DE2500062C2 - Faserreaktive Tetrazofarbstoffe und ihre Verwendung - Google Patents
Faserreaktive Tetrazofarbstoffe und ihre VerwendungInfo
- Publication number
- DE2500062C2 DE2500062C2 DE2500062A DE2500062A DE2500062C2 DE 2500062 C2 DE2500062 C2 DE 2500062C2 DE 2500062 A DE2500062 A DE 2500062A DE 2500062 A DE2500062 A DE 2500062A DE 2500062 C2 DE2500062 C2 DE 2500062C2
- Authority
- DE
- Germany
- Prior art keywords
- formula
- fiber
- reactive
- acid
- dye
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000975 dye Substances 0.000 title claims description 54
- 230000008878 coupling Effects 0.000 claims description 21
- 238000010168 coupling process Methods 0.000 claims description 21
- 238000005859 coupling reaction Methods 0.000 claims description 21
- 239000002253 acid Substances 0.000 claims description 17
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 14
- -1 cyano, carboxy Chemical group 0.000 claims description 13
- 238000000034 method Methods 0.000 claims description 11
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 claims description 9
- UGEHFOSBNBEWMP-UHFFFAOYSA-N 2,3-diaminobenzenesulfonic acid Chemical compound NC1=CC=CC(S(O)(=O)=O)=C1N UGEHFOSBNBEWMP-UHFFFAOYSA-N 0.000 claims description 9
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 claims description 9
- 125000001424 substituent group Chemical group 0.000 claims description 9
- 238000004043 dyeing Methods 0.000 claims description 8
- 230000008569 process Effects 0.000 claims description 8
- 230000010933 acylation Effects 0.000 claims description 7
- 238000005917 acylation reaction Methods 0.000 claims description 7
- 238000009833 condensation Methods 0.000 claims description 7
- 230000005494 condensation Effects 0.000 claims description 7
- 150000008049 diazo compounds Chemical class 0.000 claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- 238000007639 printing Methods 0.000 claims description 6
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims description 6
- ZAJAQTYSTDTMCU-UHFFFAOYSA-N 3-aminobenzenesulfonic acid Chemical compound NC1=CC=CC(S(O)(=O)=O)=C1 ZAJAQTYSTDTMCU-UHFFFAOYSA-N 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 4
- APRRQJCCBSJQOQ-UHFFFAOYSA-N 4-amino-5-hydroxynaphthalene-2,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC(O)=C2C(N)=CC(S(O)(=O)=O)=CC2=C1 APRRQJCCBSJQOQ-UHFFFAOYSA-N 0.000 claims description 3
- 238000006243 chemical reaction Methods 0.000 claims description 3
- 125000004442 acylamino group Chemical group 0.000 claims description 2
- 125000004423 acyloxy group Chemical group 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 2
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 2
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 2
- 125000005129 aryl carbonyl group Chemical group 0.000 claims description 2
- 125000004391 aryl sulfonyl group Chemical group 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 239000007858 starting material Substances 0.000 claims description 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 30
- 239000000243 solution Substances 0.000 description 21
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- 239000004744 fabric Substances 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- 239000003929 acidic solution Substances 0.000 description 6
- 239000011780 sodium chloride Substances 0.000 description 6
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 5
