DE2319278C2 - Pharmazeutisches Mittel - Google Patents
Pharmazeutisches MittelInfo
- Publication number
- DE2319278C2 DE2319278C2 DE2319278A DE2319278A DE2319278C2 DE 2319278 C2 DE2319278 C2 DE 2319278C2 DE 2319278 A DE2319278 A DE 2319278A DE 2319278 A DE2319278 A DE 2319278A DE 2319278 C2 DE2319278 C2 DE 2319278C2
- Authority
- DE
- Germany
- Prior art keywords
- amino
- methyl
- pyrazolon
- ethyl
- ethanol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000008177 pharmaceutical agent Substances 0.000 title claims description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 38
- -1 1-substituted pyrazolone Chemical class 0.000 description 19
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- 235000019441 ethanol Nutrition 0.000 description 14
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 150000001875 compounds Chemical class 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000004480 active ingredient Substances 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 125000000217 alkyl group Chemical group 0.000 description 5
- 239000002934 diuretic Substances 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 238000001953 recrystallisation Methods 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 4
- 239000003814 drug Substances 0.000 description 4
- 230000029142 excretion Effects 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- 241000282472 Canis lupus familiaris Species 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 230000037396 body weight Effects 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 230000001882 diuretic effect Effects 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 125000004494 ethyl ester group Chemical group 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 230000000894 saliuretic effect Effects 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000003826 tablet Substances 0.000 description 3
- 239000000454 talc Substances 0.000 description 3
- 235000012222 talc Nutrition 0.000 description 3
- 229910052623 talc Inorganic materials 0.000 description 3
- 210000002700 urine Anatomy 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 229940051880 analgesics and antipyretics pyrazolones Drugs 0.000 description 2
- 230000003276 anti-hypertensive effect Effects 0.000 description 2
- 230000002785 anti-thrombosis Effects 0.000 description 2
- 239000002220 antihypertensive agent Substances 0.000 description 2
- 229940127088 antihypertensive drug Drugs 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 229940030606 diuretics Drugs 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000003792 electrolyte Substances 0.000 description 2
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 2
- 235000013312 flour Nutrition 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical class O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 description 2
- 239000011435 rock Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 235000015424 sodium Nutrition 0.000 description 2
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 125000004434 sulfur atom Chemical group 0.000 description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 2
- 208000009304 Acute Kidney Injury Diseases 0.000 description 1
