DE2307178A1 - Azofarbstoffe - Google Patents
AzofarbstoffeInfo
- Publication number
- DE2307178A1 DE2307178A1 DE19732307178 DE2307178A DE2307178A1 DE 2307178 A1 DE2307178 A1 DE 2307178A1 DE 19732307178 DE19732307178 DE 19732307178 DE 2307178 A DE2307178 A DE 2307178A DE 2307178 A1 DE2307178 A1 DE 2307178A1
- Authority
- DE
- Germany
- Prior art keywords
- group
- azo
- formula
- sulfonic acid
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000000975 dye Substances 0.000 claims description 13
- 125000003545 alkoxy group Chemical group 0.000 claims description 11
- 125000004432 carbon atom Chemical group C* 0.000 claims description 11
- 239000000987 azo dye Substances 0.000 claims description 8
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- -1 di-substituted sulfonamide Chemical class 0.000 claims description 7
- 238000000034 method Methods 0.000 claims description 7
- 238000004043 dyeing Methods 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 239000000463 material Substances 0.000 claims description 6
- 239000004952 Polyamide Substances 0.000 claims description 5
- 239000002168 alkylating agent Substances 0.000 claims description 5
- 229940100198 alkylating agent Drugs 0.000 claims description 5
- 229920002647 polyamide Polymers 0.000 claims description 5
- 150000002431 hydrogen Chemical group 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 125000000542 sulfonic acid group Chemical group 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 150000002367 halogens Chemical group 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 125000000565 sulfonamide group Chemical group 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 241000251730 Chondrichthyes Species 0.000 claims 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 description 6
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 6
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- 230000005494 condensation Effects 0.000 description 4
- 230000008878 coupling Effects 0.000 description 4
- 238000010168 coupling process Methods 0.000 description 4
- 238000005859 coupling reaction Methods 0.000 description 4
- QWVGKYWNOKOFNN-UHFFFAOYSA-N o-cresol Chemical compound CC1=CC=CC=C1O QWVGKYWNOKOFNN-UHFFFAOYSA-N 0.000 description 4
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- IQXPRPSTZKBYER-UHFFFAOYSA-N 4-(4-aminoanilino)-3-nitrobenzenesulfonic acid Chemical compound C1=CC(N)=CC=C1NC1=CC=C(S(O)(=O)=O)C=C1[N+]([O-])=O IQXPRPSTZKBYER-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 230000029936 alkylation Effects 0.000 description 3
- 238000005804 alkylation reaction Methods 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 3
- NKTOLZVEWDHZMU-UHFFFAOYSA-N 2,5-xylenol Chemical compound CC1=CC=C(C)C(O)=C1 NKTOLZVEWDHZMU-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 229920002292 Nylon 6 Polymers 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- ULUIKGKGWGNXNR-UHFFFAOYSA-N 2-amino-5-(2,4-dinitroanilino)benzenesulfonic acid Chemical compound NC1=C(C=C(C=C1)NC1=C(C=C(C=C1)[N+](=O)[O-])[N+](=O)[O-])S(=O)(=O)O ULUIKGKGWGNXNR-UHFFFAOYSA-N 0.000 description 1
- SMFHPCZZAAMJJO-UHFFFAOYSA-N 2-chloro-5-methylphenol Chemical compound CC1=CC=C(Cl)C(O)=C1 SMFHPCZZAAMJJO-UHFFFAOYSA-N 0.000 description 1
- ISPYQTSUDJAMAB-UHFFFAOYSA-N 2-chlorophenol Chemical compound OC1=CC=CC=C1Cl ISPYQTSUDJAMAB-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- ASHGTJPOSUFTGB-UHFFFAOYSA-N 3-methoxyphenol Chemical compound COC1=CC=CC(O)=C1 ASHGTJPOSUFTGB-UHFFFAOYSA-N 0.000 description 1
- LKQYUJYPYBCDOA-UHFFFAOYSA-N 4-bromo-3-nitrobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(Br)C([N+]([O-])=O)=C1 LKQYUJYPYBCDOA-UHFFFAOYSA-N 0.000 description 1
- RPKWNMFDAOACCX-UHFFFAOYSA-N 4-chloro-3-nitrobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(Cl)C([N+]([O-])=O)=C1 RPKWNMFDAOACCX-UHFFFAOYSA-N 0.000 description 1
- UMNGEAKUUOJPAX-UHFFFAOYSA-N 4-chloro-n-methyl-3-nitrobenzenesulfonamide Chemical compound CNS(=O)(=O)C1=CC=C(Cl)C([N+]([O-])=O)=C1 UMNGEAKUUOJPAX-UHFFFAOYSA-N 0.000 description 1
- ZRVDHZHTIDPBRG-UHFFFAOYSA-N 4-methylphenol;phenol Chemical compound OC1=CC=CC=C1.CC1=CC=C(O)C=C1 ZRVDHZHTIDPBRG-UHFFFAOYSA-N 0.000 description 1
- QHPQWRBYOIRBIT-UHFFFAOYSA-N 4-tert-butylphenol Chemical compound CC(C)(C)C1=CC=C(O)C=C1 QHPQWRBYOIRBIT-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- VYZAHLCBVHPDDF-UHFFFAOYSA-N Dinitrochlorobenzene Chemical compound [O-][N+](=O)C1=CC=C(Cl)C([N+]([O-])=O)=C1 VYZAHLCBVHPDDF-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- LLEMOWNGBBNAJR-UHFFFAOYSA-N biphenyl-2-ol Chemical group OC1=CC=CC=C1C1=CC=CC=C1 LLEMOWNGBBNAJR-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 235000015243 ice cream Nutrition 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 229940050176 methyl chloride Drugs 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- QXDYIBHUQHUJJI-UHFFFAOYSA-N nitrobenzene phenol Chemical compound OC1=CC=CC=C1.[O-][N+](=O)C1=CC=CC=C1 QXDYIBHUQHUJJI-UHFFFAOYSA-N 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000001043 yellow dye Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B43/00—Preparation of azo dyes from other azo compounds
- C09B43/11—Preparation of azo dyes from other azo compounds by introducing hydrocarbon radicals or substituted hydrocarbon radicals on primary or secondary amino groups
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B29/00—Monoazo dyes prepared by diazotising and coupling
- C09B29/10—Monoazo dyes prepared by diazotising and coupling from coupling components containing hydroxy as the only directing group
- C09B29/12—Monoazo dyes prepared by diazotising and coupling from coupling components containing hydroxy as the only directing group of the benzene series
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B43/00—Preparation of azo dyes from other azo compounds
- C09B43/28—Preparation of azo dyes from other azo compounds by etherification of hydroxyl groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Priority Applications (9)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19732307178 DE2307178A1 (de) | 1973-02-14 | 1973-02-14 | Azofarbstoffe |
| NL7401842A NL7401842A (OSRAM) | 1973-02-14 | 1974-02-11 | |
| IT2045174A IT1006348B (it) | 1973-02-14 | 1974-02-11 | Coloranti azoici |
| JP1635574A JPS49113822A (OSRAM) | 1973-02-14 | 1974-02-12 | |
| CH194174A CH593380B5 (OSRAM) | 1973-02-14 | 1974-02-12 | |
| CH194174D CH194174A4 (OSRAM) | 1973-02-14 | 1974-02-12 | |
| GB653274A GB1441522A (en) | 1973-02-14 | 1974-02-13 | Monoazo dyestuffs derived from 4-amino-2-nitro-diphenylamines |
| BE140851A BE810965A (fr) | 1973-02-14 | 1974-02-13 | Colorants azoiques alcoxyles |
| FR7405073A FR2217387B1 (OSRAM) | 1973-02-14 | 1974-02-14 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19732307178 DE2307178A1 (de) | 1973-02-14 | 1973-02-14 | Azofarbstoffe |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2307178A1 true DE2307178A1 (de) | 1974-08-22 |
Family
ID=5871859
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19732307178 Withdrawn DE2307178A1 (de) | 1973-02-14 | 1973-02-14 | Azofarbstoffe |
Country Status (8)
| Country | Link |
|---|---|
| JP (1) | JPS49113822A (OSRAM) |
| BE (1) | BE810965A (OSRAM) |
| CH (2) | CH194174A4 (OSRAM) |
| DE (1) | DE2307178A1 (OSRAM) |
| FR (1) | FR2217387B1 (OSRAM) |
| GB (1) | GB1441522A (OSRAM) |
| IT (1) | IT1006348B (OSRAM) |
| NL (1) | NL7401842A (OSRAM) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1512802A (en) * | 1975-05-09 | 1978-06-01 | Ici Ltd | Nitrodiphenylamine monoazo dyes |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR638138A (fr) * | 1926-07-29 | 1928-05-16 | Ig Farbenindustrie Ag | Procédé pour produire des teintures jaunes sur des esters ou des éthers de la cellulose |
-
1973
- 1973-02-14 DE DE19732307178 patent/DE2307178A1/de not_active Withdrawn
-
1974
- 1974-02-11 IT IT2045174A patent/IT1006348B/it active
- 1974-02-11 NL NL7401842A patent/NL7401842A/xx unknown
- 1974-02-12 CH CH194174D patent/CH194174A4/xx unknown
- 1974-02-12 CH CH194174A patent/CH593380B5/xx not_active IP Right Cessation
- 1974-02-12 JP JP1635574A patent/JPS49113822A/ja active Pending
- 1974-02-13 GB GB653274A patent/GB1441522A/en not_active Expired
- 1974-02-13 BE BE140851A patent/BE810965A/xx unknown
- 1974-02-14 FR FR7405073A patent/FR2217387B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2217387A1 (OSRAM) | 1974-09-06 |
| JPS49113822A (OSRAM) | 1974-10-30 |
| IT1006348B (it) | 1976-09-30 |
| GB1441522A (en) | 1976-07-07 |
| CH593380B5 (OSRAM) | 1977-11-30 |
| FR2217387B1 (OSRAM) | 1978-06-02 |
| NL7401842A (OSRAM) | 1974-08-16 |
| CH194174A4 (OSRAM) | 1977-04-15 |
| BE810965A (fr) | 1974-08-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2353149C3 (de) | Saure Disazofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben von natürlichen oder synthetischen Polyamidfasern | |
| DE913174C (de) | Verfahren zur Herstellung von neuen, zwei 1,2,3,-Triazolringe enthaltenden aromatischen Verbindungen | |
| DE2421654C3 (de) | Trisazofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben und Bedrucken von Textilmaterialien | |
| DE2630988C2 (de) | Azofarbstoffe | |
| DE2307178A1 (de) | Azofarbstoffe | |
| EP0356860B1 (de) | Reaktivfarbstoffe | |
| DE1219146B (de) | Verfahren zur Herstellung von wasserloeslichen Monoazofarbstoffen | |
| DE2453209C2 (de) | Disazofarbstoffe, Verfahren zu deren Herstellung und deren Verwendung | |
| CH194174A (de) | Verfahren und Vorrichtung zur Herstellung von Versteifungseinlagen, insbesondere Steifkappen für Schuhwerk. | |
| DE2307179A1 (de) | Azofarbstoffe | |
| DE693025C (de) | Verfahren zur Herstellung von Polymethinfarbstoffen | |
| DE959669C (de) | Verfahren zur Herstellung von Nitrofarbstoffen | |
| EP0066781A2 (de) | Sulfonsäuregruppenhaltige Disazofarbstoffe | |
| EP0073387A1 (de) | Wasserlösliche Polyazofarbstoffe, ihre Herstellung und ihre Verwendung | |
| DE102005058906A1 (de) | Anthrachinonfarbstoffe zum Färben von Polyurethan | |
| DE2362330A1 (de) | Polyfluorierte saure azofarbstoffe | |
| DE3048212A1 (de) | Azofarbstoffe, verfahren zu ihrer herstellung, mit ihnen gefaerbte polyamidmaterialien sowie faerbe- und bedruckverfahren | |
| DE745462C (de) | Verfahren zur Herstellung von Polyazofarbstoffen | |
| DE745413C (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| DE710408C (de) | Verfahren zur Herstellung von Polyazofarbstoffen | |
| DE1544410C (de) | Verfahren zur Herstellung basischer Farbstoffe | |
| DE2024184A1 (de) | Azofarbstoffe | |
| DE2710465A1 (de) | Monoazofarbstoffe | |
| DE1644222A1 (de) | Orangenfarbige bis scharlachrote Monoazofarbstoffe und Verfahren zu deren Herstellung | |
| DE1292272B (de) | Verfahren zur Herstellung von wasserloeslichen faserreaktiven Farbstoffen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8178 | Suspension cancelled | ||
| 8130 | Withdrawal |