- 229920000742 Cotton Polymers 0.000 description 5
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 4
- HVBSAKJJOYLTQU-UHFFFAOYSA-N 4-aminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1 HVBSAKJJOYLTQU-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- 229920003043 Cellulose fiber Polymers 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 230000002378 acidificating effect Effects 0.000 description 4
- 239000012670 alkaline solution Substances 0.000 description 4
- 239000000460 chlorine Chemical group 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- VMKJWLXVLHBJNK-UHFFFAOYSA-N cyanuric fluoride Chemical compound FC1=NC(F)=NC(F)=N1 VMKJWLXVLHBJNK-UHFFFAOYSA-N 0.000 description 3
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 239000001488 sodium phosphate Substances 0.000 description 3
- 210000002268 wool Anatomy 0.000 description 3
- 125000003363 1,3,5-triazinyl group Chemical group N1=C(N=CN=C1)* 0.000 description 2
- VOZKAJLKRJDJLL-UHFFFAOYSA-N 2,4-diaminotoluene Chemical compound CC1=CC=C(N)C=C1N VOZKAJLKRJDJLL-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical class CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- ZMCHBSMFKQYNKA-UHFFFAOYSA-N 2-aminobenzenesulfonic acid Chemical compound NC1=CC=CC=C1S(O)(=O)=O ZMCHBSMFKQYNKA-UHFFFAOYSA-N 0.000 description 2
- UEUIKXVPXLWUDU-UHFFFAOYSA-N 4-diazoniobenzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=C([N+]#N)C=C1 UEUIKXVPXLWUDU-UHFFFAOYSA-N 0.000 description 2
- PHRVJZNHPVJYOM-UHFFFAOYSA-N 5-acetamido-2-aminobenzenesulfonic acid Chemical compound CC(=O)NC1=CC=C(N)C(S(O)(=O)=O)=C1 PHRVJZNHPVJYOM-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N N-phenyl amine Natural products NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 239000003599 detergent Substances 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- 238000005185 salting out Methods 0.000 description 2
- 239000000344 soap Substances 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 229950000244 sulfanilic acid Drugs 0.000 description 2
- 125000000542 sulfonic acid group Chemical group 0.000 description 2
- 230000008719 thickening Effects 0.000 description 2
- BFSPAPKTIGPYOV-BQYQJAHWSA-N (e)-1-[4-(4-hydroxyphenyl)piperazin-1-yl]-3-thiophen-2-ylprop-2-en-1-one Chemical compound C1=CC(O)=CC=C1N1CCN(C(=O)\C=C\C=2SC=CC=2)CC1 BFSPAPKTIGPYOV-BQYQJAHWSA-N 0.000 description 1
- ODIGIKRIUKFKHP-UHFFFAOYSA-N (n-propan-2-yloxycarbonylanilino) acetate Chemical compound CC(C)OC(=O)N(OC(C)=O)C1=CC=CC=C1 ODIGIKRIUKFKHP-UHFFFAOYSA-N 0.000 description 1
- FIDRAVVQGKNYQK-UHFFFAOYSA-N 1,2,3,4-tetrahydrotriazine Chemical compound C1NNNC=C1 FIDRAVVQGKNYQK-UHFFFAOYSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- CMDRPQBKAWIHTR-UHFFFAOYSA-N 1-n,2-n-bis(4,6-dichloro-1h-triazin-2-yl)benzene-1,2-diamine Chemical compound N1C(Cl)=CC(Cl)=NN1NC1=CC=CC=C1NN1N=C(Cl)C=C(Cl)N1 CMDRPQBKAWIHTR-UHFFFAOYSA-N 0.000 description 1
- VHYBUUMUUNCHCK-UHFFFAOYSA-N 2,4,6-tribromo-1,3,5-triazine Chemical compound BrC1=NC(Br)=NC(Br)=N1 VHYBUUMUUNCHCK-UHFFFAOYSA-N 0.000 description 1
- JVMSQRAXNZPDHF-UHFFFAOYSA-N 2,4-diaminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C(N)=C1 JVMSQRAXNZPDHF-UHFFFAOYSA-N 0.000 description 1
- QGNJPFLIBOTDKU-UHFFFAOYSA-N 2,5-diaminobenzene-1,3-disulfonic acid Chemical compound NC1=CC(S(O)(=O)=O)=C(N)C(S(O)(=O)=O)=C1 QGNJPFLIBOTDKU-UHFFFAOYSA-N 0.000 description 1
