DE2260048C3 - Bildwiedergabezelle - Google Patents
BildwiedergabezelleInfo
- Publication number
- DE2260048C3 DE2260048C3 DE2260048A DE2260048A DE2260048C3 DE 2260048 C3 DE2260048 C3 DE 2260048C3 DE 2260048 A DE2260048 A DE 2260048A DE 2260048 A DE2260048 A DE 2260048A DE 2260048 C3 DE2260048 C3 DE 2260048C3
- Authority
- DE
- Germany
- Prior art keywords
- cell
- electrode
- electrodes
- viologen
- image
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000126 substance Substances 0.000 claims description 23
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 14
- 229910001868 water Inorganic materials 0.000 claims description 14
- 150000001875 compounds Chemical class 0.000 claims description 11
- 239000007788 liquid Substances 0.000 claims description 8
- 239000012530 fluid Substances 0.000 description 20
- 229910052757 nitrogen Inorganic materials 0.000 description 18
- 239000000243 solution Substances 0.000 description 16
- -1 morpholinocarbonylethyl group Chemical group 0.000 description 12
- 239000000047 product Substances 0.000 description 9
- 150000001450 anions Chemical class 0.000 description 8
- 230000003647 oxidation Effects 0.000 description 8
- 238000007254 oxidation reaction Methods 0.000 description 8
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 8
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 7
- 238000009792 diffusion process Methods 0.000 description 7
- 150000003839 salts Chemical class 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- 229910020366 ClO 4 Inorganic materials 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 6
- 229940075397 calomel Drugs 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- ZOMNIUBKTOKEHS-UHFFFAOYSA-L dimercury dichloride Chemical compound Cl[Hg][Hg]Cl ZOMNIUBKTOKEHS-UHFFFAOYSA-L 0.000 description 6
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 5
- 239000011521 glass Substances 0.000 description 5
- 229920005989 resin Polymers 0.000 description 5
- 239000011347 resin Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 4
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- 229910052794 bromium Inorganic materials 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 239000004744 fabric Substances 0.000 description 4
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 4
- 229910052737 gold Inorganic materials 0.000 description 4
- 239000010931 gold Substances 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 229910052697 platinum Inorganic materials 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 3
- 229920005372 Plexiglas® Polymers 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 3
- 229910052759 nickel Inorganic materials 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 229910002651 NO3 Inorganic materials 0.000 description 2
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 125000003342 alkenyl group Chemical group 0.000 description 2
- 125000005078 alkoxycarbonylalkyl group Chemical group 0.000 description 2
- IWOUKMZUPDVPGQ-UHFFFAOYSA-N barium nitrate Chemical compound [Ba+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O IWOUKMZUPDVPGQ-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 238000005868 electrolysis reaction Methods 0.000 description 2
- 239000003792 electrolyte Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 239000012811 non-conductive material Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 125000003884 phenylalkyl group Chemical group 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 238000007086 side reaction Methods 0.000 description 2
- UGNWTBMOAKPKBL-UHFFFAOYSA-N tetrachloro-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O UGNWTBMOAKPKBL-UHFFFAOYSA-N 0.000 description 2
- ROFVEXUMMXZLPA-UHFFFAOYSA-N Bipyridyl Chemical group N1=CC=CC=C1C1=CC=CC=N1 ROFVEXUMMXZLPA-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical group C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 1
- 241000282376 Panthera tigris Species 0.000 description 1
- 241000124033 Salix Species 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 1
- 238000002835 absorbance Methods 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 159000000009 barium salts Chemical class 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 239000007772 electrode material Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 229910003437 indium oxide Inorganic materials 0.000 description 1
- PJXISJQVUVHSOJ-UHFFFAOYSA-N indium(iii) oxide Chemical compound [O-2].[O-2].[O-2].[In+3].[In+3] PJXISJQVUVHSOJ-UHFFFAOYSA-N 0.000 description 1
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000002560 nitrile group Chemical group 0.000 description 1
- 150000002825 nitriles Chemical group 0.000 description 1
- 239000005416 organic matter Substances 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 1
- 229920001343 polytetrafluoroethylene Polymers 0.000 description 1
- 239000004810 polytetrafluoroethylene Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 230000004043 responsiveness Effects 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- YPNVIBVEFVRZPJ-UHFFFAOYSA-L silver sulfate Chemical compound [Ag+].[Ag+].[O-]S([O-])(=O)=O YPNVIBVEFVRZPJ-UHFFFAOYSA-L 0.000 description 1
- 229910000367 silver sulfate Inorganic materials 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 125000005207 tetraalkylammonium group Chemical group 0.000 description 1
- STOSPPMGXZPHKP-UHFFFAOYSA-N tetrachlorohydroquinone Chemical compound OC1=C(Cl)C(Cl)=C(O)C(Cl)=C1Cl STOSPPMGXZPHKP-UHFFFAOYSA-N 0.000 description 1
- 229910001887 tin oxide Inorganic materials 0.000 description 1
- 229910000349 titanium oxysulfate Inorganic materials 0.000 description 1
- 238000007740 vapor deposition Methods 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09K—MATERIALS FOR MISCELLANEOUS APPLICATIONS, NOT PROVIDED FOR ELSEWHERE
- C09K9/00—Tenebrescent materials, i.e. materials for which the range of wavelengths for energy absorption is changed as a result of excitation by some form of energy
- C09K9/02—Organic tenebrescent materials
-
- G—PHYSICS
- G02—OPTICS
- G02F—OPTICAL DEVICES OR ARRANGEMENTS FOR THE CONTROL OF LIGHT BY MODIFICATION OF THE OPTICAL PROPERTIES OF THE MEDIA OF THE ELEMENTS INVOLVED THEREIN; NON-LINEAR OPTICS; FREQUENCY-CHANGING OF LIGHT; OPTICAL LOGIC ELEMENTS; OPTICAL ANALOGUE/DIGITAL CONVERTERS
- G02F1/00—Devices or arrangements for the control of the intensity, colour, phase, polarisation or direction of light arriving from an independent light source, e.g. switching, gating or modulating; Non-linear optics
- G02F1/01—Devices or arrangements for the control of the intensity, colour, phase, polarisation or direction of light arriving from an independent light source, e.g. switching, gating or modulating; Non-linear optics for the control of the intensity, phase, polarisation or colour
- G02F1/15—Devices or arrangements for the control of the intensity, colour, phase, polarisation or direction of light arriving from an independent light source, e.g. switching, gating or modulating; Non-linear optics for the control of the intensity, phase, polarisation or colour based on an electrochromic effect
- G02F1/1503—Devices or arrangements for the control of the intensity, colour, phase, polarisation or direction of light arriving from an independent light source, e.g. switching, gating or modulating; Non-linear optics for the control of the intensity, phase, polarisation or colour based on an electrochromic effect caused by oxidation-reduction reactions in organic liquid solutions, e.g. viologen solutions
