DE2342431A1 - Neue, lineare homo- und copolyester auf basis von terephthal- und/oder isophthalsaeure - Google Patents
Neue, lineare homo- und copolyester auf basis von terephthal- und/oder isophthalsaeureInfo
- Publication number
- DE2342431A1 DE2342431A1 DE19732342431 DE2342431A DE2342431A1 DE 2342431 A1 DE2342431 A1 DE 2342431A1 DE 19732342431 DE19732342431 DE 19732342431 DE 2342431 A DE2342431 A DE 2342431A DE 2342431 A1 DE2342431 A1 DE 2342431A1
- Authority
- DE
- Germany
- Prior art keywords
- bis
- formula
- stands
- diols
- polyester
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 title claims description 32
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 title claims description 28
- 238000004770 highest occupied molecular orbital Methods 0.000 title 1
- 229920000728 polyester Polymers 0.000 claims description 46
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 claims description 40
- 239000003054 catalyst Substances 0.000 claims description 27
- 150000002009 diols Chemical class 0.000 claims description 21
- 238000000034 method Methods 0.000 claims description 16
- -1 Diglycol ester Chemical class 0.000 claims description 12
- 229920001634 Copolyester Polymers 0.000 claims description 11
- 239000000203 mixture Substances 0.000 claims description 11
- 238000009833 condensation Methods 0.000 claims description 10
- 230000005494 condensation Effects 0.000 claims description 10
- 238000006068 polycondensation reaction Methods 0.000 claims description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- 230000008569 process Effects 0.000 claims description 7
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 claims description 6
- 238000005886 esterification reaction Methods 0.000 claims description 6
- 238000005809 transesterification reaction Methods 0.000 claims description 6
- RRTMEZBPPGMTHE-UHFFFAOYSA-N C1CCC=C2N(CCO)C(=O)N(CCO)C21 Chemical compound C1CCC=C2N(CCO)C(=O)N(CCO)C21 RRTMEZBPPGMTHE-UHFFFAOYSA-N 0.000 claims description 5
- 230000032050 esterification Effects 0.000 claims description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 5
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 4
- 150000002148 esters Chemical class 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 239000000155 melt Substances 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 239000007790 solid phase Substances 0.000 claims description 4
- WAUNJESDGAPXMO-UHFFFAOYSA-N 1,3-bis(2-hydroxypropyl)benzimidazol-2-one Chemical compound C1=CC=C2N(CC(C)O)C(=O)N(CC(O)C)C2=C1 WAUNJESDGAPXMO-UHFFFAOYSA-N 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- MYONAGGJKCJOBT-UHFFFAOYSA-N benzimidazol-2-one Chemical compound C1=CC=CC2=NC(=O)N=C21 MYONAGGJKCJOBT-UHFFFAOYSA-N 0.000 claims description 3
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 229920001169 thermoplastic Polymers 0.000 claims description 3
- 239000004416 thermosoftening plastic Substances 0.000 claims description 3
- MSHKDMCBKRXXPT-UHFFFAOYSA-N 1,3-bis(2-hydroxy-2-phenylethyl)-3a,4,5,6-tetrahydrobenzimidazol-2-one Chemical compound C=1C=CC=CC=1C(O)CN(C1=O)C2CCCC=C2N1CC(O)C1=CC=CC=C1 MSHKDMCBKRXXPT-UHFFFAOYSA-N 0.000 claims description 2
- VFANHKHTRGHNEH-UHFFFAOYSA-N 1,3-bis(hydroxymethyl)-3a,4,5,6-tetrahydrobenzimidazol-2-one Chemical compound OCN1C(N(C2C1=CCCC2)CO)=O VFANHKHTRGHNEH-UHFFFAOYSA-N 0.000 claims description 2
- CNGROZGOFRTGFU-UHFFFAOYSA-N 1,3-bis(hydroxymethyl)benzimidazol-2-one Chemical compound C1=CC=C2N(CO)C(=O)N(CO)C2=C1 CNGROZGOFRTGFU-UHFFFAOYSA-N 0.000 claims description 2
- FDQSRULYDNDXQB-UHFFFAOYSA-N benzene-1,3-dicarbonyl chloride Chemical compound ClC(=O)C1=CC=CC(C(Cl)=O)=C1 FDQSRULYDNDXQB-UHFFFAOYSA-N 0.000 claims description 2
- 230000008030 elimination Effects 0.000 claims description 2
- 238000003379 elimination reaction Methods 0.000 claims description 2
- 239000012433 hydrogen halide Substances 0.000 claims description 2
- 229910000039 hydrogen halide Inorganic materials 0.000 claims description 2
- JJAGMWAJXOBWHS-UHFFFAOYSA-N 1,3-bis(2-hydroxyethyl)-3a,4,5,6,7,7a-hexahydrobenzimidazol-2-one Chemical compound C1CCCC2N(CCO)C(=O)N(CCO)C21 JJAGMWAJXOBWHS-UHFFFAOYSA-N 0.000 claims 1
- ACCMJVJPVHTUQF-UHFFFAOYSA-N 1,3-bis(2-hydroxypropyl)-3a,4,5,6-tetrahydrobenzimidazol-2-one Chemical compound C1CCC=C2N(CC(C)O)C(=O)N(CC(O)C)C21 ACCMJVJPVHTUQF-UHFFFAOYSA-N 0.000 claims 1
- 230000015572 biosynthetic process Effects 0.000 claims 1
- 239000000178 monomer Substances 0.000 claims 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 20
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 18
- 230000009477 glass transition Effects 0.000 description 15
- 229910052757 nitrogen Inorganic materials 0.000 description 13
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 238000002844 melting Methods 0.000 description 11
- 230000008018 melting Effects 0.000 description 11
- VXUYXOFXAQZZMF-UHFFFAOYSA-N titanium(IV) isopropoxide Chemical compound CC(C)O[Ti](OC(C)C)(OC(C)C)OC(C)C VXUYXOFXAQZZMF-UHFFFAOYSA-N 0.000 description 11
- 239000012299 nitrogen atmosphere Substances 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- 230000035484 reaction time Effects 0.000 description 8
- HVLLSGMXQDNUAL-UHFFFAOYSA-N triphenyl phosphite Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)OC1=CC=CC=C1 HVLLSGMXQDNUAL-UHFFFAOYSA-N 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 7
- 239000002253 acid Substances 0.000 description 6
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 6
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 5
- 229910052787 antimony Inorganic materials 0.000 description 5
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 5
- 239000000654 additive Substances 0.000 description 4
- 238000002425 crystallisation Methods 0.000 description 4
- 230000008025 crystallization Effects 0.000 description 4
- BTVWZWFKMIUSGS-UHFFFAOYSA-N dimethylethyleneglycol Natural products CC(C)(O)CO BTVWZWFKMIUSGS-UHFFFAOYSA-N 0.000 description 4
- 238000000921 elemental analysis Methods 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 3
- UARFFANGBYNLQT-UHFFFAOYSA-N 1,3-bis(2-hydroxyethyl)benzimidazol-2-one Chemical compound C1=CC=C2N(CCO)C(=O)N(CCO)C2=C1 UARFFANGBYNLQT-UHFFFAOYSA-N 0.000 description 3
- 238000005160 1H NMR spectroscopy Methods 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000008641 benzimidazolones Chemical class 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- WSQZNZLOZXSBHA-UHFFFAOYSA-N 3,8-dioxabicyclo[8.2.2]tetradeca-1(12),10,13-triene-2,9-dione Chemical class O=C1OCCCCOC(=O)C2=CC=C1C=C2 WSQZNZLOZXSBHA-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Chemical compound O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 230000000630 rising effect Effects 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- LXEJRKJRKIFVNY-UHFFFAOYSA-N terephthaloyl chloride Chemical compound ClC(=O)C1=CC=C(C(Cl)=O)C=C1 LXEJRKJRKIFVNY-UHFFFAOYSA-N 0.000 description 2
- 238000001757 thermogravimetry curve Methods 0.000 description 2
- 230000000930 thermomechanical effect Effects 0.000 description 2
- 239000012815 thermoplastic material Substances 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- YJKMLKOCVBTSAL-UHFFFAOYSA-N 1,3,3a,4-tetrahydrobenzimidazol-2-one Chemical compound C1C=CC=C2NC(=O)NC21 YJKMLKOCVBTSAL-UHFFFAOYSA-N 0.000 description 1
- VDUQJADUZSMRNM-UHFFFAOYSA-N 1,3-bis(2-hydroxy-2-phenylethyl)benzimidazol-2-one Chemical compound C=1C=CC=CC=1C(O)CN(C1=O)C2=CC=CC=C2N1CC(O)C1=CC=CC=C1 VDUQJADUZSMRNM-UHFFFAOYSA-N 0.000 description 1
- RAQRDOXTQLDQGU-UHFFFAOYSA-N 1,3-bis(2-hydroxybutyl)benzimidazol-2-one Chemical compound C1=CC=C2N(CC(O)CC)C(=O)N(CC(O)CC)C2=C1 RAQRDOXTQLDQGU-UHFFFAOYSA-N 0.000 description 1
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 1
- WBOWCHJJBJWYKU-UHFFFAOYSA-N 2-[3-(2-hydroxyethyl)-2h-benzimidazol-1-yl]ethanol Chemical class C1=CC=C2N(CCO)CN(CCO)C2=C1 WBOWCHJJBJWYKU-UHFFFAOYSA-N 0.000 description 1
- CAWGQUPKYLTTNX-UHFFFAOYSA-N 3,4,5,6-tetrahydro-2,7-benzodioxecine-1,8-dione Chemical compound O=C1OCCCCOC(=O)C2=CC=CC=C12 CAWGQUPKYLTTNX-UHFFFAOYSA-N 0.000 description 1
- SENMPMXZMGNQAG-UHFFFAOYSA-N 3,4-dihydro-2,5-benzodioxocine-1,6-dione Chemical compound O=C1OCCOC(=O)C2=CC=CC=C12 SENMPMXZMGNQAG-UHFFFAOYSA-N 0.000 description 1
- MMINFSMURORWKH-UHFFFAOYSA-N 3,6-dioxabicyclo[6.2.2]dodeca-1(10),8,11-triene-2,7-dione Chemical class O=C1OCCOC(=O)C2=CC=C1C=C2 MMINFSMURORWKH-UHFFFAOYSA-N 0.000 description 1
- LJJLNIIWZTWCKL-UHFFFAOYSA-N 4,5-bis(2-hydroxyethyl)benzimidazol-2-one Chemical compound OCCC1=C(C=2C(=NC(N2)=O)C=C1)CCO LJJLNIIWZTWCKL-UHFFFAOYSA-N 0.000 description 1
- ZJZLFDHSFOSUIJ-UHFFFAOYSA-N 4-methyl-3,4-dihydro-2,5-benzodioxocine-1,6-dione Chemical compound O=C1OC(C)COC(=O)C2=CC=CC=C21 ZJZLFDHSFOSUIJ-UHFFFAOYSA-N 0.000 description 1
- LLLVZDVNHNWSDS-UHFFFAOYSA-N 4-methylidene-3,5-dioxabicyclo[5.2.2]undeca-1(9),7,10-triene-2,6-dione Chemical compound C1(C2=CC=C(C(=O)OC(=C)O1)C=C2)=O LLLVZDVNHNWSDS-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 239000004831 Hot glue Substances 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- AWMVMTVKBNGEAK-UHFFFAOYSA-N Styrene oxide Chemical compound C1OC1C1=CC=CC=C1 AWMVMTVKBNGEAK-UHFFFAOYSA-N 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- ZOIORXHNWRGPMV-UHFFFAOYSA-N acetic acid;zinc Chemical compound [Zn].CC(O)=O.CC(O)=O ZOIORXHNWRGPMV-UHFFFAOYSA-N 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- RGRZVYPWYSPSSH-UHFFFAOYSA-N benzimidazol-4-one Chemical compound O=C1C=CC=C2N=CN=C12 RGRZVYPWYSPSSH-UHFFFAOYSA-N 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 238000009529 body temperature measurement Methods 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 239000007809 chemical reaction catalyst Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- ZWAJLVLEBYIOTI-UHFFFAOYSA-N cyclohexene oxide Chemical compound C1CCCC2OC21 ZWAJLVLEBYIOTI-UHFFFAOYSA-N 0.000 description 1
- FWFSEYBSWVRWGL-UHFFFAOYSA-N cyclohexene oxide Natural products O=C1CCCC=C1 FWFSEYBSWVRWGL-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000004455 differential thermal analysis Methods 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- HPGJOUYGWKFYQW-UHFFFAOYSA-N diphenyl benzene-1,4-dicarboxylate Chemical compound C=1C=C(C(=O)OC=2C=CC=CC=2)C=CC=1C(=O)OC1=CC=CC=C1 HPGJOUYGWKFYQW-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 229920003247 engineering thermoplastic Polymers 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000003063 flame retardant Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 229910052732 germanium Inorganic materials 0.000 description 1
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 239000001023 inorganic pigment Substances 0.000 description 1
- WABPQHHGFIMREM-UHFFFAOYSA-N lead(0) Chemical compound [Pb] WABPQHHGFIMREM-UHFFFAOYSA-N 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 239000006224 matting agent Substances 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000012778 molding material Substances 0.000 description 1
- 230000004660 morphological change Effects 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen(.) Chemical compound [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000012860 organic pigment Substances 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920001707 polybutylene terephthalate Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000012779 reinforcing material Substances 0.000 description 1
- 238000001226 reprecipitation Methods 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000011265 semifinished product Substances 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 238000010183 spectrum analysis Methods 0.000 description 1
- 150000003503 terephthalic acid derivatives Chemical class 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- LOYIXGPTTRRLDY-UHFFFAOYSA-N tetradecane-1,8-diol Chemical compound CCCCCCC(O)CCCCCCCO LOYIXGPTTRRLDY-UHFFFAOYSA-N 0.000 description 1
- 238000002411 thermogravimetry Methods 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 238000007514 turning Methods 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 239000004246 zinc acetate Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/68—Polyesters containing atoms other than carbon, hydrogen and oxygen
- C08G63/685—Polyesters containing atoms other than carbon, hydrogen and oxygen containing nitrogen
- C08G63/6854—Polyesters containing atoms other than carbon, hydrogen and oxygen containing nitrogen derived from polycarboxylic acids and polyhydroxy compounds
- C08G63/6856—Dicarboxylic acids and dihydroxy compounds
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/78—Preparation processes
- C08G63/80—Solid-state polycondensation
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyesters Or Polycarbonates (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1265572A CH569748A5 (enExample) | 1972-08-25 | 1972-08-25 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2342431A1 true DE2342431A1 (de) | 1974-03-07 |
Family
ID=4385154
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19732342431 Withdrawn DE2342431A1 (de) | 1972-08-25 | 1973-08-22 | Neue, lineare homo- und copolyester auf basis von terephthal- und/oder isophthalsaeure |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US3860564A (enExample) |
| JP (1) | JPS568851B2 (enExample) |
| AR (1) | AR199410A1 (enExample) |
| AT (1) | AT336281B (enExample) |
| AU (1) | AU468782B2 (enExample) |
| BE (1) | BE804002A (enExample) |
| CA (1) | CA1012676A (enExample) |
| CH (1) | CH569748A5 (enExample) |
| DD (1) | DD106397A5 (enExample) |
| DE (1) | DE2342431A1 (enExample) |
| FR (1) | FR2197039B1 (enExample) |
| GB (1) | GB1429367A (enExample) |
| NL (1) | NL7311640A (enExample) |
| SE (1) | SE396610B (enExample) |
| SU (1) | SU474994A3 (enExample) |
| ZA (1) | ZA735826B (enExample) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3994864A (en) * | 1973-07-30 | 1976-11-30 | Ciba-Geigy Corporation | Linear, thermoplastic polyesters |
| US4021506A (en) * | 1973-11-13 | 1977-05-03 | Ciba-Geigy Corporation | Unsaturated, linear polyester compositions |
| US3997511A (en) * | 1973-11-13 | 1976-12-14 | Ciba-Geigy Corporation | Unsaturated linear polyesters |
| CH585238A5 (enExample) * | 1973-11-13 | 1977-02-28 | Ciba Geigy Ag | |
| US3996201A (en) * | 1973-11-13 | 1976-12-07 | Ciba-Geigy Corporation | Linear, thermoplastic polyesters and process for their manufacture |
| US3994865A (en) * | 1973-11-13 | 1976-11-30 | Ciba-Geigy Corporation | Flame-resistant fibers of linear, thermoplastic polyesters |
| CH598295A5 (enExample) * | 1974-07-30 | 1978-04-28 | Ciba Geigy Ag | |
| CH597274A5 (enExample) * | 1974-07-30 | 1978-03-31 | Ciba Geigy Ag | |
| CH597275A5 (enExample) * | 1974-11-29 | 1978-03-31 | Ciba Geigy Ag | |
| NL7603799A (nl) * | 1975-04-23 | 1976-10-26 | Ciba Geigy | Lineaire polyesters op basis van heterocyclische dicarbonzuren. |
| US4108841A (en) * | 1976-05-12 | 1978-08-22 | Ciba-Geigy Corporation | Thermoplastic polyesters and processes for their manufacture |
| DE102004015515A1 (de) * | 2004-03-28 | 2004-09-16 | Zimmer Ag | Verfahren zur Herstellung von hochkondensiertem Polyestergranulat |
| KR102589382B1 (ko) | 2018-08-08 | 2023-10-12 | 에스케이케미칼 주식회사 | 폴리에스테르 수지 및 이의 제조방법 |
| CN119019667B (zh) * | 2024-08-23 | 2026-03-20 | 武汉纺织大学 | 疏水、抗菌、阻燃共聚酯及其制备方法 |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2201582A1 (de) * | 1971-01-19 | 1972-08-03 | Inst Francais Du Petrol | Neue Diester,Verfahren zu ihrer Herstellung und ihre Verwendung |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2732316A (en) * | 1952-12-03 | 1956-01-24 | Hardening of gelatin | |
| US2785176A (en) * | 1955-03-01 | 1957-03-12 | Olin Mathieson | Ethylene urea derivatives and process of production |
-
1972
- 1972-08-25 CH CH1265572A patent/CH569748A5/xx not_active IP Right Cessation
-
1973
- 1973-07-05 SE SE7309473A patent/SE396610B/xx unknown
- 1973-08-09 AU AU59078/73A patent/AU468782B2/en not_active Expired
- 1973-08-09 US US387059A patent/US3860564A/en not_active Expired - Lifetime
- 1973-08-16 GB GB3883573A patent/GB1429367A/en not_active Expired
- 1973-08-21 DD DD173004A patent/DD106397A5/xx unknown
- 1973-08-22 DE DE19732342431 patent/DE2342431A1/de not_active Withdrawn
- 1973-08-23 NL NL7311640A patent/NL7311640A/xx not_active Application Discontinuation
- 1973-08-23 SU SU1955025A patent/SU474994A3/ru active
- 1973-08-23 AR AR249709A patent/AR199410A1/es active
- 1973-08-24 CA CA179,564A patent/CA1012676A/en not_active Expired
- 1973-08-24 ZA ZA735826A patent/ZA735826B/xx unknown
- 1973-08-24 AT AT739073A patent/AT336281B/de not_active IP Right Cessation
- 1973-08-24 FR FR7330713A patent/FR2197039B1/fr not_active Expired
- 1973-08-24 BE BE134915A patent/BE804002A/xx unknown
- 1973-08-25 JP JP9565373A patent/JPS568851B2/ja not_active Expired
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2201582A1 (de) * | 1971-01-19 | 1972-08-03 | Inst Francais Du Petrol | Neue Diester,Verfahren zu ihrer Herstellung und ihre Verwendung |
Also Published As
| Publication number | Publication date |
|---|---|
| AU468782B2 (en) | 1976-01-22 |
| SU474994A3 (ru) | 1975-06-25 |
| JPS4960396A (enExample) | 1974-06-12 |
| FR2197039A1 (enExample) | 1974-03-22 |
| SE396610B (sv) | 1977-09-26 |
| AU5907873A (en) | 1975-02-13 |
| AR199410A1 (es) | 1974-08-30 |
| CH569748A5 (enExample) | 1975-11-28 |
| CA1012676A (en) | 1977-06-21 |
| DD106397A5 (enExample) | 1974-06-12 |
| BE804002A (fr) | 1974-02-25 |
| ATA739073A (de) | 1976-08-15 |
| JPS568851B2 (enExample) | 1981-02-26 |
| GB1429367A (en) | 1976-03-24 |
| NL7311640A (enExample) | 1974-02-27 |
| AT336281B (de) | 1977-04-25 |
| ZA735826B (en) | 1974-08-28 |
| FR2197039B1 (enExample) | 1976-11-19 |
| US3860564A (en) | 1975-01-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2342415A1 (de) | Neue, lineare homo- und copolyester auf basis von tere- und/oder isophthalsaeure | |
| DE69525198T2 (de) | Verfahren zur Darstellung macrocyclischer Polyester-Oligomeren | |
| DE2261503C3 (de) | Verfahren zur Herstellung eines zweiten Polyesters aus einem ersten Polyester | |
| DE2342431A1 (de) | Neue, lineare homo- und copolyester auf basis von terephthal- und/oder isophthalsaeure | |
| DE3211899A1 (de) | Verfahren zum kondensieren von poly(alkylenterephthalaten) | |
| DE2744648C2 (enExample) | ||
| DE2340559B2 (de) | Herstellung von hochmolekularen Polyestern des Butandiols-(1,4) | |
| DE2744617C2 (enExample) | ||
| DE2545720A1 (de) | Schnellkristallisierende blockcopolyester | |
| DE2533675A1 (de) | Lineare copolyester auf basis von terephthal- und/oder isophthalsaeure | |
| DE2453448C2 (de) | Lineare, thermoplastische Polyester | |
| DE2453450C2 (de) | Neue, flammwidrige, thermoplastische Polyester | |
| DE69219798T2 (de) | Verfahren zur Herstellung aromatischer Polyester | |
| DE2720835A1 (de) | Thermoplastische polyester und verfahren zu ihrer herstellung | |
| DE2533715A1 (de) | Lineare polyester auf basis von s-triazindicarbonsaeuren | |
| DE2365934C3 (de) | Herstellung von hochmolekularen Polyestern | |
| US2794795A (en) | Linear polyesters from 4, 4'-dicar-balkoxybenzanilides | |
| DE2720844A1 (de) | Thermoplastische polyester | |
| DE2436109A1 (de) | Neue, lineare, thermoplastische polyester | |
| DE1595271A1 (de) | Copolyester und Verfahren zu deren Herstellung | |
| DE2553067A1 (de) | Lineare polyester auf basis heterocyclischer dicarbonsaeuren | |
| DE2744566A1 (de) | Kopolyester | |
| DE2939001A1 (de) | Umesterungsverfahren | |
| CH594005A5 (en) | Linear polyesters prepn. - from imidazolidine dione dicarboxylic acids, diols and opt. other dicarboxylic acids (NL261076) | |
| DE2243488A1 (de) | Verfahren zur herstellung von thermoplastischen copolyesterformmassen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8136 | Disposal/non-payment of the fee for publication/grant |