1985-09-09 | 1987-03-19 | Hoechst Ag | Schnellkristallisierende polyestermassen und verfahren zu deren herstellung |
| DE69214686T2 (de) * | 1991-02-28 | 1997-06-05 | Agfa Gevaert Nv | Verfahren zur Herstellung von Polyestern mit verbesserter thermooxydativer Stabilität |
| US5446122A (en) * | 1994-11-30 | 1995-08-29 | General Electric Company | Process for preparing macrocyclic polyesters |
| DE19512407A1 (de) * | 1995-04-03 | 1996-10-10 | Basf Ag | Flammgeschützte thermoplastische Formmassen |
| US6271291B1 (en) * | 1998-12-18 | 2001-08-07 | Eastman Chemical Company | Extrudable masterbatch |
| EP1735552A2 (en) * | 2004-04-15 | 2006-12-27 | Federal-Mogul Corporation | An integrated sensor-seal module for detecting angular position of a crankshaft |
| WO2006016458A1 (ja) * | 2004-08-11 | 2006-02-16 | Toray Industries, Inc. | 光反射体用ポリエステル樹脂組成物 |
| WO2007085380A1 (en) * | 2006-01-24 | 2007-08-02 | Cryovac, Inc. | Multilayer oriented film |
| EP2168783A1 (de) | 2008-09-24 | 2010-03-31 | Bayer MaterialScience AG | Verwendung einer Kunststoff-Folie im Farblaserdruck |
| EP2172336A1 (de) | 2008-09-24 | 2010-04-07 | Bayer MaterialScience AG | Fälschungssichere Sicherheitsmerkmale in Sicherheits- oder Wertdokumenten |
| EP2218579A1 (de) | 2009-02-13 | 2010-08-18 | Bayer MaterialScience AG | Verbessertes Verfahren zur Herstellung eines laminierten Schichtverbundes |
| DE102009024340A1 (de) | 2009-06-09 | 2010-12-16 | Bayer Materialscience Ag | Hochfließfähige Polymerzusammensetzung und Verfahren zu ihrer Herstellung |
| EP3613602A1 (de) | 2018-08-23 | 2020-02-26 | Covestro Deutschland AG | Verbessertes verfahren für das partielle einfärben von kunststoffteilen |
| KR20210099555A (ko) | 2018-12-03 | 2021-08-12 | 코베스트로 인텔렉쳐 프로퍼티 게엠베하 운트 콤파니 카게 | 층상 구조물에서의 높은 비캣 연화 온도를 갖는 플라스틱 필름 |
| US12023953B2 (en) | 2019-11-22 | 2024-07-02 | Covestro Intellectual Property Gmbh & Co. Kg | Layer structure with modified structure, and production thereof |
| CN117203063A (zh) | 2021-04-14 | 2023-12-08 | 科思创德国股份有限公司 | 使用颜色载体层中的固体染料将塑料部件进行局部着色的方法 |
| EP4197783A1 (en) | 2021-12-17 | 2023-06-21 | Covestro Deutschland AG | At least partially biobased layered structure with good flame resistance |
| CN115672362B (zh) * | 2022-11-01 | 2023-12-19 | 西南科技大学 | 用于光催化还原铀的氧化红磷的制备及应用 |
Family Cites Families (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DD82803A (cg-RX-API-DMAC10.html) * | ||||
| US2899410A (en) * | 1955-10-07 | 1959-08-11 | Manufacture of highly polymeric poly- | |
| DE1774044U (de) | 1958-06-07 | 1958-09-11 | Merkur Werk Emil Hermes | Mehrzweck-damenrasierapparat. |
| NL266948A (cg-RX-API-DMAC10.html) * | 1960-07-11 | |||
| DE1153897B (de) * | 1960-10-15 | 1963-09-05 | Hoechst Ag | Verwendung von Mischpolyestern aus Terephthalsaeure und Diolen zum Herstellen von Folien |
| US3407112A (en) * | 1963-04-09 | 1968-10-22 | Du Pont | Polyethylene terepthalate film and process of preparation thereof |
| GB1118538A (en) * | 1965-11-08 | 1968-07-03 | Goodyear Tire & Rubber | Electrostatic printing materials containing polyesters |
