DE2325826C3 - Isocyanato-isocyanurate und Herstellung lagerstabiler Lösungen hiervon - Google Patents
Isocyanato-isocyanurate und Herstellung lagerstabiler Lösungen hiervonInfo
- Publication number
- DE2325826C3 DE2325826C3 DE2325826A DE2325826A DE2325826C3 DE 2325826 C3 DE2325826 C3 DE 2325826C3 DE 2325826 A DE2325826 A DE 2325826A DE 2325826 A DE2325826 A DE 2325826A DE 2325826 C3 DE2325826 C3 DE 2325826C3
- Authority
- DE
- Germany
- Prior art keywords
- solution
- temperature
- isocyanato
- trimerization
- mixture
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000004519 manufacturing process Methods 0.000 title description 4
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 35
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 24
- 125000001261 isocyanato group Chemical group *N=C=O 0.000 description 18
- 239000003054 catalyst Substances 0.000 description 17
- 238000005829 trimerization reaction Methods 0.000 description 17
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 description 15
- 239000012948 isocyanate Substances 0.000 description 14
- 150000002513 isocyanates Chemical class 0.000 description 13
- 239000000203 mixture Substances 0.000 description 11
- 239000011541 reaction mixture Substances 0.000 description 11
- 238000006116 polymerization reaction Methods 0.000 description 10
- 239000002904 solvent Substances 0.000 description 10
- SVONRAPFKPVNKG-UHFFFAOYSA-N 2-ethoxyethyl acetate Chemical compound CCOCCOC(C)=O SVONRAPFKPVNKG-UHFFFAOYSA-N 0.000 description 9
- 239000005058 Isophorone diisocyanate Substances 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- 125000005442 diisocyanate group Chemical group 0.000 description 9
- NIMLQBUJDJZYEJ-UHFFFAOYSA-N isophorone diisocyanate Chemical compound CC1(C)CC(N=C=O)CC(C)(CN=C=O)C1 NIMLQBUJDJZYEJ-UHFFFAOYSA-N 0.000 description 9
- 238000002474 experimental method Methods 0.000 description 8
- 238000004821 distillation Methods 0.000 description 7
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical group OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 description 7
- 238000000034 method Methods 0.000 description 7
- 238000009835 boiling Methods 0.000 description 6
- 239000011877 solvent mixture Substances 0.000 description 5
- 125000005270 trialkylamine group Chemical group 0.000 description 5
- 150000001541 aziridines Chemical class 0.000 description 4
- 239000005056 polyisocyanate Substances 0.000 description 4
- 229920001228 polyisocyanate Polymers 0.000 description 4
- 230000006641 stabilisation Effects 0.000 description 4
- 238000011105 stabilization Methods 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- -1 aromatic isocyanates Chemical class 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 239000004814 polyurethane Substances 0.000 description 3
- 229920002635 polyurethane Polymers 0.000 description 3
- 238000007669 thermal treatment Methods 0.000 description 3
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 235000013877 carbamide Nutrition 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000004132 cross linking Methods 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- 238000002845 discoloration Methods 0.000 description 2
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 2
- 238000006384 oligomerization reaction Methods 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 230000009257 reactivity Effects 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000013638 trimer Substances 0.000 description 2
