DE2455858A1 - Neue acyl-substituierte benzyl- und dibenzylaether und verfahren zu deren herstellung - Google Patents
Neue acyl-substituierte benzyl- und dibenzylaether und verfahren zu deren herstellungInfo
- Publication number
- DE2455858A1 DE2455858A1 DE19742455858 DE2455858A DE2455858A1 DE 2455858 A1 DE2455858 A1 DE 2455858A1 DE 19742455858 DE19742455858 DE 19742455858 DE 2455858 A DE2455858 A DE 2455858A DE 2455858 A1 DE2455858 A1 DE 2455858A1
- Authority
- DE
- Germany
- Prior art keywords
- formula
- compounds
- carbon atoms
- different
- alkyl group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 7
- -1 DIBENZYL ETHERS Chemical class 0.000 title description 10
- 238000004519 manufacturing process Methods 0.000 title description 2
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical class [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 32
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 7
- 229910052794 bromium Inorganic materials 0.000 claims description 7
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 6
- 239000000460 chlorine Substances 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 125000001797 benzyl group Chemical class [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical class C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 claims description 4
- 150000002431 hydrogen Chemical class 0.000 claims description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 239000011737 fluorine Substances 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 2
- 229910052744 lithium Inorganic materials 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 229910052700 potassium Inorganic materials 0.000 claims description 2
- 239000011591 potassium Substances 0.000 claims description 2
- 229910052708 sodium Inorganic materials 0.000 claims description 2
- 239000011734 sodium Substances 0.000 claims description 2
- 239000003814 drug Substances 0.000 claims 1
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 4
- 239000008280 blood Substances 0.000 description 4
- 210000004369 blood Anatomy 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- ZBTMRBYMKUEVEU-UHFFFAOYSA-N 1-bromo-4-methylbenzene Chemical compound CC1=CC=C(Br)C=C1 ZBTMRBYMKUEVEU-UHFFFAOYSA-N 0.000 description 2
- ZYWGAHRBGCEFAO-UHFFFAOYSA-N 2,2-dimethyl-1-(4-methylphenyl)propan-1-one Chemical compound CC1=CC=C(C(=O)C(C)(C)C)C=C1 ZYWGAHRBGCEFAO-UHFFFAOYSA-N 0.000 description 2
- JRGJCFVXVKCQPC-UHFFFAOYSA-N 2,2-dimethyl-1-[4-[(4-methylphenoxy)methyl]phenyl]propan-1-one Chemical compound C1=CC(C)=CC=C1OCC1=CC=C(C(=O)C(C)(C)C)C=C1 JRGJCFVXVKCQPC-UHFFFAOYSA-N 0.000 description 2
- OECPUBRNDKXFDX-UHFFFAOYSA-N 2,2-dimethyl-1-phenylpropan-1-one Chemical compound CC(C)(C)C(=O)C1=CC=CC=C1 OECPUBRNDKXFDX-UHFFFAOYSA-N 0.000 description 2
- 239000004342 Benzoyl peroxide Substances 0.000 description 2
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 2
- 102000004895 Lipoproteins Human genes 0.000 description 2
- 108090001030 Lipoproteins Proteins 0.000 description 2
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 235000019400 benzoyl peroxide Nutrition 0.000 description 2
- 230000031709 bromination Effects 0.000 description 2
- 238000005893 bromination reaction Methods 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000012320 chlorinating reagent Substances 0.000 description 2
- 238000005660 chlorination reaction Methods 0.000 description 2
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical group [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 239000012730 sustained-release form Substances 0.000 description 2
- 230000001960 triggered effect Effects 0.000 description 2
- LWKQWHORLCKXPL-UHFFFAOYSA-N 1-[4-[(3-chlorophenoxy)methyl]phenyl]-2,2-dimethylpropan-1-one Chemical compound C1=CC(C(=O)C(C)(C)C)=CC=C1COC1=CC=CC(Cl)=C1 LWKQWHORLCKXPL-UHFFFAOYSA-N 0.000 description 1
- JEBBUIFDFXNYOD-UHFFFAOYSA-N 1-[4-[(4-chlorophenoxy)methyl]phenyl]-2,2-dimethylpropan-1-one Chemical compound C1=CC(C(=O)C(C)(C)C)=CC=C1COC1=CC=C(Cl)C=C1 JEBBUIFDFXNYOD-UHFFFAOYSA-N 0.000 description 1
- UGCOFPHFTHJCIV-UHFFFAOYSA-N 1-[4-[(4-chlorophenyl)methoxymethyl]phenyl]-2,2-dimethylpropan-1-one Chemical compound ClC1=CC=C(COCC2=CC=C(C=C2)C(C(C)(C)C)=O)C=C1 UGCOFPHFTHJCIV-UHFFFAOYSA-N 0.000 description 1
