DE2504625C2 - Imidgruppen enthaltende Prepolymere, Verfahren zu deren Herstellung und deren Weiterverarbeitung - Google Patents
Imidgruppen enthaltende Prepolymere, Verfahren zu deren Herstellung und deren WeiterverarbeitungInfo
- Publication number
- DE2504625C2 DE2504625C2 DE2504625A DE2504625A DE2504625C2 DE 2504625 C2 DE2504625 C2 DE 2504625C2 DE 2504625 A DE2504625 A DE 2504625A DE 2504625 A DE2504625 A DE 2504625A DE 2504625 C2 DE2504625 C2 DE 2504625C2
- Authority
- DE
- Germany
- Prior art keywords
- bis
- adduct
- maleimide
- radical
- groups
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 125000005462 imide group Chemical group 0.000 title claims description 3
- 238000000034 method Methods 0.000 title description 11
- 238000004519 manufacturing process Methods 0.000 title description 6
- 239000004593 Epoxy Substances 0.000 description 27
- 150000001875 compounds Chemical class 0.000 description 27
- 239000000203 mixture Substances 0.000 description 25
- 125000004432 carbon atom Chemical group C* 0.000 description 18
- -1 hydrocarbon radical Chemical class 0.000 description 17
- 229920000768 polyamine Polymers 0.000 description 15
- 229920000642 polymer Polymers 0.000 description 14
- XQUPVDVFXZDTLT-UHFFFAOYSA-N 1-[4-[[4-(2,5-dioxopyrrol-1-yl)phenyl]methyl]phenyl]pyrrole-2,5-dione Chemical compound O=C1C=CC(=O)N1C(C=C1)=CC=C1CC1=CC=C(N2C(C=CC2=O)=O)C=C1 XQUPVDVFXZDTLT-UHFFFAOYSA-N 0.000 description 12
- 150000004985 diamines Chemical class 0.000 description 11
- YBRVSVVVWCFQMG-UHFFFAOYSA-N 4,4'-diaminodiphenylmethane Chemical compound C1=CC(N)=CC=C1CC1=CC=C(N)C=C1 YBRVSVVVWCFQMG-UHFFFAOYSA-N 0.000 description 9
- 150000001412 amines Chemical class 0.000 description 9
- 150000003254 radicals Chemical class 0.000 description 9
- 238000010438 heat treatment Methods 0.000 description 8
- 239000000945 filler Substances 0.000 description 7
- 239000000376 reactant Substances 0.000 description 7
- 229920005989 resin Polymers 0.000 description 6
- 239000011347 resin Substances 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 239000004215 Carbon black (E152) Substances 0.000 description 5
- 229930195733 hydrocarbon Natural products 0.000 description 5
- 125000003118 aryl group Chemical group 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 125000003700 epoxy group Chemical group 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 229920000647 polyepoxide Polymers 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000004305 biphenyl Substances 0.000 description 3
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 3
- GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical class C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 description 3
- 239000003822 epoxy resin Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 2
- DOLQYFPDPKPQSS-UHFFFAOYSA-N 3,4-dimethylaniline Chemical compound CC1=CC=C(N)C=C1C DOLQYFPDPKPQSS-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- GYDMQACSUHVFFL-TZKOHIRVSA-N NC(=O)\C=C/C(O)=O.NC(=O)\C=C/C(O)=O Chemical class NC(=O)\C=C/C(O)=O.NC(=O)\C=C/C(O)=O GYDMQACSUHVFFL-TZKOHIRVSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical group C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 2
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 230000006735 deficit Effects 0.000 description 2
- 230000018044 dehydration Effects 0.000 description 2
- 238000006297 dehydration reaction Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 229920003986 novolac Polymers 0.000 description 2
- 125000000962 organic group Chemical group 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 229920003192 poly(bis maleimide) Polymers 0.000 description 2
- 238000011417 postcuring Methods 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000012209 synthetic fiber Substances 0.000 description 2
- 229920002994 synthetic fiber Polymers 0.000 description 2
- NPSMSOMZCHVSSW-UHFFFAOYSA-N (4-aminophenyl)-(2,4-diaminophenyl)methanone Chemical compound C1=CC(N)=CC=C1C(=O)C1=CC=C(N)C=C1N NPSMSOMZCHVSSW-UHFFFAOYSA-N 0.000 description 1
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical group C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 1
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 1
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 1
- FERLGYOHRKHQJP-UHFFFAOYSA-N 1-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]pyrrole-2,5-dione Chemical compound O=C1C=CC(=O)N1CCOCCOCCN1C(=O)C=CC1=O FERLGYOHRKHQJP-UHFFFAOYSA-N 0.000 description 1
- GRKKVHFJGMDVGW-UHFFFAOYSA-N 1-[3-[3-[3-(2,5-dioxopyrrol-1-yl)propoxy]propoxy]propyl]pyrrole-2,5-dione Chemical compound O=C1C=CC(=O)N1CCCOCCCOCCCN1C(=O)C=CC1=O GRKKVHFJGMDVGW-UHFFFAOYSA-N 0.000 description 1
- AQGZJQNZNONGKY-UHFFFAOYSA-N 1-[4-(2,5-dioxopyrrol-1-yl)phenyl]pyrrole-2,5-dione Chemical compound O=C1C=CC(=O)N1C1=CC=C(N2C(C=CC2=O)=O)C=C1 AQGZJQNZNONGKY-UHFFFAOYSA-N 0.000 description 1
- XQCDLHVXAXBMGW-UHFFFAOYSA-N 1-[6-(2,5-dioxopyrrol-1-yl)-3,5,5-trimethylhexyl]pyrrole-2,5-dione Chemical compound O=C1C=CC(=O)N1CC(C)(C)CC(C)CCN1C(=O)C=CC1=O XQCDLHVXAXBMGW-UHFFFAOYSA-N 0.000 description 1
- PYVHLZLQVWXBDZ-UHFFFAOYSA-N 1-[6-(2,5-dioxopyrrol-1-yl)hexyl]pyrrole-2,5-dione Chemical compound O=C1C=CC(=O)N1CCCCCCN1C(=O)C=CC1=O PYVHLZLQVWXBDZ-UHFFFAOYSA-N 0.000 description 1
- RIJSFLCTBDHBBS-UHFFFAOYSA-N 1-[6-(2,5-dioxopyrrol-1-yl)pyridin-2-yl]pyrrole-2,5-dione Chemical compound O=C1C=CC(=O)N1C1=CC=CC(N2C(C=CC2=O)=O)=N1 RIJSFLCTBDHBBS-UHFFFAOYSA-N 0.000 description 1
- LYCKDYZIIOVFCX-UHFFFAOYSA-N 1-[[3-[(2,5-dioxopyrrol-1-yl)methyl]phenyl]methyl]pyrrole-2,5-dione Chemical compound O=C1C=CC(=O)N1CC1=CC=CC(CN2C(C=CC2=O)=O)=C1 LYCKDYZIIOVFCX-UHFFFAOYSA-N 0.000 description 1
- BMVXCPBXGZKUPN-UHFFFAOYSA-N 1-hexanamine Chemical compound CCCCCCN BMVXCPBXGZKUPN-UHFFFAOYSA-N 0.000 description 1
- MQCPOLNSJCWPGT-UHFFFAOYSA-N 2,2'-Bisphenol F Chemical compound OC1=CC=CC=C1CC1=CC=CC=C1O MQCPOLNSJCWPGT-UHFFFAOYSA-N 0.000 description 1
- YYDRNPOEMZZTPM-UHFFFAOYSA-N 2,4,6-triaminotoluene Chemical compound CC1=C(N)C=C(N)C=C1N YYDRNPOEMZZTPM-UHFFFAOYSA-N 0.000 description 1
- SBLBKLRRAALOAA-UHFFFAOYSA-N 2,4,6-trimethylbenzene-1,3,5-triamine Chemical compound CC1=C(N)C(C)=C(N)C(C)=C1N SBLBKLRRAALOAA-UHFFFAOYSA-N 0.000 description 1
- YAFNTHIQVDHMBP-UHFFFAOYSA-N 3-propan-2-ylcyclopentan-1-amine Chemical compound CC(C)C1CCC(N)C1 YAFNTHIQVDHMBP-UHFFFAOYSA-N 0.000 description 1
- ICNFHJVPAJKPHW-UHFFFAOYSA-N 4,4'-Thiodianiline Chemical compound C1=CC(N)=CC=C1SC1=CC=C(N)C=C1 ICNFHJVPAJKPHW-UHFFFAOYSA-N 0.000 description 1
- VIDPINWAGZKWJR-UHFFFAOYSA-N 4-(4,4-diaminocyclohexa-1,5-dien-1-yl)oxycyclohexa-2,4-diene-1,1-diamine Chemical compound C1=CC(N)(N)CC=C1OC1=CCC(N)(N)C=C1 VIDPINWAGZKWJR-UHFFFAOYSA-N 0.000 description 1
- XECVXFWNYNXCBN-UHFFFAOYSA-N 4-[(4-aminophenyl)-phenylmethyl]aniline Chemical compound C1=CC(N)=CC=C1C(C=1C=CC(N)=CC=1)C1=CC=CC=C1 XECVXFWNYNXCBN-UHFFFAOYSA-N 0.000 description 1
- ZYEDGEXYGKWJPB-UHFFFAOYSA-N 4-[2-(4-aminophenyl)propan-2-yl]aniline Chemical compound C=1C=C(N)C=CC=1C(C)(C)C1=CC=C(N)C=C1 ZYEDGEXYGKWJPB-UHFFFAOYSA-N 0.000 description 1
- ADUMIBSPEHFSLA-UHFFFAOYSA-N 4-[bis(4-aminophenyl)methyl]aniline Chemical compound C1=CC(N)=CC=C1C(C=1C=CC(N)=CC=1)C1=CC=C(N)C=C1 ADUMIBSPEHFSLA-UHFFFAOYSA-N 0.000 description 1
- NUKYPUAOHBNCPY-UHFFFAOYSA-N 4-aminopyridine Chemical compound NC1=CC=NC=C1 NUKYPUAOHBNCPY-UHFFFAOYSA-N 0.000 description 1
- SNLFYGIUTYKKOE-UHFFFAOYSA-N 4-n,4-n-bis(4-aminophenyl)benzene-1,4-diamine Chemical compound C1=CC(N)=CC=C1N(C=1C=CC(N)=CC=1)C1=CC=C(N)C=C1 SNLFYGIUTYKKOE-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229920000049 Carbon (fiber) Polymers 0.000 description 1
- HTJDQJBWANPRPF-UHFFFAOYSA-N Cyclopropylamine Chemical compound NC1CC1 HTJDQJBWANPRPF-UHFFFAOYSA-N 0.000 description 1
- MQJKPEGWNLWLTK-UHFFFAOYSA-N Dapsone Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=C1 MQJKPEGWNLWLTK-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- JPYHHZQJCSQRJY-UHFFFAOYSA-N Phloroglucinol Natural products CCC=CCC=CCC=CCC=CCCCCC(=O)C1=C(O)C=C(O)C=C1O JPYHHZQJCSQRJY-UHFFFAOYSA-N 0.000 description 1
- 239000004962 Polyamide-imide Substances 0.000 description 1
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 1
- FDLQZKYLHJJBHD-UHFFFAOYSA-N [3-(aminomethyl)phenyl]methanamine Chemical compound NCC1=CC=CC(CN)=C1 FDLQZKYLHJJBHD-UHFFFAOYSA-N 0.000 description 1
- ISKQADXMHQSTHK-UHFFFAOYSA-N [4-(aminomethyl)phenyl]methanamine Chemical compound NCC1=CC=C(CN)C=C1 ISKQADXMHQSTHK-UHFFFAOYSA-N 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 239000004760 aramid Substances 0.000 description 1
- 229920003235 aromatic polyamide Polymers 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- RPHKINMPYFJSCF-UHFFFAOYSA-N benzene-1,3,5-triamine Chemical compound NC1=CC(N)=CC(N)=C1 RPHKINMPYFJSCF-UHFFFAOYSA-N 0.000 description 1
- HFACYLZERDEVSX-UHFFFAOYSA-N benzidine Chemical compound C1=CC(N)=CC=C1C1=CC=C(N)C=C1 HFACYLZERDEVSX-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- VCCBEIPGXKNHFW-UHFFFAOYSA-N biphenyl-4,4'-diol Chemical group C1=CC(O)=CC=C1C1=CC=C(O)C=C1 VCCBEIPGXKNHFW-UHFFFAOYSA-N 0.000 description 1
- DMVOXQPQNTYEKQ-UHFFFAOYSA-N biphenyl-4-amine Chemical group C1=CC(N)=CC=C1C1=CC=CC=C1 DMVOXQPQNTYEKQ-UHFFFAOYSA-N 0.000 description 1
- 125000002529 biphenylenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3C12)* 0.000 description 1
- ZLSMCQSGRWNEGX-UHFFFAOYSA-N bis(4-aminophenyl)methanone Chemical compound C1=CC(N)=CC=C1C(=O)C1=CC=C(N)C=C1 ZLSMCQSGRWNEGX-UHFFFAOYSA-N 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- CDQSJQSWAWPGKG-UHFFFAOYSA-N butane-1,1-diol Chemical compound CCCC(O)O CDQSJQSWAWPGKG-UHFFFAOYSA-N 0.000 description 1
- 239000004917 carbon fiber Substances 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000010431 corundum Substances 0.000 description 1
- 229910052593 corundum Inorganic materials 0.000 description 1
- KZZKOVLJUKWSKX-UHFFFAOYSA-N cyclobutanamine Chemical compound NC1CCC1 KZZKOVLJUKWSKX-UHFFFAOYSA-N 0.000 description 1
- GEQHKFFSPGPGLN-UHFFFAOYSA-N cyclohexane-1,3-diamine Chemical compound NC1CCCC(N)C1 GEQHKFFSPGPGLN-UHFFFAOYSA-N 0.000 description 1
- VKIRRGRTJUUZHS-UHFFFAOYSA-N cyclohexane-1,4-diamine Chemical compound NC1CCC(N)CC1 VKIRRGRTJUUZHS-UHFFFAOYSA-N 0.000 description 1
- 125000004956 cyclohexylene group Chemical group 0.000 description 1
- 238000007872 degassing Methods 0.000 description 1
- 229910003460 diamond Inorganic materials 0.000 description 1
- 239000010432 diamond Substances 0.000 description 1
- 150000001990 dicarboxylic acid derivatives Chemical class 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000006735 epoxidation reaction Methods 0.000 description 1
- 229960004979 fampridine Drugs 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000012765 fibrous filler Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 229920002313 fluoropolymer Polymers 0.000 description 1
- UTVVREMVDJTZAC-UHFFFAOYSA-N furan-2-amine Chemical compound NC1=CC=CO1 UTVVREMVDJTZAC-UHFFFAOYSA-N 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- CWQXQMHSOZUFJS-UHFFFAOYSA-N molybdenum disulfide Chemical compound S=[Mo]=S CWQXQMHSOZUFJS-UHFFFAOYSA-N 0.000 description 1
- 229910052982 molybdenum disulfide Inorganic materials 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- ZMVMYBGDGJLCHV-UHFFFAOYSA-N n-methyl-4-[[4-(methylamino)phenyl]methyl]aniline Chemical compound C1=CC(NC)=CC=C1CC1=CC=C(NC)C=C1 ZMVMYBGDGJLCHV-UHFFFAOYSA-N 0.000 description 1
- JOJOPWYLFLOFAE-UHFFFAOYSA-N naphthalene-1,3,7-triamine Chemical compound C1=C(N)C=C(N)C2=CC(N)=CC=C21 JOJOPWYLFLOFAE-UHFFFAOYSA-N 0.000 description 1
- KQSABULTKYLFEV-UHFFFAOYSA-N naphthalene-1,5-diamine Chemical compound C1=CC=C2C(N)=CC=CC2=C1N KQSABULTKYLFEV-UHFFFAOYSA-N 0.000 description 1
- 125000004957 naphthylene group Chemical group 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 235000011837 pasties Nutrition 0.000 description 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- QCDYQQDYXPDABM-UHFFFAOYSA-N phloroglucinol Chemical compound OC1=CC(O)=CC(O)=C1 QCDYQQDYXPDABM-UHFFFAOYSA-N 0.000 description 1
- 229960001553 phloroglucinol Drugs 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229920002312 polyamide-imide Polymers 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Chemical group COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- MWVKGSABHBJPOX-UHFFFAOYSA-N pyridine-2,4,6-triamine Chemical compound NC1=CC(N)=NC(N)=C1 MWVKGSABHBJPOX-UHFFFAOYSA-N 0.000 description 1
- VHNQIURBCCNWDN-UHFFFAOYSA-N pyridine-2,6-diamine Chemical compound NC1=CC=CC(N)=N1 VHNQIURBCCNWDN-UHFFFAOYSA-N 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 1
- GLQWRXYOTXRDNH-UHFFFAOYSA-N thiophen-2-amine Chemical compound NC1=CC=CS1 GLQWRXYOTXRDNH-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G73/00—Macromolecular compounds obtained by reactions forming a linkage containing nitrogen with or without oxygen or carbon in the main chain of the macromolecule, not provided for in groups C08G12/00 - C08G71/00
- C08G73/06—Polycondensates having nitrogen-containing heterocyclic rings in the main chain of the macromolecule
- C08G73/10—Polyimides; Polyester-imides; Polyamide-imides; Polyamide acids or similar polyimide precursors
- C08G73/12—Unsaturated polyimide precursors
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Macromolecular Compounds Obtained By Forming Nitrogen-Containing Linkages In General (AREA)
- Epoxy Resins (AREA)
- Polymers With Sulfur, Phosphorus Or Metals In The Main Chain (AREA)
- Reinforced Plastic Materials (AREA)
- Casting Or Compression Moulding Of Plastics Or The Like (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7403614A FR2259860B1 (OSRAM) | 1974-02-04 | 1974-02-04 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2504625A1 DE2504625A1 (de) | 1975-08-14 |
| DE2504625C2 true DE2504625C2 (de) | 1990-06-21 |
Family
ID=9134427
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2504625A Expired DE2504625C2 (de) | 1974-02-04 | 1975-02-04 | Imidgruppen enthaltende Prepolymere, Verfahren zu deren Herstellung und deren Weiterverarbeitung |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3978152A (OSRAM) |
| JP (1) | JPS5646489B2 (OSRAM) |
| BE (1) | BE825125A (OSRAM) |
| CA (1) | CA1050695A (OSRAM) |
| CH (1) | CH602831A5 (OSRAM) |
| DE (1) | DE2504625C2 (OSRAM) |
| DK (1) | DK145184C (OSRAM) |
| ES (1) | ES434430A1 (OSRAM) |
| FR (1) | FR2259860B1 (OSRAM) |
| GB (1) | GB1470142A (OSRAM) |
| IT (1) | IT1031453B (OSRAM) |
| LU (1) | LU71781A1 (OSRAM) |
| NL (1) | NL177603C (OSRAM) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4110364A (en) * | 1974-03-19 | 1978-08-29 | Mitsubishi Gas Chemical Company, Inc. | Curable resin compositions of cyanate esters |
| US4037018A (en) * | 1975-05-02 | 1977-07-19 | Scm Corporation | Cationic aqueous compositions of polymer having amine groups, acid neutralized, and abis-maleimide cross-linker, coatings and process |
| CH621811A5 (OSRAM) * | 1976-06-17 | 1981-02-27 | Ciba Geigy Ag | |
| CH621810A5 (OSRAM) * | 1976-06-17 | 1981-02-27 | Ciba Geigy Ag | |
| US4288359A (en) * | 1977-11-04 | 1981-09-08 | E. I. Du Pont De Nemours And Company | Epoxy imide compositions |
| US4212959A (en) * | 1978-05-09 | 1980-07-15 | Mitsubishi Denki Kabushiki Kaisha | Heat resistant resin composition |
| US4283521A (en) * | 1979-02-14 | 1981-08-11 | Trw Inc. | Curable aromatic epoxy-polyimide and cycloaliphatic epoxy-polyimide compositions |
| US4237262A (en) * | 1979-02-14 | 1980-12-02 | Trw Inc. | Curable aliphatic epoxy-polimide compositions |
| US4273916A (en) * | 1979-02-14 | 1981-06-16 | Trw Inc. | Curable cycloaliphatic epoxy-polyimide compositions |
| US4294743A (en) * | 1979-04-05 | 1981-10-13 | E. I. Du Pont De Nemours And Company | Epoxy imide |
| US4294877A (en) * | 1979-04-05 | 1981-10-13 | E. I. Du Pont De Nemours And Company | Epoxy imide compositions |
| JPS5628215A (en) * | 1979-08-17 | 1981-03-19 | Hitachi Chem Co Ltd | Preparation of imide prepolymer |
| JPS57145397A (en) * | 1981-03-04 | 1982-09-08 | Hitachi Ltd | Method of producing multilayer printed circuit board |
| FR2503173A1 (fr) * | 1981-04-01 | 1982-10-08 | Du Pont | Compositions epoxy-imide, leur preparation et produits obtenus a partir de ces compositions |
| JPS5953286A (ja) * | 1982-09-20 | 1984-03-27 | ヤマハ発動機株式会社 | 自動二輪車のフロント懸架装置 |
| US4582880A (en) * | 1983-12-27 | 1986-04-15 | Ford Motor Company | Crosslinkable composition comprising aminoepoxy resins-1 |
| FR2609467B1 (fr) * | 1987-01-09 | 1989-06-09 | Rhone Poulenc Chimie | Compositions thermodurcissables a base de groupements imide et epoxy |
| US5221723A (en) * | 1987-06-23 | 1993-06-22 | Ciba-Geigy Corporation | Thermally stable bisimido copolymerizates |
| CA1307605C (fr) * | 1987-06-23 | 1992-09-15 | Rene Arpin | Polymeres a groupements imides sans diamine et leur procede de preparation |
| CA2024189A1 (en) * | 1989-10-23 | 1991-04-24 | Kam W. Ho | Bismaleimide resin compositions |
| US6337384B1 (en) * | 2000-01-18 | 2002-01-08 | Sandia Corporation | Method of making thermally removable epoxies |
| US6825315B2 (en) * | 2001-12-21 | 2004-11-30 | Sandia Corporation | Method of making thermally removable adhesives |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2909448A (en) * | 1955-03-07 | 1959-10-20 | Shell Dev | Salts of polyamine polyepoxide adducts and their use as curing agents for polyepoxides |
| FR1555564A (fr) * | 1967-07-13 | 1969-01-31 | Rhone Poulenc Sa | Nouvelles résines thermostables dérivées de bis-imides d'acides dicarboxyliques non saturés |
| FR2045087A5 (OSRAM) * | 1969-05-30 | 1971-02-26 | Rhone Poulenc Sa | |
| FR2142742B1 (OSRAM) * | 1971-06-24 | 1974-04-26 | Rhone Poulenc Sa | |
| BE790207A (fr) * | 1971-10-18 | 1973-04-17 | Rhone Poulenc Sa | Polyamines a groupements imide |
| BE790595A (fr) * | 1971-11-19 | 1973-02-15 | Gen Electric | Compositions polymeres preparees a partir de melanges d'epoxydes et d'imides |
| JPS491960A (OSRAM) * | 1972-04-21 | 1974-01-09 | ||
| FR2204655B1 (OSRAM) * | 1972-10-31 | 1976-01-30 | Rhone Poulenc Ind Fr | |
| JPS5216512B2 (OSRAM) * | 1973-06-16 | 1977-05-10 |
-
1974
- 1974-02-04 FR FR7403614A patent/FR2259860B1/fr not_active Expired
-
1975
- 1975-01-27 NL NLAANVRAGE7500930,A patent/NL177603C/xx not_active IP Right Cessation
- 1975-01-31 JP JP1326875A patent/JPS5646489B2/ja not_active Expired
- 1975-01-31 CA CA219,121A patent/CA1050695A/fr not_active Expired
- 1975-01-31 US US05/545,968 patent/US3978152A/en not_active Expired - Lifetime
- 1975-02-03 LU LU71781A patent/LU71781A1/xx unknown
- 1975-02-03 DK DK36175A patent/DK145184C/da active
- 1975-02-03 BE BE153008A patent/BE825125A/xx not_active IP Right Cessation
- 1975-02-03 CH CH124475A patent/CH602831A5/xx not_active IP Right Cessation
- 1975-02-03 GB GB458475A patent/GB1470142A/en not_active Expired
- 1975-02-04 DE DE2504625A patent/DE2504625C2/de not_active Expired
- 1975-02-04 IT IT19939/75A patent/IT1031453B/it active
- 1975-02-04 ES ES434430A patent/ES434430A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CH602831A5 (OSRAM) | 1978-08-15 |
| JPS50109996A (OSRAM) | 1975-08-29 |
| DK36175A (OSRAM) | 1975-09-29 |
| NL177603C (nl) | 1985-10-16 |
| BE825125A (fr) | 1975-08-04 |