- AIRRELHUAAZTTL-UHFFFAOYSA-N 3-nitrobenzenesulfonic acid;sodium Chemical compound [Na].OS(=O)(=O)C1=CC=CC([N+]([O-])=O)=C1 AIRRELHUAAZTTL-UHFFFAOYSA-N 0.000 description 1
- YADSWTKOIHUSDX-UHFFFAOYSA-N 4,6-diaminobenzene-1,3-disulfonic acid Chemical compound NC1=CC(N)=C(S(O)(=O)=O)C=C1S(O)(=O)=O YADSWTKOIHUSDX-UHFFFAOYSA-N 0.000 description 1
- ZWUBBMDHSZDNTA-UHFFFAOYSA-N 4-Chloro-meta-phenylenediamine Chemical compound NC1=CC=C(Cl)C(N)=C1 ZWUBBMDHSZDNTA-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 125000006414 CCl Chemical group ClC* 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical group ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical class [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 229910000397 disodium phosphate Inorganic materials 0.000 description 1
- 235000019800 disodium phosphate Nutrition 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- 229910000403 monosodium phosphate Inorganic materials 0.000 description 1
- 235000019799 monosodium phosphate Nutrition 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- HVFSJXUIRWUHRG-UHFFFAOYSA-N oic acid Natural products C1CC2C3CC=C4CC(OC5C(C(O)C(O)C(CO)O5)O)CC(O)C4(C)C3CCC2(C)C1C(C)C(O)CC(C)=C(C)C(=O)OC1OC(COC(C)=O)C(O)C(O)C1OC(C(C1O)O)OC(COC(C)=O)C1OC1OC(CO)C(O)C(O)C1O HVFSJXUIRWUHRG-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 239000004627 regenerated cellulose Substances 0.000 description 1
- 238000010020 roller printing Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 1
- LJRGBERXYNQPJI-UHFFFAOYSA-M sodium;3-nitrobenzenesulfonate Chemical compound [Na+].[O-][N+](=O)C1=CC=CC(S([O-])(=O)=O)=C1 LJRGBERXYNQPJI-UHFFFAOYSA-M 0.000 description 1
- 238000001694 spray drying Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 229910000406 trisodium phosphate Inorganic materials 0.000 description 1
- 235000019801 trisodium phosphate Nutrition 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 230000004584 weight gain Effects 0.000 description 1
- 235000019786 weight gain Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/02—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring
- C09B62/04—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring to a triazine ring
- C09B62/043—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring to a triazine ring containing two or more triazine rings linked together by a non-chromophoric link
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH6174A CH589703A5 (en) | 1974-01-04 | 1974-01-04 | Fibre-reactive tetrazo dyes contg. halotriazine ring - for dyeing and printing cotton, and nitrogenous materials greenish-blue shades |
| CH1410374 | 1974-10-22 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2500062A1 DE2500062A1 (de) | 1975-07-10 |
| DE2500062C2 true DE2500062C2 (de) | 1986-02-20 |
Family
ID=25683396
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2500062A Expired DE2500062C2 (de) | 1974-01-04 | 1975-01-02 | Faserreaktive Tetrazofarbstoffe und ihre Verwendung |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3966705A (enExample) |
| JP (1) | JPS5850265B2 (enExample) |
| AR (1) | AR204733A1 (enExample) |
| BR (1) | BR7500010A (enExample) |
| CS (1) | CS187454B2 (enExample) |
| DE (1) | DE2500062C2 (enExample) |
| FR (1) | FR2256950B1 (enExample) |
| GB (1) | GB1488952A (enExample) |
