DE2444584C3 - Thermoplastische Polyesterformmassen - Google Patents
Thermoplastische PolyesterformmassenInfo
- Publication number
- DE2444584C3 DE2444584C3 DE2444584A DE2444584A DE2444584C3 DE 2444584 C3 DE2444584 C3 DE 2444584C3 DE 2444584 A DE2444584 A DE 2444584A DE 2444584 A DE2444584 A DE 2444584A DE 2444584 C3 DE2444584 C3 DE 2444584C3
- Authority
- DE
- Germany
- Prior art keywords
- weight
- percent
- graft
- parts
- vinyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920000728 polyester Polymers 0.000 title claims description 27
- 238000000465 moulding Methods 0.000 title claims description 16
- 150000001875 compounds Chemical class 0.000 title claims description 8
- 229920001169 thermoplastic Polymers 0.000 title claims 2
- 239000004416 thermosoftening plastic Substances 0.000 title claims 2
- -1 aliphatic dicarboxylic acids Chemical class 0.000 claims description 34
- 229920000578 graft copolymer Polymers 0.000 claims description 29
- 239000000654 additive Substances 0.000 claims description 6
- 229920006395 saturated elastomer Polymers 0.000 claims description 6
- 229920001971 elastomer Polymers 0.000 claims description 4
- 239000005060 rubber Substances 0.000 claims description 4
- 125000001931 aliphatic group Chemical group 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 125000005442 diisocyanate group Chemical group 0.000 claims description 3
- 239000000945 filler Substances 0.000 claims description 3
- 229920002959 polymer blend Polymers 0.000 claims description 3
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 claims description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 2
- 239000006057 Non-nutritive feed additive Substances 0.000 claims description 2
- 239000002216 antistatic agent Substances 0.000 claims description 2
- 150000002009 diols Chemical class 0.000 claims description 2
- 239000003063 flame retardant Substances 0.000 claims description 2
- 239000000314 lubricant Substances 0.000 claims description 2
- 239000003381 stabilizer Substances 0.000 claims description 2
- 238000004040 coloring Methods 0.000 claims 1
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 17
- 239000000203 mixture Substances 0.000 description 14
- 239000000178 monomer Substances 0.000 description 13
- 229920001577 copolymer Polymers 0.000 description 12
- 229920001707 polybutylene terephthalate Polymers 0.000 description 10
- 238000001746 injection moulding Methods 0.000 description 9
- 239000000835 fiber Substances 0.000 description 8
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 6
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 6
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 6
- 229920002554 vinyl polymer Polymers 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 5
- 230000009477 glass transition Effects 0.000 description 5
- 125000005397 methacrylic acid ester group Chemical group 0.000 description 5
- 229920003023 plastic Polymers 0.000 description 5
- 239000004033 plastic Substances 0.000 description 5
- 229920001567 vinyl ester resin Polymers 0.000 description 5
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 5
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 4
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 4
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical class C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 description 4
- 239000002318 adhesion promoter Substances 0.000 description 4
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 4
- 239000003365 glass fiber Substances 0.000 description 4
- 229920000642 polymer Polymers 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- GYCMBHHDWRMZGG-UHFFFAOYSA-N Methylacrylonitrile Chemical compound CC(=C)C#N GYCMBHHDWRMZGG-UHFFFAOYSA-N 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 238000001125 extrusion Methods 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000002667 nucleating agent Substances 0.000 description 3
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 239000005062 Polybutadiene Substances 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 description 2
- QXJJQWWVWRCVQT-UHFFFAOYSA-K calcium;sodium;phosphate Chemical compound [Na+].[Ca+2].[O-]P([O-])([O-])=O QXJJQWWVWRCVQT-UHFFFAOYSA-K 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 229920002857 polybutadiene Polymers 0.000 description 2
- 229920000139 polyethylene terephthalate Polymers 0.000 description 2
- 239000005020 polyethylene terephthalate Substances 0.000 description 2
- 239000012763 reinforcing filler Substances 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- UPMLOUAZCHDJJD-UHFFFAOYSA-N 4,4'-Diphenylmethane Diisocyanate Chemical compound C1=CC(N=C=O)=CC=C1CC1=CC=C(N=C=O)C=C1 UPMLOUAZCHDJJD-UHFFFAOYSA-N 0.000 description 1
- 229920000049 Carbon (fiber) Polymers 0.000 description 1
- 239000004641 Diallyl-phthalate Substances 0.000 description 1
- 239000004908 Emulsion polymer Substances 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 229920002367 Polyisobutene Polymers 0.000 description 1
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 125000005396 acrylic acid ester group Chemical group 0.000 description 1
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid group Chemical group C(CCCCC(=O)O)(=O)O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 229910000410 antimony oxide Inorganic materials 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- QUDWYFHPNIMBFC-UHFFFAOYSA-N bis(prop-2-enyl) benzene-1,2-dicarboxylate Chemical compound C=CCOC(=O)C1=CC=CC=C1C(=O)OCC=C QUDWYFHPNIMBFC-UHFFFAOYSA-N 0.000 description 1
- 229920001400 block copolymer Polymers 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000004917 carbon fiber Substances 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000004069 differentiation Effects 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000007720 emulsion polymerization reaction Methods 0.000 description 1
- HQQADJVZYDDRJT-UHFFFAOYSA-N ethene;prop-1-ene Chemical group C=C.CC=C HQQADJVZYDDRJT-UHFFFAOYSA-N 0.000 description 1
- BLCTWBJQROOONQ-UHFFFAOYSA-N ethenyl prop-2-enoate Chemical compound C=COC(=O)C=C BLCTWBJQROOONQ-UHFFFAOYSA-N 0.000 description 1
- LDLDYFCCDKENPD-UHFFFAOYSA-N ethenylcyclohexane Chemical compound C=CC1CCCCC1 LDLDYFCCDKENPD-UHFFFAOYSA-N 0.000 description 1
- 239000012765 fibrous filler Substances 0.000 description 1
- 239000002657 fibrous material Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000005337 ground glass Substances 0.000 description 1
- 239000010440 gypsum Substances 0.000 description 1
- 229910052602 gypsum Inorganic materials 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- XXMIOPMDWAUFGU-UHFFFAOYSA-N hexane-1,6-diol Chemical compound OCCCCCCO XXMIOPMDWAUFGU-UHFFFAOYSA-N 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N iron oxide Inorganic materials [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 1
- 235000013980 iron oxide Nutrition 0.000 description 1
- VBMVTYDPPZVILR-UHFFFAOYSA-N iron(2+);oxygen(2-) Chemical class [O-2].[Fe+2] VBMVTYDPPZVILR-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 description 1
- 229910017464 nitrogen compound Inorganic materials 0.000 description 1
