DE2431072C3 - Thermoplastische Copolyester und Verfahren zu ihrer Herstellung - Google Patents
Thermoplastische Copolyester und Verfahren zu ihrer HerstellungInfo
- Publication number
- DE2431072C3 DE2431072C3 DE2431072A DE2431072A DE2431072C3 DE 2431072 C3 DE2431072 C3 DE 2431072C3 DE 2431072 A DE2431072 A DE 2431072A DE 2431072 A DE2431072 A DE 2431072A DE 2431072 C3 DE2431072 C3 DE 2431072C3
- Authority
- DE
- Germany
- Prior art keywords
- mol
- propanediol
- dicarboxylic acid
- butanediol
- diol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 7
- 238000004519 manufacturing process Methods 0.000 title description 2
- 229920006344 thermoplastic copolyester Polymers 0.000 title 1
- 229920001634 Copolyester Polymers 0.000 claims description 12
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 claims description 10
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 claims description 10
- -1 dicarboxylic acid diol esters Chemical class 0.000 claims description 9
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 claims description 7
- 150000002009 diols Chemical class 0.000 claims description 7
- 239000007790 solid phase Substances 0.000 claims description 7
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 6
- 229920000728 polyester Polymers 0.000 claims description 6
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 5
- 238000009833 condensation Methods 0.000 claims description 5
- 238000002844 melting Methods 0.000 claims description 5
- 230000008018 melting Effects 0.000 claims description 5
- DNIAPMSPPWPWGF-VKHMYHEASA-N (+)-propylene glycol Chemical compound C[C@H](O)CO DNIAPMSPPWPWGF-VKHMYHEASA-N 0.000 claims description 3
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 claims description 3
- 229920000166 polytrimethylene carbonate Polymers 0.000 claims description 3
- 229920001169 thermoplastic Polymers 0.000 claims description 3
- 239000004416 thermosoftening plastic Substances 0.000 claims description 3
- 230000005494 condensation Effects 0.000 claims description 2
- 239000011261 inert gas Substances 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims 1
- 229920001707 polybutylene terephthalate Polymers 0.000 description 8
- 230000000052 comparative effect Effects 0.000 description 5
- 238000002474 experimental method Methods 0.000 description 5
- 238000006068 polycondensation reaction Methods 0.000 description 5
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 description 4
- VXUYXOFXAQZZMF-UHFFFAOYSA-N titanium(IV) isopropoxide Chemical compound CC(C)O[Ti](OC(C)C)(OC(C)C)OC(C)C VXUYXOFXAQZZMF-UHFFFAOYSA-N 0.000 description 4
- CDQSJQSWAWPGKG-UHFFFAOYSA-N butane-1,1-diol Chemical compound CCCC(O)O CDQSJQSWAWPGKG-UHFFFAOYSA-N 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 229940035437 1,3-propanediol Drugs 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 230000004927 fusion Effects 0.000 description 2
- 238000010348 incorporation Methods 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 238000012545 processing Methods 0.000 description 2
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 2
- 238000005809 transesterification reaction Methods 0.000 description 2
- KPZGRMZPZLOPBS-UHFFFAOYSA-N 1,3-dichloro-2,2-bis(chloromethyl)propane Chemical compound ClCC(CCl)(CCl)CCl KPZGRMZPZLOPBS-UHFFFAOYSA-N 0.000 description 1
- BIWVHGWGBMHTTP-UHFFFAOYSA-N 2-methylbutane-1,1-diol Chemical compound CCC(C)C(O)O BIWVHGWGBMHTTP-UHFFFAOYSA-N 0.000 description 1
- 229920001283 Polyalkylene terephthalate Polymers 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000004035 construction material Substances 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- QWTDNUCVQCZILF-UHFFFAOYSA-N isopentane Chemical compound CCC(C)C QWTDNUCVQCZILF-UHFFFAOYSA-N 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000004904 shortening Methods 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/02—Polyesters derived from hydroxycarboxylic acids or from polycarboxylic acids and polyhydroxy compounds
- C08G63/12—Polyesters derived from hydroxycarboxylic acids or from polycarboxylic acids and polyhydroxy compounds derived from polycarboxylic acids and polyhydroxy compounds
- C08G63/16—Dicarboxylic acids and dihydroxy compounds
- C08G63/18—Dicarboxylic acids and dihydroxy compounds the acids or hydroxy compounds containing carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/78—Preparation processes
- C08G63/80—Solid-state polycondensation
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyesters Or Polycarbonates (AREA)
Priority Applications (9)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2431072A DE2431072C3 (de) | 1974-06-28 | 1974-06-28 | Thermoplastische Copolyester und Verfahren zu ihrer Herstellung |
| US05/589,912 US4025492A (en) | 1974-06-28 | 1975-06-24 | Thermoplastic copolyesters and a process for their production |
| NL7507573A NL7507573A (nl) | 1974-06-28 | 1975-06-25 | Werkwijze voor de bereiding van een thermoplasti- sche copolyester. |
| GB26921/75A GB1507358A (en) | 1974-06-28 | 1975-06-25 | Process for producing thermoplastic copolyesters |
| IT50209/75A IT1040708B (it) | 1974-06-28 | 1975-06-25 | Copoliesteri termoplastici e procedimento per produrli |
| JP50078667A JPS5919131B2 (ja) | 1974-06-28 | 1975-06-26 | 熱可塑性コポリエステルの製造方法 |
| CA230,239A CA1051592A (en) | 1974-06-28 | 1975-06-26 | Thermoplastic copolyesters and a process for their production |
| BE157695A BE830660A (fr) | 1974-06-28 | 1975-06-26 | Copolyesters thermoplastiques et leur procede de preparation |
| FR7520367A FR2276335A1 (fr) | 1974-06-28 | 1975-06-27 | Copolyesters thermoplastiques et leur procede de preparation |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2431072A DE2431072C3 (de) | 1974-06-28 | 1974-06-28 | Thermoplastische Copolyester und Verfahren zu ihrer Herstellung |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2431072A1 DE2431072A1 (de) | 1976-01-15 |
| DE2431072B2 DE2431072B2 (de) | 1979-08-23 |
| DE2431072C3 true DE2431072C3 (de) | 1980-04-30 |
Family
ID=5919182
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2431072A Expired DE2431072C3 (de) | 1974-06-28 | 1974-06-28 | Thermoplastische Copolyester und Verfahren zu ihrer Herstellung |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4025492A (en:Method) |
| JP (1) | JPS5919131B2 (en:Method) |
| BE (1) | BE830660A (en:Method) |
| CA (1) | CA1051592A (en:Method) |
| DE (1) | DE2431072C3 (en:Method) |
| FR (1) | FR2276335A1 (en:Method) |
| GB (1) | GB1507358A (en:Method) |
| IT (1) | IT1040708B (en:Method) |
| NL (1) | NL7507573A (en:Method) |
Families Citing this family (64)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2614980C2 (de) * | 1976-04-07 | 1987-05-27 | Chemische Werke Hüls AG, 4370 Marl | Verfahren zur Herstellung von gesättigten, hochmolekularen Polyestern |
| US4110187A (en) * | 1977-09-02 | 1978-08-29 | Eastman Kodak Company | Ultraviolet curable polyester binder and coating formulation |
| US4381379A (en) * | 1981-03-25 | 1983-04-26 | Daicel Chemical Industries, Ltd. | Polyester containing 2-methyl-1,3-propylene terephthalate units |
| US4396746A (en) * | 1981-04-16 | 1983-08-02 | Daicel Chemical Industries, Ltd. | Thermoplastic polyester copolymer |
| DE3239413A1 (de) * | 1982-10-25 | 1984-04-26 | Chemische Werke Hüls AG, 4370 Marl | Formmassen mit hoher zaehigkeit und heisswasserbestaendigkeit |
| US4891406A (en) * | 1983-08-08 | 1990-01-02 | Huels Aktiengesellschaft | High impact strength molding compositions based on polyalkylene terephthalates |
| TW354305B (en) * | 1994-12-22 | 1999-03-11 | Eastman Chem Co | Production of particular polyesters using a novel catalyst system |
| US5962557A (en) * | 1996-09-30 | 1999-10-05 | Eastman Chemical Corporation | Polyesters containing copolymerized substituted 1,4-bis(2,6-dialkylanilino)-9, 10-anthraquinones as colorants |
| KR100359347B1 (ko) * | 1997-08-18 | 2002-10-31 | 아사히 가세이 가부시키가이샤 | 폴리에스테르 섬유 및 그것을 사용한 포백 |
| US6652964B1 (en) | 1997-08-18 | 2003-11-25 | Asahi Kasei Kabushiki Kaisha | Polyester fiber and fabric prepared therefrom |
| US6287656B1 (en) | 1999-06-03 | 2001-09-11 | Eastman Chemical Corporation | Low melt viscosity amorphous copolyesters having improved resistance to lipids |
| US6183848B1 (en) | 1999-06-03 | 2001-02-06 | Eastman Chemical Company | Low melt viscosity amorphous copolyesters with enhanced glass transition temperatures having improved gas barrier properties |
| US6120889A (en) * | 1999-06-03 | 2000-09-19 | Eastman Chemical Company | Low melt viscosity amorphous copolyesters with enhanced glass transition temperatures |
| US6384180B1 (en) | 1999-08-24 | 2002-05-07 | Eastman Chemical Company | Method for making polyesters employing acidic phosphorus-containing compounds |
| US6716898B2 (en) | 2001-05-18 | 2004-04-06 | Eastman Chemical Company | Amber polyester compositions for packaging food and beverages |
| US20030060596A1 (en) * | 2001-07-18 | 2003-03-27 | Turner Sam Richard | Amorphous copolyesters |
| US7834127B2 (en) * | 2001-07-18 | 2010-11-16 | Eastman Chemical Company | Amorphous copolyesters |
| US6713641B2 (en) * | 2001-10-19 | 2004-03-30 | Eastman Chemical Company | Reactive anthraquinone colorant compounds and polymeric materials reacted therewith |
| US6787589B2 (en) * | 2002-10-31 | 2004-09-07 | Eastman Chemical Company | Amber polyester compositions and container articles produced therefrom |
| US6914120B2 (en) * | 2002-11-13 | 2005-07-05 | Eastman Chemical Company | Method for making isosorbide containing polyesters |
| US6896966B2 (en) * | 2002-11-22 | 2005-05-24 | Eastman Chemical Company | Articles of manufacture incorporating polyester/polycarbonate blends |
| US7118799B2 (en) * | 2002-11-22 | 2006-10-10 | Eastman Chemical Company | Thermoplastic article having a decorative material embedded therein |
| US7482397B2 (en) * | 2003-01-13 | 2009-01-27 | Eastman Chemical Company | Polycarbonate compositions |
| US7297735B2 (en) * | 2003-03-05 | 2007-11-20 | Eastman Chemical Company | Polycarbonate compositions |
| US20040143041A1 (en) * | 2003-01-13 | 2004-07-22 | Pearson Jason Clay | Polyester compositions |
| US20040151854A1 (en) * | 2003-02-03 | 2004-08-05 | Pecorini Thomas Joseph | Extrusion blow molded articles |
| US20040183053A1 (en) * | 2003-03-20 | 2004-09-23 | Pearson Jason Clay | Process for the preparation of a hindered amine light stabilizer salt |
| ATE390460T1 (de) * | 2003-03-05 | 2008-04-15 | Eastman Chem Co | Polymerblends |
| BRPI0407952A (pt) * | 2003-03-05 | 2006-03-07 | Eastman Chem Co | composição polimérica |
| US20040180994A1 (en) * | 2003-03-05 | 2004-09-16 | Pearson Jason Clay | Polyolefin compositions |
| US20040192813A1 (en) * | 2003-03-20 | 2004-09-30 | Pearson Jason Clay | Polymer compositions containing an ultraviolet light absorbing compound |
| US20050277713A1 (en) * | 2003-03-05 | 2005-12-15 | Pearson Jason C | Polymer blends |
| US7338992B2 (en) * | 2003-03-05 | 2008-03-04 | Eastman Chemical Company | Polyolefin compositions |
| US20050277771A1 (en) * | 2003-03-20 | 2005-12-15 | Pearson Jason C | Process for the preparation of a hindered amine light stabilizer salt |
| US20050054757A1 (en) * | 2003-09-10 | 2005-03-10 | Pearson Jason Clay | Method for reducing the acetaldehyde level in polyesters |
| US7582690B2 (en) * | 2004-11-19 | 2009-09-01 | Eastman Chemical Company | Stabilized aliphatic polyester compositions |
| US7855267B2 (en) | 2005-06-17 | 2010-12-21 | Eastman Chemical Company | Film(s) and/or sheet(s) comprising polyester compositions which comprise cyclobutanediol and have a certain combination of inherent viscosity and moderate glass transition temperature |
| US8557950B2 (en) | 2005-06-16 | 2013-10-15 | Grupo Petrotemex, S.A. De C.V. | High intrinsic viscosity melt phase polyester polymers with acceptable acetaldehyde generation rates |
| US7655746B2 (en) | 2005-09-16 | 2010-02-02 | Eastman Chemical Company | Phosphorus containing compounds for reducing acetaldehyde in polyesters polymers |
