DE2460944C2 - Flammhemmende aromatische Polycarbonatzusammensetzung - Google Patents
Flammhemmende aromatische PolycarbonatzusammensetzungInfo
- Publication number
- DE2460944C2 DE2460944C2 DE2460944A DE2460944A DE2460944C2 DE 2460944 C2 DE2460944 C2 DE 2460944C2 DE 2460944 A DE2460944 A DE 2460944A DE 2460944 A DE2460944 A DE 2460944A DE 2460944 C2 DE2460944 C2 DE 2460944C2
- Authority
- DE
- Germany
- Prior art keywords
- aromatic polycarbonate
- flame
- weight
- mixture
- flame retardant
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 title claims description 30
- 229920000515 polycarbonate Polymers 0.000 title claims description 27
- 239000004417 polycarbonate Substances 0.000 title claims description 27
- 239000003063 flame retardant Substances 0.000 title claims description 19
- 150000003839 salts Chemical class 0.000 claims description 18
- 125000003118 aryl group Chemical group 0.000 claims description 14
- -1 alkaline earth metal salt Chemical class 0.000 claims description 13
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical class CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 claims description 12
- 229910052751 metal Inorganic materials 0.000 claims description 12
- 239000002184 metal Substances 0.000 claims description 12
- 229910052783 alkali metal Inorganic materials 0.000 claims description 5
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 5
- PUQLFUHLKNBKQQ-UHFFFAOYSA-L calcium;trifluoromethanesulfonate Chemical compound [Ca+2].[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F PUQLFUHLKNBKQQ-UHFFFAOYSA-L 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 239000011737 fluorine Substances 0.000 claims description 3
- GLGXXYFYZWQGEL-UHFFFAOYSA-M potassium;trifluoromethanesulfonate Chemical compound [K+].[O-]S(=O)(=O)C(F)(F)F GLGXXYFYZWQGEL-UHFFFAOYSA-M 0.000 claims description 3
- XGPOMXSYOKFBHS-UHFFFAOYSA-M sodium;trifluoromethanesulfonate Chemical compound [Na+].[O-]S(=O)(=O)C(F)(F)F XGPOMXSYOKFBHS-UHFFFAOYSA-M 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 239000000654 additive Substances 0.000 description 22
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 16
- 230000000996 additive effect Effects 0.000 description 13
- 238000002474 experimental method Methods 0.000 description 9
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 6
- 230000000052 comparative effect Effects 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 239000002253 acid Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000002243 precursor Substances 0.000 description 4
- 229920000742 Cotton Polymers 0.000 description 3
- 239000000370 acceptor Substances 0.000 description 3
- DXJURUJRANOYMX-UHFFFAOYSA-L barium(2+);trifluoromethanesulfonate Chemical compound [Ba+2].[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F DXJURUJRANOYMX-UHFFFAOYSA-L 0.000 description 3
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 150000002367 halogens Chemical group 0.000 description 3
- 150000002989 phenols Chemical class 0.000 description 3
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 3
- DEIGXXQKDWULML-UHFFFAOYSA-N 1,2,5,6,9,10-hexabromocyclododecane Chemical compound BrC1CCC(Br)C(Br)CCC(Br)C(Br)CCC1Br DEIGXXQKDWULML-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 229910052788 barium Inorganic materials 0.000 description 2
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 2
- PXKLMJQFEQBVLD-UHFFFAOYSA-N bisphenol F Chemical compound C1=CC(O)=CC=C1CC1=CC=C(O)C=C1 PXKLMJQFEQBVLD-UHFFFAOYSA-N 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 230000015556 catabolic process Effects 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000006731 degradation reaction Methods 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 229910052701 rubidium Inorganic materials 0.000 description 2
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical compound [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000010998 test method Methods 0.000 description 2
- LCHYEKKJCUJAKN-UHFFFAOYSA-N 2-propylphenol Chemical compound CCCC1=CC=CC=C1O LCHYEKKJCUJAKN-UHFFFAOYSA-N 0.000 description 1
- MLDIQALUMKMHCC-UHFFFAOYSA-N 4,4-Bis(4-hydroxyphenyl)heptane Chemical compound C=1C=C(O)C=CC=1C(CCC)(CCC)C1=CC=C(O)C=C1 MLDIQALUMKMHCC-UHFFFAOYSA-N 0.000 description 1
- LAKCQQZOTUDUTD-UHFFFAOYSA-L CS(=O)(=O)[O-].[F].[F].[F].[Ca+2].CS(=O)(=O)[O-] Chemical compound CS(=O)(=O)[O-].[F].[F].[F].[Ca+2].CS(=O)(=O)[O-] LAKCQQZOTUDUTD-UHFFFAOYSA-L 0.000 description 1
- PQUCIEFHOVEZAU-UHFFFAOYSA-N Diammonium sulfite Chemical compound [NH4+].[NH4+].[O-]S([O-])=O PQUCIEFHOVEZAU-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- WCQRWCFGZARAMR-UHFFFAOYSA-N [F].[F] Chemical compound [F].[F] WCQRWCFGZARAMR-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 229910000410 antimony oxide Inorganic materials 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 229910052790 beryllium Inorganic materials 0.000 description 1
- ATBAMAFKBVZNFJ-UHFFFAOYSA-N beryllium atom Chemical compound [Be] ATBAMAFKBVZNFJ-UHFFFAOYSA-N 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 229920000402 bisphenol A polycarbonate polymer Polymers 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- UGWCLPAXMFDWSM-UHFFFAOYSA-N calcium;fluoroform Chemical compound [Ca].FC(F)F UGWCLPAXMFDWSM-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 159000000006 cesium salts Chemical class 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 230000002542 deteriorative effect Effects 0.000 description 1
- 238000010304 firing Methods 0.000 description 1
- 239000012757 flame retardant agent Substances 0.000 description 1
- BTZNPZMHENLISZ-UHFFFAOYSA-M fluoromethanesulfonate Chemical compound [O-]S(=O)(=O)CF BTZNPZMHENLISZ-UHFFFAOYSA-M 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- MCVFFRWZNYZUIJ-UHFFFAOYSA-M lithium;trifluoromethanesulfonate Chemical compound [Li+].[O-]S(=O)(=O)C(F)(F)F MCVFFRWZNYZUIJ-UHFFFAOYSA-M 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229920005668 polycarbonate resin Polymers 0.000 description 1
- 239000004431 polycarbonate resin Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052712 strontium Inorganic materials 0.000 description 1
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 1
- NMFVADRRLPSBKH-UHFFFAOYSA-L strontium;trifluoromethanesulfonate Chemical compound [Sr+2].[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F NMFVADRRLPSBKH-UHFFFAOYSA-L 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- VYGSFTVYZHNGBU-UHFFFAOYSA-N trichloromethanesulfonic acid Chemical class OS(=O)(=O)C(Cl)(Cl)Cl VYGSFTVYZHNGBU-UHFFFAOYSA-N 0.000 description 1
- ZCPSWAFANXCCOT-UHFFFAOYSA-N trichloromethanesulfonyl chloride Chemical compound ClC(Cl)(Cl)S(Cl)(=O)=O ZCPSWAFANXCCOT-UHFFFAOYSA-N 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical class OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/36—Sulfur-, selenium-, or tellurium-containing compounds
- C08K5/41—Compounds containing sulfur bound to oxygen
- C08K5/42—Sulfonic acids; Derivatives thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US42912573A | 1973-12-28 | 1973-12-28 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2460944A1 DE2460944A1 (de) | 1975-07-10 |
| DE2460944C2 true DE2460944C2 (de) | 1984-05-10 |
Family
ID=23701916
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2460944A Expired DE2460944C2 (de) | 1973-12-28 | 1974-12-21 | Flammhemmende aromatische Polycarbonatzusammensetzung |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4153595A (OSRAM) |
| JP (1) | JPS5828292B2 (OSRAM) |
| BR (1) | BR7410861D0 (OSRAM) |
| CA (1) | CA1050685A (OSRAM) |
| DE (1) | DE2460944C2 (OSRAM) |
| FR (1) | FR2256208B1 (OSRAM) |
| GB (1) | GB1495979A (OSRAM) |
| IT (1) | IT1030922B (OSRAM) |
| NL (1) | NL7416657A (OSRAM) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4110299A (en) * | 1976-10-15 | 1978-08-29 | General Electric Company | Flame-retardant polycarbonate composition |
| DE2706126C2 (de) * | 1977-02-14 | 1984-03-29 | Bayer Ag, 5090 Leverkusen | Schwerentflammbare Polycarbonat-Folien |
| US4515937A (en) * | 1980-09-09 | 1985-05-07 | Mobay Chemical Corporation | Flame resistant sulfur-bearing copolycarbonate |
| US4600742A (en) * | 1984-08-17 | 1986-07-15 | The Lubrizol Corporation | Polycarbonate compositions |
| JP5352568B2 (ja) * | 2010-11-22 | 2013-11-27 | 三菱エンジニアリングプラスチックス株式会社 | ポリカーボネート樹脂成形品 |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE962489C (de) * | 1954-02-10 | 1957-04-25 | Dehydag Gmbh | Sparbeizmittel zum Schutze von Metallen bei der Behandlung mit sauren Mitteln |
| NL216943A (OSRAM) * | 1956-05-21 | 1900-01-01 | ||