- 150000002830 nitrogen compounds Chemical class 0.000 description 1
- ANISOHQJBAQUQP-UHFFFAOYSA-N octyl prop-2-enoate Chemical compound CCCCCCCCOC(=O)C=C ANISOHQJBAQUQP-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical class [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 150000003018 phosphorus compounds Chemical class 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 238000006068 polycondensation reaction Methods 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001195 polyisoprene Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 230000002787 reinforcement Effects 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229910000077 silane Inorganic materials 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 238000004513 sizing Methods 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 150000003504 terephthalic acids Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L67/00—Compositions of polyesters obtained by reactions forming a carboxylic ester link in the main chain; Compositions of derivatives of such polymers
- C08L67/02—Polyesters derived from dicarboxylic acids and dihydroxy compounds
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K3/00—Use of inorganic substances as compounding ingredients
- C08K3/18—Oxygen-containing compounds, e.g. metal carbonyls
- C08K3/24—Acids; Salts thereof
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K3/00—Use of inorganic substances as compounding ingredients
- C08K3/40—Glass
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L19/00—Compositions of rubbers not provided for in groups C08L7/00 - C08L17/00
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Priority Applications (9)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2444584A DE2444584C3 (de) | 1974-09-18 | 1974-09-18 | Thermoplastische Polyesterformmassen |
| US05/610,651 US4022748A (en) | 1974-09-18 | 1975-09-05 | Thermoplastic polyester molding compositions |
| BE159934A BE833295A (fr) | 1974-09-18 | 1975-09-11 | Matieres a mouler thermoplastiques, a base de polyesters, presentant une resistance au choc amelioree |
| SE7510420A SE414783B (sv) | 1974-09-18 | 1975-09-17 | Termoplastisk polyesterformmassa innehallande en gummielastisk ympsampolymer |
| GB38173/75A GB1511370A (en) | 1974-09-18 | 1975-09-17 | Thermoplastic polyester moulding compositions |
| FR7528476A FR2285435A1 (fr) | 1974-09-18 | 1975-09-17 | Matieres a mouler thermoplastiques, a base de polyesters, presentant une resistance au choc amelioree |
| IT51379/75A IT1047542B (it) | 1974-09-18 | 1975-09-17 | Masse sagomabili termoplastiche di poliestere |
| NL7510939A NL7510939A (nl) | 1974-09-18 | 1975-09-17 | Werkwijze voor het bereiden van thermoplastische polyestervormmassa's alsmede gevormd voortbreng- sel, geheel of ten dele bestaande uit aldus ver- kregen polyestervormmassa's. |
| JP50112196A JPS5818942B2 (ja) | 1974-09-18 | 1975-09-18 | ネツカソセイノ ポリエステルセイケイザイリヨウ |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2444584A DE2444584C3 (de) | 1974-09-18 | 1974-09-18 | Thermoplastische Polyesterformmassen |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2444584A1 DE2444584A1 (de) | 1976-04-01 |
| DE2444584B2 DE2444584B2 (de) | 1980-04-03 |
| DE2444584C3 true DE2444584C3 (de) | 1982-01-21 |
Family
ID=5926090
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2444584A Expired DE2444584C3 (de) | 1974-09-18 | 1974-09-18 | Thermoplastische Polyesterformmassen |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4022748A (https=) |
| JP (1) | JPS5818942B2 (https=) |
| BE (1) | BE833295A (https=) |
| DE (1) | DE2444584C3 (https=) |
| FR (1) | FR2285435A1 (https=) |
| GB (1) | GB1511370A (https=) |
| IT (1) | IT1047542B (https=) |
| NL (1) | NL7510939A (https=) |
| SE (1) | SE414783B (https=) |
Families Citing this family (78)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4096202A (en) * | 1976-06-09 | 1978-06-20 | Rohm And Haas Company | Impact modified poly(alkylene terephthalates) |
| DE2659338A1 (de) * | 1976-12-29 | 1978-07-13 | Basf Ag | Thermoplastische polyesterformmassen mit erhoehter waermeformbestaendigkeit |
| CH626388A5 (https=) * | 1976-12-31 | 1981-11-13 | Alkor Gmbh | |
| JPS53121843A (en) * | 1977-04-01 | 1978-10-24 | Polyplastics Kk | Thermoplastic resin mold composition |
| GB1603205A (en) * | 1977-04-12 | 1981-11-18 | Raychem Ltd | Polymer compositions |
| JPS53137251A (en) * | 1977-05-04 | 1978-11-30 | Mitsubishi Rayon Co Ltd | Reinforced resin composition having improved moldability |
| US4111893A (en) * | 1977-05-20 | 1978-09-05 | Gaf Corporation | Polybutylene terephthalate molding resin |
| US4157325A (en) * | 1977-07-11 | 1979-06-05 | Gaf Corporation | PBT molding compositions |
| US4168259A (en) * | 1977-07-11 | 1979-09-18 | Gaf Corporation | Glass reinforced PBT resins |
| US4244859A (en) * | 1977-11-15 | 1981-01-13 | Teijin Limited | Aromatic polyester composition |
| JPS5536248A (en) * | 1978-09-08 | 1980-03-13 | Teijin Ltd | Resin composition |
| JPS5536249A (en) * | 1978-09-08 | 1980-03-13 | Teijin Ltd | Resin composition |
| US4257937A (en) * | 1978-11-06 | 1981-03-24 | General Electric Company | Modified polyester compositions |
| US4220735A (en) * | 1978-12-18 | 1980-09-02 | General Electric Company | Modified polyester compositions |
| US4271063A (en) * | 1978-12-26 | 1981-06-02 | General Electric Company | Thermoplastic molding compositions |
| DE2902468A1 (de) * | 1979-01-23 | 1980-07-31 | Bayer Ag | Thermoplastische polyesterformmassen mit hoher zaehigkeit |
| US4280948A (en) * | 1979-02-02 | 1981-07-28 | General Electric Company | Modified polyester compositions |
| US4280949A (en) * | 1979-02-12 | 1981-07-28 | General Electric Company | Modified polyester compositions containing mineral filler |
| GB2045775B (en) * | 1979-04-02 | 1983-06-15 | Gen Electric | Polyester compositions containing acrylic ester resin modifiers |
| US4231922A (en) * | 1979-06-18 | 1980-11-04 | Union Carbide Corporation | Impact modified polyarylate blends |
| US4267286A (en) * | 1979-07-03 | 1981-05-12 | General Electric Company | Modified polyester compositions |
| US4369282A (en) * | 1979-07-03 | 1983-01-18 | General Electric Company | Modified polyester compositions |
| DE2927576A1 (de) * | 1979-07-07 | 1981-01-15 | Bayer Ag | Hochschlagzaehes polybutylenterephthalat |
| JPS5616548A (en) * | 1979-07-23 | 1981-02-17 | Teijin Ltd | External trim part |
| US4304709A (en) * | 1979-11-01 | 1981-12-08 | Hooker Chemicals & Plastics Corp. | Polymer blends with improved hydrolytic stability |
| CA1166781A (en) * | 1979-11-19 | 1984-05-01 | Peter Bier | Process for injection molding a rapidly crystallizing polyethylene terephthalate composition at reduced mold temperatures |
| US4404161A (en) * | 1979-11-19 | 1983-09-13 | Bayer Aktiengesellschaft | Process for injection molding a rapidly crystallizing polyethylene terephthalate composition at reduced mold temperatures |
| US4254011A (en) * | 1979-11-19 | 1981-03-03 | Bayer Aktiengesellschaft | Flame retarded polyethylene terephthalate compositions with improved drip suppression |
| DE3039115A1 (de) * | 1980-10-16 | 1982-05-13 | Bayer Ag, 5090 Leverkusen | Thermoplastische polyester-formmassen mit verbesserter zaehigkeit |
| JPS5790040A (en) * | 1980-11-25 | 1982-06-04 | Mitsubishi Chem Ind Ltd | Thermoplastic polyester resin composition |
| EP0056123B2 (de) * | 1981-01-09 | 1988-03-16 | BASF Aktiengesellschaft | Verfahren zur Herstellung von thermoplastischen Formmassen |
| JPS57137343A (en) * | 1981-02-18 | 1982-08-24 | Mitsubishi Chem Ind Ltd | Flame-retardant thermoplastic resin composition |
| JPS57137347A (en) * | 1981-02-18 | 1982-08-24 | Mitsubishi Chem Ind Ltd | Thermoplastic resin composition |
| DE3117052A1 (de) * | 1981-04-29 | 1982-11-18 | Bayer Ag, 5090 Leverkusen | "alterungsbestaendige, verarbeitungsstabile mischungen hoher zaehigkeit auf basis thermoplastischer polyester" |
| DE3118526A1 (de) * | 1981-05-09 | 1982-12-02 | Bayer Ag, 5090 Leverkusen | "thermoplastische formmassen aus polycarbonat, polyalkylenterephthalat und pfropfpolymerisat" |
| US4373067A (en) * | 1981-08-04 | 1983-02-08 | General Electric Company | Molded articles of improved impact resistance and compositions therefor |
| US4525529A (en) * | 1981-09-17 | 1985-06-25 | Mitsubishi Chemical Industries Limited | Polyester resin composition |
| CA1196437A (en) * | 1981-12-19 | 1985-11-05 | Kazushi Hirobe | Flame resistant resin composition |
| US4397986A (en) * | 1982-03-03 | 1983-08-09 | Ethyl Corporation | Thermoplastic polyester blends |
| US4401792A (en) * | 1982-03-16 | 1983-08-30 | General Electric Company | Process for increasing the rate of crystallization of polyesters |
| DE3248492A1 (de) * | 1982-12-29 | 1984-07-05 | Hoechst Ag, 6230 Frankfurt | Farbmittelpraeparation |
| US4485212A (en) * | 1983-05-27 | 1984-11-27 | Uniroyal, Inc. | Impact resistant blend of polybutylene terephthalate resin and OSA graft copolymer |
| US4891406A (en) * | 1983-08-08 | 1990-01-02 | Huels Aktiengesellschaft | High impact strength molding compositions based on polyalkylene terephthalates |
| JPS61501270A (ja) * | 1984-02-24 | 1986-06-26 | イ−・アイ・デユポン・デ・ニモアス・アンド・カンパニ− | 強化熱可塑性ポリエステル組成物 |
| US4745148A (en) * | 1984-04-13 | 1988-05-17 | Mobay Corporation | Thermoplastic polyester molding composition having an improved impact performance |
| DE3422862A1 (de) * | 1984-06-20 | 1986-01-02 | Bayer Ag, 5090 Leverkusen | Thermoplastische formmassen auf basis von polyalkylenterephthalat und polymerisat sowie verfahren zu ihrer herstellung |
| US4844851A (en) * | 1984-08-28 | 1989-07-04 | Polyplastics Co., Ltd. | Surface metallizing method |
| US4554315A (en) * | 1984-09-17 | 1985-11-19 | Mobay Chemical Corporation | Thermoplastic resinous blend and a method for its preparation |
| US4551507A (en) * | 1984-12-17 | 1985-11-05 | Allied Corporation | Polyester composition containing tertiary and quaternary amine carboxylate salts |
| DE3446225A1 (de) * | 1984-12-19 | 1986-06-19 | Basf Ag, 6700 Ludwigshafen | Schlagzaehe, thermoplastische polyesterformmassen |
| US4702857A (en) * | 1984-12-21 | 1987-10-27 | The Procter & Gamble Company | Block polyesters and like compounds useful as soil release agents in detergent compositions |
| US4673708A (en) * | 1984-12-28 | 1987-06-16 | General Electric Company | Impact modified polyetherimide-polycarbonate blends |
| EP0187176B1 (en) * | 1985-01-08 | 1991-03-20 | Toray Industries, Inc. | Metal-plated molding |
| US4659767A (en) * | 1985-01-10 | 1987-04-21 | Allied Corporation | Impact modified polyester blends |
| JPS61174253A (ja) * | 1985-01-30 | 1986-08-05 | Polyplastics Co | ポリブチレンテレフタレ−ト組成物 |
| US4607075A (en) * | 1986-01-06 | 1986-08-19 | Gaf Corporation | Polyester compostions |
| US4902748A (en) * | 1986-03-10 | 1990-02-20 | Montedison, S.P.A. | Polymeric blends based on vinyl-aromatic polymers |
| JPS633055A (ja) * | 1986-06-24 | 1988-01-08 | Mitsubishi Chem Ind Ltd | インサ−ト成形品 |
| DE3733838A1 (de) * | 1987-10-07 | 1989-04-20 | Basf Ag | Glasfaserverstaerkte thermoplastische formmassen auf der basis von poyestern und pfropfpolymerisaten |
| DE3804392A1 (de) * | 1988-02-12 | 1989-08-24 | Basf Ag | Fuellstoffhaltige polyamid-formmassen mit verbesserter oberflaeche und lackierbarkeit |
| US5214088A (en) * | 1989-10-20 | 1993-05-25 | General Electric Company | Highly dense thermoplastic molding compositions |
| CA2050612A1 (en) * | 1990-09-21 | 1992-03-22 | Keith Gannon | Addition of additives to polymeric materials |
| US5236645A (en) * | 1990-09-21 | 1993-08-17 | Basf Corporation | Addition of additives to polymeric materials |
| JP2924221B2 (ja) * | 1991-03-05 | 1999-07-26 | 日本精工株式会社 | 樹脂巻軸受用樹脂組成物 |
| US6077904A (en) * | 1992-02-03 | 2000-06-20 | Lawson Mardon Thermaplate Corporation | Elevated temperature dimensionally stable, impact modified polyester with low gas permeability |
| IT1264976B1 (it) * | 1993-11-17 | 1996-10-17 | Leopoldo Michelotti | Manufatto a forma di lastra sagomata a base di polietilene tereftalato e procedimento per produrlo |
| US5849846A (en) * | 1994-07-25 | 1998-12-15 | Advanced Cardiovascular Systems, Inc. | Balloons for medical catheters |
| US5554120A (en) * | 1994-07-25 | 1996-09-10 | Advanced Cardiovascular Systems, Inc. | Polymer blends for use in making medical devices including catheters and balloons for dilatation catheters |
| DE19750627A1 (de) * | 1997-11-14 | 1999-05-20 | Basf Ag | Schlagzäh modifizierte Polyester/Polycarbonat-Blends |
| US6291574B1 (en) | 1999-08-27 | 2001-09-18 | General Electric Company | Polyester molded articles |
| US6630527B2 (en) | 2001-10-19 | 2003-10-07 | General Electric Company | UV stabilized, impact modified polyester/polycarbonate blends, articles, and methods of manufacture thereof |
| CA2877263C (en) * | 2003-11-14 | 2016-08-16 | Tundra Composites, LLC | Metal polymer composite, a method for its extrusion and shaped articles made therefrom |
| US9105382B2 (en) | 2003-11-14 | 2015-08-11 | Tundra Composites, LLC | Magnetic composite |
| US8841358B2 (en) | 2009-04-29 | 2014-09-23 | Tundra Composites, LLC | Ceramic composite |
| BRPI0906886A2 (pt) * | 2008-01-18 | 2015-07-07 | Wild River Consulting Group Llc | Composto polimérico de moldagem em fusão e método de produção e utilização do mesmo |
| JP5919468B2 (ja) * | 2011-07-15 | 2016-05-18 | パナソニックＩｐマネジメント株式会社 | 回転電動機およびその製造方法 |
| US9434839B2 (en) * | 2011-09-30 | 2016-09-06 | Wintech Polymer Ltd. | Polybutylene terephthalate resin composition and welded body |
| CN109627710A (zh) * | 2018-12-26 | 2019-04-16 | 天津金发新材料有限公司 | 一种抗静电、抗菌pbt/asa材料、制备方法及其应用 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL125933C (https=) * | 1963-03-09 | |||
| DE1260135B (de) * | 1965-01-05 | 1968-02-01 | Basf Ag | Schlagfeste thermoplastische Formmassen |
| FR2092389A5 (https=) * | 1970-04-13 | 1972-01-21 | Rohm & Haas | |
| JPS5214267B2 (https=) * | 1971-12-21 | 1977-04-20 | ||
| IT963692B (it) * | 1972-08-03 | 1974-01-21 | Montedison Spa | Poliesteri antiurto |
| DE2239193A1 (de) * | 1972-08-09 | 1974-02-21 | Peter Mueller | Haftstrukturbelag aus mit klebemitteln befestigten haftorganen |
| US3969306A (en) * | 1972-11-20 | 1976-07-13 | General Electric Company | Stabilized polyester compositions |
| FR2207162A1 (en) * | 1972-11-20 | 1974-06-14 | Eastman Kodak Co | Polyester moulding materials with increased toughness - from 1,4-butane diol and terephthalic acid, with alkyl (meth) acrylate (co) polymers |
| JPS5125261B2 (https=) * | 1972-12-21 | 1976-07-29 |
-
1974
- 1974-09-18 DE DE2444584A patent/DE2444584C3/de not_active Expired
-
1975
- 1975-09-05 US US05/610,651 patent/US4022748A/en not_active Expired - Lifetime
- 1975-09-11 BE BE159934A patent/BE833295A/xx not_active IP Right Cessation
- 1975-09-17 SE SE7510420A patent/SE414783B/xx not_active IP Right Cessation
- 1975-09-17 FR FR7528476A patent/FR2285435A1/fr active Granted
- 1975-09-17 GB GB38173/75A patent/GB1511370A/en not_active Expired
- 1975-09-17 NL NL7510939A patent/NL7510939A/xx not_active Application Discontinuation
- 1975-09-17 IT IT51379/75A patent/IT1047542B/it active
- 1975-09-18 JP JP50112196A patent/JPS5818942B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2285435A1 (fr) | 1976-04-16 |
| JPS5156856A (en) | 1976-05-18 |
| DE2444584A1 (de) | 1976-04-01 |
| IT1047542B (it) | 1980-10-20 |
| GB1511370A (en) | 1978-05-17 |
| NL7510939A (nl) | 1976-03-22 |
| SE7510420L (sv) | 1976-03-19 |
| US4022748A (en) | 1977-05-10 |
| FR2285435B1 (https=) | 1981-08-07 |
| DE2444584B2 (de) | 1980-04-03 |
| BE833295A (fr) | 1976-03-11 |
| JPS5818942B2 (ja) | 1983-04-15 |
| SE414783B (sv) | 1980-08-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2444584C3 (de) | Thermoplastische Polyesterformmassen | |
| DE2454770C2 (de) | Thermoplastische Formmassen mit erhöhter Schlagzähigkeit | |
| DE3687303T2 (de) | Thermoplastische polymerzusammensetzung. | |
| DE1964156C3 (de) | Thermoplastische Formmassen hoher Schlagzähigkeit | |
| DE2552804C2 (de) | Polyamidharzmasse | |
| EP0021303B1 (de) | Mit Fasern verstärkte Polyamid-Formmassen | |
| EP0001241A1 (de) | Schlagzähe Polyamidmasse und deren Verwendung in Formkörpern | |
| DE1104694B (de) | Verfahren zur Herstellung von thermoplastischen Massen | |
| DE2612011A1 (de) | Verfahren zur herstellung von schlagzaehen thermoplastischen formmassen | |
| CH630657A5 (de) | Hochschlagzaehe thermoplastische formmasse. | |
| DE69517610T2 (de) | Reformierte Polypropylen-Harzzusammensetzung und Verfahren zu ihrer Herstellung | |
| DE3625950A1 (de) | Glasfaser-verstaerkte harzzusammensetzung auf propylen/ethylen-copolymer-basis | |
| DE4119146C2 (de) | Polymer-Mischungen Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE69004821T2 (de) | Polyamidharz-Zusammensetzung. | |
| DE2646508A1 (de) | Schlagfeste polystyrole und verfahren zu dessen herstellung | |
| DE1033890B (de) | Verwendung von Fuellstoff in Polyurethanelastomeren | |
| DE69411349T2 (de) | Thermoplastische Zusammensetzungen auf Basis von Nylon und Polyacrylkautschuk | |
| EP0275518B1 (de) | Thermoplastische Formmassen auf der Basis von Polyamiden und Ethylencopolymerisaten | |
| DE1221009B (de) | Thermoplastisch verarbeitbare Formmasse | |
| DE2654168C2 (de) | Polyamidlegierungen | |
| DE1669702B2 (de) | Verfahren zur herstellung von schlagzaehen thermoplastischen polyamid-formmassen | |
| DE1908468B2 (de) | Homogene spritzfaehige mischungen von polyamiden und polyolefinen | |
| DE2335734B2 (de) | Schlagfeste Formmassen auf der Basis von Polyvinylchlorid | |
| DE3516089A1 (de) | Mit monoisocyanaten modifizierte polyamide | |
| DE2359719A1 (de) | Polymergemisch und verfahren zur verbesserung der eigenschaften eines ein nicht-gepfropftes, kristallisierbares polymerisat enthaltenden polymergemisches |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| AG | Has addition no. |
Ref country code: DE Ref document number: 2659338 Format of ref document f/p: P |
|
| C3 | Grant after two publication steps (3rd publication) |