| IT (1) | IT1026200B (enExample) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH626650A5 (enExample) * | 1974-12-18 | 1981-11-30 | Ciba Geigy Ag | |
| CH606347A5 (enExample) * | 1975-01-15 | 1978-10-31 | Ciba Geigy Ag | |
| CA1067895A (en) * | 1975-11-25 | 1979-12-11 | Ciba-Geigy Ag | Fibre-reactive dyes, process for their manufacture and use thereof |
| CH614969A5 (en) * | 1975-12-19 | 1979-12-28 | Ciba Geigy Ag | Process for preparing fibre-reactive azo dyes |
| JPS5857464B2 (ja) * | 1975-12-29 | 1983-12-20 | 日本化薬株式会社 | ハンノウセイアゾセンリヨウノセイホウ |
| FR2304651A1 (fr) * | 1976-03-18 | 1976-10-15 | Ciba Geigy Ag | Colorants reactifs vis-a-vis de la fibre, leur procede de preparation et leur utilisation |
| CH637679A5 (de) * | 1977-07-22 | 1983-08-15 | Bayer Ag | Faserreaktive disazofarbstoffe. |
| IT1116249B (it) * | 1978-06-19 | 1986-02-10 | Ciba Geigy Ag | Colopanti reattivi e procedimento per la loro produzione ed applicazione |
| US5298607A (en) * | 1978-07-06 | 1994-03-29 | Ciba-Geigy Corporation | Reactive dyes containing fluorotriazine and vinylsulfonyl radicals |
| JPS5599967A (en) * | 1979-01-26 | 1980-07-30 | Mitsubishi Chem Ind Ltd | Disazo dye for cellulose-containing fibers |
| CH643583A5 (de) * | 1979-08-16 | 1984-06-15 | Sandoz Ag | Reaktivfarbstoffe sowie deren herstellung. |
| CH656629A5 (de) * | 1981-08-08 | 1986-07-15 | Sandoz Ag | Tetrakisazoverbindungen mit brueckenglied, verfahren zur herstellung und verwendung. |
| FR2518106B1 (fr) * | 1981-12-11 | 1986-12-05 | Sandoz Sa | Procede de teinture et d'impression de substrats organiques a l'aide de colorants directs bisazoiques |
| DE3476218D1 (en) * | 1983-02-24 | 1989-02-23 | Ciba Geigy Ag | Reactive dyes, their preparation and their use |
| GB8619914D0 (en) * | 1986-08-15 | 1986-09-24 | Ici Plc | Reactive dyes |
| US5196033A (en) * | 1986-08-15 | 1993-03-23 | Imperial Chemical Industries Plc | BIS-azotriazinyl reactive dyes having an N-alkyl-phenylenediamine link for cellulose textiles |
| ES2092081T3 (es) * | 1991-12-20 | 1996-11-16 | Ciba Geigy Ag | Procedimiento para teñir o estampar materiales de fibra que contengan grupos hidroxilo. |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1228184A (fr) * | 1958-03-05 | 1960-08-26 | Ici Ltd | Nouvelles matières colorantes azoïques |
| GB961078A (en) * | 1961-05-23 | 1964-06-17 | Ciba Ltd | New disazo-dyestuffs and their manufacture and use |
| US3639662A (en) * | 1968-03-07 | 1972-02-01 | Ici Ltd | Azo dyes of the triazine series |
| GB1243263A (en) * | 1968-03-08 | 1971-08-18 | Ici Ltd | New water-soluble reactive dyestuffs containing chlorotriazine residues |
| GB1283771A (en) * | 1969-01-16 | 1972-08-02 | Ici Ltd | New reactive disazo dyestuffs |
| GB1272291A (en) * | 1969-01-16 | 1972-04-26 | Ici Ltd | New reactive metallised disazo dyestuffs |
| CH554402A (de) * | 1969-07-11 | 1974-09-30 | Ciba Geigy Ag | Verfahren zur herstellung von faserreaktiven farbstoffen. |
-
1974
- 1974-12-12 US US05/532,420 patent/US3966705A/en not_active Expired - Lifetime
- 1974-12-28 JP JP49149298A patent/JPS5850265B2/ja not_active Expired
- 1974-12-30 FR FR7443328A patent/FR2256950B1/fr not_active Expired
- 1974-12-30 IT IT54816/74A patent/IT1026200B/it active
-
1975
- 1975-01-02 BR BR10/75A patent/BR7500010A/pt unknown
- 1975-01-02 DE DE2500062A patent/DE2500062C2/de not_active Expired
- 1975-01-02 CS CS7537A patent/CS187454B2/cs unknown
- 1975-01-03 GB GB297/75A patent/GB1488952A/en not_active Expired
-
1976
- 1976-01-01 AR AR20473376D patent/AR204733A1/es active
Also Published As
| Publication number | Publication date |
|---|---|
| CS187454B2 (en) | 1979-01-31 |
| DE2500062A1 (de) | 1975-07-10 |
| FR2256950B1 (enExample) | 1977-07-01 |
| AU7683174A (en) | 1976-06-24 |
| US3966705A (en) | 1976-06-29 |
| GB1488952A (en) | 1977-10-19 |
| JPS5850265B2 (ja) | 1983-11-09 |
| BR7500010A (pt) | 1975-11-04 |
| IT1026200B (it) | 1978-09-20 |
| AR204733A1 (es) | 1976-02-27 |
| JPS5098930A (enExample) | 1975-08-06 |
| FR2256950A1 (enExample) | 1975-08-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2500062C2 (de) | Faserreaktive Tetrazofarbstoffe und ihre Verwendung | |
| CH628670A5 (de) | Verfahren zur herstellung von reaktivfarbstoffen. | |
| DE2945537A1 (de) | Kupferkomplex-formazanverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe | |
| DE2601043A1 (de) | Tetrareaktive disazofarbstoffe, deren herstellung und verwendung | |
| EP0041922B1 (de) | Verfahren zur Herstellung von aminosubstituierten 1-Amino-8-hydroxynaphthalin-sulfonsäuren | |
| CH467838A (de) | Verfahren zur Herstellung metallfreier Azofarbstoffe | |
| DE2600164A1 (de) | Faserreaktive disazofarbstoffe, deren herstellung und verwendung | |
| DE2731258A1 (de) | Faserreaktive azofarbstoffe, deren herstellung und verwendung | |
| EP0170612B1 (de) | Reaktivfarbstoffe, deren Herstellung und Verwendung | |
| DE3217388A1 (de) | Wasserloesliche disazoverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe | |
| EP0134197B1 (de) | Reaktivfarbstoffe der Disazoreihe, deren Herstellung und Verwendung | |
| CH599316A5 (en) | Fibre-reactive azo dyes prepn. | |
| EP0122881B1 (de) | Reaktivfarbstoffe, deren Herstellung und Verwendung | |
| EP0105027B1 (de) | Reaktivfarbstoffe, deren Herstellung und Verwendung | |
| CH606345A5 (en) | Tetrakis:azo dyes contg. two fibre-reactive triazinyl gps. | |
| DE3009788A1 (de) | Wasserloesliche nickelphtalocyaninazofarbstoffe | |
| EP0012716B1 (de) | Monochlortriazinfarbstoffe der Azopyrazolonreihe, deren Herstellung und Verwendung zum Färben und Bedrucken von Textilmaterial | |
| DE69903090T2 (de) | Wasserlösliche halogentriazinhaltige Azoverbindungen, Verfahren zu deren Herstellung und ihre Verwendung als Farbstoffe | |
| DE3132724A1 (de) | Wasserloesliche azoverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe | |
| CH515316A (de) | Verfahren zur Herstellung von faserreaktiven schwermetallhaltigen Formazanfarbstoffen | |
| DE2927718A1 (de) | Faserreaktive azofarbstoffe, deren herstellung und verwendung | |
| CH589703A5 (en) | Fibre-reactive tetrazo dyes contg. halotriazine ring - for dyeing and printing cotton, and nitrogenous materials greenish-blue shades | |
| DE1192346B (de) | Verfahren zur Herstellung von Azophthalocyaninfarbstoffen | |
| DE1644354C3 (de) | Wasserlösliche reaktive Monoazopyrazolonfarbstoffe, Verfahren zu deren Herstellung und deren Verwendung zum Färben und Klotzen von ZeHulose, von Fasern tierischer Herkunft und Polyamiden | |
| DE1231365B (de) | Verfahren zur Herstellung faserreaktiver Azofarbstoffe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8125 | Change of the main classification |
Ipc: C09B 62/09 |
|
| 8128 | New person/name/address of the agent |
Representative=s name: SCHWABE, H., DIPL.-ING. SANDMAIR, K., DIPL.-CHEM. |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |