DE2460945A1 - Flammhemmende polycarbonatzusammensetzung - Google Patents
Flammhemmende polycarbonatzusammensetzungInfo
- Publication number
- DE2460945A1 DE2460945A1 DE19742460945 DE2460945A DE2460945A1 DE 2460945 A1 DE2460945 A1 DE 2460945A1 DE 19742460945 DE19742460945 DE 19742460945 DE 2460945 A DE2460945 A DE 2460945A DE 2460945 A1 DE2460945 A1 DE 2460945A1
- Authority
- DE
- Germany
- Prior art keywords
- group
- composition according
- chlorine
- bromine
- fluorine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 229920000515 polycarbonate Polymers 0.000 title claims description 26
- 239000004417 polycarbonate Substances 0.000 title claims description 26
- 239000003063 flame retardant Substances 0.000 title claims description 22
- 239000000203 mixture Substances 0.000 title claims description 20
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 title description 19
- 239000000654 additive Substances 0.000 claims description 27
- 239000002253 acid Substances 0.000 claims description 26
- 125000003118 aryl group Chemical group 0.000 claims description 17
- 150000007513 acids Chemical class 0.000 claims description 13
- 150000003839 salts Chemical class 0.000 claims description 12
- 229910052751 metal Inorganic materials 0.000 claims description 11
- 239000002184 metal Substances 0.000 claims description 11
- 230000000996 additive effect Effects 0.000 claims description 9
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 8
- 239000000460 chlorine Substances 0.000 claims description 8
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 6
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 6
- 239000003513 alkali Substances 0.000 claims description 6
- 229910052731 fluorine Inorganic materials 0.000 claims description 6
- 239000011737 fluorine Substances 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- -1 sodium pentachlor Chemical compound 0.000 claims description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 4
- 229910052708 sodium Inorganic materials 0.000 claims description 4
- 239000011734 sodium Substances 0.000 claims description 4
- FITANBHHCLWRKG-UHFFFAOYSA-L disodium;2,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,4-diolate Chemical group [Na+].[Na+].[O-]C1=C(Cl)C(=O)C([O-])=C(Cl)C1=O FITANBHHCLWRKG-UHFFFAOYSA-L 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 2
- 125000004957 naphthylene group Chemical group 0.000 claims description 2
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 2
- 125000000732 arylene group Chemical group 0.000 claims 2
- 241000251730 Chondrichthyes Species 0.000 claims 1
- 150000001447 alkali salts Chemical class 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- 238000012360 testing method Methods 0.000 description 21
- 238000007792 addition Methods 0.000 description 8
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 6
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- 238000000034 method Methods 0.000 description 6
- 238000011156 evaluation Methods 0.000 description 5
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 4
- 239000002243 precursor Substances 0.000 description 4
- 229920000742 Cotton Polymers 0.000 description 3
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 3
- 239000000370 acceptor Substances 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 239000004744 fabric Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000001294 propane Substances 0.000 description 3
- 229910014033 C-OH Inorganic materials 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- 229910014570 C—OH Inorganic materials 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 229910052788 barium Inorganic materials 0.000 description 2
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- IPPWILKGXFOXHO-UHFFFAOYSA-N chloranilic acid Chemical compound OC1=C(Cl)C(=O)C(O)=C(Cl)C1=O IPPWILKGXFOXHO-UHFFFAOYSA-N 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052701 rubidium Inorganic materials 0.000 description 2
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical compound [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 229910052712 strontium Inorganic materials 0.000 description 2
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 2
- 238000010998 test method Methods 0.000 description 2
