DE2313874B2 - Verfahren zur Herstellung eines segmentierten, thermoplastischen Mischpolyesters - Google Patents
Verfahren zur Herstellung eines segmentierten, thermoplastischen MischpolyestersInfo
- Publication number
- DE2313874B2 DE2313874B2 DE2313874A DE2313874A DE2313874B2 DE 2313874 B2 DE2313874 B2 DE 2313874B2 DE 2313874 A DE2313874 A DE 2313874A DE 2313874 A DE2313874 A DE 2313874A DE 2313874 B2 DE2313874 B2 DE 2313874B2
- Authority
- DE
- Germany
- Prior art keywords
- acid
- molecular weight
- polycondensation
- melt
- polymer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 238000004519 manufacturing process Methods 0.000 title claims description 13
- 229920001169 thermoplastic Polymers 0.000 title claims description 5
- 239000004416 thermosoftening plastic Substances 0.000 title claims description 5
- 229920000728 polyester Polymers 0.000 title description 32
- 238000000034 method Methods 0.000 title description 23
- 230000008569 process Effects 0.000 title description 15
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 claims description 6
- 125000004185 ester group Chemical group 0.000 claims 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 50
- 229920000642 polymer Polymers 0.000 description 50
- 238000006068 polycondensation reaction Methods 0.000 description 35
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 25
- 239000000155 melt Substances 0.000 description 21
- 239000007790 solid phase Substances 0.000 description 21
- 238000009833 condensation Methods 0.000 description 18
- 230000005494 condensation Effects 0.000 description 18
- 150000002009 diols Chemical class 0.000 description 17
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 16
- 239000002245 particle Substances 0.000 description 15
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 14
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 description 14
- 150000002148 esters Chemical group 0.000 description 14
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 13
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 12
- 125000004432 carbon atom Chemical group C* 0.000 description 11
- -1 ethylene, propylene, pentamethylene, 2,2-dimethyltrimethylene, Hexamethylene Chemical group 0.000 description 11
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 229920000233 poly(alkylene oxides) Polymers 0.000 description 9
- 239000003054 catalyst Substances 0.000 description 8
- 150000001991 dicarboxylic acids Chemical class 0.000 description 8
- 238000006116 polymerization reaction Methods 0.000 description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 7
- 150000002334 glycols Chemical class 0.000 description 7
- 239000002253 acid Substances 0.000 description 6
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 6
- 230000000704 physical effect Effects 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 125000001931 aliphatic group Chemical group 0.000 description 5
- 239000011261 inert gas Substances 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 230000004048 modification Effects 0.000 description 5
- 238000012986 modification Methods 0.000 description 5
- 125000004430 oxygen atom Chemical group O* 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 4
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 238000005809 transesterification reaction Methods 0.000 description 3
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- NIQCNGHVCWTJSM-UHFFFAOYSA-N Dimethyl phthalate Chemical compound COC(=O)C1=CC=CC=C1C(=O)OC NIQCNGHVCWTJSM-UHFFFAOYSA-N 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- 239000001361 adipic acid Substances 0.000 description 2
