DE2331878B2 - Verfahren zur herstellung von diphenylamin und dessen derivaten - Google Patents
Verfahren zur herstellung von diphenylamin und dessen derivatenInfo
- Publication number
- DE2331878B2 DE2331878B2 DE19732331878 DE2331878A DE2331878B2 DE 2331878 B2 DE2331878 B2 DE 2331878B2 DE 19732331878 DE19732331878 DE 19732331878 DE 2331878 A DE2331878 A DE 2331878A DE 2331878 B2 DE2331878 B2 DE 2331878B2
- Authority
- DE
- Germany
- Prior art keywords
- diphenylamine
- derivatives
- hydrogen
- selectivity
- catalyst
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical compound C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 title claims description 22
- 238000000034 method Methods 0.000 title claims description 14
- 238000004519 manufacturing process Methods 0.000 title description 2
- 150000002466 imines Chemical class 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 2
- 238000006243 chemical reaction Methods 0.000 description 19
- 239000003054 catalyst Substances 0.000 description 18
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 12
- 239000001257 hydrogen Substances 0.000 description 12
- 229910052739 hydrogen Inorganic materials 0.000 description 12
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 8
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- 238000006356 dehydrogenation reaction Methods 0.000 description 5
- 239000003085 diluting agent Substances 0.000 description 5
- RPFGCUFAJAQNLJ-UHFFFAOYSA-N n-phenylcyclohexanimine Chemical compound C1CCCCC1=NC1=CC=CC=C1 RPFGCUFAJAQNLJ-UHFFFAOYSA-N 0.000 description 4
- 239000011261 inert gas Substances 0.000 description 3
- ZNLHZWKOQDHTSK-UHFFFAOYSA-N 2-ethyl-n-phenylaniline Chemical compound CCC1=CC=CC=C1NC1=CC=CC=C1 ZNLHZWKOQDHTSK-UHFFFAOYSA-N 0.000 description 2
- DIPQESUZKQIFFL-UHFFFAOYSA-N 3-(cyclohexylideneamino)-N,N-dimethylaniline Chemical compound C1(CCCCC1)=NC1=CC(=CC=C1)N(C)C DIPQESUZKQIFFL-UHFFFAOYSA-N 0.000 description 2
- AGHYMXKKEXDUTA-UHFFFAOYSA-N 4-methyl-n-phenylaniline Chemical compound C1=CC(C)=CC=C1NC1=CC=CC=C1 AGHYMXKKEXDUTA-UHFFFAOYSA-N 0.000 description 2
- 229910017813 Cu—Cr Inorganic materials 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- -1 ammonium halides Chemical class 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 239000007791 liquid phase Substances 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- MBTLJTKXUUPKLV-UHFFFAOYSA-N n-(2-ethylphenyl)cyclohexanimine Chemical compound CCC1=CC=CC=C1N=C1CCCCC1 MBTLJTKXUUPKLV-UHFFFAOYSA-N 0.000 description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000012808 vapor phase Substances 0.000 description 2
- KRKCQGKWPXGWLP-UHFFFAOYSA-N 3-n,3-n-dimethyl-1-n-phenylbenzene-1,3-diamine Chemical compound CN(C)C1=CC=CC(NC=2C=CC=CC=2)=C1 KRKCQGKWPXGWLP-UHFFFAOYSA-N 0.000 description 1
- OBHGSIGHEBGGFS-UHFFFAOYSA-N 4-methoxy-n-phenylaniline Chemical compound C1=CC(OC)=CC=C1NC1=CC=CC=C1 OBHGSIGHEBGGFS-UHFFFAOYSA-N 0.000 description 1
- WUTLSQXYESXYAE-UHFFFAOYSA-N 4-methyl-n-phenylcyclohexan-1-imine Chemical compound C1CC(C)CCC1=NC1=CC=CC=C1 WUTLSQXYESXYAE-UHFFFAOYSA-N 0.000 description 1
- 229910004298 SiO 2 Inorganic materials 0.000 description 1
- 229910010413 TiO 2 Inorganic materials 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000011707 mineral Chemical class 0.000 description 1
- ONWDRYHADDRYDR-UHFFFAOYSA-N n-(4-methoxyphenyl)cyclohexanimine Chemical compound C1=CC(OC)=CC=C1N=C1CCCCC1 ONWDRYHADDRYDR-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C209/00—Preparation of compounds containing amino groups bound to a carbon skeleton
- C07C209/68—Preparation of compounds containing amino groups bound to a carbon skeleton from amines, by reactions not involving amino groups, e.g. reduction of unsaturated amines, aromatisation, or substitution of the carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT26170/72A IT961240B (it) | 1972-06-24 | 1972-06-24 | Procedimento per la produzione di difenilammina e suoi derivati |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2331878A1 DE2331878A1 (de) | 1974-01-17 |
| DE2331878B2 true DE2331878B2 (de) | 1976-03-04 |
Family
ID=11218821
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19732331878 Withdrawn DE2331878B2 (de) | 1972-06-24 | 1973-06-22 | Verfahren zur herstellung von diphenylamin und dessen derivaten |
Country Status (25)
| Country | Link |
|---|---|
| JP (1) | JPS4949925A (OSRAM) |
| AR (1) | AR201830A1 (OSRAM) |
| AT (1) | AT323717B (OSRAM) |
| BE (1) | BE801096A (OSRAM) |
| BG (1) | BG25789A3 (OSRAM) |
| BR (1) | BR7304614D0 (OSRAM) |
| CA (1) | CA998693A (OSRAM) |
| CH (1) | CH574902A5 (OSRAM) |
| DD (1) | DD104508A5 (OSRAM) |
| DE (1) | DE2331878B2 (OSRAM) |
| ES (1) | ES416626A1 (OSRAM) |
| FR (1) | FR2189377B1 (OSRAM) |
| GB (1) | GB1382206A (OSRAM) |
| IE (1) | IE38691B1 (OSRAM) |
| IT (1) | IT961240B (OSRAM) |
| LU (1) | LU67838A1 (OSRAM) |
| NL (1) | NL150425B (OSRAM) |
| NO (1) | NO137194C (OSRAM) |
| PH (1) | PH9359A (OSRAM) |
| PL (1) | PL81082B1 (OSRAM) |
| RO (1) | RO62809A (OSRAM) |
| SE (1) | SE396596B (OSRAM) |
| TR (1) | TR17477A (OSRAM) |
| ZA (1) | ZA733781B (OSRAM) |
| ZM (1) | ZM10073A1 (OSRAM) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0051802A1 (de) * | 1980-11-06 | 1982-05-19 | Hoechst Aktiengesellschaft | Verfahren zur Herstellung von aromatischen Aminen |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2520893C2 (de) * | 1975-05-10 | 1982-03-11 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Diphenylamin |
| DE3041836A1 (de) * | 1980-11-06 | 1982-06-09 | Hoechst Ag, 6000 Frankfurt | Verfahren zur herstellung von aromatischen aminen |
| FR2659652B1 (fr) * | 1990-03-13 | 1992-07-03 | Rhone Poulenc Chimie | Procede de preparation de n-phenyl benzoquinone-imine. |
| US5196592A (en) * | 1991-01-10 | 1993-03-23 | Bayer Aktiengesellschaft | Process for the preparation of diphenylamines |
| DE4100514A1 (de) * | 1991-01-10 | 1992-07-16 | Bayer Ag | Verfahren zur herstellung von diphenylaminen |
| DE4132945A1 (de) * | 1991-10-04 | 1993-04-08 | Bayer Ag | Verfahren zur herstellung von diphenylaminen |
| DE4224366A1 (de) * | 1992-07-23 | 1994-01-27 | Bayer Ag | Verfahren zur Herstellung von Diphenylaminen |
| US5536878A (en) * | 1992-08-11 | 1996-07-16 | Mitsui Toatsu Chemicals, Inc. | Method for preparing aromatic secondary amino compound |
| US5382690A (en) * | 1992-08-11 | 1995-01-17 | Mitsui Toatsu Chemicals, Incorporated | Method for preparing aromatic secondary amino compound |
-
1972
- 1972-06-24 IT IT26170/72A patent/IT961240B/it active
-
1973
- 1973-04-17 AR AR247611A patent/AR201830A1/es active
- 1973-05-22 TR TR17477A patent/TR17477A/xx unknown
- 1973-06-05 ZA ZA733781A patent/ZA733781B/xx unknown
- 1973-06-11 IE IE947/73A patent/IE38691B1/xx unknown
- 1973-06-11 RO RO7300075104A patent/RO62809A/ro unknown
- 1973-06-12 GB GB2797373A patent/GB1382206A/en not_active Expired
- 1973-06-15 ZM ZM100/73*UA patent/ZM10073A1/xx unknown
- 1973-06-15 PH PH14729*UA patent/PH9359A/en unknown
- 1973-06-18 FR FR7322029A patent/FR2189377B1/fr not_active Expired
- 1973-06-19 BE BE1005174A patent/BE801096A/xx unknown
- 1973-06-20 BR BR4614/73A patent/BR7304614D0/pt unknown
- 1973-06-20 LU LU67838A patent/LU67838A1/xx unknown
- 1973-06-21 CH CH900373A patent/CH574902A5/xx not_active IP Right Cessation
- 1973-06-21 CA CA174,598A patent/CA998693A/en not_active Expired
- 1973-06-21 NO NO2574/73A patent/NO137194C/no unknown
- 1973-06-22 DE DE19732331878 patent/DE2331878B2/de not_active Withdrawn
- 1973-06-22 DD DD171773A patent/DD104508A5/xx unknown
- 1973-06-22 AT AT552773A patent/AT323717B/de not_active IP Right Cessation
- 1973-06-22 JP JP48069954A patent/JPS4949925A/ja active Pending
- 1973-06-22 PL PL1973163514A patent/PL81082B1/pl unknown
- 1973-06-23 BG BG023958A patent/BG25789A3/xx unknown
- 1973-06-23 ES ES416626A patent/ES416626A1/es not_active Expired
- 1973-06-25 SE SE7308920A patent/SE396596B/xx unknown
- 1973-06-25 NL NL737308824A patent/NL150425B/xx unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0051802A1 (de) * | 1980-11-06 | 1982-05-19 | Hoechst Aktiengesellschaft | Verfahren zur Herstellung von aromatischen Aminen |
Also Published As
| Publication number | Publication date |
|---|---|
| BR7304614D0 (pt) | 1974-08-29 |
| FR2189377B1 (OSRAM) | 1978-03-17 |
| PL81082B1 (OSRAM) | 1975-08-30 |
| DD104508A5 (OSRAM) | 1974-03-12 |
| TR17477A (tr) | 1975-07-23 |
| NO137194B (no) | 1977-10-10 |
| ZM10073A1 (en) | 1974-05-21 |
| RO62809A (fr) | 1978-05-15 |
| AU5587973A (en) | 1974-11-21 |
| NO137194C (no) | 1978-01-18 |
| NL7308824A (OSRAM) | 1973-12-28 |
| NL150425B (nl) | 1976-08-16 |
| PH9359A (en) | 1975-10-09 |
| GB1382206A (en) | 1975-01-29 |
| AT323717B (de) | 1975-07-25 |
| CA998693A (en) | 1976-10-19 |
| ES416626A1 (es) | 1976-02-16 |
| DE2331878A1 (de) | 1974-01-17 |
| SE396596B (sv) | 1977-09-26 |
| BE801096A (fr) | 1973-10-15 |
| FR2189377A1 (OSRAM) | 1974-01-25 |
| IE38691B1 (en) | 1978-05-10 |
| LU67838A1 (OSRAM) | 1973-08-28 |
| IT961240B (it) | 1973-12-10 |
| BG25789A3 (en) | 1978-12-12 |
| JPS4949925A (OSRAM) | 1974-05-15 |
| IE38691L (en) | 1973-12-24 |
| ZA733781B (en) | 1974-09-25 |
| CH574902A5 (OSRAM) | 1976-04-30 |
| AR201830A1 (es) | 1975-04-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0355351A2 (de) | Verfahren zur Herstellung von Aminen | |
| DE2020865A1 (de) | Verfahren zur Herstellung von alpha,ss-ungesaettigten Carbonylverbindungen | |
| DE2331878A1 (de) | Verfahren zur herstellung von diphenylamin und dessen derivaten | |
| EP0800507A1 (de) | Verfahren zur herstellung von aliphatischen alpha, omega-aminonitrilen | |
| DE2535725A1 (de) | Verfahren zur herstellung langkettiger tertiaerer amine | |
| DE2520893A1 (de) | Verfahren zur herstellung von diphenylamin | |
| DE2551055A1 (de) | Verfahren zur herstellung von 1,3- oder 1,4-bis-(aminomethyl)-cyclohexan | |
| DE3886501T2 (de) | Verfahren zur Synthese von N,N-Dialkylhydroxylaminen. | |
| DE2061709C3 (de) | Verfahren zur Herstellung von N-Methylanilin | |
| EP0135833B1 (de) | Verfahren zur Herstellung von 2-Amino-alkylpyridinen | |
| DE2437983A1 (de) | Verfahren zur herstellung von resorcinen | |
| DE2547654C2 (de) | Herstellung von 2-Amino-1-alkoholen und 3-Oxalin-Derivate | |
| DE69901192T2 (de) | Verfahren zur herstellung von cyclopropanmethylamin | |
| DE2121325C2 (de) | Verfahren zur Herstellung von Methoxypropionitril | |
| DE2630562C2 (de) | Verfahren zur katalytischen Hydrierung von Perfluoralkyl-substituierten Anilinen | |
| DE2329923C3 (de) | Verfahren zur Herstellung von 5-Oxohexannitri! | |
| DE69123742T2 (de) | Verfahren zur herstellung von 2-methyl-3,5-dialkylpyridinen durch dealkylierung mit schwefel | |
| DE2348536C3 (de) | Verfahren zur Herstellung von 5-Oxocarbonsäuren | |
| DE4210311A1 (de) | Verfahren zur Herstellung von Aminen aus Azinen | |
| DE3020298C2 (de) | Verfahren zur Herstellung von 2,2,4,5,5-Pentamethyl-3-formyl-3-pyrrolin | |
| DE2143846C3 (de) | Verfahren zur Herstellung von Indol aus o-Äthylanilin | |
| WO1993013047A1 (de) | Verfahren zur herstellung von dibenzylamin | |
| DE69316825T2 (de) | Prozess zur Herstellung von Diphenylamin oder kern-substitierten Derivaten | |
| DE2154482C3 (de) | Verfahren zur Herstellung von Indolderivaten | |
| DE2732409A1 (de) | Verfahren zur herstellung von diaminoalkoxybenzolen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| BHJ | Nonpayment of the annual fee |