DE2502016A1 - Zusammensetzung zum stabilisieren von kunststoffen - Google Patents
Zusammensetzung zum stabilisieren von kunststoffenInfo
- Publication number
- DE2502016A1 DE2502016A1 DE19752502016 DE2502016A DE2502016A1 DE 2502016 A1 DE2502016 A1 DE 2502016A1 DE 19752502016 DE19752502016 DE 19752502016 DE 2502016 A DE2502016 A DE 2502016A DE 2502016 A1 DE2502016 A1 DE 2502016A1
- Authority
- DE
- Germany
- Prior art keywords
- carbon atoms
- formula
- compound
- alkyl
- radical
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000004033 plastic Substances 0.000 title claims abstract description 8
- 229920003023 plastic Polymers 0.000 title claims abstract description 8
- 229920000098 polyolefin Polymers 0.000 title claims abstract description 7
- 239000003381 stabilizer Substances 0.000 title abstract description 5
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 title 2
- 150000001408 amides Chemical class 0.000 title 1
- 229910052759 nickel Inorganic materials 0.000 title 1
- 150000002989 phenols Chemical class 0.000 title 1
- -1 polyethylene Polymers 0.000 claims abstract description 75
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 18
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 17
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims abstract description 9
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims abstract description 7
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 5
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 4
- 125000003118 aryl group Chemical group 0.000 claims abstract description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims abstract description 3
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 3
- 150000002367 halogens Chemical class 0.000 claims abstract description 3
- 150000001875 compounds Chemical class 0.000 claims description 79
- 125000004432 carbon atom Chemical group C* 0.000 claims description 49
- 239000000203 mixture Substances 0.000 claims description 28
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 14
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 9
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 8
- 230000000087 stabilizing effect Effects 0.000 claims description 6
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 150000003254 radicals Chemical class 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 230000015556 catabolic process Effects 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 238000006731 degradation reaction Methods 0.000 claims description 3
- 150000002431 hydrogen Chemical group 0.000 claims description 3
- YUDRVAHLXDBKSR-UHFFFAOYSA-N [CH]1CCCCC1 Chemical compound [CH]1CCCCC1 YUDRVAHLXDBKSR-UHFFFAOYSA-N 0.000 claims description 2
- GDNCXORZAMVMIW-UHFFFAOYSA-N dodecane Chemical compound [CH2]CCCCCCCCCCC GDNCXORZAMVMIW-UHFFFAOYSA-N 0.000 claims description 2
- 230000001419 dependent effect Effects 0.000 claims 2
- 230000006641 stabilisation Effects 0.000 claims 1
- 238000011105 stabilization Methods 0.000 claims 1
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 abstract description 8
- 239000004743 Polypropylene Substances 0.000 abstract description 7
- 229920001155 polypropylene Polymers 0.000 abstract description 7
- 239000004952 Polyamide Substances 0.000 abstract description 2
- 239000004698 Polyethylene Substances 0.000 abstract description 2
- 229920000122 acrylonitrile butadiene styrene Polymers 0.000 abstract description 2
- 229920002239 polyacrylonitrile Polymers 0.000 abstract description 2
- 229920002647 polyamide Polymers 0.000 abstract description 2
- 229920000728 polyester Polymers 0.000 abstract description 2
- 229920000573 polyethylene Polymers 0.000 abstract description 2
- 229920000642 polymer Polymers 0.000 abstract description 2
- 229920002635 polyurethane Polymers 0.000 abstract description 2
- 239000004814 polyurethane Substances 0.000 abstract description 2
- 230000002195 synergetic effect Effects 0.000 abstract description 2
- 125000002947 alkylene group Chemical group 0.000 abstract 1
- 125000000753 cycloalkyl group Chemical group 0.000 abstract 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 abstract 1
- 229920000058 polyacrylate Polymers 0.000 abstract 1
- 239000000843 powder Substances 0.000 description 7
- 238000002360 preparation method Methods 0.000 description 7
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 239000000654 additive Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 230000003078 antioxidant effect Effects 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 239000011888 foil Substances 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 229920001897 terpolymer Polymers 0.000 description 2
- 229910052724 xenon Inorganic materials 0.000 description 2
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 description 2
- 125000004398 2-methyl-2-butyl group Chemical group CC(C)(CC)* 0.000 description 1
- 125000004922 2-methyl-3-pentyl group Chemical group CC(C)C(CC)* 0.000 description 1
- 239000004594 Masterbatch (MB) Substances 0.000 description 1
- 238000002835 absorbance Methods 0.000 description 1
- 238000000862 absorption spectrum Methods 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 238000002074 melt spinning Methods 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- UCFFGYASXIPWPD-UHFFFAOYSA-N methyl hypochlorite Chemical group COCl UCFFGYASXIPWPD-UHFFFAOYSA-N 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- SSDSCDGVMJFTEQ-UHFFFAOYSA-N octadecyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate Chemical compound CCCCCCCCCCCCCCCCCCOC(=O)CCC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 SSDSCDGVMJFTEQ-UHFFFAOYSA-N 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000003223 protective agent Substances 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/0008—Organic ingredients according to more than one of the "one dot" groups of C08K5/01 - C08K5/59
- C08K5/005—Stabilisers against oxidation, heat, light, ozone
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH910474A CH596254A5 (OSRAM) | 1974-07-03 | 1974-07-03 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2502016A1 true DE2502016A1 (de) | 1976-01-22 |
Family
ID=4348359
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752502016 Pending DE2502016A1 (de) | 1974-07-03 | 1975-01-20 | Zusammensetzung zum stabilisieren von kunststoffen |
Country Status (2)
| Country | Link |
|---|---|
| CH (1) | CH596254A5 (OSRAM) |
| DE (1) | DE2502016A1 (OSRAM) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN119431148A (zh) * | 2024-11-04 | 2025-02-14 | 福州大学 | 一种耐迁移复合抗老化剂的制备方法及应用 |
-
1974
- 1974-07-03 CH CH910474A patent/CH596254A5/xx not_active IP Right Cessation
-
1975
- 1975-01-20 DE DE19752502016 patent/DE2502016A1/de active Pending
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN119431148A (zh) * | 2024-11-04 | 2025-02-14 | 福州大学 | 一种耐迁移复合抗老化剂的制备方法及应用 |
Also Published As
| Publication number | Publication date |
|---|---|
| CH596254A5 (OSRAM) | 1978-03-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3780712T2 (de) | Polyolefinzusammensetzungen zur anwendung in warmwassersystemen. | |
| DE1670951A1 (de) | Alkylen-bis-(benztriazolyl-phenole) | |
| DE69206081T2 (de) | Stabilisierte Polyolefinzusammensetzung. | |
| DE3885040T2 (de) | Stabilisierte antimikrobielle Mittel, thermoplastische Zusammensetzungen, welche sie enthalten und damit hergestellte Erzeugnisse. | |
| DE4405670A1 (de) | Stabilisatorgemisch aus Chromanderivaten, organischen Phosphiten oder Phosphoniten und Aminen | |
| DE2502015A1 (de) | Zusammensetzung zum stabilisieren von kunststoffen | |
| DE2502016A1 (de) | Zusammensetzung zum stabilisieren von kunststoffen | |
| DE1454804B2 (de) | Verfahren zum dispergieren von festen zusatzstoffen in synthetischen thermoplastischen stoffen | |
| DE2543858A1 (de) | Uv-licht stabilisiertes polymer | |
| DE2456735A1 (de) | Verbindungen zum stabilisieren von organischen materialien | |
| DE2316420A1 (de) | Nickel-cyclohexylamin-komplexe von 2,2' -thiobis(p-alkylphenolen) und ihre anwendung in polyolefinen | |
| DE962831C (de) | Verfahren zum Stabilisieren von vinylidenchloridhaltigen Mischpolymerisaten | |
| DE1569504C3 (de) | Verbesserung der Verwitterungsbeständigkeit von festen organischen Kunststoffen | |
| DE1469810B2 (de) | Thermoplastische massen | |
| DE1242361B (de) | Verfahren zum Stabilisieren von Polyolefinen gegen UV-Bestrahlung | |
| DE69623945T2 (de) | Polyketonpolymer-zusammensetzung | |
| DE68911207T2 (de) | Verfahren zum Stabilisieren von Polymeren, Stabilisatorzusammensetzung und stabilisiertes Polymermaterial. | |
| DE2109304A1 (de) | Verfahren zum Stabilisieren von polyolefinischem Material | |
| DE2232306A1 (de) | Mit antioxidantien und phospiten stabilisierte polymerisate | |
| DE1231893B (de) | Thermoplastische Massen zur Herstellung stabilisierter Formkoerper oder UEberzuege aus Polymerisaten von alpha-Monoolefinen | |
| DE2533097A1 (de) | Polybutylenterephthalat-formmassen mit verbesserter bestaendigkeit gegen waerme und sauerstoff | |
| DE2248833A1 (de) | Lichtabbaubare kunststoff-formmassen | |
| DE1153522B (de) | Verfahren zum Stabilisieren von kristallinem Polypropylen | |
| DE1720857A1 (de) | Gegen oxydativen Abbau stabilisierte Polyphenylenoxydmasse | |
| DE1161011B (de) | Verfahren zum Stabilisieren von kristallinen Polyolefinen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHJ | Non-payment of the annual fee |