DE2334063C3 - Kompositpulver - Google Patents
KompositpulverInfo
- Publication number
- DE2334063C3 DE2334063C3 DE2334063A DE2334063A DE2334063C3 DE 2334063 C3 DE2334063 C3 DE 2334063C3 DE 2334063 A DE2334063 A DE 2334063A DE 2334063 A DE2334063 A DE 2334063A DE 2334063 C3 DE2334063 C3 DE 2334063C3
- Authority
- DE
- Germany
- Prior art keywords
- weight
- combustion
- binder
- composite powder
- charges
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000843 powder Substances 0.000 title claims description 24
- 239000002131 composite material Substances 0.000 title claims description 17
- 238000002485 combustion reaction Methods 0.000 claims description 33
- 239000000203 mixture Substances 0.000 claims description 26
- 239000011230 binding agent Substances 0.000 claims description 21
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 18
- 239000007789 gas Substances 0.000 claims description 14
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 13
- 239000007800 oxidant agent Substances 0.000 claims description 10
- 239000006230 acetylene black Substances 0.000 claims description 9
- 239000004014 plasticizer Substances 0.000 claims description 9
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical compound [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 claims description 8
- 229910052799 carbon Inorganic materials 0.000 claims description 7
- 229920002284 Cellulose triacetate Polymers 0.000 claims description 6
- NNLVGZFZQQXQNW-ADJNRHBOSA-N [(2r,3r,4s,5r,6s)-4,5-diacetyloxy-3-[(2s,3r,4s,5r,6r)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6s)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](OC(C)=O)[C@H]1OC(C)=O)O[C@H]1[C@@H]([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O1)OC(C)=O)COC(=O)C)[C@@H]1[C@@H](COC(C)=O)O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O NNLVGZFZQQXQNW-ADJNRHBOSA-N 0.000 claims description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 6
- AXZAYXJCENRGIM-UHFFFAOYSA-J dipotassium;tetrabromoplatinum(2-) Chemical group [K+].[K+].[Br-].[Br-].[Br-].[Br-].[Pt+2] AXZAYXJCENRGIM-UHFFFAOYSA-J 0.000 claims description 6
- 239000001301 oxygen Substances 0.000 claims description 6
- 229910052760 oxygen Inorganic materials 0.000 claims description 6
- 229910001487 potassium perchlorate Inorganic materials 0.000 claims description 6
- 229920002379 silicone rubber Polymers 0.000 claims description 6
- 238000002156 mixing Methods 0.000 claims description 5
- GDDNTTHUKVNJRA-UHFFFAOYSA-N 3-bromo-3,3-difluoroprop-1-ene Chemical compound FC(F)(Br)C=C GDDNTTHUKVNJRA-UHFFFAOYSA-N 0.000 claims description 4
- 229910052751 metal Inorganic materials 0.000 claims description 4
- 239000002184 metal Substances 0.000 claims description 4
- 231100000252 nontoxic Toxicity 0.000 claims description 4
- 230000003000 nontoxic effect Effects 0.000 claims description 4
- 239000002341 toxic gas Substances 0.000 claims description 4
- 239000003513 alkali Substances 0.000 claims description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 3
- 239000000567 combustion gas Substances 0.000 claims description 3
- 239000004945 silicone rubber Substances 0.000 claims description 3
- -1 alkaline earth metal perchlorates Chemical class 0.000 claims description 2
- KHPLPBHMTCTCHA-UHFFFAOYSA-N ammonium chlorate Chemical group N.OCl(=O)=O KHPLPBHMTCTCHA-UHFFFAOYSA-N 0.000 claims description 2
- 229920002301 cellulose acetate Polymers 0.000 claims description 2
- 239000010439 graphite Substances 0.000 claims description 2
- 229910002804 graphite Inorganic materials 0.000 claims description 2
- 239000002075 main ingredient Substances 0.000 claims description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 claims description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 claims description 2
- YSMRWXYRXBRSND-UHFFFAOYSA-N TOTP Chemical group CC1=CC=CC=C1OP(=O)(OC=1C(=CC=CC=1)C)OC1=CC=CC=C1C YSMRWXYRXBRSND-UHFFFAOYSA-N 0.000 claims 1
- 229910052783 alkali metal Inorganic materials 0.000 claims 1
- 150000001340 alkali metals Chemical class 0.000 claims 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims 1
- 230000001590 oxidative effect Effects 0.000 claims 1
- 230000001681 protective effect Effects 0.000 claims 1
- 229910052782 aluminium Inorganic materials 0.000 description 15
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 7
- 229920002050 silicone resin Polymers 0.000 description 6
- URAYPUMNDPQOKB-UHFFFAOYSA-N triacetin Chemical compound CC(=O)OCC(OC(C)=O)COC(C)=O URAYPUMNDPQOKB-UHFFFAOYSA-N 0.000 description 6
- 239000000654 additive Substances 0.000 description 4
- 238000004898 kneading Methods 0.000 description 4
- 229910002090 carbon oxide Inorganic materials 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 235000013773 glyceryl triacetate Nutrition 0.000 description 3
- 239000001087 glyceryl triacetate Substances 0.000 description 3
- MWUXSHHQAYIFBG-UHFFFAOYSA-N nitrogen oxide Inorganic materials O=[N] MWUXSHHQAYIFBG-UHFFFAOYSA-N 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 229960002622 triacetin Drugs 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 229910002091 carbon monoxide Inorganic materials 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 238000004880 explosion Methods 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 230000035939 shock Effects 0.000 description 2
- ILJSQTXMGCGYMG-UHFFFAOYSA-N triacetic acid Chemical compound CC(=O)CC(=O)CC(O)=O ILJSQTXMGCGYMG-UHFFFAOYSA-N 0.000 description 2
- BZSXEZOLBIJVQK-UHFFFAOYSA-N 2-methylsulfonylbenzoic acid Chemical compound CS(=O)(=O)C1=CC=CC=C1C(O)=O BZSXEZOLBIJVQK-UHFFFAOYSA-N 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- SNIOPGDIGTZGOP-UHFFFAOYSA-N Nitroglycerin Chemical compound [O-][N+](=O)OCC(O[N+]([O-])=O)CO[N+]([O-])=O SNIOPGDIGTZGOP-UHFFFAOYSA-N 0.000 description 1
- 239000000006 Nitroglycerin Substances 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- TYDBGIXSDJMDEE-UHFFFAOYSA-N [Cr](=O)([O-])O[Cr](=O)[O-].[Cu+2] Chemical compound [Cr](=O)([O-])O[Cr](=O)[O-].[Cu+2] TYDBGIXSDJMDEE-UHFFFAOYSA-N 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- SOCTUWSJJQCPFX-UHFFFAOYSA-N dichromate(2-) Chemical compound [O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O SOCTUWSJJQCPFX-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 229960003711 glyceryl trinitrate Drugs 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000000265 homogenisation Methods 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 230000002452 interceptive effect Effects 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 239000011435 rock Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- BAZAXWOYCMUHIX-UHFFFAOYSA-M sodium perchlorate Chemical compound [Na+].[O-]Cl(=O)(=O)=O BAZAXWOYCMUHIX-UHFFFAOYSA-M 0.000 description 1
- 229910001488 sodium perchlorate Inorganic materials 0.000 description 1
- 239000004071 soot Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000004575 stone Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 238000004073 vulcanization Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B45/00—Compositions or products which are defined by structure or arrangement of component of product
- C06B45/04—Compositions or products which are defined by structure or arrangement of component of product comprising solid particles dispersed in solid solution or matrix not used for explosives where the matrix consists essentially of nitrated carbohydrates or a low molecular organic explosive
- C06B45/06—Compositions or products which are defined by structure or arrangement of component of product comprising solid particles dispersed in solid solution or matrix not used for explosives where the matrix consists essentially of nitrated carbohydrates or a low molecular organic explosive the solid solution or matrix containing an organic component
- C06B45/10—Compositions or products which are defined by structure or arrangement of component of product comprising solid particles dispersed in solid solution or matrix not used for explosives where the matrix consists essentially of nitrated carbohydrates or a low molecular organic explosive the solid solution or matrix containing an organic component the organic component containing a resin
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B23/00—Compositions characterised by non-explosive or non-thermic constituents
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Dispersion Chemistry (AREA)
- Molecular Biology (AREA)
- Crystallography & Structural Chemistry (AREA)
- Air Bags (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Battery Electrode And Active Subsutance (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7224226A FR2190776B1 (show.php) | 1972-07-05 | 1972-07-05 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2334063A1 DE2334063A1 (de) | 1974-01-24 |
| DE2334063B2 DE2334063B2 (de) | 1979-05-31 |
| DE2334063C3 true DE2334063C3 (de) | 1980-01-31 |
Family
ID=9101363
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2334063A Expired DE2334063C3 (de) | 1972-07-05 | 1973-07-04 | Kompositpulver |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US3986908A (show.php) |
| JP (1) | JPS5820919B2 (show.php) |
| AU (1) | AU474237B2 (show.php) |
| BE (1) | BE801956A (show.php) |
| BR (1) | BR7304960D0 (show.php) |
| CA (1) | CA1006356A (show.php) |
| CH (1) | CH578612A5 (show.php) |
| CS (1) | CS191901B2 (show.php) |
| DE (1) | DE2334063C3 (show.php) |
| ES (1) | ES416380A1 (show.php) |
| FR (1) | FR2190776B1 (show.php) |
| GB (1) | GB1397523A (show.php) |
| IE (1) | IE37802B1 (show.php) |
| IT (1) | IT991661B (show.php) |
| LU (1) | LU67926A1 (show.php) |
| NL (1) | NL7309396A (show.php) |
| SE (1) | SE427834B (show.php) |
| SU (1) | SU520028A3 (show.php) |
| ZA (1) | ZA734222B (show.php) |
Families Citing this family (51)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2448615C3 (de) * | 1974-10-11 | 1981-04-02 | Hercules Inc., 19899 Wilmington, Del. | Feste Treibmittel und ihre Verwendung |
| US4152891A (en) * | 1977-10-11 | 1979-05-08 | Allied Chemical Corporation | Pyrotechnic composition and method of inflating an inflatable automobile safety restraint |
| US4128996A (en) * | 1977-12-05 | 1978-12-12 | Allied Chemical Corporation | Chlorite containing pyrotechnic composition and method of inflating an inflatable automobile safety restraint |
| US4214438A (en) * | 1978-02-03 | 1980-07-29 | Allied Chemical Corporation | Pyrotechnic composition and method of inflating an inflatable device |
| US4244758A (en) * | 1978-05-15 | 1981-01-13 | Allied Chemical Corporation | Ignition enhancer coating compositions for azide propellant |
| US4246051A (en) * | 1978-09-15 | 1981-01-20 | Allied Chemical Corporation | Pyrotechnic coating composition |
| CA1147593A (en) * | 1979-08-24 | 1983-06-07 | Michael S. Ady | Model rocket propulsion system including a solid propellant grain with a cylindrical burning port adjacent the throat section of a nozzle |
| US4412874A (en) * | 1981-11-19 | 1983-11-01 | The United States Of America As Represented By The Secretary Of The Army | Silane ballistic modifier containing propellant |
| US5056436A (en) * | 1988-10-03 | 1991-10-15 | Loral Aerospace Corp. | Solid pyrotechnic compositions for projectile base-bleed systems |
| US5348596A (en) * | 1989-08-25 | 1994-09-20 | Hercules Incorporated | Solid propellant with non-crystalline polyether/inert plasticizer binder |
| DE4026468C2 (de) * | 1990-08-22 | 1998-10-08 | Hercules Inc | Feste Treibstoffe mit einem Bindemittel aus nicht-kristallinem Polyether/energiereichem Weichmacher |
| WO1992021636A1 (fr) * | 1991-05-28 | 1992-12-10 | Daicel Chemical Industries, Ltd. | Agent gazogene |
| US5403035A (en) * | 1992-06-01 | 1995-04-04 | Oea, Inc. | Preparing air bag vehicle restraint device having cellulose containing sheet propellant |
| EP0713808A1 (de) | 1992-09-21 | 1996-05-29 | DIEHL GMBH & CO. | Airbaganordnung |
| AU5091493A (en) * | 1992-12-28 | 1994-07-19 | Atlantic Research Corporation | Inflating crash bags |
| US5482579A (en) * | 1993-04-15 | 1996-01-09 | Nof Corporation | Gas generator compositions |
| US5474625A (en) * | 1993-12-16 | 1995-12-12 | The United States Of America As Represented By The Secretary Of The Navy | Desensitized solid rocket propellant formulation |
| JPH07232613A (ja) * | 1993-12-28 | 1995-09-05 | Nippon Kayaku Co Ltd | エアバッグ用ガス発生器およびスクイブ |
| US20050067074A1 (en) | 1994-01-19 | 2005-03-31 | Hinshaw Jerald C. | Metal complexes for use as gas generants |
| US5725699A (en) * | 1994-01-19 | 1998-03-10 | Thiokol Corporation | Metal complexes for use as gas generants |
| US6969435B1 (en) | 1994-01-19 | 2005-11-29 | Alliant Techsystems Inc. | Metal complexes for use as gas generants |
| JPH07309194A (ja) * | 1994-05-20 | 1995-11-28 | Sensor Technol Kk | エアバッグ用ガス発生剤 |
| FR2728562B1 (fr) * | 1994-12-22 | 1997-01-24 | Poudres & Explosifs Ste Nale | Procede de fabrication en continu de chargements pyrotechniques a liant silicone et compositions susceptibles d'etre mises en oeuvre par ce procede |
| US6860951B2 (en) * | 1995-03-10 | 2005-03-01 | Talley Defense Systems, Inc. | Gas generating compositions |
| US5734123A (en) * | 1995-10-03 | 1998-03-31 | Atlantic Research Corporation | Extrudable gas-generating compositions |
| DE19541924A1 (de) * | 1995-11-10 | 1997-05-15 | Diehl Gmbh & Co | Gasgenerator |
| JP3608902B2 (ja) * | 1997-03-24 | 2005-01-12 | ダイセル化学工業株式会社 | ガス発生剤組成物及びその成型体 |
| US5936195A (en) * | 1997-06-10 | 1999-08-10 | Atlantic Research Corporation | Gas generating composition with exploded aluminum powder |
| US6224099B1 (en) | 1997-07-22 | 2001-05-01 | Cordant Technologies Inc. | Supplemental-restraint-system gas generating device with water-soluble polymeric binder |
| US6170399B1 (en) | 1997-08-30 | 2001-01-09 | Cordant Technologies Inc. | Flares having igniters formed from extrudable igniter compositions |
| FR2772370B1 (fr) | 1997-12-12 | 2000-01-07 | Poudres & Explosifs Ste Nale | Compositions pyrotechniques generatrices de gaz non toxiques a base de perchlorate d'ammonium |
| JP2000103691A (ja) * | 1998-09-28 | 2000-04-11 | Daicel Chem Ind Ltd | ガス発生剤組成物 |
| JP2003535003A (ja) | 1999-07-02 | 2003-11-25 | オートモーティブ システムズ ラボラトリー インコーポレーテッド | シリコーン被膜を含むガス発生組成物 |
| EP1377534A2 (en) * | 1999-09-16 | 2004-01-07 | Automotive Systems Laboratory Inc. | Gas generants containing silicone fuels |
| US7094296B1 (en) | 1999-09-16 | 2006-08-22 | Automotive Systems Laboratory, Inc. | Gas generants containing silicone fuels |
| DE60133189D1 (de) * | 2000-05-02 | 2008-04-24 | Automotive Systems Lab | Aufblasvorrichtung |
| WO2002043990A2 (en) * | 2000-11-28 | 2002-06-06 | Automotive Systems Laboratory, Inc. | Gas generator and method of assembly |
| FR2818636B1 (fr) | 2000-12-22 | 2003-02-28 | Poudres & Explosifs Ste Nale | Compositions pyrotechniques generatrices de gaz a liant hydrocarbone et procede de fabrication en continu |
| US6841015B1 (en) | 2003-10-09 | 2005-01-11 | The United States Of America As Represented By The Secretary Of The Navy | Delay element and ignition composition |
| US20060219340A1 (en) * | 2005-03-31 | 2006-10-05 | Dunham Steven M | Gas generating system |
| US7758709B2 (en) * | 2006-06-21 | 2010-07-20 | Autoliv Asp, Inc. | Monolithic gas generant grains |
| US9193639B2 (en) * | 2007-03-27 | 2015-11-24 | Autoliv Asp, Inc. | Methods of manufacturing monolithic generant grains |
| FR2915746B1 (fr) * | 2007-05-02 | 2009-08-21 | Snpe Materiaux Energetiques Sa | Compose pyrotechnique generateur de gaz; procede d'obtention |
| US8057612B2 (en) * | 2007-08-13 | 2011-11-15 | Autoliv Asp, Inc. | Methods of forming a multi-composition pyrotechnic grain |
| US8057611B2 (en) * | 2007-08-13 | 2011-11-15 | Autoliv Asp, Inc. | Multi-composition pyrotechnic grain |
| US8815029B2 (en) * | 2008-04-10 | 2014-08-26 | Autoliv Asp, Inc. | High performance gas generating compositions |
| RU2379274C1 (ru) * | 2008-07-08 | 2010-01-20 | Государственное образовательное учреждение высшего профессионального образования "Алтайский государственный технический университет им. И.И. Ползунова" (АлтГТУ) | Твердый пиротехнический газогенерирующий элемент |
| US8808476B2 (en) * | 2008-11-12 | 2014-08-19 | Autoliv Asp, Inc. | Gas generating compositions having glass fibers |
| RU2423338C2 (ru) * | 2008-12-22 | 2011-07-10 | Государственное образовательное учреждение высшего профессионального образования Томский государственный университет (ТГУ) | Способ регулирования скорости горения смесевого твердого топлива |
| FR2959508B1 (fr) | 2010-04-29 | 2015-01-02 | Snpe Materiaux Energetiques | Compose pyrotechnique generateur de gaz; procede d'obtention |
| US9051223B2 (en) | 2013-03-15 | 2015-06-09 | Autoliv Asp, Inc. | Generant grain assembly formed of multiple symmetric pieces |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3126304A (en) * | 1964-03-24 | Ammonium nitrate gas generator | ||
| US2949352A (en) * | 1956-10-01 | 1960-08-16 | North American Aviation Inc | Propellant composition |
| US3020180A (en) * | 1957-12-17 | 1962-02-06 | Standard Oil Co | Stabilized ammonium nitrate propellant |
| US3665862A (en) * | 1962-03-08 | 1972-05-30 | Dow Chemical Co | Caseless rocket containing silane polymer |
| US3161550A (en) * | 1962-08-27 | 1964-12-15 | Standard Oil Co | Ammonium nitrate propellant composition providing exhaust gases of reduced temperature |
| US3197349A (en) * | 1963-02-15 | 1965-07-27 | Nitrochemie G M B H | Silicone propellant compositions containing nitroguanidine |
| NL121978C (show.php) * | 1964-03-23 | |||
| US3833432A (en) * | 1970-02-11 | 1974-09-03 | Us Navy | Sodium azide gas generating solid propellant with fluorocarbon binder |
| US3663036A (en) * | 1970-06-16 | 1972-05-16 | Olin Corp | Vehicle safety device having an inflatable confinement |
| US3692495A (en) * | 1970-06-19 | 1972-09-19 | Thiokol Chemical Corp | Gas generator |
| US3723205A (en) * | 1971-05-07 | 1973-03-27 | Susquehanna Corp | Gas generating composition with polyvinyl chloride binder |
| US3773351A (en) * | 1971-08-02 | 1973-11-20 | Timmerman H | Gas generator |
-
1972
- 1972-07-05 FR FR7224226A patent/FR2190776B1/fr not_active Expired
-
1973
- 1973-06-15 IE IE988/73A patent/IE37802B1/xx unknown
- 1973-06-21 CH CH901473A patent/CH578612A5/xx not_active IP Right Cessation
- 1973-06-22 ZA ZA734222A patent/ZA734222B/xx unknown
- 1973-06-25 US US05/373,118 patent/US3986908A/en not_active Expired - Lifetime
- 1973-06-26 AU AU57371/73A patent/AU474237B2/en not_active Expired
- 1973-06-28 CA CA175,202A patent/CA1006356A/en not_active Expired
- 1973-06-28 ES ES416380A patent/ES416380A1/es not_active Expired
- 1973-07-03 LU LU67926A patent/LU67926A1/xx unknown
- 1973-07-04 IT IT68987/73A patent/IT991661B/it active
- 1973-07-04 CS CS734841A patent/CS191901B2/cs unknown
- 1973-07-04 SE SE7309422A patent/SE427834B/xx unknown
- 1973-07-04 JP JP48074962A patent/JPS5820919B2/ja not_active Expired
- 1973-07-04 GB GB3192073A patent/GB1397523A/en not_active Expired
- 1973-07-04 SU SU1942245A patent/SU520028A3/ru active
- 1973-07-04 BR BR4960/73A patent/BR7304960D0/pt unknown
- 1973-07-04 DE DE2334063A patent/DE2334063C3/de not_active Expired
- 1973-07-05 NL NL7309396A patent/NL7309396A/xx not_active Application Discontinuation
- 1973-07-05 BE BE133154A patent/BE801956A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| ES416380A1 (es) | 1976-02-16 |
| AU5737173A (en) | 1975-01-09 |
| FR2190776A1 (show.php) | 1974-02-01 |
| SU520028A3 (ru) | 1976-06-30 |
| CA1006356A (en) | 1977-03-08 |
| GB1397523A (en) | 1975-06-11 |
| DE2334063A1 (de) | 1974-01-24 |
| BR7304960D0 (pt) | 1974-09-05 |
| JPS49132208A (show.php) | 1974-12-18 |
| ZA734222B (en) | 1974-07-31 |
| BE801956A (fr) | 1974-01-07 |
| DE2334063B2 (de) | 1979-05-31 |
| IE37802B1 (en) | 1977-10-12 |
| IE37802L (en) | 1974-01-05 |
| FR2190776B1 (show.php) | 1976-10-29 |
| SE427834B (sv) | 1983-05-09 |
| LU67926A1 (show.php) | 1975-04-11 |
| AU474237B2 (en) | 1976-07-15 |
| IT991661B (it) | 1975-08-30 |
| NL7309396A (show.php) | 1974-01-08 |
| JPS5820919B2 (ja) | 1983-04-26 |
| CH578612A5 (show.php) | 1976-08-13 |
| CS191901B2 (en) | 1979-07-31 |
| US3986908A (en) | 1976-10-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2334063C3 (de) | Kompositpulver | |
| DE69103720T2 (de) | Zündmittelzusammensetzung für Gasaufblasvorrichtung. | |
| DE69004787T2 (de) | Gaserzeugende Azid enthaltende Zusammensetzung für aufblasbare Vorrichtungen. | |
| DE69830372T2 (de) | Gaserzeugende zusammensetzung und formmasse davon | |
| DE69424041T2 (de) | Zündmittelzusammensetzungen für airbag-gasgeneratoren | |
| DE3602731A1 (de) | Zusammensetzung und verfahren zur erzeugung von stickstoffgas | |
| DE60112231T2 (de) | Kohlenwasserstoffbindemittel enthaltende pyrotechnische gaserzeugende Zusammensetzungen und Verfahren zur kontinuierlichen Herstellung | |
| DE69323410T2 (de) | Gaserzeugungsmittel für airbags | |
| DE2435648A1 (de) | Zusammensetzung und verfahren fuer die aufblaehung von passiven zurueckhaltesystemen | |
| DE112005000805T5 (de) | Gaserzeugungssystem | |
| AT525440B1 (de) | Plastische Sprengstoff-Zusammensetzung | |
| DE3316676C2 (de) | Treibstoffzusammensetzung | |
| DE69008341T2 (de) | Rauchproduzierende, giessbare, pyrotechnische Zusammensetzungen. | |
| DE3113010A1 (de) | "doppelbasige festtreibstoffe mit verbessertem abbrandverhalten" | |
| DE3723118C2 (de) | Nitrocellulose-Treibstoffgemisch | |
| US4057441A (en) | Solid propellant with burning rate catalyst | |
| DE112007001437T5 (de) | Thermisch initiierbare pyrotechnische Zusammensetzungen, Verwendung | |
| DE2530209A1 (de) | Brandmittel-zusammensetzung | |
| DE2329558C3 (de) | Gießfähige Gasgeneratortreibstoffe | |
| US2995430A (en) | Composite propellant reinforced with | |
| DE102010052628A1 (de) | Perchloratfreie pyrotechnische Mischung | |
| DE60012933T2 (de) | Zusammengesetztes, gaserzeugendes material für gasbetriebene fahrzeugsicherheitseinrichtungen | |
| DE102012005759A1 (de) | Gaserzeugende zusammensetzung | |
| DE2448615C3 (de) | Feste Treibmittel und ihre Verwendung | |
| DE112004000230T5 (de) | Phasenstabilisiertes Ammoniumnitrat |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |