DE2258985C2 - Verfahren zur Herstellung von 2-(3- Benzoylphenyl)-propionsäure - Google Patents
Verfahren zur Herstellung von 2-(3- Benzoylphenyl)-propionsäureInfo
- Publication number
- DE2258985C2 DE2258985C2 DE2258985A DE2258985A DE2258985C2 DE 2258985 C2 DE2258985 C2 DE 2258985C2 DE 2258985 A DE2258985 A DE 2258985A DE 2258985 A DE2258985 A DE 2258985A DE 2258985 C2 DE2258985 C2 DE 2258985C2
- Authority
- DE
- Germany
- Prior art keywords
- benzoylphenyl
- acid
- formula
- propionic acid
- preparation
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 15
- DKYWVDODHFEZIM-UHFFFAOYSA-N ketoprofen Chemical compound OC(=O)C(C)C1=CC=CC(C(=O)C=2C=CC=CC=2)=C1 DKYWVDODHFEZIM-UHFFFAOYSA-N 0.000 title claims description 8
- 238000002360 preparation method Methods 0.000 title claims description 5
- 150000003839 salts Chemical class 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 11
- 150000002825 nitriles Chemical class 0.000 claims description 6
- 229910052751 metal Inorganic materials 0.000 claims description 5
- 239000002184 metal Substances 0.000 claims description 5
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 5
- 238000005727 Friedel-Crafts reaction Methods 0.000 claims description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 3
- 230000003110 anti-inflammatory effect Effects 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 8
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 239000002585 base Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- RGYOCHMZSLUCNP-UHFFFAOYSA-N 2-(3-benzoylphenyl)propanenitrile Chemical compound N#CC(C)C1=CC=CC(C(=O)C=2C=CC=CC=2)=C1 RGYOCHMZSLUCNP-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000012153 distilled water Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- XXQNFMGCPMJJSJ-UHFFFAOYSA-N 3-(1-cyanoethyl)benzoyl chloride Chemical compound N#CC(C)C1=CC=CC(C(Cl)=O)=C1 XXQNFMGCPMJJSJ-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 150000005171 halobenzenes Chemical class 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- GPSDUZXPYCFOSQ-UHFFFAOYSA-N m-toluic acid Chemical compound CC1=CC=CC(C(O)=O)=C1 GPSDUZXPYCFOSQ-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- HGRGFZWEVKNHJT-UHFFFAOYSA-N 2-(3-benzoylphenyl)-2-methylpropanoic acid Chemical compound OC(=O)C(C)(C)C1=CC=CC(C(=O)C=2C=CC=CC=2)=C1 HGRGFZWEVKNHJT-UHFFFAOYSA-N 0.000 description 1
- ALDSXDRDRWDASQ-UHFFFAOYSA-N 2-(3-benzoylphenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(C(=O)C=2C=CC=CC=2)=C1 ALDSXDRDRWDASQ-UHFFFAOYSA-N 0.000 description 1
- IKCLCGXPQILATA-UHFFFAOYSA-N 2-chlorobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1Cl IKCLCGXPQILATA-UHFFFAOYSA-N 0.000 description 1
- IRYIYPWRXROPSX-UHFFFAOYSA-N 3-(1-cyanoethyl)benzoic acid Chemical compound N#CC(C)C1=CC=CC(C(O)=O)=C1 IRYIYPWRXROPSX-UHFFFAOYSA-N 0.000 description 1
- SKDHHIUENRGTHK-UHFFFAOYSA-N 4-nitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=CC=C(C(Cl)=O)C=C1 SKDHHIUENRGTHK-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 235000015895 biscuits Nutrition 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- AUHZEENZYGFFBQ-UHFFFAOYSA-N mesitylene Substances CC1=CC(C)=CC(C)=C1 AUHZEENZYGFFBQ-UHFFFAOYSA-N 0.000 description 1
- 125000001827 mesitylenyl group Chemical group [H]C1=C(C(*)=C(C([H])=C1C([H])([H])[H])C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- YXFVVABEGXRONW-UHFFFAOYSA-N toluene Substances CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/08—Preparation of carboxylic acids or their salts, halides or anhydrides from nitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7143565A FR2163875A5 (en) | 1971-12-03 | 1971-12-03 | 3-benzoylphenyl acetic and 2-(3-benzoyl phenyl) - propionic acids prepn - for use as anti-inflammatories |
| FR7236570A FR2202873A2 (en) | 1972-10-16 | 1972-10-16 | 3-benzoylphenyl acetic and 2-(3-benzoyl phenyl) - propionic acids prepn - for use as anti-inflammatories |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2258985A1 DE2258985A1 (de) | 1973-06-14 |
| DE2258985C2 true DE2258985C2 (de) | 1982-07-01 |
Family
ID=26216758
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2258985A Expired DE2258985C2 (de) | 1971-12-03 | 1972-12-01 | Verfahren zur Herstellung von 2-(3- Benzoylphenyl)-propionsäure |
Country Status (26)
| Country | Link |
|---|---|
| JP (1) | JPS528301B2 (enExample) |
| AR (1) | AR194864A1 (enExample) |
| AT (1) | AT321283B (enExample) |
| BE (1) | BE792218A (enExample) |
| CA (1) | CA972765A (enExample) |
| CH (1) | CH545761A (enExample) |
| CS (1) | CS170457B2 (enExample) |
| CY (1) | CY916A (enExample) |
| DD (1) | DD100239A5 (enExample) |
| DE (1) | DE2258985C2 (enExample) |
| DK (1) | DK134814B (enExample) |
| ES (1) | ES409237A1 (enExample) |
| FI (1) | FI55173C (enExample) |
| GB (1) | GB1360560A (enExample) |
| HK (1) | HK60177A (enExample) |
| HU (1) | HU166290B (enExample) |
| IE (1) | IE36936B1 (enExample) |
| IL (1) | IL40972A (enExample) |
| LU (1) | LU66586A1 (enExample) |
| NL (1) | NL7215990A (enExample) |
| NO (1) | NO139782C (enExample) |
| OA (1) | OA04219A (enExample) |
| PL (1) | PL77271B1 (enExample) |
| SE (1) | SE397675B (enExample) |
| SU (1) | SU457210A3 (enExample) |
| YU (1) | YU36003B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1985003287A1 (en) * | 1984-01-19 | 1985-08-01 | Pharmacia Ab | Novel arylacetic acid derivatives |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS582934B2 (ja) * | 1974-07-29 | 1983-01-19 | ニツシンセイフン カブシキガイシヤ | 2−(置換アリ−ル)−プロピオン酸の製法 |
| DE2708142C3 (de) * | 1977-02-25 | 1981-10-29 | Rütgerswerke AG, 6000 Frankfurt | Verfahren zur Herstellung von substituierten Phenylacetonitrilen und neue Phenylacetonitrile |
| US4340740A (en) | 1979-07-16 | 1982-07-20 | Sagami Chemical Research Center | Alpha-thio-alpha-aryl-substituted alkanonitrile and process for preparing alpha-aryl-substituted alkanonitrile therefrom |
| ES2058024B1 (es) * | 1992-11-10 | 1995-05-01 | Menarini Lab | Nuevo derivado arilpropionico, procedimiento de fabricacion del mismo y su utilizacion como analgesico. |
| ES2163986B1 (es) * | 1999-07-13 | 2003-02-16 | Menarini Lab | Acidos-alfa-arilpropionicos y arilaceticos como inhibidores de la ciclooxigenasa-ii. |
| CN111675631A (zh) * | 2020-06-24 | 2020-09-18 | 湖北仙盛科技股份有限公司 | 一种氰基酮洛芬合成工艺 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1546478A (fr) * | 1967-01-27 | 1968-11-22 | Rhone Poulenc Sa | Nouveaux dérivés de l'acide benzoyl-3 phénylacétique et leur préparation |
| GB1226344A (enExample) * | 1967-07-31 | 1971-03-24 |
-
1972
- 1972-11-22 OA OA54753A patent/OA04219A/xx unknown
- 1972-11-24 NL NL7215990A patent/NL7215990A/xx unknown
- 1972-11-30 JP JP47119468A patent/JPS528301B2/ja not_active Expired
- 1972-11-30 IE IE1660/72A patent/IE36936B1/xx unknown
- 1972-11-30 IL IL40972A patent/IL40972A/en unknown
- 1972-12-01 NO NO4425/72A patent/NO139782C/no unknown
- 1972-12-01 DE DE2258985A patent/DE2258985C2/de not_active Expired
- 1972-12-01 CA CA158,010A patent/CA972765A/en not_active Expired
- 1972-12-01 DK DK602072AA patent/DK134814B/da not_active IP Right Cessation
- 1972-12-01 GB GB5564072A patent/GB1360560A/en not_active Expired
- 1972-12-01 AR AR245440A patent/AR194864A1/es active
- 1972-12-01 DD DD167245A patent/DD100239A5/xx unknown
- 1972-12-01 YU YU2990/72A patent/YU36003B/xx unknown
- 1972-12-01 AT AT1022772A patent/AT321283B/de active
- 1972-12-01 LU LU66586A patent/LU66586A1/xx unknown
- 1972-12-01 SE SE7215722A patent/SE397675B/xx unknown
- 1972-12-01 PL PL1972159227A patent/PL77271B1/pl unknown
- 1972-12-01 BE BE792218D patent/BE792218A/xx not_active IP Right Cessation
- 1972-12-01 CS CS8228A patent/CS170457B2/cs unknown
- 1972-12-01 FI FI3415/72A patent/FI55173C/fi active
- 1972-12-01 CY CY916A patent/CY916A/xx unknown
- 1972-12-01 CH CH1756172A patent/CH545761A/xx not_active IP Right Cessation
- 1972-12-01 SU SU1859757A patent/SU457210A3/ru active
- 1972-12-01 HU HURO687A patent/HU166290B/hu unknown
- 1972-12-02 ES ES409237A patent/ES409237A1/es not_active Expired
-
1977
- 1977-12-01 HK HK601/77A patent/HK60177A/xx unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1985003287A1 (en) * | 1984-01-19 | 1985-08-01 | Pharmacia Ab | Novel arylacetic acid derivatives |
Also Published As
| Publication number | Publication date |
|---|---|
| SU457210A3 (ru) | 1975-01-15 |
| GB1360560A (en) | 1974-07-17 |
| DE2258985A1 (de) | 1973-06-14 |
| JPS4864059A (enExample) | 1973-09-05 |
| HK60177A (en) | 1977-12-09 |
| DK134814B (da) | 1977-01-24 |
| LU66586A1 (enExample) | 1973-07-18 |
| FI55173C (fi) | 1979-06-11 |
| FI55173B (fi) | 1979-02-28 |
| CA972765A (en) | 1975-08-12 |
| OA04219A (fr) | 1979-12-31 |
| IL40972A0 (en) | 1973-01-30 |
| BE792218A (fr) | 1973-06-01 |
| YU299072A (en) | 1981-02-28 |
| DK134814C (enExample) | 1977-06-13 |
| NO139782C (no) | 1979-05-09 |
| NO139782B (no) | 1979-01-29 |
| CY916A (en) | 1977-12-23 |
| CS170457B2 (enExample) | 1976-08-27 |
| IE36936B1 (en) | 1977-03-30 |
| CH545761A (enExample) | 1974-02-15 |
| ES409237A1 (es) | 1975-12-01 |
| HU166290B (enExample) | 1975-02-28 |
| YU36003B (en) | 1981-11-13 |
| SE397675B (sv) | 1977-11-14 |
| IE36936L (en) | 1973-06-03 |
| DD100239A5 (enExample) | 1973-09-12 |
| AT321283B (de) | 1975-03-25 |
| PL77271B1 (en) | 1975-04-30 |
| JPS528301B2 (enExample) | 1977-03-08 |
| IL40972A (en) | 1976-03-31 |
| NL7215990A (enExample) | 1973-06-05 |
| AR194864A1 (es) | 1973-08-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2258985C2 (de) | Verfahren zur Herstellung von 2-(3- Benzoylphenyl)-propionsäure | |
| EP0034741B1 (de) | Verfahren zur Herstellung eines substituierten Bromfluorbenzols und 3-Brom-4-fluorbenzonitril | |
| DE2240883A1 (de) | Verfahren zur herstellung von carbonsaeure- und sulfonsaeurechloriden | |
| DE2751610A1 (de) | Verfahren zur herstellung von cyclopropanderivaten | |
| DE2737210C2 (de) | Verfahren zur Herstellung von Nitrilen | |
| DE2642140C2 (de) | Verfahren zur Herstellung von Benzoylcyanid | |
| CH633528A5 (de) | Verfahren zur herstellung von cyclopropanderivaten. | |
| CH413814A (de) | Verfahren zur Herstellung von 2,5-Dichlor-, 2,5-Dibrom- und 2,5-Dijod-terephthalsäure | |
| CH630877A5 (de) | Verfahren zur herstellung von aromatischen fluorverbindungen. | |
| DE2716773A1 (de) | Verfahren zur herstellung von estern von m-phenoxybenzylalkohol und seiner alpha-cyano- und alpha- aethinylderivate mit carbonsaeuren | |
| CH390271A (de) | Verfahren zur Herstellung von diarylaminoaromatischen Dicarbonsäuren | |
| EP0805140A1 (de) | Verfahren zur Herstellung von 4,5-Dichlor-2-methylbenzoesäure | |
| CH633765A5 (en) | Process for the preparation of o-substituted benzal bromides and benzyl bromides | |
| DE2442883A1 (de) | Verfahren zur herstellung von carbonsaeurefluoriden | |
| DE2460821A1 (de) | Verfahren zur herstellung von carbonsaeurefluoriden | |
| EP0365914A2 (de) | Neue Fluor enthaltende und an der CH3-Gruppe gegebenenfalls halogenierte Acetophenone und deren Herstellung aus neuen Fluor enthaltenden Benzonitrilen | |
| AT343113B (de) | Verfahren zur herstellung von neuen 5- oder 6- substituierten benzoxazolen | |
| DE2023460C3 (de) | L- und DL-Tyrosine und Verfahren zu ihrer Herstellung | |
| WO1991010635A1 (de) | Verfahren zur herstellung von 2,4,6-trimethylacetophenon | |
| DE2329251C2 (de) | Verfahren zur Herstellung von disubstituiertem Malonsäuredinitril | |
| CH628878A5 (en) | Process for the preparation of 2-cyanohexanoic acid derivatives | |
| DE1174797B (de) | Verfahren zur Herstellung von Sulfamylanthranilsaeuren | |
| DE1793350C3 (de) | Verfahren zur Herstellung von alkylsubstituierten Glutarsäuren | |
| DE192035C (enExample) | ||
| CH626602A5 (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| D2 | Grant after examination |