DE2332747A1 - Verfahren zur hydroxylierung aromatischer verbindungen - Google Patents
Verfahren zur hydroxylierung aromatischer verbindungenInfo
- Publication number
- DE2332747A1 DE2332747A1 DE19732332747 DE2332747A DE2332747A1 DE 2332747 A1 DE2332747 A1 DE 2332747A1 DE 19732332747 DE19732332747 DE 19732332747 DE 2332747 A DE2332747 A DE 2332747A DE 2332747 A1 DE2332747 A1 DE 2332747A1
- Authority
- DE
- Germany
- Prior art keywords
- acid
- hydrogen peroxide
- molar ratio
- hydroxylation
- metal ion
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 29
- 150000001491 aromatic compounds Chemical class 0.000 title claims description 14
- 230000033444 hydroxylation Effects 0.000 title claims description 10
- 238000005805 hydroxylation reaction Methods 0.000 title claims description 10
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 31
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 26
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 18
- 238000006243 chemical reaction Methods 0.000 claims description 18
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 claims description 13
- 239000002253 acid Substances 0.000 claims description 13
- 235000019253 formic acid Nutrition 0.000 claims description 13
- 235000011007 phosphoric acid Nutrition 0.000 claims description 10
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 9
- 239000012429 reaction media Substances 0.000 claims description 8
- XPPKVPWEQAFLFU-UHFFFAOYSA-N diphosphoric acid Chemical compound OP(O)(=O)OP(O)(O)=O XPPKVPWEQAFLFU-UHFFFAOYSA-N 0.000 claims description 7
- 229910021645 metal ion Inorganic materials 0.000 claims description 7
- 229940005657 pyrophosphoric acid Drugs 0.000 claims description 7
- OXNIZHLAWKMVMX-UHFFFAOYSA-N picric acid Chemical compound OC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-N 0.000 claims description 4
- LJGHYPLBDBRCRZ-UHFFFAOYSA-N 3-(3-aminophenyl)sulfonylaniline Chemical compound NC1=CC=CC(S(=O)(=O)C=2C=C(N)C=CC=2)=C1 LJGHYPLBDBRCRZ-UHFFFAOYSA-N 0.000 claims description 3
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 3
- 238000011065 in-situ storage Methods 0.000 claims description 3
- 230000002378 acidificating effect Effects 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 150000007522 mineralic acids Chemical class 0.000 claims description 2
- 150000007524 organic acids Chemical class 0.000 claims description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims 3
- 239000011230 binding agent Substances 0.000 claims 3
- 150000002148 esters Chemical class 0.000 claims 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 9
- 229910052760 oxygen Inorganic materials 0.000 description 9
- 239000001301 oxygen Substances 0.000 description 9
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 8
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 8
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 6
- 239000003153 chemical reaction reagent Substances 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 239000008139 complexing agent Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- -1 aliphatic peracid Chemical class 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- LHGVFZTZFXWLCP-UHFFFAOYSA-N guaiacol Chemical compound COC1=CC=CC=C1O LHGVFZTZFXWLCP-UHFFFAOYSA-N 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229940069428 antacid Drugs 0.000 description 1
- 239000003159 antacid agent Substances 0.000 description 1
- 230000001458 anti-acid effect Effects 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- YTFJQDNGSQJFNA-UHFFFAOYSA-N benzyl dihydrogen phosphate Chemical class OP(O)(=O)OCC1=CC=CC=C1 YTFJQDNGSQJFNA-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 230000009918 complex formation Effects 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 150000001896 cresols Chemical class 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 239000007857 degradation product Substances 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 229960001867 guaiacol Drugs 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- TUJKJAMUKRIRHC-UHFFFAOYSA-N hydroxyl Chemical compound [OH] TUJKJAMUKRIRHC-UHFFFAOYSA-N 0.000 description 1
- 238000013383 initial experiment Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 150000004967 organic peroxy acids Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229930195143 oxyphenol Natural products 0.000 description 1
- NWVVVBRKAWDGAB-UHFFFAOYSA-N p-methoxyphenol Chemical compound COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 1
- DLRJIFUOBPOJNS-UHFFFAOYSA-N phenetole Chemical compound CCOC1=CC=CC=C1 DLRJIFUOBPOJNS-UHFFFAOYSA-N 0.000 description 1
- 150000008379 phenol ethers Chemical class 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000004053 quinones Chemical class 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C37/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring
- C07C37/60—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by oxidation reactions introducing directly hydroxy groups on a =CH-group belonging to a six-membered aromatic ring with the aid of other oxidants than molecular oxygen or their mixtures with molecular oxygen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7223175A FR2190787B1 (enExample) | 1972-06-27 | 1972-06-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2332747A1 true DE2332747A1 (de) | 1974-01-10 |
Family
ID=9100884
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19732332747 Pending DE2332747A1 (de) | 1972-06-27 | 1973-06-27 | Verfahren zur hydroxylierung aromatischer verbindungen |
Country Status (14)
| Country | Link |
|---|---|
| JP (1) | JPS4962430A (enExample) |
| AR (1) | AR195023A1 (enExample) |
| AU (1) | AU5733373A (enExample) |
| BE (1) | BE801462A (enExample) |
| BR (1) | BR7304692D0 (enExample) |
| CH (1) | CH575359A5 (enExample) |
| DD (1) | DD104285A5 (enExample) |
| DE (1) | DE2332747A1 (enExample) |
| FR (1) | FR2190787B1 (enExample) |
| GB (1) | GB1428271A (enExample) |
| IT (1) | IT990733B (enExample) |
| LU (1) | LU67874A1 (enExample) |
| NL (1) | NL7308513A (enExample) |
| PL (1) | PL85551B1 (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0074162A1 (en) * | 1981-09-08 | 1983-03-16 | Mitsubishi Gas Chemical Company, Inc. | Process for producing p-cresol |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5833207B2 (ja) * | 1975-08-28 | 1983-07-18 | 工業技術院長 | ニカフエノ−ルノセイゾウホウホウ |
| JPS5265232A (en) * | 1975-11-21 | 1977-05-30 | Ube Ind Ltd | Industrial preparation of divalent phenols |
| DE2942366A1 (de) * | 1979-10-19 | 1981-04-30 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung mehrwertiger phenole |
| US6323377B1 (en) | 1995-06-07 | 2001-11-27 | Syngenta Participations Ag | Oxidation process |
| WO1998047843A1 (en) * | 1997-04-17 | 1998-10-29 | Novartis Ag | Process for the hydroxylation of 1,4-dichlorobenzene |
-
1964
- 1964-09-09 BE BE132740A patent/BE801462A/xx unknown
-
1972
- 1972-06-27 FR FR7223175A patent/FR2190787B1/fr not_active Expired
-
1973
- 1973-06-19 NL NL7308513A patent/NL7308513A/xx unknown
- 1973-06-22 DD DD17176973A patent/DD104285A5/xx unknown
- 1973-06-23 PL PL16354273A patent/PL85551B1/pl unknown
- 1973-06-25 JP JP7161273A patent/JPS4962430A/ja active Pending
- 1973-06-25 AU AU57333/73A patent/AU5733373A/en not_active Expired
- 1973-06-26 GB GB3037173A patent/GB1428271A/en not_active Expired
- 1973-06-26 AR AR24875473A patent/AR195023A1/es active
- 1973-06-26 CH CH929473A patent/CH575359A5/xx not_active IP Right Cessation
- 1973-06-26 BR BR469273A patent/BR7304692D0/pt unknown
- 1973-06-26 LU LU67874D patent/LU67874A1/xx unknown
- 1973-06-27 IT IT2593473A patent/IT990733B/it active
- 1973-06-27 DE DE19732332747 patent/DE2332747A1/de active Pending
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0074162A1 (en) * | 1981-09-08 | 1983-03-16 | Mitsubishi Gas Chemical Company, Inc. | Process for producing p-cresol |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2190787B1 (enExample) | 1974-07-26 |
| GB1428271A (en) | 1976-03-17 |
| CH575359A5 (enExample) | 1976-05-14 |
| AU5733373A (en) | 1975-01-09 |
| AR195023A1 (es) | 1973-08-30 |
| PL85551B1 (enExample) | 1976-04-30 |
| BR7304692D0 (pt) | 1974-08-29 |
| BE801462A (fr) | 1973-12-26 |
| JPS4962430A (enExample) | 1974-06-17 |
| IT990733B (it) | 1975-07-10 |
| DD104285A5 (enExample) | 1974-03-05 |
| NL7308513A (enExample) | 1974-01-02 |
| FR2190787A1 (enExample) | 1974-02-01 |
| LU67874A1 (enExample) | 1974-01-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2064497C3 (de) | Verfahren zur Kernhydroxylierung von aromatischen Verbindungen | |
| DE2633302C2 (de) | Verfahren zur Herstellung von Phenolen durch Hydroxylierung von aromatischen Verbindungen | |
| EP0889019B1 (de) | Verfahren zur Herstellung von Cyclohexanonen durch Hydrierung der entsprechenden Phenole in Gegenwart von Alkanen als Lösungsmittel | |
| EP0255673B1 (de) | Verfahren zur Rückgewinnung von Rhodium aus Rhodiumkomplex-verbindungen enthaltenden wässrigen Lösungen | |
| DE2625108A1 (de) | Verfahren zum herstellen von methyltriacetoxysilan | |
| EP0632047B1 (de) | Verfahren zur Herstellung von sulfonierten Arylphosphinen | |
| DE2332747A1 (de) | Verfahren zur hydroxylierung aromatischer verbindungen | |
| DE2944295C2 (de) | Verfahren zur Herstellung von racemischer p-Hydroxy-Mandelsäure | |
| EP0367957B1 (de) | Verfahren zur Rückgewinnung von Rhodium | |
| DE2502953C2 (de) | N-Methylammonium-tris (methylenphosphonsäure) und Verfahren zu ihrer Herstellung | |
| DE2348957A1 (de) | Verfahren zur hydroxylierung aromatischer verbindungen | |
| EP1173450B1 (de) | Verfahren zur herstellung von sulfonierten arylphosphinen | |
| DE3228770A1 (de) | Verfahren zur selektiven herstellung von aldehyden | |
| DE69707008T2 (de) | Synthese von jodpropargylcarbamat in wässriger lösung | |
| DE1275059B (de) | Verfahren zur Herstellung von aliphatischen Hydroxydiphosphonsaeuren | |
| DE2108237A1 (de) | Pyridoxin alpha ketoglutarat und dessen Derivate sowie Verfahren zum Herstellen dieser Verbindungen | |
| DE3628664A1 (de) | Verfahren zur herstellung von 1,12-dodecandisaeure ii | |
| EP0322661B1 (de) | Verfahren zur Rückgewinnung von Rhodium aus Rhodiumkomplexverbindungen enthaltenden wässrigen Lösungen | |
| DE3312684A1 (de) | Verfahren zur herstellung von aethylenglykolmonoarylaethern | |
| DE899433C (de) | Verfahren zum Herstellen insekticider, im wesentlichen Octaalkyltetrapyrophosphorsaeureamie enthaltender Mischungen | |
| DE650380C (de) | Verfahren zur Darstellung von Morpholin bzw. 2, 6-Dimethylmorpholin | |
| DE2603269A1 (de) | Verfahren zur herstellung von cyclohexanon und alkylsubstituiertem oder unsubstituiertem phenol | |
| DE962527C (de) | Verfahren zur Herstellung von Oxyhydroperoxyden | |
| DE2360369A1 (de) | Verfahren zur oxydation von monosacchariden | |
| DE1418577C (de) | Verfahren zur Herstellung von kersubstituierten o-(alpha-Alkylol)-phenolen |