- 235000011037 adipic acid Nutrition 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- YHWCPXVTRSHPNY-UHFFFAOYSA-N butan-1-olate;titanium(4+) Chemical compound [Ti+4].CCCC[O-].CCCC[O-].CCCC[O-].CCCC[O-] YHWCPXVTRSHPNY-UHFFFAOYSA-N 0.000 description 2
- CDQSJQSWAWPGKG-UHFFFAOYSA-N butane-1,1-diol Chemical compound CCCC(O)O CDQSJQSWAWPGKG-UHFFFAOYSA-N 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 230000003247 decreasing effect Effects 0.000 description 2
- VNGOYPQMJFJDLV-UHFFFAOYSA-N dimethyl benzene-1,3-dicarboxylate Chemical compound COC(=O)C1=CC=CC(C(=O)OC)=C1 VNGOYPQMJFJDLV-UHFFFAOYSA-N 0.000 description 2
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical compound C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 230000003301 hydrolyzing effect Effects 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 description 2
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 description 2
- 239000008188 pellet Substances 0.000 description 2
- 229920001451 polypropylene glycol Polymers 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 125000001140 1,4-phenylene group Chemical group [H]C1=C([H])C([*:2])=C([H])C([H])=C1[*:1] 0.000 description 1
- RTBFRGCFXZNCOE-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-one Chemical compound CS(=O)(=O)N1CCC(=O)CC1 RTBFRGCFXZNCOE-UHFFFAOYSA-N 0.000 description 1
- CDPPYCZVWYZBJH-UHFFFAOYSA-N 2,2,3,3-tetramethylbutanedioic acid Chemical compound OC(=O)C(C)(C)C(C)(C)C(O)=O CDPPYCZVWYZBJH-UHFFFAOYSA-N 0.000 description 1
- LTMRRSWNXVJMBA-UHFFFAOYSA-N 2,2-diethylpropanedioic acid Chemical compound CCC(CC)(C(O)=O)C(O)=O LTMRRSWNXVJMBA-UHFFFAOYSA-N 0.000 description 1
- WUDDSDIHJHPJRP-UHFFFAOYSA-N 2-ethyloctanedioic acid Chemical compound CCC(C(O)=O)CCCCCC(O)=O WUDDSDIHJHPJRP-UHFFFAOYSA-N 0.000 description 1
- QTWJRLJHJPIABL-UHFFFAOYSA-N 2-methylphenol;3-methylphenol;4-methylphenol Chemical compound CC1=CC=C(O)C=C1.CC1=CC=CC(O)=C1.CC1=CC=CC=C1O QTWJRLJHJPIABL-UHFFFAOYSA-N 0.000 description 1
- SQJQLYOMPSJVQS-UHFFFAOYSA-N 4-(4-carboxyphenyl)sulfonylbenzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1S(=O)(=O)C1=CC=C(C(O)=O)C=C1 SQJQLYOMPSJVQS-UHFFFAOYSA-N 0.000 description 1
- NORZXJVANGNNPP-UHFFFAOYSA-N 4-[(4-carboxycyclohexyl)methyl]cyclohexane-1-carboxylic acid Chemical compound C1CC(C(=O)O)CCC1CC1CCC(C(O)=O)CC1 NORZXJVANGNNPP-UHFFFAOYSA-N 0.000 description 1
- VTDMBRAUHKUOON-UHFFFAOYSA-N 4-[(4-carboxyphenyl)methyl]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1CC1=CC=C(C(O)=O)C=C1 VTDMBRAUHKUOON-UHFFFAOYSA-N 0.000 description 1
- ZDZVKPXKLLLOOA-UHFFFAOYSA-N Allylmalonic acid Chemical compound OC(=O)C(C(O)=O)CC=C ZDZVKPXKLLLOOA-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- ORLQHILJRHBSAY-UHFFFAOYSA-N [1-(hydroxymethyl)cyclohexyl]methanol Chemical compound OCC1(CO)CCCCC1 ORLQHILJRHBSAY-UHFFFAOYSA-N 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- JFCQEDHGNNZCLN-UHFFFAOYSA-N anhydrous glutaric acid Natural products OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 1
- FNGGVJIEWDRLFV-UHFFFAOYSA-N anthracene-1,2-dicarboxylic acid Chemical compound C1=CC=CC2=CC3=C(C(O)=O)C(C(=O)O)=CC=C3C=C21 FNGGVJIEWDRLFV-UHFFFAOYSA-N 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 229920001400 block copolymer Polymers 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000011362 coarse particle Substances 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 238000000748 compression moulding Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 229930003836 cresol Natural products 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- CCQPAEQGAVNNIA-UHFFFAOYSA-N cyclobutane-1,1-dicarboxylic acid Chemical compound OC(=O)C1(C(O)=O)CCC1 CCQPAEQGAVNNIA-UHFFFAOYSA-N 0.000 description 1
- ILUAAIDVFMVTAU-UHFFFAOYSA-N cyclohex-4-ene-1,2-dicarboxylic acid Chemical compound OC(=O)C1CC=CCC1C(O)=O ILUAAIDVFMVTAU-UHFFFAOYSA-N 0.000 description 1
- QYQADNCHXSEGJT-UHFFFAOYSA-N cyclohexane-1,1-dicarboxylate;hydron Chemical class OC(=O)C1(C(O)=O)CCCCC1 QYQADNCHXSEGJT-UHFFFAOYSA-N 0.000 description 1
- PDXRQENMIVHKPI-UHFFFAOYSA-N cyclohexane-1,1-diol Chemical compound OC1(O)CCCCC1 PDXRQENMIVHKPI-UHFFFAOYSA-N 0.000 description 1
- YZFOGXKZTWZVFN-UHFFFAOYSA-N cyclopentane-1,1-dicarboxylic acid Chemical compound OC(=O)C1(C(O)=O)CCCC1 YZFOGXKZTWZVFN-UHFFFAOYSA-N 0.000 description 1
- FOTKYAAJKYLFFN-UHFFFAOYSA-N decane-1,10-diol Chemical compound OCCCCCCCCCCO FOTKYAAJKYLFFN-UHFFFAOYSA-N 0.000 description 1
- 230000002950 deficient Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 150000001990 dicarboxylic acid derivatives Chemical class 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- FBSAITBEAPNWJG-UHFFFAOYSA-N dimethyl phthalate Natural products CC(=O)OC1=CC=CC=C1OC(C)=O FBSAITBEAPNWJG-UHFFFAOYSA-N 0.000 description 1
- 229960001826 dimethylphthalate Drugs 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 239000000806 elastomer Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- SYLAFCZSYRXBJF-UHFFFAOYSA-N furan-3,4-dicarboxylic acid Chemical compound OC(=O)C1=COC=C1C(O)=O SYLAFCZSYRXBJF-UHFFFAOYSA-N 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- UEGPKNKPLBYCNK-UHFFFAOYSA-L magnesium acetate Chemical compound [Mg+2].CC([O-])=O.CC([O-])=O UEGPKNKPLBYCNK-UHFFFAOYSA-L 0.000 description 1
- 239000011654 magnesium acetate Substances 0.000 description 1
- 229940069446 magnesium acetate Drugs 0.000 description 1
- 235000011285 magnesium acetate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- DFFZOPXDTCDZDP-UHFFFAOYSA-N naphthalene-1,5-dicarboxylic acid Chemical compound C1=CC=C2C(C(=O)O)=CC=CC2=C1C(O)=O DFFZOPXDTCDZDP-UHFFFAOYSA-N 0.000 description 1
- RXOHFPCZGPKIRD-UHFFFAOYSA-N naphthalene-2,6-dicarboxylic acid Chemical compound C1=C(C(O)=O)C=CC2=CC(C(=O)O)=CC=C21 RXOHFPCZGPKIRD-UHFFFAOYSA-N 0.000 description 1
- WPUMVKJOWWJPRK-UHFFFAOYSA-N naphthalene-2,7-dicarboxylic acid Chemical compound C1=CC(C(O)=O)=CC2=CC(C(=O)O)=CC=C21 WPUMVKJOWWJPRK-UHFFFAOYSA-N 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- AHHWIHXENZJRFG-UHFFFAOYSA-N oxetane Chemical compound C1COC1 AHHWIHXENZJRFG-UHFFFAOYSA-N 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- AJDJKHROQJQURF-UHFFFAOYSA-N phenanthrene-1,2-dicarboxylic acid Chemical compound C1=CC=C2C3=CC=C(C(=O)O)C(C(O)=O)=C3C=CC2=C1 AJDJKHROQJQURF-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 238000013031 physical testing Methods 0.000 description 1
- 238000012643 polycondensation polymerization Methods 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 230000000171 quenching effect Effects 0.000 description 1
- 229920005604 random copolymer Polymers 0.000 description 1
- 230000036632 reaction speed Effects 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/66—Polyesters containing oxygen in the form of ether groups
- C08G63/668—Polyesters containing oxygen in the form of ether groups derived from polycarboxylic acids and polyhydroxy compounds
- C08G63/672—Dicarboxylic acids and dihydroxy compounds
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/66—Polyesters containing oxygen in the form of ether groups
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyesters Or Polycarbonates (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US23644472A | 1972-03-20 | 1972-03-20 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2313874A1 DE2313874A1 (de) | 1973-10-04 |
| DE2313874B2 true DE2313874B2 (de) | 1979-02-01 |
| DE2313874C3 DE2313874C3 (enExample) | 1991-03-07 |
Family
ID=22889532
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2313874A Granted DE2313874B2 (de) | 1972-03-20 | 1973-03-20 | Verfahren zur Herstellung eines segmentierten, thermoplastischen Mischpolyesters |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3801547A (enExample) |
| JP (1) | JPS5230999B2 (enExample) |
| AR (1) | AR194045A1 (enExample) |
| AU (1) | AU473618B2 (enExample) |
| BE (1) | BE796978A (enExample) |
| BR (1) | BR7301972D0 (enExample) |
| CA (1) | CA1012288A (enExample) |
| DE (1) | DE2313874B2 (enExample) |
| ES (1) | ES412810A1 (enExample) |
| FR (1) | FR2176861B1 (enExample) |
| GB (1) | GB1418517A (enExample) |
| IT (1) | IT982564B (enExample) |
| NL (1) | NL162942B (enExample) |
| SE (1) | SE406917B (enExample) |
| ZA (1) | ZA731145B (enExample) |
Families Citing this family (35)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4080317A (en) * | 1970-10-23 | 1978-03-21 | Ciba-Geigy Ag | High molecular weight polycondensates from solid phase condensation |
| US3960817A (en) * | 1970-10-23 | 1976-06-01 | Ciba-Geigy Ag | Solid phase polyester polycondensation |
| US3972852A (en) * | 1973-08-07 | 1976-08-03 | Teijin Limited | Process for preparing aromatic polyesters from diphenols |
| US3954689A (en) * | 1973-12-10 | 1976-05-04 | E. I. Du Pont De Nemours And Company | Segmented thermoplastic copolyester elastomers |
| US3953404A (en) * | 1974-02-07 | 1976-04-27 | General Electric Company | Solid state polymerization of poly(1,4-butylene terephthalate) |
| JPS5218753A (en) * | 1975-08-05 | 1977-02-12 | Toray Ind Inc | Chips for molding composed of a polyester-polyether block copolymer an d a process for preparing them |
| US4328333A (en) * | 1981-04-24 | 1982-05-04 | Eastman Kodak Company | Copolyesterethers |
| US4857604A (en) * | 1984-01-04 | 1989-08-15 | General Electric Company | Blends of elastomeric polyetherester copolymers with thermoplastic polycarbonates and thermoplastic polyalkylene terephthalates |
| US4581420A (en) * | 1984-12-24 | 1986-04-08 | General Electric Company | Copolyetherester-hexahydrophthalate ester-block copolymers |
| EP0203634B1 (en) * | 1985-05-17 | 1989-08-30 | Akzo N.V. | Copolyetherester based on poly(propylene oxide) glycol blocked with ethylene oxide |
| US4824723A (en) * | 1986-06-02 | 1989-04-25 | General Electric Company | Flame resistant electrical insulating material |
| US4798858A (en) * | 1987-03-04 | 1989-01-17 | General Electric Company | Flame retardant polyetherimide ester elastomers |
| US4891397A (en) * | 1987-12-02 | 1990-01-02 | General Electric Company | Nucleated thermoplastic polyetherimide ester elastomer molding compositions |
| US5214088A (en) * | 1989-10-20 | 1993-05-25 | General Electric Company | Highly dense thermoplastic molding compositions |
| US5110668A (en) * | 1990-12-21 | 1992-05-05 | General Electric Company | Flexible laminate having copolyetherester adhesive |
| CA2103420A1 (en) * | 1992-12-22 | 1994-06-23 | Eileen B. Walsh | Stabilization of low molecular weight polybutylene terephthalate/polyester blends with phosphorus compounds |
| US5346767A (en) * | 1992-12-22 | 1994-09-13 | General Electric Company | Abrasion resistant highly filled polyester compositions |
| US5441997A (en) * | 1992-12-22 | 1995-08-15 | General Electric Company | High density polyester-polycarbonate molding composition |
| US5624737A (en) * | 1993-02-18 | 1997-04-29 | General Electric Company | Method for adhering materials having differing expansion properties and articles produced therefrom |
| US5674931A (en) * | 1995-04-07 | 1997-10-07 | General Electric Company | Flame retardant heavily filled thermoplastic composition |
| US6075113A (en) * | 1998-10-05 | 2000-06-13 | Mirror Image Technologies, Inc. | Wheel composition |
| NL1010385C2 (nl) * | 1998-10-23 | 2000-04-26 | Dsm Nv | Bereiding van een copolyetherester. |
| US6300399B1 (en) | 1999-08-27 | 2001-10-09 | General Electric Company | High specific gravity polyester blend |
| US6610795B2 (en) | 2001-08-10 | 2003-08-26 | E. I. Du Pont De Nemours And Company | Process to produce poly(alkylene ether) glycol-containing polyesters |
| US6423789B1 (en) | 2001-08-10 | 2002-07-23 | E. I. Dupont De Nemours & Company | Process to produce poly(alkylene ether)glycol-containing polyesters |
| US6399737B1 (en) | 2001-09-21 | 2002-06-04 | General Electric Company | EMI-shielding thermoplastic composition, method for the preparation thereof, and pellets and articles derived therefrom |
| US7625994B2 (en) | 2002-07-30 | 2009-12-01 | E.I. Du Pont De Nemours And Company | Sulfonated aliphatic-aromatic copolyetheresters |
| US20040024102A1 (en) * | 2002-07-30 | 2004-02-05 | Hayes Richard Allen | Sulfonated aliphatic-aromatic polyetherester films, coatings, and laminates |
| US7223456B2 (en) * | 2004-03-18 | 2007-05-29 | Noveon, Inc. | Flexible laminated plastic pipe having a chlorinated poly(vinyl chloride) hollow core |
| US7550552B2 (en) * | 2004-05-10 | 2009-06-23 | Mitsubishi Chemical Corporation | Process for producing polybutylene terephthalate |
| US20080182963A1 (en) * | 2005-09-01 | 2008-07-31 | Mitsubishi Chemical Corporation | Method For Producing Polyester |
| JP5299819B2 (ja) * | 2007-02-12 | 2013-09-25 | ディーエスエム アイピー アセッツ ビー.ブイ. | ポリマー組成物およびそれから作製されたプラスチック管 |
| US7847023B2 (en) * | 2007-03-12 | 2010-12-07 | Sabic Innovative Plastics Ip B.V. | Polysiloxane/polyimide copolymer blends |
| KR101484390B1 (ko) | 2012-04-24 | 2015-01-19 | 주식회사 엘지화학 | 열가소성 폴리에스테르 엘라스토머 수지 조성물 및 이를 포함하는 성형품 |
| KR101632101B1 (ko) | 2013-06-19 | 2016-06-20 | 주식회사 엘지화학 | 열가소성 폴리에스테르 엘라스토머 수지 조성물 및 이를 포함하는 성형품 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE592181A (enExample) * | 1955-12-22 | |||
| US3652713A (en) * | 1969-02-18 | 1972-03-28 | Toray Industries | Polyester composition having improved antistatic properties and process for the preparation thereof |
| BE753040A (fr) * | 1969-07-18 | 1970-12-16 | Du Pont | Elastomeres de copolyesters thermoplastiques segmentes |
| US3763109A (en) * | 1971-08-19 | 1973-10-02 | Du Pont | Segmented thermoplastic copolyesters |
-
1972
- 1972-03-20 US US00236444A patent/US3801547A/en not_active Expired - Lifetime
-
1973
- 1973-02-19 ZA ZA731145A patent/ZA731145B/xx unknown
- 1973-03-02 NL NL7302998.A patent/NL162942B/xx not_active Application Discontinuation
- 1973-03-05 CA CA165,309A patent/CA1012288A/en not_active Expired
- 1973-03-13 AR AR247018A patent/AR194045A1/es active
- 1973-03-15 AU AU53304/73A patent/AU473618B2/en not_active Expired
- 1973-03-16 IT IT21822/73A patent/IT982564B/it active
- 1973-03-16 SE SE7303724A patent/SE406917B/xx unknown
- 1973-03-16 JP JP48030148A patent/JPS5230999B2/ja not_active Expired
- 1973-03-17 ES ES412810A patent/ES412810A1/es not_active Expired
- 1973-03-19 GB GB1302473A patent/GB1418517A/en not_active Expired
- 1973-03-19 BE BE128954A patent/BE796978A/xx not_active IP Right Cessation
- 1973-03-19 FR FR7309703A patent/FR2176861B1/fr not_active Expired
- 1973-03-20 BR BR731972A patent/BR7301972D0/pt unknown
- 1973-03-20 DE DE2313874A patent/DE2313874B2/de active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| NL7302998A (enExample) | 1973-09-24 |
| ES412810A1 (es) | 1976-01-01 |
| JPS4913297A (enExample) | 1974-02-05 |
| JPS5230999B2 (enExample) | 1977-08-11 |
| BE796978A (fr) | 1973-09-19 |
| AU5330473A (en) | 1974-09-19 |
| FR2176861B1 (enExample) | 1976-11-05 |
| FR2176861A1 (enExample) | 1973-11-02 |
| GB1418517A (en) | 1975-12-24 |
| ZA731145B (en) | 1973-11-28 |
| DE2313874A1 (de) | 1973-10-04 |
| CA1012288A (en) | 1977-06-14 |
| AU473618B2 (en) | 1976-06-24 |
| BR7301972D0 (pt) | 1974-07-18 |
| US3801547A (en) | 1974-04-02 |
| SE406917B (sv) | 1979-03-05 |
| DE2313874C3 (enExample) | 1991-03-07 |
| AR194045A1 (es) | 1973-06-12 |
| IT982564B (it) | 1974-10-21 |
| NL162942B (nl) | 1980-02-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2313874B2 (de) | Verfahren zur Herstellung eines segmentierten, thermoplastischen Mischpolyesters | |
| DE2265320A1 (de) | Verfahren zum herstellen eines segmentierten thermoplastischen mischpolyesterelastomeren | |
| DE60315313T2 (de) | Polytrimethylenetherester | |
| DE2431072C3 (de) | Thermoplastische Copolyester und Verfahren zu ihrer Herstellung | |
| DE2503000A1 (de) | Polymerisation des poly(1,4-butylen- terephthalats) im festen aggregatzustand | |
| CH456142A (de) | Verformbare Masse aus Polycarbonat und Polyalkylen-terephthalat | |
| DE2265294B2 (de) | Verfahren zum Herstellen eines segmentierten, thermoplastischen Mischpolyesterelastomeren | |
| DE2342415A1 (de) | Neue, lineare homo- und copolyester auf basis von tere- und/oder isophthalsaeure | |
| DE2458472A1 (de) | Elastomere segmentpolyester | |
| DE3586414T2 (de) | Zusammensetzung von thermoplastischem elastomer. | |
| DE2412591C2 (enExample) | ||
| DE2035333C2 (de) | Segmentierte thermoplastische Mischpolyesterelastomere und Verfahren zu ihrer Herstellung | |
| DE2331596C3 (de) | Verfahren zur Herstellung von thermoplastischen, elastomeren Copolyätherestern | |
| DE2720004A1 (de) | Copolyester sowie verfahren zu ihrer herstellung | |
| DE2340559B2 (de) | Herstellung von hochmolekularen Polyestern des Butandiols-(1,4) | |
| DE60214734T2 (de) | Amorphe copolyester | |
| DE2456536A1 (de) | Segmentiertes thermoplastisches copolyesterelastomeres | |
| DE69424510T2 (de) | Fluormodifizierte Polyester mit verbesserter Verarbeitbarkeit | |
| EP0023248B1 (de) | Formmasse aus einem hochmolekularen linearen Polyester | |
| DE2311849A1 (de) | Herstellung von mischpolyesterelastomerem | |
| EP0126890B1 (de) | Hydrolysebeständige, thermoplastische Poly(butylenterephthalat)Formmassen | |
| DE1945594A1 (de) | Verfahren zur Herstellung von aromatischen Polyestern | |
| DE2348698A1 (de) | Copolyester mit einer logarithmischen viskositaetszahl von mindestens 0,4 | |
| DE2152245A1 (de) | Verfahren zur Herstellung hochmolekularer Polykondensate | |
| DE2421001A1 (de) | Verfahren zum stabilisieren von esterbindungen enthaltenden polymeren |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OGA | New person/name/address of the applicant | ||
| C3 | Grant after two publication steps (3rd publication) |