- DEIGXXQKDWULML-UHFFFAOYSA-N 1,2,5,6,9,10-hexabromocyclododecane Chemical compound BrC1CCC(Br)C(Br)CCC(Br)C(Br)CCC1Br DEIGXXQKDWULML-UHFFFAOYSA-N 0.000 description 1
- OQZBAQXTXNIPRA-UHFFFAOYSA-N 1-pyridin-4-ylpiperazine Chemical compound C1CNCCN1C1=CC=NC=C1 OQZBAQXTXNIPRA-UHFFFAOYSA-N 0.000 description 1
- HSBQYDCVAYTMFR-UHFFFAOYSA-N 2,5-difluoro-3,6-dihydroxycyclohexa-2,5-diene-1,4-dione Chemical compound OC1=C(F)C(=O)C(O)=C(F)C1=O HSBQYDCVAYTMFR-UHFFFAOYSA-N 0.000 description 1
- YMTYZTXUZLQUSF-UHFFFAOYSA-N 3,3'-Dimethylbisphenol A Chemical compound C1=C(O)C(C)=CC(C(C)(C)C=2C=C(C)C(O)=CC=2)=C1 YMTYZTXUZLQUSF-UHFFFAOYSA-N 0.000 description 1
- VBDCTFDIXXYZOO-UHFFFAOYSA-N 4,6-dichloro-1,3-dimethylpyrazolo[3,4-d]pyrimidine Chemical compound ClC1=NC(Cl)=C2C(C)=NN(C)C2=N1 VBDCTFDIXXYZOO-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 125000004653 anthracenylene group Chemical group 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 229910000410 antimony oxide Inorganic materials 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- 229910052790 beryllium Inorganic materials 0.000 description 1
- ATBAMAFKBVZNFJ-UHFFFAOYSA-N beryllium atom Chemical compound [Be] ATBAMAFKBVZNFJ-UHFFFAOYSA-N 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 159000000006 cesium salts Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- RBSLJAJQOVYTRQ-UHFFFAOYSA-N croconic acid Chemical compound OC1=C(O)C(=O)C(=O)C1=O RBSLJAJQOVYTRQ-UHFFFAOYSA-N 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 230000002542 deteriorative effect Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- CSFWPUWCSPOLJW-UHFFFAOYSA-N lawsone Chemical compound C1=CC=C2C(=O)C(O)=CC(=O)C2=C1 CSFWPUWCSPOLJW-UHFFFAOYSA-N 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 229920005668 polycarbonate resin Polymers 0.000 description 1
- 239000004431 polycarbonate resin Substances 0.000 description 1
- UNUVOQUVNRHMOA-UHFFFAOYSA-L sodium squarate Chemical compound [Na+].[Na+].[O-]C1=C([O-])C(=O)C1=O UNUVOQUVNRHMOA-UHFFFAOYSA-L 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- PWEBUXCTKOWPCW-UHFFFAOYSA-N squaric acid Chemical compound OC1=C(O)C(=O)C1=O PWEBUXCTKOWPCW-UHFFFAOYSA-N 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/04—Oxygen-containing compounds
- C08K5/09—Carboxylic acids; Metal salts thereof; Anhydrides thereof
- C08K5/098—Metal salts of carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/04—Oxygen-containing compounds
- C08K5/09—Carboxylic acids; Metal salts thereof; Anhydrides thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US42916473A | 1973-12-28 | 1973-12-28 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2460945A1 true DE2460945A1 (de) | 1975-07-10 |
Family
ID=23702076
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742460945 Withdrawn DE2460945A1 (de) | 1973-12-28 | 1974-12-21 | Flammhemmende polycarbonatzusammensetzung |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4069201A (enExample) |
| JP (1) | JPS5743098B2 (enExample) |
| BR (1) | BR7410856D0 (enExample) |
| CA (1) | CA1063282A (enExample) |
| DE (1) | DE2460945A1 (enExample) |
| FR (1) | FR2256215B1 (enExample) |
| GB (1) | GB1495955A (enExample) |
| IT (1) | IT1027808B (enExample) |
| NL (1) | NL7416661A (enExample) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4320049A (en) * | 1980-07-14 | 1982-03-16 | Mobay Chemical Corporation | Flame retarding agents for polycarbonates |
| US4880853A (en) * | 1984-02-10 | 1989-11-14 | General Electric Company | Enhancing color stability to sterilizing radiation of polymer compositions |
| US4996246A (en) * | 1984-02-10 | 1991-02-26 | General Electric Company | Enhancing color stability to sterilizing radiation of polymer compositions |
| US4600742A (en) * | 1984-08-17 | 1986-07-15 | The Lubrizol Corporation | Polycarbonate compositions |
| US4632949A (en) * | 1984-12-31 | 1986-12-30 | Mobay Chemical Corporation | Flame retarding agents for polycarbonates |
| US4578409A (en) * | 1985-01-14 | 1986-03-25 | Mobay Chemical Corporation | Flame retarding silanes |
| US4994510A (en) * | 1990-04-05 | 1991-02-19 | General Electric Company | Poly(carbonate-siloxane) with reduced tendency to burn |
| US6995212B2 (en) | 2003-08-08 | 2006-02-07 | Bayer Materialscience Llc | Flame retardant, thermoplastic polycarbonate molding compositions |
