DE2248607B2 - - Google Patents
Info
- Publication number
- DE2248607B2 DE2248607B2 DE2248607A DE2248607A DE2248607B2 DE 2248607 B2 DE2248607 B2 DE 2248607B2 DE 2248607 A DE2248607 A DE 2248607A DE 2248607 A DE2248607 A DE 2248607A DE 2248607 B2 DE2248607 B2 DE 2248607B2
- Authority
- DE
- Germany
- Prior art keywords
- water
- weight
- soluble
- reaction vessel
- monomers
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 238000006243 chemical reaction Methods 0.000 claims description 28
- 239000003638 chemical reducing agent Substances 0.000 claims description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 14
- 239000000178 monomer Substances 0.000 claims description 13
- 238000000034 method Methods 0.000 claims description 11
- 239000003054 catalyst Substances 0.000 claims description 10
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 claims description 7
- 230000003746 surface roughness Effects 0.000 claims description 7
- 239000002270 dispersing agent Substances 0.000 claims description 6
- 239000000654 additive Substances 0.000 claims description 5
- 229920000915 polyvinyl chloride Polymers 0.000 claims description 5
- 239000004800 polyvinyl chloride Substances 0.000 claims description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 claims description 3
- 239000007900 aqueous suspension Substances 0.000 claims description 3
- 229920001577 copolymer Polymers 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 3
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 2
- 229920001328 Polyvinylidene chloride Polymers 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 150000002926 oxygen Chemical class 0.000 claims description 2
- 229910052698 phosphorus Inorganic materials 0.000 claims description 2
- 239000011574 phosphorus Substances 0.000 claims description 2
- 230000000379 polymerizing effect Effects 0.000 claims description 2
- 239000005033 polyvinylidene chloride Substances 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 239000011593 sulfur Substances 0.000 claims description 2
- 238000006116 polymerization reaction Methods 0.000 description 15
- -1 B. maleic Chemical class 0.000 description 11
- 150000001875 compounds Chemical class 0.000 description 7
- 229920000642 polymer Polymers 0.000 description 5
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 238000004140 cleaning Methods 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 230000002265 prevention Effects 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- BEQKKZICTDFVMG-UHFFFAOYSA-N 1,2,3,4,6-pentaoxepane-5,7-dione Chemical compound O=C1OOOOC(=O)O1 BEQKKZICTDFVMG-UHFFFAOYSA-N 0.000 description 2
- BVQVLAIMHVDZEL-UHFFFAOYSA-N 1-phenyl-1,2-propanedione Chemical group CC(=O)C(=O)C1=CC=CC=C1 BVQVLAIMHVDZEL-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000000084 colloidal system Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000008367 deionised water Substances 0.000 description 2
- 229910021641 deionized water Inorganic materials 0.000 description 2
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 229920000609 methyl cellulose Polymers 0.000 description 2
- 239000001923 methylcellulose Substances 0.000 description 2
- 235000010981 methylcellulose Nutrition 0.000 description 2
- 125000005634 peroxydicarbonate group Chemical group 0.000 description 2
- 230000001681 protective effect Effects 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 2,3-dimethylbutane Chemical group CC(C)C(C)C ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- QSJXEFYPDANLFS-UHFFFAOYSA-N Diacetyl Chemical group CC(=O)C(C)=O QSJXEFYPDANLFS-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 229910052586 apatite Inorganic materials 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- WURBFLDFSFBTLW-UHFFFAOYSA-N benzil Chemical group C=1C=CC=CC=1C(=O)C(=O)C1=CC=CC=C1 WURBFLDFSFBTLW-UHFFFAOYSA-N 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000001913 cellulose Chemical class 0.000 description 1
- 229920002678 cellulose Chemical class 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000008139 complexing agent Substances 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- LSXWFXONGKSEMY-UHFFFAOYSA-N di-tert-butyl peroxide Chemical compound CC(C)(C)OOC(C)(C)C LSXWFXONGKSEMY-UHFFFAOYSA-N 0.000 description 1
- 239000012933 diacyl peroxide Substances 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- HRKQOINLCJTGBK-UHFFFAOYSA-N dihydroxidosulfur Chemical class OSO HRKQOINLCJTGBK-UHFFFAOYSA-N 0.000 description 1
- 229910000397 disodium phosphate Inorganic materials 0.000 description 1
- 235000019800 disodium phosphate Nutrition 0.000 description 1
- ZRRLFMPOAYZELW-UHFFFAOYSA-N disodium;hydrogen phosphite Chemical compound [Na+].[Na+].OP([O-])[O-] ZRRLFMPOAYZELW-UHFFFAOYSA-N 0.000 description 1
- IGBZOHMCHDADGY-UHFFFAOYSA-N ethenyl 2-ethylhexanoate Chemical compound CCCCC(CC)C(=O)OC=C IGBZOHMCHDADGY-UHFFFAOYSA-N 0.000 description 1
- MEGHWIAOTJPCHQ-UHFFFAOYSA-N ethenyl butanoate Chemical compound CCCC(=O)OC=C MEGHWIAOTJPCHQ-UHFFFAOYSA-N 0.000 description 1
- UIWXSTHGICQLQT-UHFFFAOYSA-N ethenyl propanoate Chemical compound CCC(=O)OC=C UIWXSTHGICQLQT-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 150000004675 formic acid derivatives Chemical class 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 229910052588 hydroxylapatite Inorganic materials 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 125000005395 methacrylic acid group Chemical group 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- XONPDZSGENTBNJ-UHFFFAOYSA-N molecular hydrogen;sodium Chemical compound [Na].[H][H] XONPDZSGENTBNJ-UHFFFAOYSA-N 0.000 description 1
- YCWSUKQGVSGXJO-NTUHNPAUSA-N nifuroxazide Chemical group C1=CC(O)=CC=C1C(=O)N\N=C\C1=CC=C([N+]([O-])=O)O1 YCWSUKQGVSGXJO-NTUHNPAUSA-N 0.000 description 1
- 150000002826 nitrites Chemical class 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- VSIIXMUUUJUKCM-UHFFFAOYSA-D pentacalcium;fluoride;triphosphate Chemical compound [F-].[Ca+2].[Ca+2].[Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O VSIIXMUUUJUKCM-UHFFFAOYSA-D 0.000 description 1
- XYJRXVWERLGGKC-UHFFFAOYSA-D pentacalcium;hydroxide;triphosphate Chemical compound [OH-].[Ca+2].[Ca+2].[Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O XYJRXVWERLGGKC-UHFFFAOYSA-D 0.000 description 1
- 150000002976 peresters Chemical class 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 230000005501 phase interface Effects 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- ACVYVLVWPXVTIT-UHFFFAOYSA-N phosphinic acid Chemical class O[PH2]=O ACVYVLVWPXVTIT-UHFFFAOYSA-N 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 229920001291 polyvinyl halide Polymers 0.000 description 1
- 238000010526 radical polymerization reaction Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229940079827 sodium hydrogen sulfite Drugs 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- UIIMBOGNXHQVGW-UHFFFAOYSA-N sodium;hydron;carbonate Chemical compound [Na+].OC(O)=O UIIMBOGNXHQVGW-UHFFFAOYSA-N 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- OPQYOFWUFGEMRZ-UHFFFAOYSA-N tert-butyl 2,2-dimethylpropaneperoxoate Chemical compound CC(C)(C)OOC(=O)C(C)(C)C OPQYOFWUFGEMRZ-UHFFFAOYSA-N 0.000 description 1
- SWAXTRYEYUTSAP-UHFFFAOYSA-N tert-butyl ethaneperoxoate Chemical compound CC(=O)OOC(C)(C)C SWAXTRYEYUTSAP-UHFFFAOYSA-N 0.000 description 1
- BWSZXUOMATYHHI-UHFFFAOYSA-N tert-butyl octaneperoxoate Chemical compound CCCCCCCC(=O)OOC(C)(C)C BWSZXUOMATYHHI-UHFFFAOYSA-N 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 239000010409 thin film Substances 0.000 description 1
- 150000004764 thiosulfuric acid derivatives Chemical class 0.000 description 1
- 150000003606 tin compounds Chemical class 0.000 description 1