- QSSXJPIWXQTSIX-UHFFFAOYSA-N 1-bromo-2-methylbenzene Chemical compound CC1=CC=CC=C1Br QSSXJPIWXQTSIX-UHFFFAOYSA-N 0.000 description 1
- ACHHQIQPZANFPH-UHFFFAOYSA-N 2,2-dimethyl-1-[4-(phenoxymethyl)phenyl]butan-1-one Chemical compound C1=CC(C(=O)C(C)(C)CC)=CC=C1COC1=CC=CC=C1 ACHHQIQPZANFPH-UHFFFAOYSA-N 0.000 description 1
- BGCXNRJDPOLQGU-UHFFFAOYSA-N 2,2-dimethyl-1-[4-(phenylmethoxymethyl)phenyl]propan-1-one Chemical compound C1=CC(C(=O)C(C)(C)C)=CC=C1COCC1=CC=CC=C1 BGCXNRJDPOLQGU-UHFFFAOYSA-N 0.000 description 1
- JVSFQJZRHXAUGT-UHFFFAOYSA-N 2,2-dimethylpropanoyl chloride Chemical compound CC(C)(C)C(Cl)=O JVSFQJZRHXAUGT-UHFFFAOYSA-N 0.000 description 1
- WDRFYIPWHMGQPN-UHFFFAOYSA-N 2-chloroisoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(Cl)C(=O)C2=C1 WDRFYIPWHMGQPN-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241000700157 Rattus norvegicus Species 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 239000003524 antilipemic agent Substances 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- HSPSCWZIJWKZKD-UHFFFAOYSA-N n-chloroacetamide Chemical compound CC(=O)NCl HSPSCWZIJWKZKD-UHFFFAOYSA-N 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 150000001451 organic peroxides Chemical class 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000008024 pharmaceutical diluent Substances 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- RPDAUEIUDPHABB-UHFFFAOYSA-N potassium ethoxide Chemical compound [K+].CC[O-] RPDAUEIUDPHABB-UHFFFAOYSA-N 0.000 description 1
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 1
- 229910000105 potassium hydride Inorganic materials 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000003822 preparative gas chromatography Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- UFTFJSFQGQCHQW-UHFFFAOYSA-N triformin Chemical compound O=COCC(OC=O)COC=O UFTFJSFQGQCHQW-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/76—Ketones containing a keto group bound to a six-membered aromatic ring
- C07C49/84—Ketones containing a keto group bound to a six-membered aromatic ring containing ether groups, groups, groups, or groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/004—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reaction with organometalhalides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/63—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by introduction of halogen; by substitution of halogen atoms by other halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/70—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form
- C07C45/71—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form being hydroxy groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US42254073A | 1973-12-06 | 1973-12-06 | |
| US495863A US3919323A (en) | 1974-08-08 | 1974-08-08 | Acyl substituted dibenzylethers |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2455858A1 true DE2455858A1 (de) | 1975-06-12 |
Family
ID=27025650
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742455858 Pending DE2455858A1 (de) | 1973-12-06 | 1974-11-26 | Neue acyl-substituierte benzyl- und dibenzylaether und verfahren zu deren herstellung |
Country Status (12)
| Country | Link |
|---|---|
| JP (1) | JPS5088038A (enExample) |
| AU (1) | AU7608074A (enExample) |
| DD (1) | DD114944A5 (enExample) |
| DE (1) | DE2455858A1 (enExample) |
| DK (1) | DK617174A (enExample) |
| FI (1) | FI343574A7 (enExample) |
| FR (1) | FR2253511B1 (enExample) |
| GB (1) | GB1480950A (enExample) |
| IL (1) | IL46179A0 (enExample) |
| NL (1) | NL7415683A (enExample) |
| NO (1) | NO744293L (enExample) |
| SE (1) | SE7414886L (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0174191A1 (en) * | 1984-09-04 | 1986-03-12 | Chisso Corporation | Liquid crystal compound having methyleneoxy group and composition containing same |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4778931A (en) * | 1982-12-01 | 1988-10-18 | Usv Pharmaceutical Corporation | Certain [3-(1-hydroxy hexyl-tetrahydro)naphthalenes], the corresponding naphthalenes having anti-inflammatory and anti-allergic activity |
| US4794188A (en) * | 1982-12-01 | 1988-12-27 | Usv Pharmaceutical Corporation | Certain unsymmetrical quinolinyl ethers having anti-inflammatory and anti-allergic activity |
| IE56702B1 (en) * | 1982-12-01 | 1991-11-06 | Usv Pharma Corp | Antiinflammatory antiallergic compounds |