Landscapes
- Chemical & Material Sciences (AREA)
- Physics & Mathematics (AREA)
- Nonlinear Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Physics & Mathematics (AREA)
- Optics & Photonics (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Organic Chemistry (AREA)
- Electrochromic Elements, Electrophoresis, Or Variable Reflection Or Absorption Elements (AREA)
- Devices For Indicating Variable Information By Combining Individual Elements (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL7117713.A NL161587C (nl) | 1971-12-23 | 1971-12-23 | Beeldweergeefcel, alsmede werkwijze voor het weergeven van beelden. |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2260048A1 DE2260048A1 (de) | 1973-07-05 |
| DE2260048B2 DE2260048B2 (de) | 1979-07-26 |
| DE2260048C3 true DE2260048C3 (de) | 1980-03-20 |
Family
ID=19814770
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2260048A Expired DE2260048C3 (de) | 1971-12-23 | 1972-12-08 | Bildwiedergabezelle |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3854794A (enExample) |
| JP (1) | JPS4871380A (enExample) |
| AU (1) | AU467004B2 (enExample) |
| BE (1) | BE793156A (enExample) |
| CA (1) | CA984604A (enExample) |
| CH (1) | CH578190A5 (enExample) |
| DE (1) | DE2260048C3 (enExample) |
| FR (1) | FR2170525A5 (enExample) |
| GB (1) | GB1376799A (enExample) |
| IT (1) | IT976130B (enExample) |
| NL (1) | NL161587C (enExample) |
| SE (1) | SE388944B (enExample) |
Families Citing this family (49)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL7313982A (nl) * | 1973-10-11 | 1975-04-15 | Philips Nv | Bekrachtigingsschakeling voor een visueel weer- lement. |
| JPS50100870A (enExample) * | 1974-01-09 | 1975-08-09 | ||
| FR2264342B1 (enExample) * | 1974-03-12 | 1978-12-01 | Commissariat Energie Atomique | |
| JPS5112795A (ja) * | 1974-07-22 | 1976-01-31 | Suwa Seikosha Kk | Hyojitai |
| JPS6044666B2 (ja) * | 1974-08-12 | 1985-10-04 | シャープ株式会社 | 電気化学的表示装置 |
| US3961842A (en) * | 1974-09-20 | 1976-06-08 | Texas Instruments Incorporated | Regenerating electrode for electrochromic display cell |
| US3950077A (en) * | 1974-09-20 | 1976-04-13 | Texas Instruments Incorporated | Lead reference and counter electrode for an electrochromic display |
| JPS5167091A (enExample) * | 1974-12-09 | 1976-06-10 | Suwa Seikosha Kk | |
| JPS5937804B2 (ja) * | 1974-12-11 | 1984-09-12 | 松下電器産業株式会社 | 表示装置 |
| GB1512284A (en) * | 1975-03-13 | 1978-06-01 | Ici Ltd | Electrochromic display devices |
| JPS5937311B2 (ja) * | 1975-05-31 | 1984-09-08 | ガツコウホウジン トウキヨウデンキダイガク | 表示素子 |
| JPS525298A (en) * | 1975-07-02 | 1977-01-14 | Citizen Watch Co Ltd | Electro chromic display |
| JPS5289341A (en) * | 1976-01-20 | 1977-07-26 | Sharp Corp | Indication device |
| JPS52100381A (en) * | 1976-02-20 | 1977-08-23 | Dainippon Toryo Co Ltd | Electrochromic display element |
| US4116535A (en) * | 1976-05-10 | 1978-09-26 | U.S. Philips Corporation | Picture display cell with memory effect |
| DE2737564C2 (de) * | 1976-09-02 | 1985-05-02 | Matsushita Electric Industrial Co., Ltd., Kadoma, Osaka | Farbanzeigevorrichtung mit an einer Indikatorelektrode entstehenden Redox-Reaktionsprodukten |
| GB1513999A (en) * | 1976-12-22 | 1978-06-14 | Ibm | Electrochromic display device |
| US4093358A (en) * | 1976-12-27 | 1978-06-06 | International Business Machines Corporation | High efficiency electrochromic display device |
| JPS5387251A (en) * | 1977-01-10 | 1978-08-01 | Matsushita Electric Ind Co Ltd | Display device |
| GB1564264A (en) * | 1977-04-19 | 1980-04-02 | Ibm | Electrochromic display device |
| GB1566031A (en) * | 1977-04-19 | 1980-04-30 | Ibm | Electrochromic display device |
| US4090782A (en) * | 1977-05-31 | 1978-05-23 | International Business Machines Corporation | Electrochromic display devices comprising thienylidene pyrazoline compounds |
| DE2827688A1 (de) * | 1977-06-28 | 1979-01-04 | Dainippon Toryo Kk | Elektrochrome masse und sie enthaltende elektrochrome anzeigevorrichtung |
| US4187003A (en) * | 1977-11-02 | 1980-02-05 | International Business Machines Corporation | Electrolyte for electrochromic display device |
| US4139276A (en) * | 1978-03-27 | 1979-02-13 | International Business Machines Corporation | Electrochromic display devices comprising substituted fluorene compounds |
| US4252418A (en) * | 1978-03-31 | 1981-02-24 | International Business Machines Corporation | Electrochromic display device |
| JPS5580483A (en) * | 1978-12-11 | 1980-06-17 | Ibm | Electrochromic display element |
| GB2051393A (en) * | 1979-05-23 | 1981-01-14 | Ibm | Electrochromic electrolyte |
| US4304465A (en) * | 1979-10-29 | 1981-12-08 | International Business Machines Corporation | Electrochromic display device |
| DE3175185D1 (en) * | 1981-12-24 | 1986-09-25 | Ibm | Electrolytic display device employing metal ion catalysis |
| US4773742A (en) * | 1984-05-15 | 1988-09-27 | Canon Kabushiki Kaisha | Display method with fatly acid ester host molecule |
| JPS62208027A (ja) * | 1986-03-07 | 1987-09-12 | Kureha Chem Ind Co Ltd | 液晶を用いた記憶方法及び記憶素子 |
| US5151816A (en) * | 1989-12-29 | 1992-09-29 | Donnelly Corporation | Method for reducing current leakage and enhancing uv stability in electrochemichromic solutions and devices |
| US5140455A (en) | 1989-11-29 | 1992-08-18 | Donnelly Corporation | High performance electrochemichromic solutions and devices thereof |
| US5145609A (en) * | 1990-11-07 | 1992-09-08 | Donnelly Corporation | Linear polyether-containing electrochemichromic solutions and related devices |
| US5233461A (en) * | 1991-09-06 | 1993-08-03 | Donnelly Corporation | Methods for sealing electrochromic devices and devices manufactured thereby |
| US5500760A (en) * | 1991-09-06 | 1996-03-19 | Donnelly Corporation | Electrochemichromic solutions, processes for preparing and using the same, and devices manufactured with the same |
| US5239405A (en) * | 1991-09-06 | 1993-08-24 | Donnelly Corporation | Electrochemichromic solutions, processes for preparing and using the same, and devices manufactured with the same |
| US5910854A (en) | 1993-02-26 | 1999-06-08 | Donnelly Corporation | Electrochromic polymeric solid films, manufacturing electrochromic devices using such solid films, and processes for making such solid films and devices |
| EP0612826B1 (en) * | 1993-02-26 | 2000-10-04 | Donnelly Corporation | Electrochromic polymeric solid films, manufacturing electrochromic devices using such solid films, and processing for making such solid films and devices |
| US5668663A (en) | 1994-05-05 | 1997-09-16 | Donnelly Corporation | Electrochromic mirrors and devices |
| US7370983B2 (en) | 2000-03-02 | 2008-05-13 | Donnelly Corporation | Interior mirror assembly with display |
| US7167796B2 (en) | 2000-03-09 | 2007-01-23 | Donnelly Corporation | Vehicle navigation system for use with a telematics system |
| US7446924B2 (en) | 2003-10-02 | 2008-11-04 | Donnelly Corporation | Mirror reflective element assembly including electronic component |
| WO2009002556A1 (en) | 2007-06-27 | 2008-12-31 | Gentex Corporation | Electrochromic device having an improved fill port plug |
| US8345345B2 (en) | 2007-06-27 | 2013-01-01 | Gentex Corporation | Electrochromic device having an improved fill port plug |
| US9196424B2 (en) * | 2011-08-30 | 2015-11-24 | Ocean's King Lighting Science & Technology Co., Ltd. | Double-center bipyridyl cationic ion liquid, preparation method therefor and use thereof |
| US9057925B2 (en) | 2013-03-15 | 2015-06-16 | Gentex Corporation | Fill port plugs for electrochromic devices |
| US9454054B2 (en) | 2013-11-18 | 2016-09-27 | Magna Mirrors Of America, Inc. | Electro-optic mirror element and process of making same |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3451741A (en) * | 1966-06-15 | 1969-06-24 | Du Pont | Electrochromic device |
| BE755563A (fr) * | 1969-09-02 | 1971-03-01 | Polaroid Corp | Dispositif de filtrage variable de lumiere |
-
0
- BE BE793156D patent/BE793156A/xx not_active IP Right Cessation
-
1971
- 1971-12-23 NL NL7117713.A patent/NL161587C/xx not_active IP Right Cessation
-
1972
- 1972-12-08 DE DE2260048A patent/DE2260048C3/de not_active Expired
- 1972-12-11 US US00313822A patent/US3854794A/en not_active Expired - Lifetime
- 1972-12-15 CA CA159,174A patent/CA984604A/en not_active Expired
- 1972-12-20 CH CH1855872A patent/CH578190A5/xx not_active IP Right Cessation
- 1972-12-20 GB GB5874572A patent/GB1376799A/en not_active Expired
- 1972-12-20 JP JP47127322A patent/JPS4871380A/ja active Pending
- 1972-12-20 IT IT71017/72A patent/IT976130B/it active
- 1972-12-20 SE SE7216732A patent/SE388944B/xx unknown
- 1972-12-21 AU AU50403/72A patent/AU467004B2/en not_active Expired
- 1972-12-21 FR FR7245650A patent/FR2170525A5/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2170525A5 (enExample) | 1973-09-14 |
| AU5040372A (en) | 1974-06-27 |
| US3854794A (en) | 1974-12-17 |
| JPS4871380A (enExample) | 1973-09-27 |
| BE793156A (fr) | 1973-06-21 |
| NL161587B (nl) | 1979-09-17 |
| CA984604A (en) | 1976-03-02 |
| AU467004B2 (en) | 1974-06-27 |
| IT976130B (it) | 1974-08-20 |
| NL7117713A (enExample) | 1973-06-26 |
| SE388944B (sv) | 1976-10-18 |
| CH578190A5 (enExample) | 1976-07-30 |
| NL161587C (nl) | 1980-02-15 |
| GB1376799A (en) | 1974-12-11 |
| DE2260048B2 (de) | 1979-07-26 |
| DE2260048A1 (de) | 1973-07-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2260048C3 (de) | Bildwiedergabezelle | |
| DE2419223C3 (de) | Bildwiedergabezelle | |
| DE2718910C2 (de) | Bildwiedergabezelle mit Speicherwirkung | |
| DE2129104C3 (de) | Bildwiedergabevorrichtung, die eine Lösung eines reversibel reduzierbaren organischen Stoffes enthält | |
| DE69530900T2 (de) | Optische Vorrichtung | |
| DE69122910T2 (de) | Verfahren zur Kupfer-Elektroplattierung | |
| EP0467846B1 (de) | Neue elektrochrome Stoffzusammensetzungen auf der Basis von Diketopyrrolopyrrolen | |
| DE2511314A1 (de) | Elektrochromie-anordnung und dafuer geeignete elektrochrome medien | |
| DE2846665A1 (de) | Elektrochrome vorrichtungen und verfahren zu ihrer herstellung | |
| DE2737564C2 (de) | Farbanzeigevorrichtung mit an einer Indikatorelektrode entstehenden Redox-Reaktionsprodukten | |
| DE3438492A1 (de) | Elektrochrome einrichtung | |
| EP1103842B1 (de) | Elektrochrome Vorrichtung | |
| DE2638491B2 (de) | Elektrochrome anzeigevorrichtung | |
| DE2946792C2 (de) | Elektrochrome Anzeigevorrichtung | |
| DE2733529C2 (de) | Treiberschaltung für eine elektrochrome Anzeigevorrichtung | |
| DE4010285A1 (de) | Elektrochromie-vorrichtung | |
| DE2943049A1 (de) | Loesung und verfahren zum elektroplattieren von chrom oder chromlegierungen | |
| DE69813118T2 (de) | Optische Vorrichtung und elektrolytische Lösung | |
| DE2610528A1 (de) | Elektrochromievorrichtung und -medium | |
| DE19539865A1 (de) | Durchlauf-Galvanikanlage | |
| EP0563690A1 (de) | Elektrochemische Messzelle zum Nachweis einer in Wasser gelösten Spezies | |
| EP0717791B1 (de) | Electrolysezelle mit teilelektroden und zumindest einer gegenpoligen gegenelektrode | |
| DE2723023A1 (de) | Chromquelle fuer das elektroplattieren und deren herstellung und verwendung | |
| DE2816837A1 (de) | Verfahren und schaltungsanordnung zur ansteuerung einer elektrochromen anzeigevorrichtung | |
| DE7517076U (de) | Elektrochrome anzeigevorrichtung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |