DE2329782A1 - Gegen uv-licht stabilisierte kunststoffe - Google Patents
Gegen uv-licht stabilisierte kunststoffeInfo
- Publication number
- DE2329782A1 DE2329782A1 DE2329782A DE2329782A DE2329782A1 DE 2329782 A1 DE2329782 A1 DE 2329782A1 DE 2329782 A DE2329782 A DE 2329782A DE 2329782 A DE2329782 A DE 2329782A DE 2329782 A1 DE2329782 A1 DE 2329782A1
- Authority
- DE
- Germany
- Prior art keywords
- cyanoethyl
- bis
- phosphine oxide
- tris
- phosphine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000004033 plastic Substances 0.000 title claims description 7
- 229920003023 plastic Polymers 0.000 title claims description 7
- 239000003381 stabilizer Substances 0.000 claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 4
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical group [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 229910052717 sulfur Chemical group 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- 125000005041 acyloxyalkyl group Chemical group 0.000 claims 1
- 125000004432 carbon atom Chemical group C* 0.000 claims 1
- 125000004966 cyanoalkyl group Chemical group 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims 1
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 12
- -1 polyethylene Polymers 0.000 description 6
- MRVZORUPSXTRHD-UHFFFAOYSA-N bis(hydroxymethyl)phosphorylmethanol Chemical compound OCP(=O)(CO)CO MRVZORUPSXTRHD-UHFFFAOYSA-N 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 2
- 239000004743 Polypropylene Substances 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 239000011888 foil Substances 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- MPQXHAGKBWFSNV-UHFFFAOYSA-N oxidophosphanium Chemical group [PH3]=O MPQXHAGKBWFSNV-UHFFFAOYSA-N 0.000 description 2
- 150000003003 phosphines Chemical group 0.000 description 2
- 229920001155 polypropylene Polymers 0.000 description 2
- WSANLGASBHUYGD-UHFFFAOYSA-N sulfidophosphanium Chemical group S=[PH3] WSANLGASBHUYGD-UHFFFAOYSA-N 0.000 description 2
- UFGGBJYMEZXRLU-UHFFFAOYSA-N 1-methylphosphonoylethane Chemical compound CCP(C)=O UFGGBJYMEZXRLU-UHFFFAOYSA-N 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- XDILCINHTMZTGG-UHFFFAOYSA-N 3-(3-dodecoxy-3-oxopropyl)sulfanylpropanoic acid Chemical compound CCCCCCCCCCCCOC(=O)CCSCCC(O)=O XDILCINHTMZTGG-UHFFFAOYSA-N 0.000 description 1
- SJNRUDFVMRFAJV-UHFFFAOYSA-N 3-[(2-chloro-1-hydroxyethyl)-(2-cyanoethyl)phosphoryl]propanenitrile Chemical compound N#CCCP(=O)(C(CCl)O)CCC#N SJNRUDFVMRFAJV-UHFFFAOYSA-N 0.000 description 1
- QDKWTQLUXUYCSJ-UHFFFAOYSA-N 3-[2-cyanoethyl(1-hydroxyethyl)phosphoryl]propanenitrile Chemical compound N#CCCP(=O)(C(O)C)CCC#N QDKWTQLUXUYCSJ-UHFFFAOYSA-N 0.000 description 1
- IIYQTXPLWMEKKO-UHFFFAOYSA-N 3-[2-cyanoethyl(hydroxymethyl)phosphinothioyl]propanenitrile Chemical compound N#CCCP(=S)(CO)CCC#N IIYQTXPLWMEKKO-UHFFFAOYSA-N 0.000 description 1
- HRBZADSIMQYHBU-UHFFFAOYSA-N 3-[2-cyanoethyl(hydroxymethyl)phosphoryl]propanenitrile Chemical compound N#CCCP(=O)(CO)CCC#N HRBZADSIMQYHBU-UHFFFAOYSA-N 0.000 description 1
- BATQYEHBJXWTRT-UHFFFAOYSA-N 3-[2-cyanoethyl-(2,2,2-trichloro-1-hydroxyethyl)phosphoryl]propanenitrile Chemical compound N#CCCP(=O)(C(C(Cl)(Cl)Cl)O)CCC#N BATQYEHBJXWTRT-UHFFFAOYSA-N 0.000 description 1