| US20080085390A1 (en) | 2006-10-04 | 2008-04-10 | Ryan Thomas Neill | Encapsulation of electrically energized articles |
| US8287991B2 (en) * | 2006-10-04 | 2012-10-16 | Eastman Chemical Company | Using branched polymers to control the dimensional stability of articles in the lamination process |
| US20080167440A1 (en) * | 2007-01-10 | 2008-07-10 | Pickel Deanna L | Use of copolymerizable sulfonate salts to promote char formation in polyesters and copolyesters |
| US9074092B2 (en) | 2010-12-20 | 2015-07-07 | Eastman Chemical Company | Miscible polyester blends utilizing recycled polyesters |
| US9150006B2 (en) | 2011-06-23 | 2015-10-06 | Eastman Chemical Company | Lamination process optimization utilizing neopentyl glycol-modified polyesters |
| US8877862B2 (en) | 2011-07-15 | 2014-11-04 | Saudi Basic Industries Corporation | Method for color stabilization of poly(butylene-co-adipate terephthalate |
| US9334360B2 (en) | 2011-07-15 | 2016-05-10 | Sabic Global Technologies B.V. | Color-stabilized biodegradable aliphatic-aromatic copolyesters, methods of manufacture, and articles thereof |
| US8933162B2 (en) | 2011-07-15 | 2015-01-13 | Saudi Basic Industries Corporation | Color-stabilized biodegradable aliphatic-aromatic copolyesters, methods of manufacture, and articles thereof |
| US8946345B2 (en) | 2011-08-30 | 2015-02-03 | Saudi Basic Industries Corporation | Method for the preparation of (polybutylene-co-adipate terephthalate) through the in situ phosphorus containing titanium based catalyst |
| US8969506B2 (en) | 2012-02-15 | 2015-03-03 | Saudi Basic Industries Corporation | Amorphous, high glass transition temperature copolyester compositions, methods of manufacture, and articles thereof |
| US8889820B2 (en) | 2012-02-15 | 2014-11-18 | Saudi Basic Industries Corporation | Amorphous, high glass transition temperature copolyester compositions, methods of manufacture, and articles thereof |
| US8901273B2 (en) | 2012-02-15 | 2014-12-02 | Saudi Basic Industries Corporation | Amorphous, high glass transition temperature copolyester compositions, methods of manufacture, and articles thereof |
| US9034983B2 (en) | 2012-03-01 | 2015-05-19 | Saudi Basic Industries Corporation | Poly(butylene-co-adipate terephthalate), method of manufacture and uses thereof |
| US8895660B2 (en) | 2012-03-01 | 2014-11-25 | Saudi Basic Industries Corporation | Poly(butylene-co-adipate terephthalate), method of manufacture, and uses thereof |
| US8901243B2 (en) | 2012-03-30 | 2014-12-02 | Saudi Basic Industries Corporation | Biodegradable aliphatic-aromatic copolyesters, methods of manufacture, and articles thereof |
| US9517584B2 (en) | 2013-12-18 | 2016-12-13 | Eastman Chemical Company | Articles comprising isosorbide and processes for their manufacture |
| EP3394130A4 (en) | 2015-12-22 | 2019-06-26 | ExxonMobil Chemical Patents Inc. | Terephthalate CO BIBENZOATPOLYESTER |
| WO2018030443A1 (ja) | 2016-08-08 | 2018-02-15 | 旭化成株式会社 | コーティング組成物分散体、水性複合粒子分散体、及び水性複合粒子分散体の製造方法 |
| WO2018097908A1 (en) | 2016-11-23 | 2018-05-31 | Exxonmobil Chemical Patents Inc. | Diacid modified copolyesters |
| WO2018097909A1 (en) | 2016-11-23 | 2018-05-31 | Exxonmobil Chemical Patents Inc. | Bibenzoate copolyesters |
| WO2019152529A1 (en) | 2018-01-31 | 2019-08-08 | Exxonmobil Chemical Patents Inc. | Fiber reinforced terephthalate-co-4,4'-bibenzoate copolyester |
| US11926605B2 (en) | 2018-03-21 | 2024-03-12 | Exxonmobil Chemical Patents Inc. | Functionalized bifuran and synthesis thereof |
| US20250163213A1 (en) | 2022-02-16 | 2025-05-22 | Mitsubishi Gas Chemical Company, Inc. | Curable resin, cured product thereof, and resin composition |
| CN118871500A (zh) | 2022-02-16 | 2024-10-29 | 三菱瓦斯化学株式会社 | 固化性树脂、其固化物、树脂组合物和固化性树脂的制造方法 |
| JPWO2023157780A1 (en:Method) | 2022-02-16 | 2023-08-24 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA879151A (en) | 1971-08-24 | Celanese Corporation | Polyalkylene terephthalate molding resin | |
| FR1580834A (en:Method) * | 1968-01-04 | 1969-09-12 | ||
| DE2011813A1 (de) | 1969-03-12 | 1970-10-01 | Fiber Industries Inc., Charlotte, N.C. (V.St.A.) | Elastische gekräuselte Polyesterfasern und daraus hergestellte Materlallen |
| DE2214775C3 (de) * | 1972-03-25 | 1975-08-21 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von Polybutylenterephthalat |
| DE2404312A1 (de) * | 1974-01-30 | 1975-08-14 | Basf Ag | Verfahren zur herstellung von 3-methylpentan-1,5-diol |
-
1974
- 1974-06-28 DE DE2431072A patent/DE2431072C3/de not_active Expired
-
1975
- 1975-06-24 US US05/589,912 patent/US4025492A/en not_active Expired - Lifetime
- 1975-06-25 GB GB26921/75A patent/GB1507358A/en not_active Expired
- 1975-06-25 NL NL7507573A patent/NL7507573A/xx unknown
- 1975-06-25 IT IT50209/75A patent/IT1040708B/it active
- 1975-06-26 BE BE157695A patent/BE830660A/xx unknown
- 1975-06-26 CA CA230,239A patent/CA1051592A/en not_active Expired
- 1975-06-26 JP JP50078667A patent/JPS5919131B2/ja not_active Expired
- 1975-06-27 FR FR7520367A patent/FR2276335A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5118795A (en:Method) | 1976-02-14 |
| IT1040708B (it) | 1979-12-20 |
| CA1051592A (en) | 1979-03-27 |
| NL7507573A (nl) | 1975-12-30 |
| FR2276335B1 (en:Method) | 1979-08-24 |
| FR2276335A1 (fr) | 1976-01-23 |
| GB1507358A (en) | 1978-04-12 |
| JPS5919131B2 (ja) | 1984-05-02 |
| BE830660A (fr) | 1975-12-29 |
| DE2431072A1 (de) | 1976-01-15 |
| US4025492A (en) | 1977-05-24 |
| DE2431072B2 (de) | 1979-08-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2431072C3 (de) | Thermoplastische Copolyester und Verfahren zu ihrer Herstellung | |
| DE69602276T2 (de) | Pet copolyester die bernsteinsäure und naphthalendicarbonsäure einheiten enthalten mit verbesserter gasundurchlässigkeit | |
| DE60027126T2 (de) | Verfahren zur herstellung von polyesterblockcopolymeren, polyesterblockcopolymer-zusammensetzungen und verfahren zu ihrer herstellung | |
| DE3236051C2 (de) | Polyestercopolymer | |
| DE19631068B4 (de) | Verfahren zur Beschleunigung der Polykondensation von Polyester | |
| EP0346735B1 (de) | Verfahren zur kontinuierlichen Herstellung von linearen thermoplastischen Polyestern | |
| DE2313903A1 (de) | Verzweigte thermoplastische copolyester | |
| DE2348697A1 (de) | Verfahren zur herstellung eines copolyesters | |
| DE2753998A1 (de) | Herstellung von verzweigten poly (alkylenterephthalaten) | |
| EP0525463A2 (de) | Verfahren zur Herstellung eines Modifizierten Co-Polyethylenterephthalates | |
| DE1720253A1 (de) | Verfahren zur Herstellung von Polyestern | |
| DE3213586A1 (de) | Thermoplastisches polyestercopolymeres | |
| DE2720004A1 (de) | Copolyester sowie verfahren zu ihrer herstellung | |
| DE2456536A1 (de) | Segmentiertes thermoplastisches copolyesterelastomeres | |
| EP0305683A2 (de) | Formmassen bestehend aus einem thermotropen, aromatischen Polyester | |
| EP0023248A1 (de) | Formmasse aus einem hochmolekularen linearen Polyester | |
| CH656885A5 (de) | Massepolymerisationsverfahren zur herstellung von thermisch bestaendigen, vollstaendig aromatischen homopolyestern oder copolyestern. | |
| DE2348698C2 (en:Method) | ||
| DE2435507C3 (de) | Carbonatmodifizierte Copolyester, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE1966884C3 (de) | Verfahren zur Herstellung von faserbildenden aromatischen Polyestern | |
| DE3047990A1 (de) | Thermoplastische blockcopolyester, verfahren zu ihrer herstellung und ihre verwendung zur herstellung von formkoerpern | |
| DE3925607A1 (de) | Verfahren zur synthese von polyesterharzen | |
| DE3738495C2 (de) | Gesättigte, zur Herstellung von Klebemassen geeignete Copolyester | |
| DE2365934C3 (de) | Herstellung von hochmolekularen Polyestern | |
| EP0543265A1 (de) | Modifiziertes Polyethylenterephthalat und seine Verwendung zur Herstellung von Behältern durch Blasextrusion |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |