DE2460946A1 - Flammhemmende polycarbonatzusammensetzung - Google Patents
Flammhemmende polycarbonatzusammensetzungInfo
- Publication number
- DE2460946A1 DE2460946A1 DE19742460946 DE2460946A DE2460946A1 DE 2460946 A1 DE2460946 A1 DE 2460946A1 DE 19742460946 DE19742460946 DE 19742460946 DE 2460946 A DE2460946 A DE 2460946A DE 2460946 A1 DE2460946 A1 DE 2460946A1
- Authority
- DE
- Germany
- Prior art keywords
- additive
- composition according
- aromatic
- flame
- disodium
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 229920000515 polycarbonate Polymers 0.000 title claims description 26
- 239000004417 polycarbonate Substances 0.000 title claims description 26
- 239000000203 mixture Substances 0.000 title claims description 21
- 239000003063 flame retardant Substances 0.000 title description 22
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 title description 21
- 239000000654 additive Substances 0.000 claims description 36
- 230000000996 additive effect Effects 0.000 claims description 22
- 125000003118 aryl group Chemical group 0.000 claims description 16
- 150000003839 salts Chemical class 0.000 claims description 13
- 229910052751 metal Inorganic materials 0.000 claims description 11
- 239000002184 metal Substances 0.000 claims description 11
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims description 7
- 239000000460 chlorine Substances 0.000 claims description 6
- 150000002367 halogens Chemical class 0.000 claims description 5
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical compound [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 claims description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 4
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 4
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 4
- 229910052731 fluorine Inorganic materials 0.000 claims description 4
- 239000011737 fluorine Substances 0.000 claims description 4
- 229920000642 polymer Polymers 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- SAQSTQBVENFSKT-UHFFFAOYSA-M TCA-sodium Chemical compound [Na+].[O-]C(=O)C(Cl)(Cl)Cl SAQSTQBVENFSKT-UHFFFAOYSA-M 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- FPFJTBQQZWBMAZ-UHFFFAOYSA-L disodium;2,2,3,3,4,4-hexafluoropentanedioate Chemical compound [Na+].[Na+].[O-]C(=O)C(F)(F)C(F)(F)C(F)(F)C([O-])=O FPFJTBQQZWBMAZ-UHFFFAOYSA-L 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims 1
- 150000001342 alkaline earth metals Chemical class 0.000 claims 1
- 150000001735 carboxylic acids Chemical class 0.000 claims 1
- -1 aromatic Carboxylic acids Chemical class 0.000 description 11
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 8
- 239000000463 material Substances 0.000 description 6
- 238000011156 evaluation Methods 0.000 description 5
- 239000002253 acid Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000002243 precursor Substances 0.000 description 4
- 229920000742 Cotton Polymers 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 239000000370 acceptor Substances 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052712 strontium Inorganic materials 0.000 description 3
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 3
- 238000010998 test method Methods 0.000 description 3
- DEIGXXQKDWULML-UHFFFAOYSA-N 1,2,5,6,9,10-hexabromocyclododecane Chemical compound BrC1CCC(Br)C(Br)CCC(Br)C(Br)CCC1Br DEIGXXQKDWULML-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910052788 barium Inorganic materials 0.000 description 2
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 2
- 230000008033 biological extinction Effects 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052701 rubidium Inorganic materials 0.000 description 2
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical compound [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- YMTYZTXUZLQUSF-UHFFFAOYSA-N 3,3'-Dimethylbisphenol A Chemical compound C1=C(O)C(C)=CC(C(C)(C)C=2C=C(C)C(O)=CC=2)=C1 YMTYZTXUZLQUSF-UHFFFAOYSA-N 0.000 description 1
- MLDIQALUMKMHCC-UHFFFAOYSA-N 4,4-Bis(4-hydroxyphenyl)heptane Chemical compound C=1C=C(O)C=CC=1C(CCC)(CCC)C1=CC=C(O)C=C1 MLDIQALUMKMHCC-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- UMIVMLKFARKXIF-UAIGNFCESA-L [Na+].[Na+].[O-]C(=O)C(\Br)=C(\Br)C([O-])=O Chemical compound [Na+].[Na+].[O-]C(=O)C(\Br)=C(\Br)C([O-])=O UMIVMLKFARKXIF-UAIGNFCESA-L 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 229910000410 antimony oxide Inorganic materials 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 229910052790 beryllium Inorganic materials 0.000 description 1
- ATBAMAFKBVZNFJ-UHFFFAOYSA-N beryllium atom Chemical compound [Be] ATBAMAFKBVZNFJ-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 229940106691 bisphenol a Drugs 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 159000000006 cesium salts Chemical class 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 230000002542 deteriorative effect Effects 0.000 description 1
- SMBQBQBNOXIFSF-UHFFFAOYSA-N dilithium Chemical compound [Li][Li] SMBQBQBNOXIFSF-UHFFFAOYSA-N 0.000 description 1
- KCIDZIIHRGYJAE-YGFYJFDDSA-L dipotassium;[(2r,3r,4s,5r,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate Chemical compound [K+].[K+].OC[C@H]1O[C@H](OP([O-])([O-])=O)[C@H](O)[C@@H](O)[C@H]1O KCIDZIIHRGYJAE-YGFYJFDDSA-L 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229920005668 polycarbonate resin Polymers 0.000 description 1
- 239000004431 polycarbonate resin Substances 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/04—Oxygen-containing compounds
- C08K5/09—Carboxylic acids; Metal salts thereof; Anhydrides thereof
- C08K5/098—Metal salts of carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/04—Oxygen-containing compounds
- C08K5/09—Carboxylic acids; Metal salts thereof; Anhydrides thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Fireproofing Substances (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/429,644 US4066618A (en) | 1973-12-28 | 1973-12-28 | Flame retardant polycarbonate composition |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2460946A1 true DE2460946A1 (de) | 1975-07-10 |
Family
ID=23704127
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742460946 Withdrawn DE2460946A1 (de) | 1973-12-28 | 1974-12-21 | Flammhemmende polycarbonatzusammensetzung |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4066618A (enExample) |
| JP (1) | JPS5929611B2 (enExample) |
| BR (1) | BR7410857D0 (enExample) |
| CA (1) | CA1062836A (enExample) |
| DE (1) | DE2460946A1 (enExample) |
| FR (1) | FR2256222B1 (enExample) |
| GB (1) | GB1495954A (enExample) |
| IT (1) | IT1027810B (enExample) |
| NL (1) | NL7416731A (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4320049A (en) * | 1980-07-14 | 1982-03-16 | Mobay Chemical Corporation | Flame retarding agents for polycarbonates |
| US4464497A (en) * | 1982-12-15 | 1984-08-07 | General Electric Company | Carbon black filled flame retardant polycarbonate compositions |
| US4600742A (en) * | 1984-08-17 | 1986-07-15 | The Lubrizol Corporation | Polycarbonate compositions |
| US4632949A (en) * | 1984-12-31 | 1986-12-30 | Mobay Chemical Corporation | Flame retarding agents for polycarbonates |
| US4578409A (en) * | 1985-01-14 | 1986-03-25 | Mobay Chemical Corporation | Flame retarding silanes |
| JPH03175218A (ja) * | 1989-12-04 | 1991-07-30 | Mitsubishi Electric Corp | 床暖房パネル |
| US4994510A (en) * | 1990-04-05 | 1991-02-19 | General Electric Company | Poly(carbonate-siloxane) with reduced tendency to burn |
| US6995212B2 (en) | 2003-08-08 | 2006-02-07 | Bayer Materialscience Llc | Flame retardant, thermoplastic polycarbonate molding compositions |
| KR102294921B1 (ko) * | 2013-10-08 | 2021-08-30 | 코베스트로 도이칠란트 아게 | 약산의 염을 이용하는 폴리실록산-폴리카보네이트 블록 공축합물의 제조 방법 |
| JP6605456B2 (ja) * | 2013-10-08 | 2019-11-13 | コベストロ、ドイチュラント、アクチエンゲゼルシャフト | ポリシロキサン−ポリカーボネートブロック共縮合物 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2839553A (en) * | 1955-03-14 | 1958-06-17 | Shell Dev | Polyhalogeno bicyclic acids |
| US2758918A (en) * | 1955-03-14 | 1956-08-14 | Shell Dev | Plant regulators |
| US3365470A (en) * | 1964-05-08 | 1968-01-23 | Universal Oil Prod Co | Halo-substituted polyhydrodialkanotricyclic dicarboxylic acids, derivatives and a method of preparation thereof |
| US3288813A (en) * | 1964-08-26 | 1966-11-29 | Velsicol Chemical Corp | 5, 6, 7, 8, 9, 9-hexachloro-1, 2, 3, 4, 4alpha, 5, 8, 8alpha-octahydro-1, 4, 5, 8-dimethanonaphthalene-2, 3-dicarboxylic acid and 5, 6, 7, 8, 9, 9-hexachloro-1, 2, 3, 4,4alpha, 5, 8, 8alpha-octahydro-1, 4, 5, 8-dimethanonaphthalene-2, 3-dicarboxylic anhydride |
| US3535300A (en) * | 1967-10-12 | 1970-10-20 | Mobay Chemical Corp | Flame resistant polycarbonates |
| US3522204A (en) * | 1968-07-01 | 1970-07-28 | American Cyanamid Co | Synergistic flame-retardant compositions |
-
1973
- 1973-12-28 US US05/429,644 patent/US4066618A/en not_active Expired - Lifetime
-
1974
- 1974-10-15 CA CA211,459A patent/CA1062836A/en not_active Expired
- 1974-12-06 JP JP49141107A patent/JPS5929611B2/ja not_active Expired
- 1974-12-16 GB GB54244/74A patent/GB1495954A/en not_active Expired
- 1974-12-19 IT IT30732/74A patent/IT1027810B/it active
- 1974-12-20 NL NL7416731A patent/NL7416731A/xx not_active Application Discontinuation
- 1974-12-21 DE DE19742460946 patent/DE2460946A1/de not_active Withdrawn
- 1974-12-26 BR BR10857/74A patent/BR7410857D0/pt unknown
- 1974-12-27 FR FR7443101A patent/FR2256222B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1495954A (en) | 1977-12-21 |
| FR2256222A1 (enExample) | 1975-07-25 |
| FR2256222B1 (enExample) | 1980-04-18 |
| CA1062836A (en) | 1979-09-18 |
| JPS5929611B2 (ja) | 1984-07-21 |
| US4066618A (en) | 1978-01-03 |
| NL7416731A (nl) | 1975-07-01 |
| IT1027810B (it) | 1978-12-20 |
| JPS5097642A (enExample) | 1975-08-02 |
| AU7586174A (en) | 1976-06-03 |
| BR7410857D0 (pt) | 1975-09-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2458968C2 (de) | Flammhemmende Polycarbonatzusammensetzung | |
| DE2461077C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2461146C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2461063C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2458527C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2460786C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2948871A1 (de) | Flammhemmende polycarbonat-zusammensetzung | |
| DE2460787A1 (de) | Flammhemmende polycarbonat-zusammensetzung | |
| DE2461144A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE2460937C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2242509C2 (de) | Nicht-tropfende, flammhemmende, mit Glas verstärkte Polyesterharze und Verfahren zu ihrer Herstellung | |
| DE2461145A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE2154095A1 (de) | Ammoniumpolyphosphat-Phosphoniumbromid-Kombinationen als feuerhemmende Mittel für Propylenpolymere | |
| DE2631755A1 (de) | Neue, flammhemmende polycarbonat- zusammensetzungen | |
| CH628664A5 (de) | Feuerhemmende polyamid-grundmischung und -masse. | |
| DE2460788A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE2460946A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE2460935A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE2460945A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE68925794T2 (de) | Verfahren zur Verteilung von entzündungsfesten Zusätzen in Carbonatpolymeren | |
| DE2915563A1 (de) | Flammhemmende kristalline polycarbonatzusammensetzungen | |
| DE2042450B2 (de) | Flammwidrige polyalkylenterephthalatpressmassen | |
| DE2460944C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2346177B2 (de) | Selbsterlöschende Formmasse | |
| DE2644114A1 (de) | Nicht-opake, flammhemmende polycarbonat-zusammensetzung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8130 | Withdrawal |