- QGLRLXLDMZCFBP-UHFFFAOYSA-N 1,6-diisocyanato-2,4,4-trimethylhexane Chemical compound O=C=NCC(C)CC(C)(C)CCN=C=O QGLRLXLDMZCFBP-UHFFFAOYSA-N 0.000 description 1
- VYONOYYDEFODAJ-UHFFFAOYSA-N 2-(1-Aziridinyl)ethanol Chemical compound OCCN1CC1 VYONOYYDEFODAJ-UHFFFAOYSA-N 0.000 description 1
- 239000004971 Cross linker Substances 0.000 description 1
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 1
- 241001443715 Fusarium oxysporum f. sp. conglutinans Species 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 230000006750 UV protection Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 229920000180 alkyd Polymers 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 125000004069 aziridinyl group Chemical group 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 150000007973 cyanuric acids Chemical class 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 238000007700 distillative separation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 235000015096 spirit Nutrition 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 230000008646 thermal stress Effects 0.000 description 1
- 239000010409 thin film Substances 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/02—Polymeric products of isocyanates or isothiocyanates of isocyanates or isothiocyanates only
- C08G18/022—Polymeric products of isocyanates or isothiocyanates of isocyanates or isothiocyanates only the polymeric products containing isocyanurate groups
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyurethanes Or Polyureas (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Priority Applications (9)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2325826A DE2325826C3 (de) | 1973-05-22 | 1973-05-22 | Isocyanato-isocyanurate und Herstellung lagerstabiler Lösungen hiervon |
| GB2126374A GB1467953A (en) | 1973-05-22 | 1974-05-14 | Isocyanato-isocyanurates |
| US471723A US3919218A (en) | 1973-05-22 | 1974-05-20 | Stable polyisocyanates and process therefor |
| IT22937/74A IT1012630B (it) | 1973-05-22 | 1974-05-20 | Poliisocianato stabile alla conser vazione e procedimento per la sua preparazione |
| JP5622274A JPS5726514B2 (enExample) | 1973-05-22 | 1974-05-21 | |
| CA200,379A CA1037640A (en) | 1973-05-22 | 1974-05-21 | Storage stable polyisocyanates and manufacture thereof |
| NLAANVRAGE7406797,A NL178004C (nl) | 1973-05-22 | 1974-05-21 | Werkwijze voor het bereiden van een bij opslag stabiele isocyanato-isocyanuraatoplossing. |
| FR7417902A FR2230642B1 (enExample) | 1973-05-22 | 1974-05-22 | |
| BE193227A BE873888Q (fr) | 1973-05-22 | 1979-02-02 | Polyisocyanates stables au stockage et leur preparation |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2325826A DE2325826C3 (de) | 1973-05-22 | 1973-05-22 | Isocyanato-isocyanurate und Herstellung lagerstabiler Lösungen hiervon |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2325826A1 DE2325826A1 (de) | 1974-12-19 |
| DE2325826B2 DE2325826B2 (de) | 1980-05-22 |
| DE2325826C3 true DE2325826C3 (de) | 1981-01-29 |
Family
ID=5881676
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2325826A Expired DE2325826C3 (de) | 1973-05-22 | 1973-05-22 | Isocyanato-isocyanurate und Herstellung lagerstabiler Lösungen hiervon |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3919218A (enExample) |
| JP (1) | JPS5726514B2 (enExample) |
| BE (1) | BE873888Q (enExample) |
| CA (1) | CA1037640A (enExample) |
| DE (1) | DE2325826C3 (enExample) |
| FR (1) | FR2230642B1 (enExample) |
| GB (1) | GB1467953A (enExample) |
| IT (1) | IT1012630B (enExample) |
| NL (1) | NL178004C (enExample) |
Families Citing this family (51)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2551634C3 (de) * | 1975-11-18 | 1980-07-17 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Isocyanuratgruppen aufweisenden Polyisocyanaten |
| DE2616416C2 (de) * | 1976-04-14 | 1982-11-11 | Basf Ag, 6700 Ludwigshafen | 1,3,5-Tris-(N,N-dialkylaminoalkyl)-s- hexahydrotriazin-Anlagerungsverbindungen und ihre Verwendung als Trimerisierungskatalysatoren für Polyisocyanate |
| DE2641380C2 (de) * | 1976-09-15 | 1989-11-23 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Polyisocyanaten mit Isocyanuratstruktur |
| DE2644684C2 (de) * | 1976-10-02 | 1983-01-13 | Chemische Werke Huels Ag, 4370 Marl | Verfahren zur Herstellung von 2,4,6-Triketohexahydrotriazinen |
| DE2712931A1 (de) * | 1977-03-24 | 1978-09-28 | Veba Chemie Ag | Isocyanuratgruppen - und endstaendig- blockierte isocyanatgruppen - enthaltende verbindungen |
| DE2726749A1 (de) * | 1977-06-14 | 1979-01-04 | Veba Chemie Ag | Verfahren zur herstellung von 2,4,6- triketohexahydrotriazinen |
| DE2732662A1 (de) * | 1977-07-20 | 1979-02-01 | Veba Chemie Ag | Isocyanuratgruppen - und endstaendig- blockierte isocyanatgruppen-enthaltende verbindungen |
| DE2737211A1 (de) * | 1977-08-18 | 1979-03-01 | Bayer Ag | Verfahren zur herstellung von polyisocyanaten mit isocyanuratstruktur sowie ihre verwendung |
| DE2806731A1 (de) * | 1978-02-17 | 1979-08-23 | Bayer Ag | Verfahren zur herstellung von isocyanuratgruppen aufweisenden polyisocyanaten |
| US4283535A (en) * | 1978-05-13 | 1981-08-11 | Chemische Werke Huls Ag | Method for the production of 2,4,6-triketohexahydrotriazines |
| DE2901479A1 (de) * | 1979-01-16 | 1980-07-24 | Bayer Ag | Neue isocyanato-isocyanurate, ein verfahren zu ihrer herstellung, sowie ihre verwendung als isocyanatkomponente in polyurethan-lacken |
| ATE3979T1 (de) * | 1979-08-22 | 1983-07-15 | Chemische Werke Huels Ag | Isocyanatgruppenhaltige 2,4,6triketohexahydrotriazine und ein verfahren zu ihrer herstellung. |
| DE3033860A1 (de) * | 1980-09-09 | 1982-04-15 | Bayer Ag, 5090 Leverkusen | Neue isocyanato-isocyanurate, ein verfahren zu ihrer herstellung, sowie ihre verwendung als isocyanatkomponente in polyurethanlacken |
| DE3100262A1 (de) * | 1981-01-08 | 1982-08-05 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von isocyanuratgruppen aufweisenden polyisocyanaten, als katalysator-komponente fuer dieses verfahren geeignete loesungen, sowie die verwendung der verfahrensprodukte als isocyanat-komponente bei der herstellung von polyurethanen |
| DE3100263A1 (de) * | 1981-01-08 | 1982-08-12 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von isocyanuratgruppen aufweisenden polyisocyanaten und ihre verwendung bei der herstellung von polyurethanen |
| DE3144672A1 (de) * | 1981-11-10 | 1983-05-26 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von mischtrimerisaten organischer isocyanate, die nach dem verfahren erhaltenen mischtrimerisate, sowie ihre verwendung zur herstellung von polyurethanen |
| DE3151855C2 (de) * | 1981-12-30 | 1993-11-04 | Huels Chemische Werke Ag | Isocyanato-isocyanurate sowie ein verfahren zu deren herstellung |
| DE3226131A1 (de) * | 1982-07-13 | 1984-01-19 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von ueberzuegen |
| DE3227489A1 (de) * | 1982-07-23 | 1984-01-26 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von isocyanuratgruppen aufweisenden polyisocyanaten und ihre verwendung als isocyanatkomponente zur herstellung von polyurethanen |