| DE3617183A1 (de) * | 1985-11-16 | 1987-05-27 | Bayer Ag | Substituierte benzylether |
-
1974
- 1974-11-26 DE DE19742455858 patent/DE2455858A1/de active Pending
- 1974-11-27 FI FI3435/74A patent/FI343574A7/fi unknown
- 1974-11-27 SE SE7414886A patent/SE7414886L/xx not_active Application Discontinuation
- 1974-11-27 DK DK617174A patent/DK617174A/da unknown
- 1974-11-28 NO NO744293A patent/NO744293L/no unknown
- 1974-11-28 FR FR7438964A patent/FR2253511B1/fr not_active Expired
- 1974-12-02 NL NL7415683A patent/NL7415683A/xx unknown
- 1974-12-04 DD DD182777A patent/DD114944A5/xx unknown
- 1974-12-04 GB GB52399/74A patent/GB1480950A/en not_active Expired
- 1974-12-04 AU AU76080/74A patent/AU7608074A/en not_active Expired
- 1974-12-04 JP JP49138552A patent/JPS5088038A/ja active Pending
- 1974-12-04 IL IL46179A patent/IL46179A0/xx unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0174191A1 (en) * | 1984-09-04 | 1986-03-12 | Chisso Corporation | Liquid crystal compound having methyleneoxy group and composition containing same |
Also Published As
| Publication number | Publication date |
|---|---|
| AU7608074A (en) | 1976-06-10 |
| DD114944A5 (enExample) | 1975-09-05 |
| FR2253511A1 (enExample) | 1975-07-04 |
| NO744293L (enExample) | 1975-06-30 |
| NL7415683A (nl) | 1975-06-10 |
| GB1480950A (en) | 1977-07-27 |
| FR2253511B1 (enExample) | 1978-07-21 |
| DK617174A (enExample) | 1975-08-11 |
| FI343574A7 (enExample) | 1975-06-07 |
| IL46179A0 (en) | 1975-08-31 |
| JPS5088038A (enExample) | 1975-07-15 |
| SE7414886L (enExample) | 1975-06-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1568042A1 (de) | Verfahren zur Herstellung von fluorierten AEthern | |
| DE1197468B (de) | Verfahren zur Herstellung von Bromderivaten des Diphenyls, Diphenylaethers oder Di-,Tri- bzw. Tetraphenylmethans mit 4 und mehr Bromatomen je Molekuel | |
| DE1668429A1 (de) | Verfahren zur Fluoralkylierung nucleophiler Verbindungen | |
| DE3010195A1 (de) | Verfahren zur herstellung von 2,5-bis(2,2,2-trifluoraethoxy)-n- (2-piperidylmethyl)benzamid | |
| DE2455858A1 (de) | Neue acyl-substituierte benzyl- und dibenzylaether und verfahren zu deren herstellung | |
| AT356097B (de) | Verfahren zur herstellung von neuen dibenzo- furanderivaten und von deren salzen | |
| EP0158138B1 (de) | 1-Alkylsubstituierte 1,4-Dihydropyridinlactone, Verfahren zu ihrer Herstellung und ihre Verwendung in Arzneimitteln | |
| DE2406881A1 (de) | Neue carbonsaeure-derivate und verfahren zu deren herstellung | |
| EP1223158B1 (de) | Verfahren zur Herstellung trifluormethyl-substituierter Biphenylcarbonsäuren und neue trichlormethyl- und trifluormethyl-substituierte Biphenylcarbonitrile | |
| EP1427700A1 (de) | Verfahren zur herstellung von 3-brommethylbenzoesäuren | |
| DE2929760A1 (de) | 2-acyl-6-aminomethylphenolderivate, verfahren zu ihrer herstellung und sie enthaltende derivate | |
| EP0111329B1 (de) | Fluormethylchinolin-Derivate und ihre Herstellung | |
| EP0317883B1 (de) | Teilfluorierte Diphenylether, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE1668968A1 (de) | Neue organische Verbindungen | |
| DE3236096A1 (de) | In der 7- oder 8-stellung chlor- oder trifluormethylsubstituierte n-(chinol-4-yl)-anthranilsaeureester, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE2514960A1 (de) | Neue substituierte imimodimethylen- ditert.-alkylphenone und verfahren zu deren herstellung | |
| EP0075698B1 (de) | Verfahren zur Herstellung von 10,11-Dihydro-5H-dibenzo (a,d) cyclohepten-5-on und dessen Substitutionsprodukten | |
| WO2005042545A2 (de) | Halogenierte koordinationsverbindungen, deren darstellung und verwendung | |
| DE2341044A1 (de) | Neue substituierte pivaloylphenylderivate und verfahren zu deren herstellung | |
| DE868296C (de) | Verfahren zur Herstellung von Aryl-trichlor-aethanolen | |
| DE3813453C2 (enExample) | ||
| DE1695731A1 (de) | Neue organische Verbindungen | |
| DE2332081C2 (de) | Verfahren zur Herstellung von 5-Cycloalkyl-6-halogen-indan-1-carbonsäuren | |
| AT247847B (de) | Verfahren zur Herstellung von neuen 5-(3'-Aminopropyliden)-5H-dibenzo [a, d] cycloheptenen bzw. den 10, 11-Dihydroderivaten derselben | |
| AT349002B (de) | Verfahren zur herstellung von 5-fluor-2- methylind-1- oder -2-en-3-essigsaeure |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHJ | Non-payment of the annual fee |