| US3535300A (en) * | 1967-10-12 | 1970-10-20 | Mobay Chemical Corp | Flame resistant polycarbonates |
| AT297333B (de) * | 1969-06-13 | 1972-03-27 | Bayer Ag | Verfahren zur Herstellung von Polycarbonaten mit verminderter Brennbarkeit |
| US3576617A (en) * | 1969-11-25 | 1971-04-27 | Eugene P Di Bella | Method of promoting the growth of plants |
| US3836490A (en) * | 1970-10-08 | 1974-09-17 | Bayer Ag | Flameproof polycarbonates containing an alkali metal salt soluble in the polycarbonate melt |
| DE2049358C3 (de) * | 1970-10-08 | 1979-12-06 | Bayer Ag, 5090 Leverkusen | Flammwidriges Polycarbonat |
| US3912688A (en) * | 1971-06-12 | 1975-10-14 | Bayer Ag | Flameproof polycarbonates |
| US3876580A (en) * | 1971-09-29 | 1975-04-08 | Bayer Ag | Flame-resistant thermoplastic molding compositions and moldings made therefrom |
| US3875107A (en) * | 1971-09-29 | 1975-04-01 | Bayer Ag | Flame-resistant thermoplastic molding compositions and moldings made therefrom |
| BE789458A (fr) * | 1971-09-29 | 1973-03-29 | Bayer Ag | Masses de moulage thermoplastiques ignifuges et corps moules a haute resilience |
| BE790919R (fr) * | 1971-11-03 | 1973-05-03 | Bayer Ag | Polycarbonates thermoplastiques a poids moleculaire eleve de phenols |
| US3971756A (en) * | 1974-08-09 | 1976-07-27 | General Electric Company | Flame retardant polycarbonate composition |
-
1974
- 1974-11-05 CA CA212,993A patent/CA1050685A/en not_active Expired
- 1974-12-06 JP JP49141106A patent/JPS5828292B2/ja not_active Expired
- 1974-12-16 GB GB54243/74A patent/GB1495979A/en not_active Expired
- 1974-12-19 IT IT30737/74A patent/IT1030922B/it active
- 1974-12-20 NL NL7416657A patent/NL7416657A/xx not_active Application Discontinuation
- 1974-12-21 DE DE2460944A patent/DE2460944C2/de not_active Expired
- 1974-12-26 BR BR10861/74A patent/BR7410861D0/pt unknown
- 1974-12-27 FR FR7443086A patent/FR2256208B1/fr not_active Expired
-
1977
- 1977-09-09 US US05/831,915 patent/US4153595A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5828292B2 (ja) | 1983-06-15 |
| JPS5097641A (OSRAM) | 1975-08-02 |
| FR2256208A1 (OSRAM) | 1975-07-25 |
| US4153595A (en) | 1979-05-08 |
| DE2460944A1 (de) | 1975-07-10 |
| CA1050685A (en) | 1979-03-13 |
| NL7416657A (nl) | 1975-07-01 |
| IT1030922B (it) | 1979-04-10 |
| AU7570274A (en) | 1976-05-27 |
| FR2256208B1 (OSRAM) | 1979-10-05 |
| BR7410861D0 (pt) | 1975-09-02 |
| GB1495979A (en) | 1977-12-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2461146C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2461063C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2461077C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2458968C2 (de) | Flammhemmende Polycarbonatzusammensetzung | |
| DE2460786C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2458527C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2461144A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE2460937C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2948871A1 (de) | Flammhemmende polycarbonat-zusammensetzung | |
| DE2461145A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE2460787A1 (de) | Flammhemmende polycarbonat-zusammensetzung | |
| DE2154095A1 (de) | Ammoniumpolyphosphat-Phosphoniumbromid-Kombinationen als feuerhemmende Mittel für Propylenpolymere | |
| DE2604275C2 (OSRAM) | ||
| DE2460788A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE2460935A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE2460944C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2460945A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE2460946A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE68925794T2 (de) | Verfahren zur Verteilung von entzündungsfesten Zusätzen in Carbonatpolymeren | |
| DE2346177C3 (de) | Selbsterlöschende Formmasse | |
| DE2263926A1 (de) | Entflammungshemmende polymermasse | |
| DE2644114A1 (de) | Nicht-opake, flammhemmende polycarbonat-zusammensetzung | |
| DE1469899C3 (de) | Flammfeste Kunststoffe | |
| DE2154096A1 (de) | Tert phosphinoxid Ammoniumpolyphos phat Kombinationen als feuerhemmende Zu satze für Propylenpolymere | |
| DE1669938A1 (de) | Verfahren zur Herabsetzung der Entflammbarkeit von organischen Hochpolymeren |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| D2 | Grant after examination | ||
| 8363 | Opposition against the patent | ||
| 8330 | Complete disclaimer |