| ES434430A1 (es) | 1976-11-16 |
| LU71781A1 (OSRAM) | 1975-12-09 |
| NL7500930A (nl) | 1975-08-06 |
| NL177603B (nl) | 1985-05-17 |
| JPS5646489B2 (OSRAM) | 1981-11-04 |
| CA1050695A (fr) | 1979-03-13 |
| DK145184C (da) | 1983-02-21 |
| DE2504625A1 (de) | 1975-08-14 |
| GB1470142A (en) | 1977-04-14 |
| DK145184B (da) | 1982-09-27 |
| FR2259860B1 (OSRAM) | 1976-12-03 |
| IT1031453B (it) | 1979-04-30 |
| US3978152A (en) | 1976-08-31 |
| FR2259860A1 (OSRAM) | 1975-08-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2504625C2 (de) | Imidgruppen enthaltende Prepolymere, Verfahren zu deren Herstellung und deren Weiterverarbeitung | |
| DE3886454T2 (de) | Härtbare Harzzusammensetzung. | |
| DE68904396T2 (de) | Alpha, alpha', alpha''-tris(4-cyanatophenyl)-1,3,5-tri-isopropylbenzole und harze davon. | |
| DE1720663C3 (de) | Verfahren zur Herstellung von Kunststoffen | |
| DE60116777T2 (de) | Zur kettenverknüpfung geeignete zusammensetzungen | |
| DE3852839T2 (de) | Hitzehärtbare Harzzusammensetzung. | |
| EP0161576B1 (en) | Epoxy resin composition | |
| DE2354654C3 (de) | Wärmehärtbare Mischungen | |
| DE69934969T2 (de) | Verfahren zur herstellung von polyarylethersulphonen | |
| DE69130769T2 (de) | Epoxydharze auf basis von diaminobisimidverbindungen | |
| DE69621635T2 (de) | Aushärtendes Bismaleinimid Polymer für Kleb- und Verbundwerkstoffe | |
| DE1420797B2 (de) | Verfahren zur ueberfuehrung von polyglycidylpolyaethern mehrwertiger phenole in hochmolekulare vernetzte produkte | |
| DE19756554A1 (de) | Siloxan-Polyimid und ein Siloxan-Polyimid-haltiges, wärmebeständiges Haftmittel | |
| DE69323129T2 (de) | Mit Sulfonpolymeren zäher gemachte hitzehärtbare Harze | |
| DE2230887C3 (de) | Verfahren zur Herstellung von härtbaren Vorpolymeren aus Maleinsäureimiden und Polyaminen | |
| DE2438327A1 (de) | Polyaetherchinoxaline und verfahren zu deren herstellung | |
| EP2825580B1 (de) | Neue reaktive polymerkatalysatoren für 2k epoxidharzsysteme | |
| DE68914150T2 (de) | Polyimid-harz. | |
| DE60032624T2 (de) | Bei variablen temperaturen härtbare zusammensetzung | |
| DE3220726C2 (de) | Härtbare Harzzusammensetzung | |
| DE69030375T2 (de) | Mit polyimid-thermoplastischem harz gehärtete epoxydmatrize | |
| DE3882123T2 (de) | Epoxyharze, die einen aromatischen diaminhaerter enthalten. | |
| DE69914779T2 (de) | Epoxy-härtungsmittel aus phenol-aldehyd das mit polyamin reagiert hat | |
| DE2743657A1 (de) | Hitzehaertbare harzmasse | |
| DE69132923T2 (de) | Härtbare Verbindung und Verfahren zu ihrer Herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8128 | New person/name/address of the agent |
Representative=s name: ZUMSTEIN SEN., F., DR. ASSMANN, E., DIPL.-CHEM. DR |
|
| D2 | Grant after examination | ||
| 8380 | Miscellaneous part iii |
Free format text: SEITE 2, ZEILE 40:"EXPOXIDVERBINDUNG" AENDERN IN "EPOXIDVERBINDUNG" |
|
| 8363 | Opposition against the patent | ||
| 8366 | Restricted maintained after opposition proceedings | ||
| 8305 | Restricted maintenance of patent after opposition | ||
| D4 | Patent maintained restricted | ||
| 8380 | Miscellaneous part iii |
Free format text: SEITE 8, ZEILE 22, NACH DEM WORT "ADDUKT" EIN "(A)" EINSETZEN |