- KLSJWNVTNUYHDU-UHFFFAOYSA-N Amitrole Chemical compound NC1=NC=NN1 KLSJWNVTNUYHDU-UHFFFAOYSA-N 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 239000004097 EU approved flavor enhancer Substances 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Chemical compound OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Chemical compound OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- RMUCZJUITONUFY-UHFFFAOYSA-N Phenelzine Chemical compound NNCCC1=CC=CC=C1 RMUCZJUITONUFY-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 208000004880 Polyuria Diseases 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 208000033626 Renal failure acute Diseases 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 201000011040 acute kidney failure Diseases 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229940035676 analgesics Drugs 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000000730 antalgic agent Substances 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 230000001741 anti-phlogistic effect Effects 0.000 description 1
- 230000001754 anti-pyretic effect Effects 0.000 description 1
- 239000002221 antipyretic Substances 0.000 description 1
- 229940125716 antipyretic agent Drugs 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- 230000035619 diuresis Effects 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000002497 edematous effect Effects 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 238000005048 flame photometry Methods 0.000 description 1
- 235000019264 food flavour enhancer Nutrition 0.000 description 1
- 238000003304 gavage Methods 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 244000243234 giant cane Species 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- 210000003097 mucus Anatomy 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 231100000614 poison Toxicity 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 239000003440 toxic substance Substances 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D231/44—Oxygen and nitrogen or sulfur and nitrogen atoms
- C07D231/52—Oxygen atom in position 3 and nitrogen atom in position 5, or vice versa
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D231/18—One oxygen or sulfur atom
- C07D231/20—One oxygen atom attached in position 3 or 5
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (14)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2319278A DE2319278C2 (de) | 1973-04-17 | 1973-04-17 | Pharmazeutisches Mittel |
| FR7411442A FR2226169B1 (enExample) | 1973-04-17 | 1974-03-29 | |
| PH15695A PH10818A (en) | 1973-04-17 | 1974-04-02 | Diuretic and antihypertensive drugs |
| US05/459,408 US4018890A (en) | 1973-04-17 | 1974-04-09 | Pyrazol-5-one pharmaceutical compositions and methods for effecting diuresis, saluresis and for treating hypertension |
| IL44625A IL44625A (en) | 1973-04-17 | 1974-04-12 | Diuretic and antihypertensive compositions containing certain pyrazole derivatives |
| BE143221A BE813745A (fr) | 1973-04-17 | 1974-04-16 | Nouvelle composition diuretique et anti-hypertensive a base de derives de pyrazolones-(5) portant un substituant en position 1 |
| ZA00742383A ZA742383B (en) | 1973-04-17 | 1974-04-16 | Diuretic and antihypertensive drugs and their use |
| LU69870A LU69870A1 (enExample) | 1973-04-17 | 1974-04-16 | |
| AU67934/74A AU491678B2 (en) | 1973-04-17 | 1974-04-16 | Diuretic and antihypertensive drugs and their use |
| GB1650974A GB1434171A (en) | 1973-04-17 | 1974-04-16 | Diuretic and antihypertensive medicines comprising pyrazolone derivatives |
| NLAANVRAGE7405114,A NL178564C (nl) | 1973-04-17 | 1974-04-16 | Werkwijze voor het bereiden van farmaceutische preparaten op basis van 1-gesubstitueerde pyrazolon-5-derivaten. |
| IE797/74A IE39211B1 (en) | 1973-04-17 | 1974-04-17 | Diuretic and antihypertensive medicines comprising pyrazololone derivatives |
| US05/633,601 US4045571A (en) | 1973-04-17 | 1975-11-20 | Pyrazol-5-ones |
| US06/102,840 US4288446A (en) | 1973-04-17 | 1979-12-12 | Pyrazol-5-ones |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2319278A DE2319278C2 (de) | 1973-04-17 | 1973-04-17 | Pharmazeutisches Mittel |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2319278A1 DE2319278A1 (de) | 1974-11-07 |
| DE2319278C2 true DE2319278C2 (de) | 1986-02-20 |
Family
ID=5878313
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2319278A Expired DE2319278C2 (de) | 1973-04-17 | 1973-04-17 | Pharmazeutisches Mittel |
Country Status (11)
| Country | Link |
|---|---|
| US (2) | US4018890A (enExample) |
| BE (1) | BE813745A (enExample) |
| DE (1) | DE2319278C2 (enExample) |
| FR (1) | FR2226169B1 (enExample) |
| GB (1) | GB1434171A (enExample) |
| IE (1) | IE39211B1 (enExample) |
| IL (1) | IL44625A (enExample) |
| LU (1) | LU69870A1 (enExample) |
| NL (1) | NL178564C (enExample) |
| PH (1) | PH10818A (enExample) |
| ZA (1) | ZA742383B (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2427272C3 (de) | 1974-06-06 | 1981-10-01 | Bayer Ag, 5090 Leverkusen | 1-(2-(β-Naphthyloxy)-äthyl)-3-methyl -pyrazolon-(5), Verfahren sowie Verwendung als Antithrombotikum |
| CA1229553A (en) * | 1983-05-18 | 1987-11-24 | Edmund Y. Lukevits | Pharmaceutical preparation for the treatment of hypertensive disease and myocardial infarction |
| DE3436383A1 (de) * | 1984-10-04 | 1986-04-10 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von pyrazolonderivaten |
| DK169672B1 (da) * | 1985-05-20 | 1995-01-09 | Mitsubishi Chem Ind | Farmaceutiske præparater indeholdende pyrazolonderivater som aktiv bestanddel og anvendelsen af pyrazolonderivater til fremstilling af farmaceutiske præparater |
| USRE35801E (en) * | 1985-05-20 | 1998-05-19 | Mitsubishi Chemical Corporation | Prophylactic and therapeutic composition for circulatory disorders and method of treatment |
| DE3626908A1 (de) * | 1986-08-08 | 1988-02-11 | Bayer Ag | Parenterale loesung |
| AU2003250483A1 (en) | 2002-08-19 | 2004-03-11 | Pfizer Products Inc. | Combination therapy for hyperproliferative diseases |
| US7741317B2 (en) | 2005-10-21 | 2010-06-22 | Bristol-Myers Squibb Company | LXR modulators |
| US7888376B2 (en) | 2005-11-23 | 2011-02-15 | Bristol-Myers Squibb Company | Heterocyclic CETP inhibitors |
| CN101663262B (zh) | 2006-12-01 | 2014-03-26 | 百时美施贵宝公司 | 用于治疗动脉粥样硬化和心血管疾病的作为cetp抑制剂的n-(3-苄基)-2,2-(二苯基)-丙-1胺衍生物 |
| EP2986599A1 (en) | 2013-04-17 | 2016-02-24 | Pfizer Inc. | N-piperidin-3-ylbenzamide derivatives for treating cardiovascular diseases |
| US9573122B2 (en) * | 2014-08-29 | 2017-02-21 | Chevron U.S.A. Inc. | Small crystal LTL framework type zeolites |
| WO2016055901A1 (en) | 2014-10-08 | 2016-04-14 | Pfizer Inc. | Substituted amide compounds |
| BR112021013807A2 (pt) | 2019-01-18 | 2021-11-30 | Astrazeneca Ab | Inibidores de pcsk9 e seus métodos de uso |
| CN116589409A (zh) * | 2023-05-17 | 2023-08-15 | 郑州轻工业大学 | 一种氯唑啉胺的化学合成方法 |
Family Cites Families (33)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2476987A (en) * | 1949-07-26 | S-acyloxy pyrazqles and method foe | ||
| US2476986A (en) * | 1949-07-26 | Elmobe louis martin | ||
| US2376380A (en) * | 1945-05-22 | Preparation of amino pyrazolones | ||
| US3147276A (en) * | 1964-09-01 | Pyrazolones | ||
| GB559919A (en) * | 1942-09-07 | 1944-03-10 | Lamson Engineering Co | Improvements in and relating to pneumatic tube conveyor systems |
| GB636988A (en) * | 1947-12-24 | 1950-05-10 | Gevaert Photo Producten Naamlo | Improvements in and relating to the production of colour photographic images |
| US2511231A (en) * | 1949-03-26 | 1950-06-13 | Eastman Kodak Co | 1-cyanophenyl-3-acylamino-5-pyrazolone couplers for color photography |
| US2600788A (en) * | 1949-06-07 | 1952-06-17 | Eastman Kodak Co | Halogen-substituted pyrazolone couplers for color photography |
| ZA10401B (enExample) * | 1949-08-22 | |||
| US2672417A (en) * | 1949-12-31 | 1954-03-16 | Gevaert Photo Prod Nv | Production of color photographic images |
| GB779703A (en) * | 1953-07-06 | 1957-07-24 | Hoechst Ag | Pyrazolone compounds and a process for making them |
| US2848446A (en) * | 1954-02-23 | 1958-08-19 | Saul & Co | Azo dyestuffs |
| DE1003215B (de) * | 1954-08-07 | 1957-02-28 | Hoechst Ag | Verfahren zur Herstellung von 1-Benzyl-3-methyl-pyrazolon-(5) |
| US3014916A (en) * | 1959-01-22 | 1961-12-26 | May & Baker Ltd | Pyrazole derivatives |
| GB935538A (en) * | 1959-04-06 | 1963-08-28 | Stop Motion Devices Corp | Stop-motion head for use on knitting machines |
| GB961037A (en) * | 1960-08-23 | 1964-06-17 | Smith & Nephew | Pyrazolones and processes for their preparation |
| NL121416C (enExample) * | 1961-05-31 | |||
| US3190888A (en) * | 1963-08-22 | 1965-06-22 | American Home Prod | Aryloxyalkylpyrazole |
| DE1670529C3 (de) * | 1966-07-13 | 1974-01-10 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler, 6000 Frankfurt | Substituierte s-Triazine |
| GB1190914A (en) * | 1966-09-26 | 1970-05-06 | Agfa Gevaert Nv | 2-Pyrazolin-5-Ones and the use thereof as Colour Couplers |
| FR1558513A (enExample) * | 1968-01-04 | 1969-02-28 | ||
| GB1247688A (en) * | 1968-02-26 | 1971-09-29 | Agfa Gevaert | Monomeric and polymeric 2-pyrazoline-5-one colour couplers |
| JPS4818858B1 (enExample) * | 1969-04-07 | 1973-06-08 | ||
| FR2068413A1 (en) * | 1969-10-22 | 1971-08-27 | Synthelabo | 1-alkyl-3-alkylamino-5-aryl-pyrazolines hypo-and hypertensives |
| US3615506A (en) * | 1970-02-09 | 1971-10-26 | Eastman Kodak Co | Silver halide emulsions containing 3-cyclicamino-5-pyrazolone color couplers |
| US3694456A (en) * | 1970-05-08 | 1972-09-26 | Takeda Chemical Industries Ltd | 1-disubstituted aminopyrazoles |
| FR2101060B1 (enExample) * | 1970-08-14 | 1974-02-01 | Roussel Uclaf | |
| FR2104931B1 (enExample) * | 1970-09-08 | 1975-01-10 | Ferlux | |
| JPS5417772B1 (enExample) * | 1970-12-04 | 1979-07-03 | ||
| JPS548689B1 (enExample) * | 1970-12-04 | 1979-04-18 | ||
| DE2230792A1 (de) * | 1972-06-23 | 1974-01-17 | Bayer Ag | 3-amino-pyrazolone-(5), verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| DE2230675A1 (de) * | 1972-06-23 | 1974-01-10 | Bayer Ag | Diuretisches und antihypertensives mittel |
| AR207445A1 (es) * | 1973-04-17 | 1976-10-08 | Bayer Ag | Procedimiento de preparacion de nuevos derivados de pirazolonas-(5)-1-substituidas |
-
1973
- 1973-04-17 DE DE2319278A patent/DE2319278C2/de not_active Expired
-
1974
- 1974-03-29 FR FR7411442A patent/FR2226169B1/fr not_active Expired
- 1974-04-02 PH PH15695A patent/PH10818A/en unknown
- 1974-04-09 US US05/459,408 patent/US4018890A/en not_active Expired - Lifetime
- 1974-04-12 IL IL44625A patent/IL44625A/xx unknown
- 1974-04-16 BE BE143221A patent/BE813745A/xx not_active IP Right Cessation
- 1974-04-16 LU LU69870A patent/LU69870A1/xx unknown
- 1974-04-16 NL NLAANVRAGE7405114,A patent/NL178564C/xx not_active IP Right Cessation
- 1974-04-16 GB GB1650974A patent/GB1434171A/en not_active Expired
- 1974-04-16 ZA ZA00742383A patent/ZA742383B/xx unknown
- 1974-04-17 IE IE797/74A patent/IE39211B1/xx unknown
-
1979
- 1979-12-12 US US06/102,840 patent/US4288446A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| PH10818A (en) | 1977-09-08 |
| GB1434171A (en) | 1976-05-05 |
| USB459408I5 (enExample) | 1976-03-23 |
| US4018890A (en) | 1977-04-19 |
| LU69870A1 (enExample) | 1974-11-21 |
| NL178564B (nl) | 1985-11-18 |
| NL178564C (nl) | 1986-04-16 |
| DE2319278A1 (de) | 1974-11-07 |
| AU6793474A (en) | 1975-10-16 |
| IE39211B1 (en) | 1978-08-30 |
| IL44625A0 (en) | 1974-06-30 |
| BE813745A (fr) | 1974-10-16 |
| IL44625A (en) | 1978-07-31 |
| FR2226169A1 (enExample) | 1974-11-15 |
| FR2226169B1 (enExample) | 1978-07-28 |
| IE39211L (en) | 1974-10-17 |
| NL7405114A (enExample) | 1974-10-21 |
| ZA742383B (en) | 1975-04-30 |
| US4288446A (en) | 1981-09-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2319278C2 (de) | Pharmazeutisches Mittel | |
| DE2928485A1 (de) | Verwendung von harnstoffderivaten als arzneimittel bei der behandlung von fettstoffwechselstoerungen | |
| DE2105490A1 (de) | Imidazolderivate, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel | |
| DE2929777C2 (enExample) | ||
| DE2041771B2 (de) | derivate | |
| DD202152A5 (de) | Verfahren zur herstellung von phenylpiperazinderivaten | |
| DE2706977A1 (de) | Benzoesaeuren und deren derivate sowie verfahren zu ihrer herstellung | |
| DE2363511A1 (de) | Pyrazol-derivate, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE69708130T2 (de) | A-oxo-butansäuren enthaltende pharmazeutische zusammensetzung | |
| DE2523103A1 (de) | Neue propargyl-2-phenylamino-imidazoline-(2), deren saeureadditionssalze, diese enthaltende arzneimittel und verfahren zur herstellung derselben | |
| DE3532279A1 (de) | 1,4-benzoxathiin-derivate | |
| DE1695133A1 (de) | Verfahren zur Herstellung von Imidazolderivaten | |
| DE2427272C3 (de) | 1-(2-(β-Naphthyloxy)-äthyl)-3-methyl -pyrazolon-(5), Verfahren sowie Verwendung als Antithrombotikum | |
| EP0030343B1 (de) | Substituierte 2-Amino-3,4-dihydropyridinderivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel | |
| EP0088323B1 (de) | Imidazothiadiazolalkencarbonsäureamide, neue Zwischenprodukte zu ihrer Herstellung, ihre Herstellung und ihre Verwendung in Arzneimitteln | |
| DE2140865A1 (de) | 1-imidazolyl-methanphosphonsaeureester, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE2319281A1 (de) | Diuretisches und antihypertensives mittel | |
| DE2319280A1 (de) | 1-substituierte pyrazolone-(5), verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE3020421A1 (de) | Imidazoazolalkensaeureamide, neue zwischenprodukte zu ihrer herstellung, ihre herstellung und ihre verwendung in arzneimitteln | |
| DE2641129A1 (de) | Derivate des 5-aminomethylthiazols, ihr herstellungsverfahren und pharmazeutische zusammensetzungen | |
| DE2526467A1 (de) | 4-substituierte pyrazolderivate, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE1806995C3 (de) | Bisimidazolyl-bisphenylmethane und deren Salze | |
| DE2230792A1 (de) | 3-amino-pyrazolone-(5), verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE2366559C2 (de) | 1-substituierte 3-Aminopyrazolone-(5) sowie deren Verwendung | |
| DE2143646A1 (de) | 2-Amino-l,5-benzodiazocinderivate und Verfahren zu ihrer Herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8172 | Supplementary division/partition in: |
Ref country code: DE Ref document number: 2366601 Format of ref document f/p: P |
|
| Q171 | Divided out to: |
Ref country code: DE Ref document number: 2366601 |
|
| AH | Division in |
Ref country code: DE Ref document number: 2366601 Format of ref document f/p: P |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |