DE2318900A1 - Magnetischer bandfoerderer - Google Patents
Magnetischer bandfoerdererInfo
- Publication number
- DE2318900A1 DE2318900A1 DE2318900A DE2318900A DE2318900A1 DE 2318900 A1 DE2318900 A1 DE 2318900A1 DE 2318900 A DE2318900 A DE 2318900A DE 2318900 A DE2318900 A DE 2318900A DE 2318900 A1 DE2318900 A1 DE 2318900A1
- Authority
- DE
- Germany
- Prior art keywords
- magnetic
- belt conveyor
- legs
- conveyor according
- magnetic belt
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 32
- 210000002414 leg Anatomy 0.000 claims description 22
- 229910052742 iron Inorganic materials 0.000 claims description 16
- 239000000463 material Substances 0.000 claims description 3
- 210000000689 upper leg Anatomy 0.000 claims description 2
- 239000000853 adhesive Substances 0.000 description 3
- 230000001070 adhesive effect Effects 0.000 description 3
- BGPVFRJUHWVFKM-UHFFFAOYSA-N N1=C2C=CC=CC2=[N+]([O-])C1(CC1)CCC21N=C1C=CC=CC1=[N+]2[O-] Chemical compound N1=C2C=CC=CC2=[N+]([O-])C1(CC1)CCC21N=C1C=CC=CC1=[N+]2[O-] BGPVFRJUHWVFKM-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 230000004907 flux Effects 0.000 description 1
- 239000000696 magnetic material Substances 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 230000000284 resting effect Effects 0.000 description 1
- 230000032258 transport Effects 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B65—CONVEYING; PACKING; STORING; HANDLING THIN OR FILAMENTARY MATERIAL
- B65G—TRANSPORT OR STORAGE DEVICES, e.g. CONVEYORS FOR LOADING OR TIPPING, SHOP CONVEYOR SYSTEMS OR PNEUMATIC TUBE CONVEYORS
- B65G21/00—Supporting or protective framework or housings for endless load-carriers or traction elements of belt or chain conveyors
- B65G21/20—Means incorporated in, or attached to, framework or housings for guiding load-carriers, traction elements or loads supported on moving surfaces
- B65G21/2009—Magnetic retaining means
- B65G21/2018—Magnetic retaining means for retaining the load on the load-carrying surface
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Belt Conveyors (AREA)
- Structure Of Belt Conveyors (AREA)
- Non-Mechanical Conveyors (AREA)
Priority Applications (12)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2318900A DE2318900A1 (de) | 1973-04-14 | 1973-04-14 | Magnetischer bandfoerderer |
| CH404374A CH562145A5 (enExample) | 1973-04-14 | 1974-03-22 | |
| SE7404173A SE407387B (sv) | 1973-04-14 | 1974-03-28 | Magnetisk bandtransportor |
| BE142747A BE813184A (fr) | 1973-04-14 | 1974-04-02 | Transporteur magnetique a bande |
| IT50026/74A IT1004083B (it) | 1973-04-14 | 1974-04-03 | Trasportatore a nastro magnetico |
| FR7412035A FR2225358B1 (enExample) | 1973-04-14 | 1974-04-04 | |
| AT279874A AT338165B (de) | 1973-04-14 | 1974-04-04 | Magnetischer bandforderer |
| ES425036A ES425036A1 (es) | 1973-04-14 | 1974-04-05 | Transportador de cinta magnetico. |
| CA198,154A CA1014885A (en) | 1973-04-14 | 1974-04-10 | Magnetic conveyor belt |
| GB1636574A GB1456124A (en) | 1973-04-14 | 1974-04-11 | Magnetic belt conveyor |
| NL7405054A NL7405054A (enExample) | 1973-04-14 | 1974-04-11 | |
| US05/755,205 US4236632A (en) | 1973-04-14 | 1976-12-29 | Magnetic conveyor belt |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2318900A DE2318900A1 (de) | 1973-04-14 | 1973-04-14 | Magnetischer bandfoerderer |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2318900A1 true DE2318900A1 (de) | 1974-10-17 |
Family
ID=5878091
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2318900A Withdrawn DE2318900A1 (de) | 1973-04-14 | 1973-04-14 | Magnetischer bandfoerderer |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4236632A (enExample) |
| AT (1) | AT338165B (enExample) |
| BE (1) | BE813184A (enExample) |
| CA (1) | CA1014885A (enExample) |
| CH (1) | CH562145A5 (enExample) |
| DE (1) | DE2318900A1 (enExample) |
| ES (1) | ES425036A1 (enExample) |
| FR (1) | FR2225358B1 (enExample) |
| GB (1) | GB1456124A (enExample) |
| IT (1) | IT1004083B (enExample) |
| NL (1) | NL7405054A (enExample) |
| SE (1) | SE407387B (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE19614742A1 (de) * | 1996-04-15 | 1997-11-06 | Mtd Magnettechnik Deutschland | Vorrichtung zum aufliegenden Transport von flachen, insbesondere plattenförmigen Gegenständen |
| DE19636086A1 (de) * | 1996-09-06 | 1998-03-12 | Nsm Magnettechnik Gmbh | Magnetbandförderer für den hängenden Transport von Blechen o. dgl. |
| DE102009019307A1 (de) * | 2009-04-29 | 2010-11-11 | Kba-Metalprint Gmbh | Transportvorrichtung für tafelförmige Güter sowie Verfahren zum Transportieren der Güter |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2444629B1 (fr) * | 1978-12-21 | 1983-11-10 | Gefra Bv | Convoyeur a chaine |
| DE8408857U1 (de) * | 1984-03-22 | 1984-07-19 | Pellikaan, Brigitte Jacoba Anna, Gravenzande | Kettenfoerderer |
| NL8501928A (nl) * | 1985-07-05 | 1987-02-02 | Mcc Nederland | Bochtsegment voor de loopbaan van een kettingtransporteur. |
| US4850542A (en) * | 1986-08-28 | 1989-07-25 | Isoreg Corporation | Winding apparatus utilizing magnetic carrier units |
| IT219317Z2 (it) * | 1990-03-20 | 1993-02-18 | Regina Sud Spa | Trasportatore a catena perfezionato |
| US5204835A (en) * | 1990-06-13 | 1993-04-20 | Waferscale Integration Inc. | Eprom virtual ground array |
| US5176247A (en) * | 1991-08-12 | 1993-01-05 | Rexnord Corporation | Sideflexing conveyor chain including low centerline hinge pin |
| US5327378A (en) * | 1992-03-04 | 1994-07-05 | Waferscale Integration, Inc. | Easily manufacturable compact EPROM |
| KR100279368B1 (ko) * | 1996-11-15 | 2001-01-15 | 가와다 미쓰구 | 칩부품공급장치및이에사용되는흡착플레이트 |
| AT407228B (de) * | 1997-02-13 | 2001-01-25 | Gomariz Perez Ana Maria | Vorrichtung zum nachlackieren von einschnitten in kreisförmigen schnellöffner-deckeln |
| DE19816232A1 (de) * | 1998-04-10 | 1999-10-14 | Schlafhorst & Co W | Transportsystem für Spinnspulen und Spulenhülsen mit einem einen Durchgang überbrückenden Transportweg |
| WO2017152294A1 (es) * | 2016-03-11 | 2017-09-14 | Jara Inostroza Andrés | Correa transportadora suspendida por levitación magnética |
| US12208967B2 (en) | 2023-01-26 | 2025-01-28 | Intelligrated Headquarters, Llc | Magnetic cover apparatuses, systems, and methods |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3338374A (en) * | 1965-02-09 | 1967-08-29 | Peco Corp | Magnetic conveyor |
| US3523602A (en) * | 1968-03-14 | 1970-08-11 | Fleetwood Syst Inc | Can handling apparatus |
-
1973
- 1973-04-14 DE DE2318900A patent/DE2318900A1/de not_active Withdrawn
-
1974
- 1974-03-22 CH CH404374A patent/CH562145A5/xx not_active IP Right Cessation
- 1974-03-28 SE SE7404173A patent/SE407387B/xx unknown
- 1974-04-02 BE BE142747A patent/BE813184A/xx unknown
- 1974-04-03 IT IT50026/74A patent/IT1004083B/it active
- 1974-04-04 AT AT279874A patent/AT338165B/de not_active IP Right Cessation
- 1974-04-04 FR FR7412035A patent/FR2225358B1/fr not_active Expired
- 1974-04-05 ES ES425036A patent/ES425036A1/es not_active Expired
- 1974-04-10 CA CA198,154A patent/CA1014885A/en not_active Expired
- 1974-04-11 NL NL7405054A patent/NL7405054A/xx not_active Application Discontinuation
- 1974-04-11 GB GB1636574A patent/GB1456124A/en not_active Expired
-
1976
- 1976-12-29 US US05/755,205 patent/US4236632A/en not_active Expired - Lifetime
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE19614742A1 (de) * | 1996-04-15 | 1997-11-06 | Mtd Magnettechnik Deutschland | Vorrichtung zum aufliegenden Transport von flachen, insbesondere plattenförmigen Gegenständen |
| DE19614742C2 (de) * | 1996-04-15 | 1998-07-23 | Mtd Magnettechnik Deutschland | Vorrichtung zum aufliegenden Transport von flachen, insbesondere plattenförmigen Gegenständen |
| DE19636086A1 (de) * | 1996-09-06 | 1998-03-12 | Nsm Magnettechnik Gmbh | Magnetbandförderer für den hängenden Transport von Blechen o. dgl. |
| DE102009019307A1 (de) * | 2009-04-29 | 2010-11-11 | Kba-Metalprint Gmbh | Transportvorrichtung für tafelförmige Güter sowie Verfahren zum Transportieren der Güter |
| DE102009019307B4 (de) * | 2009-04-29 | 2013-02-07 | Kba-Metalprint Gmbh | Transportvorrichtung für tafelförmige Güter sowie Verfahren zum Transportieren der Güter |
Also Published As
| Publication number | Publication date |
|---|---|
| NL7405054A (enExample) | 1974-10-16 |
| GB1456124A (en) | 1976-11-17 |
| FR2225358B1 (enExample) | 1978-01-13 |
| US4236632A (en) | 1980-12-02 |
| SE407387B (sv) | 1979-03-26 |
| CH562145A5 (enExample) | 1975-05-30 |
| AT338165B (de) | 1977-07-25 |
| IT1004083B (it) | 1976-07-10 |
| BE813184A (fr) | 1974-07-31 |
| ATA279874A (de) | 1976-11-15 |
| FR2225358A1 (enExample) | 1974-11-08 |
| CA1014885A (en) | 1977-08-02 |
| ES425036A1 (es) | 1976-05-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2318900A1 (de) | Magnetischer bandfoerderer | |
| DE3635258C1 (de) | Magnetkraftsystem fuer reibungsarmen Transport von Lasten | |
| DE2615598A1 (de) | Plattenbandfoerderer | |
| EP0976884A1 (de) | Mobile Trennwand | |
| DE3213986C2 (de) | Befestigung von Führungsleisten für das Fördergut eines Endlosförderers | |
| DE2112359C3 (de) | Elektromagnetische Schienenbremse | |
| DE1964660A1 (de) | Verfahren und Einrichtung zur Orientierung von elektrisch leitenden Koerpern | |
| DE2225470A1 (de) | Montageeinheit fuer zwischenwaende od.dgl | |
| DE1128357B (de) | Magnetischer Bandfoerderer | |
| DE2233615A1 (de) | Kettenschloss | |
| DE662910C (de) | Ausbau, insbesondere fuer Gruben | |
| DE571131C (de) | Befestigungsvorrichtung fuer ringlose Gardinenstangen, Laufschienen, -rohre, Leisten o. dgl. mittels Stegklemmen | |
| CH683366A5 (de) | Vorrichtung zum Tragen eines Heizkessels. | |
| DE8231693U1 (de) | Foerderanlage in form einer transportrollenbahn | |
| CH447933A (de) | Vorrichtung zum Transport von ferromagnetischen Gütern | |
| DE2155580C3 (de) | Bremsmagnet für mit Wirbelstrombremsen ausgerüstete Schienenfahrzeuge | |
| DE8713347U1 (de) | Transportmittel für Montagetransferstraßen | |
| DE1904501U (de) | Muldengehaenge fuer gewirkte teigstuecke. | |
| DE1271621B (de) | Magnetischer Bandfoerderer | |
| Ehlers | G-edenkansprache | |
| DE1207269B (de) | Vorrichtung zum dehnungsfreien Wenden eines Foerderband-Untertrums | |
| DE6601379U (de) | Rollenbahnförderer | |
| DE1865473U (de) | Magnetischer bandfoerderer. | |
| DE1086809B (de) | Polarisierte Magnetanordnung | |
| DE7536250U (de) | Spannungssystem eines Wechselstrom-Elektrizitätszählers |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8139 | Disposal/non-payment of the annual fee |