- BGDPNTJHBNRBIY-UHFFFAOYSA-N 3-[[1-(4-bromophenyl)-1-hydroxyethyl]-(2-cyanoethyl)phosphoryl]propanenitrile Chemical compound N#CCCP(=O)(CCC#N)C(O)(C)C1=CC=C(Br)C=C1 BGDPNTJHBNRBIY-UHFFFAOYSA-N 0.000 description 1
- YHGRWKREYGXJFH-UHFFFAOYSA-N 3-[bis(2-cyanoethyl)phosphinothioyl]propanenitrile Chemical compound N#CCCP(=S)(CCC#N)CCC#N YHGRWKREYGXJFH-UHFFFAOYSA-N 0.000 description 1
- ILFYYSUCZQEGOL-UHFFFAOYSA-N 3-[bis(2-cyanoethyl)phosphoryl]propanenitrile Chemical compound N#CCCP(=O)(CCC#N)CCC#N ILFYYSUCZQEGOL-UHFFFAOYSA-N 0.000 description 1
- JSFITYFUKSFPBZ-UHFFFAOYSA-N 4-(7-methyloctyl)phenol Chemical compound CC(C)CCCCCCC1=CC=C(O)C=C1 JSFITYFUKSFPBZ-UHFFFAOYSA-N 0.000 description 1
- LCWUGPGYLAQXRB-UHFFFAOYSA-N C(CCCCCCCCCCCCCCCCC)(=O)OC(OC(CCCCCCCCCCCCCCCCC)=O)(OC(CCCCCCCCCCCCCCCCC)=O)[PH2]=O Chemical compound C(CCCCCCCCCCCCCCCCC)(=O)OC(OC(CCCCCCCCCCCCCCCCC)=O)(OC(CCCCCCCCCCCCCCCCC)=O)[PH2]=O LCWUGPGYLAQXRB-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- BCVMCDJDUHGWCT-UHFFFAOYSA-N OCC[PH2]=O Chemical compound OCC[PH2]=O BCVMCDJDUHGWCT-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- 239000012963 UV stabilizer Substances 0.000 description 1
- PLXQNKOUNNCZGV-UHFFFAOYSA-N [di(octadecanoyloxy)-phosphanylmethyl] octadecanoate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OC(P)(OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC PLXQNKOUNNCZGV-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- UCXHFTRBPWTKQI-UHFFFAOYSA-N bis(acetyloxymethyl)phosphorylmethyl acetate Chemical compound CC(=O)OCP(=O)(COC(C)=O)COC(C)=O UCXHFTRBPWTKQI-UHFFFAOYSA-N 0.000 description 1
- GGECNORVQSLCLI-UHFFFAOYSA-N bis(chloromethyl)phosphoryl-chloromethane Chemical compound ClCP(=O)(CCl)CCl GGECNORVQSLCLI-UHFFFAOYSA-N 0.000 description 1
- JMXMXKRNIYCNRV-UHFFFAOYSA-N bis(hydroxymethyl)phosphanylmethanol Chemical compound OCP(CO)CO JMXMXKRNIYCNRV-UHFFFAOYSA-N 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 238000004898 kneading Methods 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- AUONHKJOIZSQGR-UHFFFAOYSA-N oxophosphane Chemical compound P=O AUONHKJOIZSQGR-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920001083 polybutene Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 150000004023 quaternary phosphonium compounds Chemical class 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- MDDUHVRJJAFRAU-YZNNVMRBSA-N tert-butyl-[(1r,3s,5z)-3-[tert-butyl(dimethyl)silyl]oxy-5-(2-diphenylphosphorylethylidene)-4-methylidenecyclohexyl]oxy-dimethylsilane Chemical compound C1[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)C(=C)\C1=C/CP(=O)(C=1C=CC=CC=1)C1=CC=CC=C1 MDDUHVRJJAFRAU-YZNNVMRBSA-N 0.000 description 1
- 229910052724 xenon Inorganic materials 0.000 description 1
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/49—Phosphorus-containing compounds
- C08K5/51—Phosphorus bound to oxygen
- C08K5/53—Phosphorus bound to oxygen bound to oxygen and to carbon only
- C08K5/5397—Phosphine oxides
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/49—Phosphorus-containing compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Priority Applications (9)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2329782A DE2329782A1 (de) | 1973-06-12 | 1973-06-12 | Gegen uv-licht stabilisierte kunststoffe |
| NL7407680A NL7407680A (enExample) | 1973-06-12 | 1974-06-07 | |
| ZA00743664A ZA743664B (en) | 1973-06-12 | 1974-06-10 | Plastic stabilized against ultraviolet radiation |
| AU69936/74A AU487738B2 (en) | 1973-06-12 | 1974-06-10 | Plastics stabilized against ultraviolet radiation |
| US05/477,834 US3931104A (en) | 1973-06-12 | 1974-06-10 | Plastics stabilized against ultraviolet radiation |
| IT23803/74A IT1014918B (it) | 1973-06-12 | 1974-06-10 | Materiali plastici stabilizzati contro la luce ultravioletta |
| JP49065649A JPS5035240A (enExample) | 1973-06-12 | 1974-06-11 | |
| GB2585074A GB1469810A (en) | 1973-06-12 | 1974-06-11 | Plastics materials stabilized against ultraviolet radiation |
| FR7420340A FR2233359B1 (enExample) | 1973-06-12 | 1974-06-12 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2329782A DE2329782A1 (de) | 1973-06-12 | 1973-06-12 | Gegen uv-licht stabilisierte kunststoffe |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2329782A1 true DE2329782A1 (de) | 1975-01-23 |
Family
ID=5883712
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2329782A Pending DE2329782A1 (de) | 1973-06-12 | 1973-06-12 | Gegen uv-licht stabilisierte kunststoffe |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3931104A (enExample) |
| JP (1) | JPS5035240A (enExample) |
| DE (1) | DE2329782A1 (enExample) |
| FR (1) | FR2233359B1 (enExample) |
| GB (1) | GB1469810A (enExample) |
| IT (1) | IT1014918B (enExample) |
| NL (1) | NL7407680A (enExample) |
| ZA (1) | ZA743664B (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4115349A (en) * | 1977-08-03 | 1978-09-19 | Phillips Petroleum Company | Triphenylphosphine oxide as a promoter for phosphorus-containing flame retardant |
| JPS6032768B2 (ja) * | 1979-03-30 | 1985-07-30 | 松下電器産業株式会社 | 高周波加熱装置 |
| US4278588A (en) * | 1979-09-24 | 1981-07-14 | American Cyanamid Company | Phosphine oxide flame retarded, rubber-modified, polyphenylene ether resin compositions |
| US4255324A (en) * | 1979-10-18 | 1981-03-10 | American Cyanamid Company | Synergistic flame retardant compositions for polyphenylene ether resins |
| US4301057A (en) * | 1980-01-28 | 1981-11-17 | Fmc Corporation | Tris-(3-hydroxyalkyl) phosphine oxide flame retardant compositions |
| US4341696A (en) * | 1980-01-28 | 1982-07-27 | Fmc Corporation | Tris-(3-hydroxyalkyl) phosphine oxide flame retardant compositions |
| US4287119A (en) * | 1980-02-04 | 1981-09-01 | Fmc Corporation | 3-Hydroxyalkyl phosphine oxide flame retardant compositions |
| US4357433A (en) * | 1981-06-12 | 1982-11-02 | Fmc Corporation | Flame retardant polyphenylene ether resin compositions |
| US4343914A (en) * | 1981-07-22 | 1982-08-10 | Fmc Corporation | Flame retardant polyurethane containing alkyl bis(3-hydroxypropyl) phosphine oxide |
| US4485262A (en) * | 1982-05-26 | 1984-11-27 | Fmc Corporation | s-Butyl bis(3-hydroxypropyl) phosphine oxide |
| US5158999A (en) * | 1990-08-13 | 1992-10-27 | Minnesota Mining And Manufacturing Company | Flame retardants |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1289653B (de) * | 1963-09-25 | 1969-02-20 | Basf Ag | Schwer entflammbare Formmassen aus Styrolpolymerisaten |
| US3341625A (en) * | 1966-09-15 | 1967-09-12 | American Cyanamid Co | Phosphine oxides as flame-retardant agents for thermoplastic products |
| DE1694156B2 (de) * | 1967-06-09 | 1975-11-06 | Bayer Ag, 5090 Leverkusen | Lichtstabilisierte Polyamide |
| US3532668A (en) * | 1968-07-01 | 1970-10-06 | American Cyanamid Co | Synergistic flame-retardant compositions |
| US3676393A (en) * | 1968-10-14 | 1972-07-11 | Goodyear Tire & Rubber | Polyesters stabilized by phosphorus compounds |
| US3629365A (en) * | 1970-09-14 | 1971-12-21 | Akzona Inc | Flame retardant polyesters containing polyamides and phosphine oxides |
-
1973
- 1973-06-12 DE DE2329782A patent/DE2329782A1/de active Pending
-
1974
- 1974-06-07 NL NL7407680A patent/NL7407680A/xx unknown
- 1974-06-10 US US05/477,834 patent/US3931104A/en not_active Expired - Lifetime
- 1974-06-10 ZA ZA00743664A patent/ZA743664B/xx unknown
- 1974-06-10 IT IT23803/74A patent/IT1014918B/it active
- 1974-06-11 GB GB2585074A patent/GB1469810A/en not_active Expired
- 1974-06-11 JP JP49065649A patent/JPS5035240A/ja active Pending
- 1974-06-12 FR FR7420340A patent/FR2233359B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US3931104A (en) | 1976-01-06 |
| ZA743664B (en) | 1975-07-30 |
| IT1014918B (it) | 1977-04-30 |
| AU6993674A (en) | 1975-12-11 |
| FR2233359A1 (enExample) | 1975-01-10 |
| NL7407680A (enExample) | 1974-12-16 |
| FR2233359B1 (enExample) | 1978-01-13 |
| GB1469810A (en) | 1977-04-06 |
| JPS5035240A (enExample) | 1975-04-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2329782A1 (de) | Gegen uv-licht stabilisierte kunststoffe | |
| DE1769646B2 (de) | Stabilisierung von synthetischen Polymeren | |
| DE1469941A1 (de) | Stabilisierte halogenhaltige Polymerisatkunststoffmassen | |
| DE4222423A1 (de) | Lichtempfindliche masse | |
| DE1569595A1 (de) | Lichtstabilisierte Polymermassen | |
| DE69624478T2 (de) | Thermisch stabile antistatische agenzien | |
| DE3877251T2 (de) | Fluor enthaltendes a-b-blockkopolymer. | |
| DE1239848B (de) | Stabilisierte Formmassen aus festen Olefinpolymerisaten | |
| DE1694692A1 (de) | Gegen Hitzeeinwirkung stabilisierte Formmassen auf der Grundlage von Polyphenylenaethern | |
| CH676242A5 (enExample) | ||
| DE3702209C2 (enExample) | ||
| DE2834871A1 (de) | Arylphosphonite und arylthiophosphonite, deren herstellung und verwendung als antioxydantien | |
| DE3603738C2 (enExample) | ||
| EP0638106B1 (de) | Aminoverbindungen als verarbeitungsstabilisatoren für thermoplastische kunststoffe | |
| DE1265407B (de) | Selbsterloeschende Formmassen aus alkenylaromatischen Polymerisaten | |
| DE2330979A1 (de) | Gegen uv-licht stabilisierte kunststoffmassen | |
| EP0086990A1 (de) | Witterungsstabile Polyamide | |
| DE1231893B (de) | Thermoplastische Massen zur Herstellung stabilisierter Formkoerper oder UEberzuege aus Polymerisaten von alpha-Monoolefinen | |
| DE2811525A1 (de) | Polyphosphazen-zusammensetzungen, sie enthaltende kunststoffe und gegenstaende | |
| DE2054729A1 (de) | Verfahren zur Stabilisierung von Polymerzusammensetzungen | |
| DE1569222C (de) | Stabilisierte Vinylchlorid polymerisate fur Form , Preß und Uberzugszwecke | |
| DE1282920B (de) | Verfahren zum Stabilisieren von Polymerisaten aus Olefinen | |
| DE1618699A1 (de) | Verwendung von Organosilicium-Aminoverbindungen zum Stabilisieren von organischen Stoffen gegen den schaedlichen Einfluss von Waerme und bzw.oder Sauerstoff | |
| DE1669809B2 (de) | Verwendung von oligomeren als zusatz zu polymeren zum verringern der elektrostatischen aufladbarkeit | |
| CH628913A5 (en) | Process for the flameproofing of polymeric organic materials |