| US4442256A (en) * | 1982-12-16 | 1984-04-10 | E. I. Du Pont De Nemours And Company | Additive for alkyd resin coating compositions |
| JPS59120615A (ja) * | 1982-12-27 | 1984-07-12 | Nippon Polyurethan Kogyo Kk | 耐熱性ポリイソシアヌレート重合体硬化物の製造方法 |
| JPS59221321A (ja) * | 1983-05-31 | 1984-12-12 | Nippon Polyurethan Kogyo Kk | ポリイソシアヌレ−ト系耐熱性樹脂の成形方法 |
| DE3322830A1 (de) * | 1983-06-24 | 1985-01-03 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von ueberzuegen |
| DE3322829A1 (de) * | 1983-06-24 | 1985-01-03 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von ueberzuegen |
| DE3325185A1 (de) * | 1983-07-13 | 1985-01-24 | Basf Ag, 6700 Ludwigshafen | In 3-stellung heterocyclische oder 3-dialkylamino-2,2-dialkyl-propylisocyanate und verfahren zur herstellung von in 3-stellung heterocyclischen oder 3-dialkylamino-2,2-dialkylpropylisocyanaten |
| DE3339579A1 (de) * | 1983-11-02 | 1985-05-09 | Bayer Ag, 5090 Leverkusen | Neue isocyanato-isocyanurate, ein verfahren zu ihrer herstellung sowie ihre verwendung als isocyanat-komponente in polyurethanlacken |
| DE3401345A1 (de) * | 1984-01-17 | 1985-07-25 | Chemische Werke Hüls AG, 4370 Marl | Formmassen auf basis von hochmolekularen poly(alkylenterephthalaten) |
| DE3406951A1 (de) * | 1984-02-25 | 1985-08-29 | Chemische Werke Hüls AG, 4370 Marl | Formmassen auf basis von hochmolekularen poly(etheresteramiden) |
| DE3418482A1 (de) * | 1984-05-18 | 1985-11-21 | Basf Ag, 6700 Ludwigshafen | Magnetische aufzeichnungstraeger |
| DE3507719A1 (de) * | 1985-03-05 | 1986-09-11 | Bayer Ag, 5090 Leverkusen | Isocyanuratgruppen aufweisende polyisocyanate, ein verfahren zu ihrer herstellung und ihre verwendung als isocyanatkomponente in polyurethanlacken |
| DE3541859A1 (de) * | 1985-11-27 | 1987-06-04 | Bayer Ag | Verfahren zur herstellung von isocyanuratgruppen aufweisenden polyisocyanaten und ihre verwendung als isocyanatkomponente in polyurethanlacken |
| DE3543925A1 (de) * | 1985-12-12 | 1987-06-19 | Bayer Ag | Verfahren zur herstellung von isocyanuratgruppen aufweisenden polyisocyanaten und ihre verwendung als isocyanatkomponente zur herstellung von polyurethanen |
| FR2607499A1 (fr) * | 1986-12-02 | 1988-06-03 | Rhone Poulenc Chimie | Polyisocyanates a groupement isocyanurique purs et procede d'obtention de ces polyisocyanates |
| US4855383A (en) * | 1988-09-23 | 1989-08-08 | Ashland Oil, Inc. | In situ quaternary ammonium catalyst formation for curing polymeric isocyanates |
| FI902321A7 (fi) * | 1989-05-19 | 1990-11-20 | Eisai Co Ltd | Buteenihappojohdannaiset |
| DE3938880A1 (de) * | 1989-11-24 | 1991-05-29 | Huels Chemische Werke Ag | Textile fixiereinlagen |
| DE4343885A1 (de) * | 1993-12-22 | 1995-06-29 | Hoechst Ag | Wäßrige, strahlenhärtbare Bindemitteldispersionen |
| DE4432644A1 (de) | 1994-09-14 | 1996-03-21 | Hoechst Ag | Ungesättigte Polyesterurethanacrylate als Bindemittel für Pulverlacke |
| DE4438430A1 (de) * | 1994-10-27 | 1996-05-02 | Hoechst Ag | Reaktive Emulgatoren auf Basis ungesättigter Polyurethane |
| DE4439421A1 (de) | 1994-11-04 | 1996-05-09 | Huels Chemische Werke Ag | Neue harnstoffgruppenhaltige Polyamine und Verfahren zu ihrer Herstellung |
| DE10008928A1 (de) | 2000-02-25 | 2001-08-30 | Degussa | Transparente oder pigmentierte Pulverlacke mit Vernetzern aus Hydroxyalkylamiden und blockierten, nicht aromatischen Polyisocyanaten |
| WO2008068198A1 (de) | 2006-12-04 | 2008-06-12 | Basf Se | Verfahren zur herstellung von polyisocyanaten |
| JP5404598B2 (ja) * | 2007-03-26 | 2014-02-05 | ビーエーエスエフ ソシエタス・ヨーロピア | 水乳化性ポリイソシアネート |
| HUE041930T2 (hu) * | 2007-03-27 | 2019-06-28 | Basf Se | Eljárás diizocianátok színtelen izocianurátjainak elõállítására |
| US20090176907A1 (en) | 2008-01-08 | 2009-07-09 | Ramesh Subramanian | Direct-to-metal radiation curable compositions |
| EP2571948A4 (en) | 2010-05-21 | 2014-09-03 | Allnex Ip S R L | RADIATION-HARDENABLE COMPOSITIONS WITH WEAK GLOSSY |
| CN103443222B (zh) | 2011-01-20 | 2016-08-17 | 湛新Ip有限公司 | 非水性聚氨酯涂料组合物 |
| DE102011088149A1 (de) | 2011-12-09 | 2013-06-13 | Evonik Industries Ag | Beschichteter Verbundkörper, umfassend ein Verbundmaterial |
| US20140275320A1 (en) | 2013-03-14 | 2014-09-18 | Allnex IP S.à.r.I. | Methods for making elastomers, elastomer compositions and related elastomers |
| US10100223B2 (en) | 2013-03-14 | 2018-10-16 | Allnex Netherlands B.V. | Methods for making elastomers, elastomer compositions and related elastomers |
| CN115335424A (zh) * | 2020-01-27 | 2022-11-11 | 意大利亿达化料有限公司 | 大分子化合物以及其在组合物中的用途 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3517002A (en) * | 1966-11-17 | 1970-06-23 | Mobay Chemical Corp | Polyisocyanates containing isocyanurate groups |
| GB1200542A (en) * | 1967-01-19 | 1970-07-29 | Takeda Chemical Industries Ltd | A method for producing isocyanate trimers |
| US3641024A (en) * | 1968-11-01 | 1972-02-08 | Marathon Oil Co | Low molecular weight polyisocyanates |
| US3817937A (en) * | 1971-11-04 | 1974-06-18 | Marathon Oil Co | Reacting hydroxyl-terminated isocyanurate salts with diisocyanates |
-
1973
- 1973-05-22 DE DE2325826A patent/DE2325826C3/de not_active Expired
-
1974
- 1974-05-14 GB GB2126374A patent/GB1467953A/en not_active Expired
- 1974-05-20 US US471723A patent/US3919218A/en not_active Expired - Lifetime
- 1974-05-20 IT IT22937/74A patent/IT1012630B/it active
- 1974-05-21 JP JP5622274A patent/JPS5726514B2/ja not_active Expired
- 1974-05-21 NL NLAANVRAGE7406797,A patent/NL178004C/xx active Search and Examination
- 1974-05-21 CA CA200,379A patent/CA1037640A/en not_active Expired
- 1974-05-22 FR FR7417902A patent/FR2230642B1/fr not_active Expired
-
1979
- 1979-02-02 BE BE193227A patent/BE873888Q/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| IT1012630B (it) | 1977-03-10 |
| NL178004C (nl) | 1986-01-02 |
| CA1037640A (en) | 1978-08-29 |
| FR2230642B1 (enExample) | 1978-11-17 |
| US3919218A (en) | 1975-11-11 |
| DE2325826B2 (de) | 1980-05-22 |
| FR2230642A1 (enExample) | 1974-12-20 |
| BE873888Q (fr) | 1979-05-29 |
| DE2325826A1 (de) | 1974-12-19 |
| JPS5047988A (enExample) | 1975-04-28 |
| GB1467953A (en) | 1977-03-23 |
| JPS5726514B2 (enExample) | 1982-06-04 |
| NL7406797A (enExample) | 1974-11-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2325826C3 (de) | Isocyanato-isocyanurate und Herstellung lagerstabiler Lösungen hiervon | |
| EP0178520B1 (de) | Verfahren zur Herstellung von Uretdiongruppen aufweisenden Verbindungen, die nach diesem Verfahren erhältlichen Verbindungen und ihre Verwendung bei der Herstellung von Polyurethankunststoffen | |
| EP0003765B1 (de) | Verfahren zur Herstellung von Isocyanuratgruppen aufweisenden Polyisocyanaten auf Basis von 1-Isocyanato-3,3,5-trimethyl-5-isocyanatomethylcyclohexan und ihre Verwendung als Isocyanatkomponente in Polyurethanlacken | |
| EP0173252B1 (de) | Verfahren zur Herstellung von oligomeren Polyisocyanaten und ihre Verwendung bei der Herstellung von Polyurethankunststoffen | |
| DE1954093A1 (de) | Verfahren zur Herstellung von polymeren organischen Isocyanaten | |
| EP0056158A1 (de) | Verfahren zur Herstellung von Isocyanuratgruppen aufweisenden Polyisocyanaten, als Katalysator-Komponente für dieses Verfahren geeignete Lösungen, sowie die Verwendung der Verfahrensprodukte als Isocyanat-Komponente bei der Herstellung von Polyurethanen | |
| DE2551634A1 (de) | Verfahren zur herstellung von isocyanuratgruppen aufweisenden polyisocyanaten | |
| EP0010589A1 (de) | Verfahren zur Herstellung von Isocyanuratgruppen aufweisenden Polyisocyanaten und ihre Verwendung als Isocyanatkomponente in Polyurethanlacken | |
| CH371122A (de) | Verfahren zum Polymerisieren von organischen Isocyanaten | |
| DE19734048A1 (de) | Verfahren zur Herstellung von Polyisocyanaten, damit hergestellte Polyisocyanate und deren Verwendung | |
| EP0337116B1 (de) | Verfahren zur Herstellung von Uretdion- und Isocyanuratgruppen aufweisenden Polyisocyanatgemischen | |
| DE4029809A1 (de) | Polyisocyanatgemisch, ein verfahren zu seiner herstellung und seine verwendung in polyurethanlacken | |
| EP0166173B1 (de) | Verfahren zur Herstellung von Uretdiongruppen aufweisenden Polyisocyanaten | |
| EP0630928B1 (de) | Verfahren zur Herstellung von Isocyanurat- und/oder Uretdiongruppen enthaltenden Polyisocyanaten mit reduzierter Farbzahl und verbesserter Lagerstabilität sowie nach diesem Verfahren hergestellte Produkte | |
| DE19603245A1 (de) | Dünnschichtdestillation von Uretdiondiisocyanaten | |
| DE2342603C3 (de) | Verfahren zur Herstellung von Malonsäuredialkylesterblockierten Biuretpolyisocyanaten sowie deren Verwendung | |
| EP0026448B1 (de) | Einkomponenten-Einbrennlacke | |
| EP0183150B1 (de) | Verfahren zur Herstellung von modifizierten Polyisocyanaten und ihre Verwendung in Polyurethananlacken | |
| EP0818485A2 (de) | Verfahren zur Herstellung von Isocyanuratgruppen aufweisenden Polyisocyanaten, die nach diesem Verfahren erhältlichen Verbindungen und ihre Verwendung zur Herstellung von Polyisocyanat-Additionsprodukten | |
| EP0115298A2 (de) | Verfahren zur Herstellung von Isocyanuratgruppen aufweisenden Polyisocyanaten, die nach diesem Verfahren erhältlichen Verbindungen und ihre Verwendung zur Herstellung von Polyurethanen | |
| EP0166172B1 (de) | Neue Uretdiondiisocyanate, diese Diisocyanate enthaltende Polyisocyanatgemische, ein Verfahren zu deren Herstellung und ihre Verwendung zur Herstellung von Polyurethankunststoffen | |
| EP0643087B1 (de) | Verfahren zur Herstellung von Isocyanurat- und Uretdiongruppen enthaltenden Polyisocyanatmischungen mit reduzierter Farbzahl | |
| DE3420923A1 (de) | Verfahren zur herstellung von isocyanuratgruppen aufweisenden polyisocyanaten, die nach diesem verfahren erhaeltlichen verbindungen und ihre verwendung zur herstellung von polyurethanen | |
| EP0014365A1 (de) | Verfahren zur Herstellung von linearen heterocyclischen Nylon-1-polymerisaten, ihre Verwendung als verkappte Diisocyanate für die Herstellung von Polyurethan-Kunststoffen und ein Verfahren zur Herstellung von im wesentlichen reinen cycloaliphatischen Diisocyanat-Stereoisomeren | |
| EP0520210B1 (de) | Verfahren zur Herstellung von oligomeren Polyisocyanaten und ihre Verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OGA | New person/name/address of the applicant | ||
| C3 | Grant after two publication steps (3rd publication) | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: HUELS AG, 4370 MARL, DE |
|
| 8339 | Ceased/non-payment of the annual fee |