| US20090233142A2 (en) * | 2004-04-30 | 2009-09-17 | Sumitomo Chemical Company, Limited | Polymer having oxocarbon group, and use thereof |
| KR20070097569A (ko) | 2005-01-12 | 2007-10-04 | 스미또모 가가꾸 가부시키가이샤 | 옥소카본류를 함유하는 조성물 및 그의 용도 |
| JP4935079B2 (ja) * | 2005-01-12 | 2012-05-23 | 住友化学株式会社 | オキソカーボン類を含有する高分子組成物及びその用途 |
| US8138231B2 (en) * | 2007-10-29 | 2012-03-20 | Sumitomo Chemical Company, Limited | Polymer having oxycarbon group, and use thereof |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB739183A (en) * | 1952-02-18 | 1955-10-26 | Monsanto Chemicals | Substituted 1-hydroxy-4-ketonaphthalenes |
| US3357942A (en) * | 1965-04-05 | 1967-12-12 | Eastman Kodak Co | Fire-retardant polycarbonates |
| US3809676A (en) * | 1972-01-03 | 1974-05-07 | Gen Electric | Thermally stable flame retardant polycarbonate composition comprising a polycarbonate and a stabilizer |
| JPS49134655A (enExample) * | 1973-05-07 | 1974-12-25 | ||
| US3859285A (en) * | 1973-11-09 | 1975-01-07 | Marcel K Eberle | 10, 11-dihydro-5h-benzo (4,5) cyclohepta (1,2-b) pyrazines |
-
1974
- 1974-11-05 CA CA213,018A patent/CA1063282A/en not_active Expired
- 1974-12-10 JP JP49142426A patent/JPS5743098B2/ja not_active Expired
- 1974-12-16 GB GB54249/74A patent/GB1495955A/en not_active Expired
- 1974-12-19 IT IT30730/74A patent/IT1027808B/it active
- 1974-12-20 NL NL7416661A patent/NL7416661A/xx not_active Application Discontinuation
- 1974-12-21 DE DE19742460945 patent/DE2460945A1/de not_active Withdrawn
- 1974-12-26 BR BR10856/74A patent/BR7410856D0/pt unknown
- 1974-12-27 FR FR7443093A patent/FR2256215B1/fr not_active Expired
-
1975
- 1975-12-22 US US05/642,994 patent/US4069201A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| IT1027808B (it) | 1978-12-20 |
| AU7586374A (en) | 1976-06-03 |
| JPS5743098B2 (enExample) | 1982-09-13 |
| FR2256215A1 (enExample) | 1975-07-25 |
| US4069201A (en) | 1978-01-17 |
| BR7410856D0 (pt) | 1975-09-02 |
| NL7416661A (nl) | 1975-07-01 |
| JPS5098538A (enExample) | 1975-08-05 |
| GB1495955A (en) | 1977-12-21 |
| FR2256215B1 (enExample) | 1979-09-21 |
| CA1063282A (en) | 1979-09-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2461146C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2458527C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2461063C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2461077C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2458968A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE2460937C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2461144A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE2460786C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2948871A1 (de) | Flammhemmende polycarbonat-zusammensetzung | |
| DE2461145A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| EP0042561B1 (de) | Flammwidrige Formmassen auf Basis thermoplastischer aromatischer Polyester, Verfahren zu ihrer Herstellung und ihre Verwendung zur Herstellung von Formkörpern | |
| DE2503336C2 (de) | Polycarbonat-Formmassen | |
| DE2460787A1 (de) | Flammhemmende polycarbonat-zusammensetzung | |
| DE2242509C2 (de) | Nicht-tropfende, flammhemmende, mit Glas verstärkte Polyesterharze und Verfahren zu ihrer Herstellung | |
| DE2631755A1 (de) | Neue, flammhemmende polycarbonat- zusammensetzungen | |
| DE2931172A1 (de) | Verwendung von alkali- und erdalkalisalzen alkylsubstituierter aromatischer sulfonsaeuren, phosphonsaeuren und sauerer phosphonsaeureester als interne antistatika fuer polycarbonat, insbesondere fuer polycarbonatfolien | |
| DE2460945A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE2154095A1 (de) | Ammoniumpolyphosphat-Phosphoniumbromid-Kombinationen als feuerhemmende Mittel für Propylenpolymere | |
| DE2460788A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE2460935A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE2633944A1 (de) | Massen aus aromatischen copolyestern | |
| DE68925794T2 (de) | Verfahren zur Verteilung von entzündungsfesten Zusätzen in Carbonatpolymeren | |
| DE2460946A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE2644114A1 (de) | Nicht-opake, flammhemmende polycarbonat-zusammensetzung | |
| DE2460944C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8130 | Withdrawal |