| GB1246448A (en) * | 1967-11-27 | 1971-09-15 | Ici Ltd | Production of aromatic copolyesters |
| DE1770044A1 (de) * | 1968-03-23 | 1971-09-23 | Hoechst Ag | Glasklare,thermoplastische Formmassen auf Polyesterbasis und Verfahren zu ihrer Herstellung |
| DE1769035A1 (de) * | 1968-03-23 | 1971-10-07 | Hoechst Ag | Thermoplastische Polyesterformmassen |
| DE1770823A1 (de) * | 1968-07-09 | 1972-10-19 | Hoechst Ag | Thermoplastische Formmassen aus Blockcopolyestern |
| US3498952A (en) * | 1968-10-03 | 1970-03-03 | Goodyear Tire & Rubber | Polyester resins from 2-methyl-2-phenyl-1,3-propanediol |
| FR2023326A1 (cg-RX-API-DMAC10.html) * | 1968-10-25 | 1970-08-21 | Huels Chemische Werke Ag | |
| DE2023527B2 (de) * | 1970-05-14 | 1973-07-12 | Farbwerke Hoechst AG, vormals Meister Lucius & Brüning, 6000 Frankfurt | Fasern und faeden aus mit 2,2dimethylpropandiol-1,3 modifiziertem polyaethylenterephthalat |
| US3669921A (en) * | 1971-02-08 | 1972-06-13 | Eastman Kodak Co | Copolyester melt adhesive |
| DE2109560A1 (de) * | 1971-03-01 | 1972-09-14 | Hoechst Ag | Glasklare, thermoplastische Formmassen |
| US3953394A (en) * | 1971-11-15 | 1976-04-27 | General Electric Company | Polyester alloys and molding compositions containing the same |
| GB1428751A (en) * | 1972-10-04 | 1976-03-17 | Gen Electric | Reinforced rapidly crystallizable copolyester resin compo sition |
| JPS588673A (ja) * | 1981-07-09 | 1983-01-18 | Brother Ind Ltd | サ−マルヘツド |
-
1975
- 1975-02-22 DE DE19752507674 patent/DE2507674A1/de active Granted
-
1976
- 1976-01-27 NL NL7600808.A patent/NL167179C/xx not_active IP Right Cessation
- 1976-02-17 US US05/658,816 patent/US4086212A/en not_active Expired - Lifetime
- 1976-02-20 CH CH210176A patent/CH602819A5/xx not_active IP Right Cessation
- 1976-02-20 FR FR7604786A patent/FR2301546A1/fr active Granted
- 1976-02-20 GB GB6793/76A patent/GB1505599A/en not_active Expired
- 1976-02-20 IT IT48200/76A patent/IT1053880B/it active
- 1976-02-20 CA CA246,192A patent/CA1076738A/en not_active Expired
- 1976-02-20 JP JP51017186A patent/JPS614842B2/ja not_active Expired
- 1976-02-20 DD DD191382A patent/DD126600A5/xx unknown
- 1976-02-20 CS CS761141A patent/CS194235B2/cs unknown
- 1976-02-20 BE BE164496A patent/BE838778A/xx not_active IP Right Cessation
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE102004014590A1 (de) * | 2004-03-23 | 2005-10-20 | Buehler Ag | Teilkristallines Polyethylenterephthalat |
| WO2023110961A1 (en) | 2021-12-17 | 2023-06-22 | Covestro Deutschland Ag | At least partially biobased layered structure with good favourable properties |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2301546A1 (fr) | 1976-09-17 |
| DD126600A5 (cg-RX-API-DMAC10.html) | 1977-08-03 |
| BE838778A (fr) | 1976-08-20 |
| CS194235B2 (en) | 1979-11-30 |
| DE2507674A1 (de) | 1976-09-09 |
| FR2301546B1 (cg-RX-API-DMAC10.html) | 1979-05-04 |
| NL167179C (nl) | 1981-11-16 |
| JPS614842B2 (cg-RX-API-DMAC10.html) | 1986-02-13 |
| NL167179B (nl) | 1981-06-16 |
| CA1076738A (en) | 1980-04-29 |
| CH602819A5 (cg-RX-API-DMAC10.html) | 1978-08-15 |
| IT1053880B (it) | 1981-10-10 |
| NL7600808A (nl) | 1976-08-24 |
| US4086212A (en) | 1978-04-25 |
| JPS51107396A (cg-RX-API-DMAC10.html) | 1976-09-22 |
| GB1505599A (en) | 1978-03-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2507674C2 (cg-RX-API-DMAC10.html) | ||
| DE2507776C2 (de) | Schnellkristallisierende Poly(äthylen/alkylen)-terephthalate | |
| DE2715932C2 (cg-RX-API-DMAC10.html) | ||
| US4223125A (en) | Polyester compositions which crystallize rapidly | |
| US4136089A (en) | Molded articles of crystalline poly (ethylene/alkylene) terephthalates which crystallize rapidly | |
| DE2431072A1 (de) | Thermoplastische copolyester und verfahren zu ihrer herstellung | |
| DE2626827C2 (de) | Stabilisierung von Polyethylenterephthalaten | |
| DE602004009882T2 (de) | Verfahren zur Herstellung von Polyesterharzen | |
| DE69214686T2 (de) | Verfahren zur Herstellung von Polyestern mit verbesserter thermooxydativer Stabilität | |
| US4435546A (en) | Polyesters compositions which crystallize rapidly | |
| DE2313903A1 (de) | Verzweigte thermoplastische copolyester | |
| DE2922486A1 (de) | Polyaetherester-blockcopolymer sowie verfahren zur herstellung desselben | |
| US4207230A (en) | Block copolyesters which crystallize rapidly | |
| DE10330774A1 (de) | Flammhemmend modifizierte, phosphorhaltige Copolyester, deren Verwendung und Verfahren zu ihrer Herstellung | |
| DE2706128C2 (de) | Schnell kristallisierende Polyestermassen und Verfahren zu ihrer Herstellung | |
| DE2340559A1 (de) | Herstellung von hochmolekularen polyestern des butandiols-(1,4) | |
| DE2545720A1 (de) | Schnellkristallisierende blockcopolyester | |
| EP0215364B1 (de) | Verfahren zur Herstellung schnellkristallisierender Polyestermassen | |
| US4163100A (en) | Rapidly crystallizing polyester compositions | |
| US4399244A (en) | Glass fiber reinforced polyethylene terephthalate compositions having improved heat distortion temperatures | |
| DE2706123C2 (cg-RX-API-DMAC10.html) | ||
| DE2653120C2 (de) | Schnellkristallisierende Polyestermassen, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2435507A1 (de) | Thermoplastische carbonatmodifizierte copolyester und verfahren zu ihrer herstellung | |
| EP0284726B1 (de) | Aromatische Polyester auf Basis von Phenoxyterephthalsäure, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2639428C2 (de) | Schnell kristallisierende Polyestermassen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8172 | Supplementary division/partition in: |
Ref country code: DE Ref document number: 2560492 Format of ref document f/p: P |
|
| Q171 | Divided out to: |
Ref country code: DE Ref document number: 2560492 |
|
| AH | Division in |
Ref country code: DE Ref document number: 2560492 Format of ref document f/p: P |
|
| AH | Division in |
Ref country code: DE Ref document number: 2560492 Format of ref document f/p: P |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |