DE2252210A1 - Schwerentflammbare thermoplastische polyester - Google Patents
Schwerentflammbare thermoplastische polyesterInfo
- Publication number
- DE2252210A1 DE2252210A1 DE2252210A DE2252210A DE2252210A1 DE 2252210 A1 DE2252210 A1 DE 2252210A1 DE 2252210 A DE2252210 A DE 2252210A DE 2252210 A DE2252210 A DE 2252210A DE 2252210 A1 DE2252210 A1 DE 2252210A1
- Authority
- DE
- Germany
- Prior art keywords
- polyester
- radical
- weight
- saturated
- carbon atoms
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 229920000728 polyester Polymers 0.000 title claims description 31
- 229920001169 thermoplastic Polymers 0.000 title claims description 5
- 239000004416 thermosoftening plastic Substances 0.000 title claims description 5
- -1 cyclic alkyl radical Chemical class 0.000 claims description 21
- 238000004519 manufacturing process Methods 0.000 claims description 11
- 229920006395 saturated elastomer Polymers 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 5
- 239000000835 fiber Substances 0.000 claims description 4
- 238000001746 injection moulding Methods 0.000 claims description 4
- 150000003009 phosphonic acids Chemical class 0.000 claims description 4
- 150000003254 radicals Chemical class 0.000 claims description 4
- 150000001447 alkali salts Chemical class 0.000 claims description 3
- 239000003365 glass fiber Substances 0.000 claims description 3
- 229920000642 polymer Polymers 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 150000005840 aryl radicals Chemical class 0.000 claims description 2
- 238000001125 extrusion Methods 0.000 claims description 2
- 239000000945 filler Substances 0.000 claims description 2
- 238000000748 compression moulding Methods 0.000 claims 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 11
- 238000000465 moulding Methods 0.000 description 9
- 229920000139 polyethylene terephthalate Polymers 0.000 description 8
- 239000005020 polyethylene terephthalate Substances 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 7
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 6
- 238000009833 condensation Methods 0.000 description 5
- 229920001283 Polyalkylene terephthalate Polymers 0.000 description 4
- 239000000654 additive Substances 0.000 description 4
- 230000005494 condensation Effects 0.000 description 4
- 150000002009 diols Chemical class 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 238000007792 addition Methods 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 150000003018 phosphorus compounds Chemical class 0.000 description 3
- KSKSMWHBMWHUAL-UHFFFAOYSA-M sodium;ethyl(hydroxy)phosphinate Chemical compound [Na+].CCP(O)([O-])=O KSKSMWHBMWHUAL-UHFFFAOYSA-M 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 2
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000003063 flame retardant Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- 239000002667 nucleating agent Substances 0.000 description 2
- 238000006068 polycondensation reaction Methods 0.000 description 2
- 239000007790 solid phase Substances 0.000 description 2
- 238000005809 transesterification reaction Methods 0.000 description 2
- JHDJUJAFXNIIIW-UHFFFAOYSA-N (4-phosphonophenyl)phosphonic acid Chemical class OP(O)(=O)C1=CC=C(P(O)(O)=O)C=C1 JHDJUJAFXNIIIW-UHFFFAOYSA-N 0.000 description 1
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- XYJLPCAKKYOLGU-UHFFFAOYSA-N 2-phosphonoethylphosphonic acid Chemical class OP(O)(=O)CCP(O)(O)=O XYJLPCAKKYOLGU-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- DZKUVVFEQHCDSK-UHFFFAOYSA-N P([O-])([O-])[O-].[Ge+3] Chemical compound P([O-])([O-])[O-].[Ge+3] DZKUVVFEQHCDSK-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- YIMQCDZDWXUDCA-UHFFFAOYSA-N [4-(hydroxymethyl)cyclohexyl]methanol Chemical compound OCC1CCC(CO)CC1 YIMQCDZDWXUDCA-UHFFFAOYSA-N 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001722 carbon compounds Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- JXSJBGJIGXNWCI-UHFFFAOYSA-N diethyl 2-[(dimethoxyphosphorothioyl)thio]succinate Chemical compound CCOC(=O)CC(SP(=S)(OC)OC)C(=O)OCC JXSJBGJIGXNWCI-UHFFFAOYSA-N 0.000 description 1
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 1
- 229940042400 direct acting antivirals phosphonic acid derivative Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000007706 flame test Methods 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 239000012784 inorganic fiber Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 229940071125 manganese acetate Drugs 0.000 description 1
- UOGMEBQRZBEZQT-UHFFFAOYSA-L manganese(2+);diacetate Chemical compound [Mn+2].CC([O-])=O.CC([O-])=O UOGMEBQRZBEZQT-UHFFFAOYSA-L 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000009347 mechanical transmission Effects 0.000 description 1
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 1
- RXOHFPCZGPKIRD-UHFFFAOYSA-N naphthalene-2,6-dicarboxylic acid Chemical compound C1=C(C(O)=O)C=CC2=CC(C(=O)O)=CC=C21 RXOHFPCZGPKIRD-UHFFFAOYSA-N 0.000 description 1
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 150000002903 organophosphorus compounds Chemical class 0.000 description 1
- 150000003007 phosphonic acid derivatives Chemical class 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- ULWHHBHJGPPBCO-UHFFFAOYSA-N propane-1,1-diol Chemical compound CCC(O)O ULWHHBHJGPPBCO-UHFFFAOYSA-N 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- BESAEFHCILHDTB-UHFFFAOYSA-M sodium;benzyl(hydroxy)phosphinate Chemical compound [Na+].OP([O-])(=O)CC1=CC=CC=C1 BESAEFHCILHDTB-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/49—Phosphorus-containing compounds
- C08K5/51—Phosphorus bound to oxygen
- C08K5/53—Phosphorus bound to oxygen bound to oxygen and to carbon only
- C08K5/5317—Phosphonic compounds, e.g. R—P(:O)(OR')2
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Polyesters Or Polycarbonates (AREA)
Priority Applications (11)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2252210A DE2252210A1 (de) | 1972-10-25 | 1972-10-25 | Schwerentflammbare thermoplastische polyester |
| NL7314425A NL7314425A (OSRAM) | 1972-10-25 | 1973-10-19 | |
| CH1486073A CH555870A (de) | 1972-10-25 | 1973-10-22 | Schwerentflammbare thermoplastische polyester. |
| US408646A US3894986A (en) | 1972-10-25 | 1973-10-23 | Flame resistant thermoplastic polyesters |
| IT30478/73A IT998899B (it) | 1972-10-25 | 1973-10-23 | Poliesteri termoplastici difficil mente infiammabili |
| AU61718/73A AU6171873A (en) | 1972-10-25 | 1973-10-23 | Thermoplastic polyesters |
| JP48118589A JPS4974735A (OSRAM) | 1972-10-25 | 1973-10-23 | |
| BR8327/73A BR7308327D0 (pt) | 1972-10-25 | 1973-10-24 | Composicao de poliesteres termoplasticos |
| ZA738244A ZA738244B (en) | 1972-10-25 | 1973-10-24 | Flame resistant thermoplastic polyesters |
| BE137070A BE806520A (fr) | 1972-10-25 | 1973-10-25 | Polyesters thermoplastiques peu inflammables |
| FR7338039A FR2204658B1 (OSRAM) | 1972-10-25 | 1973-10-25 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2252210A DE2252210A1 (de) | 1972-10-25 | 1972-10-25 | Schwerentflammbare thermoplastische polyester |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2252210A1 true DE2252210A1 (de) | 1974-05-09 |
Family
ID=5859967
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2252210A Pending DE2252210A1 (de) | 1972-10-25 | 1972-10-25 | Schwerentflammbare thermoplastische polyester |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3894986A (OSRAM) |
| JP (1) | JPS4974735A (OSRAM) |
| AU (1) | AU6171873A (OSRAM) |
| BE (1) | BE806520A (OSRAM) |
| BR (1) | BR7308327D0 (OSRAM) |
| CH (1) | CH555870A (OSRAM) |
| DE (1) | DE2252210A1 (OSRAM) |
| FR (1) | FR2204658B1 (OSRAM) |
| IT (1) | IT998899B (OSRAM) |
| NL (1) | NL7314425A (OSRAM) |
| ZA (1) | ZA738244B (OSRAM) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP1739122A1 (de) * | 2005-06-30 | 2007-01-03 | Lanxess Deutschland GmbH | Polymerzubereitungen enthaltend ein Metallsalz einer Phosphonsäure |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL7510243A (nl) * | 1974-09-04 | 1976-03-08 | Hoechst Ag | Gestabiliseerde polyalkeenvormmassa. |
| DE2447727A1 (de) * | 1974-10-07 | 1976-04-08 | Hoechst Ag | Schwerentflammbare polyamidformmassen |
| US4288489A (en) * | 1978-02-06 | 1981-09-08 | Ciba-Geigy Corporation | Process for flameproofing organic fibrous material with phosphonic acid salts |
| US4224203A (en) * | 1978-09-05 | 1980-09-23 | Argus Chemical Corporation | Vinyl chloride polymer stabilizer comprising a metal organophosphonate |
| US4383066A (en) * | 1980-04-15 | 1983-05-10 | Mitsubishi Gas Chemical Company, Inc. | Polyphenylene ether resin composition |
| FR2512039B1 (fr) * | 1981-08-26 | 1985-10-11 | Ato Chimie | Composition de resine synthetique ayant une bonne resistance au feu renfermant un polycarbonate, un additif ignifugeant phosphore, et eventuellement d'autres additifs et/ou des charges et objets conformes |
| GB8611357D0 (en) * | 1986-05-09 | 1986-06-18 | Ciba Geigy Ag | Flame retardent polymer compositions |
| NL8703025A (nl) * | 1987-12-15 | 1989-07-03 | Gen Electric | Polymeer samenstelling met lithiumzout van fosfonzuur en lithiumzout. |
| GB8912388D0 (en) * | 1989-05-30 | 1989-07-12 | Ici Plc | 3-hydroxybutyrate polymer composition |
| WO2000014152A1 (en) * | 1998-09-08 | 2000-03-16 | Isle Firestop Ltd. | Combustion retardant for polymeric materials |
| RU2281992C1 (ru) * | 2005-03-02 | 2006-08-20 | Государственное образовательное учреждение высшего профессионального образования Саратовский государственный технический университет (ГОУ ВПО СГТУ) | Способ получения огнезащищенного полиэфирного волокнистого материала |
| DE102008063668A1 (de) * | 2008-12-18 | 2010-07-01 | Clariant International Limited | Verfahren zur Herstellung von Alkylphosponsäuren, -estern und -salzen mittels Oxidation von Alkylphosphonigsäuren und ihre Verwendung |
| US9765204B2 (en) | 2013-07-24 | 2017-09-19 | Lanxess Solutions Us Inc. | Halogen free high temperature polyamide compositions comprising phosphorus containing flame retardants |
| US9745449B2 (en) * | 2013-07-24 | 2017-08-29 | Lanxess Solutions Us Inc. | Phosphorus containing flame retardants |
| EP3172217B1 (en) * | 2014-07-22 | 2021-09-01 | LANXESS Corporation | Phosphorus containing flame retardants |
| US10035896B2 (en) | 2014-07-29 | 2018-07-31 | Lanxess Solutions Us Inc. | Salts of pyrophosphonic acid as flame retardants |
| EP3242912B1 (en) * | 2015-01-09 | 2020-12-09 | LANXESS Corporation | Process stabilization of polymer compositions comprising phosphorous containing flame retardants |
| US9752009B2 (en) | 2015-01-26 | 2017-09-05 | Lanxess Solutions Us Inc. | Flame retardant polymer compositions comprising heat treated phosphorus compounds and melam |
| US9534108B2 (en) | 2015-03-13 | 2017-01-03 | Chemtura Corporation | Flame retardant epoxy resins comprising phosphorus containing flame retardants |
| US12152129B2 (en) | 2018-12-20 | 2024-11-26 | Lanxess Corporation | Method for preparing readily processable, thermally-stable, phosphorus-containing flame retardant material |
| JP7751598B2 (ja) | 2020-06-17 | 2025-10-08 | ランクセス・コーポレーション | 熱可塑性プラスチックとともに使用するための難燃剤と安定剤との組み合わせ |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3474047A (en) * | 1959-08-28 | 1969-10-21 | Wyandotte Chemicals Corp | Polyurethane compositions |
| US3471552A (en) * | 1965-08-24 | 1969-10-07 | Plains Chem Dev Co | Aliphatic polyphosphonic acids and derivatives thereof |
| US3463835A (en) * | 1965-10-05 | 1969-08-26 | Plains Chem Dev Co | Aromatic polyphosphonic acids,salts and esters |
| US3576793A (en) * | 1967-05-08 | 1971-04-27 | Monsanto Co | Polymers of alkylene diphosphonic acids and salts and copolymers thereof |
| US3522204A (en) * | 1968-07-01 | 1970-07-28 | American Cyanamid Co | Synergistic flame-retardant compositions |
| US3676393A (en) * | 1968-10-14 | 1972-07-11 | Goodyear Tire & Rubber | Polyesters stabilized by phosphorus compounds |
| DE1934903A1 (de) * | 1969-07-10 | 1971-01-14 | Hoechst Ag | Thermoplastische Formmassen auf Basis Polyester |
| BE754116A (fr) * | 1969-07-29 | 1971-01-29 | Hoechst Ag | Matieres a mouler thermoplastiques a base de polyesters |
| US3664975A (en) * | 1970-04-13 | 1972-05-23 | Monsanto Co | Flame resistant polyurethane prepared by adding an ethane diphosphonate into the urethane-forming mixture |
| US3751396A (en) * | 1970-11-27 | 1973-08-07 | Celanese Corp | Reinforced polyalkylene terephthalate molding resin having reduced burning properties in thin sections |
-
1972
- 1972-10-25 DE DE2252210A patent/DE2252210A1/de active Pending
-
1973
- 1973-10-19 NL NL7314425A patent/NL7314425A/xx unknown
- 1973-10-22 CH CH1486073A patent/CH555870A/xx not_active IP Right Cessation
- 1973-10-23 US US408646A patent/US3894986A/en not_active Expired - Lifetime
- 1973-10-23 AU AU61718/73A patent/AU6171873A/en not_active Expired
- 1973-10-23 JP JP48118589A patent/JPS4974735A/ja active Pending
- 1973-10-23 IT IT30478/73A patent/IT998899B/it active
- 1973-10-24 ZA ZA738244A patent/ZA738244B/xx unknown
- 1973-10-24 BR BR8327/73A patent/BR7308327D0/pt unknown
- 1973-10-25 BE BE137070A patent/BE806520A/xx unknown
- 1973-10-25 FR FR7338039A patent/FR2204658B1/fr not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP1739122A1 (de) * | 2005-06-30 | 2007-01-03 | Lanxess Deutschland GmbH | Polymerzubereitungen enthaltend ein Metallsalz einer Phosphonsäure |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2204658A1 (OSRAM) | 1974-05-24 |
| US3894986A (en) | 1975-07-15 |
| CH555870A (de) | 1974-11-15 |
| BR7308327D0 (pt) | 1974-09-05 |
| FR2204658B1 (OSRAM) | 1977-03-11 |
| IT998899B (it) | 1976-02-20 |
| ZA738244B (en) | 1974-10-30 |
| AU6171873A (en) | 1975-04-24 |
| NL7314425A (OSRAM) | 1974-04-29 |
| JPS4974735A (OSRAM) | 1974-07-18 |
| BE806520A (fr) | 1974-04-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2252210A1 (de) | Schwerentflammbare thermoplastische polyester | |
| DE2252258A1 (de) | Schwerentflammbare thermoplastische polyester | |
| DE2255971C2 (de) | Neue cyclische Phosphonatester, Verfahren zu deren Herstellung und deren Verwendung als Flammverzögerungsmittel | |
| DE2346787C3 (de) | Schwer entflammbare lineare Polyester, Verfahren zu deren Herstellung und deren Verwendung | |
| JPS59202240A (ja) | 難燃性熱可塑性樹脂組成物 | |
| CH640547A5 (de) | Verfahren zur herstellung eines linearen homo- oder copolyesters mit verbesserter hitzestabilitaet. | |
| DE2454189A1 (de) | Verfahren zur herstellung schwer entflammbarer linearer polyester | |
| EP0327092B1 (de) | Phosphonate, Verfahren zu deren Herstellung und deren Verwendung als Flammschutzmittel in Kunststoffen | |
| DE69226503T2 (de) | Polymerzusammensetzung mit phosphorhaltigen linearen Copolyestern | |
| DE2706128C2 (de) | Schnell kristallisierende Polyestermassen und Verfahren zu ihrer Herstellung | |
| DE2545720A1 (de) | Schnellkristallisierende blockcopolyester | |
| EP0970093B1 (de) | Aluminiumsalze von alkylhydroxymethylphosphinsäuren | |
| DE2653120C2 (de) | Schnellkristallisierende Polyestermassen, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE4221678C2 (de) | Hydroxyalkan-phosphonate von Polyolen | |
| DE2706123C2 (OSRAM) | ||
| EP0048878B1 (de) | Neue Hydroxiphenylgruppen enthaltende Phosphorigsäureester, Verfahren zu ihrer Herstellung und ihre Verwendung als Stabilisatoren für thermoplastische Polyester | |
| EP0971936B1 (de) | Aluminiumsalze von alkyl-1-alkoxyethylphosphinsäuren | |
| DE2238222A1 (de) | Schwerentflammbare thermoplastische polyester | |
| EP0304785B1 (de) | Polyphenylensulfid-Formmassen mit verbesserten elektrischen Eigenschaften | |
| US3883474A (en) | Flame resistant thermoplastic polyesters | |
| DE2236039A1 (de) | Schwerentflammbare, glasklare thermoplastische polyester | |
| AT264140B (de) | Verfahren zur Herstellung 2,5-Dihydroxyterephthalsäure enthaltender Polyester und Copolyester | |
| DE2258663A1 (de) | Schwerentflammbare thermoplastische polyester | |
| US4210740A (en) | Copolyesters prepared from phosphorus compounds which can be shaped and which have reduced flammability | |
| AT257940B (de) | Verfahren zur Herstellung linearer Copolyester |