- 238000013022 venting Methods 0.000 description 1
- 229920001567 vinyl ester resin Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F14/00—Homopolymers and copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and at least one being terminated by a halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Polymerisation Methods In General (AREA)
Priority Applications (15)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19722248607 DE2248607A1 (de) | 1972-10-04 | 1972-10-04 | Verfahren zur herstellung von polyvinylhalogeniden |
| US338840A US3923765A (en) | 1972-10-04 | 1973-03-07 | Process for suspension polymerization of vinyl halides with low polymer deposition |
| DD17057873A DD106851A5 (enExample) | 1972-05-24 | 1973-05-02 | |
| ES415009A ES415009A1 (es) | 1972-05-24 | 1973-05-22 | Procedimiento para la preparacion de poli(halogenuros de vi-nilo). |
| IT5011373A IT985114B (it) | 1972-05-24 | 1973-05-22 | Procedimento per produrre poli vinil alogenuri |
| CH737073A CH576491A5 (enExample) | 1972-05-24 | 1973-05-23 | |
| FR7318867A FR2185638A1 (en) | 1972-05-24 | 1973-05-24 | Scale prevention in polyvinyl halide reactors - by adding oxyacids of P,N or S, or their salts |
| NL7313487A NL7313487A (enExample) | 1972-10-04 | 1973-10-01 | |
| NO3840/73A NO142751C (no) | 1972-10-04 | 1973-10-03 | Fremgangsmaate ved fremstilling av polyvinylklorid, polyvinylidenklorid eller copolymerer av vinylklorid eller vinylidenklorid med inntil 30 vekt % av andre olefinisk umettede monomerer |
| AT845473A AT323999B (de) | 1972-10-04 | 1973-10-03 | Verfahren zur herstellung von polyvinylhalogeniden |
| GB4620273A GB1421486A (en) | 1972-10-04 | 1973-10-03 | Polymerisation of vinyl and vinylidene halides |
| CA182,668A CA1013098A (en) | 1972-10-04 | 1973-10-04 | Process for the suspension polymerization of vinyl halides with low polymer deposition |
| AU60986/73A AU479520B2 (en) | 1972-10-04 | 1973-10-04 | Polymerisation of vinyl and vinylidene halides |
| JP11190973A JPS535910B2 (enExample) | 1972-10-04 | 1973-10-04 | |
| FR7413362A FR2230660B1 (enExample) | 1972-05-24 | 1974-04-17 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19722248607 DE2248607A1 (de) | 1972-10-04 | 1972-10-04 | Verfahren zur herstellung von polyvinylhalogeniden |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2248607A1 DE2248607A1 (de) | 1974-04-11 |
| DE2248607B2 true DE2248607B2 (enExample) | 1978-07-06 |
Family
ID=5858130
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19722248607 Ceased DE2248607A1 (de) | 1972-05-24 | 1972-10-04 | Verfahren zur herstellung von polyvinylhalogeniden |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3923765A (enExample) |
| JP (1) | JPS535910B2 (enExample) |
| AT (1) | AT323999B (enExample) |
| CA (1) | CA1013098A (enExample) |
| DE (1) | DE2248607A1 (enExample) |
| GB (1) | GB1421486A (enExample) |
| NL (1) | NL7313487A (enExample) |
| NO (1) | NO142751C (enExample) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5150990A (en) * | 1974-10-31 | 1976-05-06 | Shinetsu Chemical Co | Enkabiniru mataha enkabiniruoshutaitosurutanryotaikongobutsuno jugohoho |
| AU503273B2 (en) * | 1975-08-26 | 1979-08-30 | Imperial Chemical Industries Limited | Reactor and process for vinyl chloride polymerisation |
| DE2540654A1 (de) * | 1975-09-12 | 1977-03-17 | Hoechst Ag | Kunststoffolie zur herstellung von bild-ton-informationstraegern |
| JPS53102396A (en) * | 1977-02-17 | 1978-09-06 | Sumitomo Chem Co Ltd | Polymerization of vinyl chloride monomer |
| JPS5795191A (en) * | 1980-12-04 | 1982-06-12 | Ritsukaa Kk | Speed control apparatus for sewing machine |
| US4471096A (en) * | 1982-08-03 | 1984-09-11 | Tenneco Polymers, Incorporated | Process for the production of vinyl chloride polymers in the presence of a chain-transfer agent that is a mercapto organic compound having at least one beta-ether linkage |
| DE3401158A1 (de) * | 1984-01-14 | 1985-07-18 | Hoechst Ag, 6230 Frankfurt | Verfahren zur polymerisation von vinylchlorid |
| IN165525B (enExample) * | 1984-07-23 | 1989-11-04 | Shinetsu Chemical Co | |
| PT80975B (pt) * | 1984-08-17 | 1987-11-11 | Shinetsu Chemical Co | Processo para a preparacao de um polimero de vinilo |
| US4826935A (en) * | 1986-09-04 | 1989-05-02 | Toyo Soda Manufacturing Co., Ltd. | Process for gas phase polymerization of vinyl chloride |
| US5214371A (en) * | 1991-12-04 | 1993-05-25 | General Motors Corporation | Voltage regulator for variable speed permanent magnet alternators |
| ATE271406T1 (de) * | 2000-09-21 | 2004-08-15 | Nutrition 21 Inc | Chrom enthaltende zusammensetzung zur behandlung von diabetes, zur verbesserung der insulinsensitivität und zur reduktion von hyperglykämie, hypercholesterolämie und des körperfettanteils |
| JP2005330381A (ja) * | 2004-05-20 | 2005-12-02 | Sumitomo Chemical Co Ltd | 液相重合方法 |
| EP2185610B1 (en) * | 2007-08-31 | 2011-04-20 | ExxonMobil Chemical Patents Inc. | Method for reducing depositions in polymerization vessels |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2576720A (en) * | 1949-06-21 | 1951-11-27 | Du Pont | Granular polymerization of polymerizable liquid organic compound in the presence of a hypophosphite |
| GB1150488A (en) * | 1966-05-30 | 1969-04-30 | Shinetsu Chem Ind Co | Process for the Suspension Polymerisation of Vinyl Chloride |
| US3544539A (en) * | 1966-11-08 | 1970-12-01 | Shinetsu Chem Ind Co | Process for the suspension polymerization of vinyl chloride |
| DE1770113C2 (de) * | 1968-04-02 | 1984-01-05 | Wacker-Chemie GmbH, 8000 München | Verfahren zur Polymerisation von Vinylchlorid in wäßriger Suspension |
| US3562238A (en) * | 1968-09-16 | 1971-02-09 | Goodrich Co B F | Suspension polymerization process for vinyl chloride polymers |
| DE1910482B2 (de) * | 1969-03-01 | 1972-11-16 | Chemische Werke Hüls AG, 4370 Mari | Polymerisationsreaktor |
| US3738974A (en) * | 1969-11-20 | 1973-06-12 | Japan Atomic Energy Res Inst | Liquid phase process for the polymerization of unsaturated monomers |
-
1972
- 1972-10-04 DE DE19722248607 patent/DE2248607A1/de not_active Ceased
-
1973
- 1973-03-07 US US338840A patent/US3923765A/en not_active Expired - Lifetime
- 1973-10-01 NL NL7313487A patent/NL7313487A/xx not_active Application Discontinuation
- 1973-10-03 NO NO3840/73A patent/NO142751C/no unknown
- 1973-10-03 AT AT845473A patent/AT323999B/de not_active IP Right Cessation
- 1973-10-03 GB GB4620273A patent/GB1421486A/en not_active Expired
- 1973-10-04 CA CA182,668A patent/CA1013098A/en not_active Expired
- 1973-10-04 JP JP11190973A patent/JPS535910B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NL7313487A (enExample) | 1974-04-08 |
| AU6098673A (en) | 1975-04-10 |
| CA1013098A (en) | 1977-06-28 |
| GB1421486A (en) | 1976-01-21 |
| US3923765A (en) | 1975-12-02 |
| JPS4973484A (enExample) | 1974-07-16 |
| NO142751C (no) | 1980-10-08 |
| JPS535910B2 (enExample) | 1978-03-02 |
| NO142751B (no) | 1980-06-30 |
| DE2248607A1 (de) | 1974-04-11 |
| AT323999B (de) | 1975-08-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2239942C3 (de) | Verfahren zur Polymerisation von Vinylchlorid | |
| DE3025171A1 (de) | Verfahren zur herstellung von vinylhalogenidpolymerisaten | |
| DE2248607B2 (enExample) | ||
| DE1595848C3 (de) | Verfahren zur Herstellung von Vinylchloridpolymerisaten | |
| DE2461083C2 (enExample) | ||
| EP0093936B1 (de) | Verfahren und Vorrichtung zur Herstellung von Vinylchloridpolymerisaten | |
| DE2225236A1 (de) | Verfahren zur polymerisation von vinylchlorid | |
| DE2427385B2 (de) | Verfahren zur Herstellung von Vinylchloridhomo- oder -copolymeren | |
| DE1946474A1 (de) | Verbessertes Suspensionspolymerisationsverfahren zur Herstellung von Vinylchloridpolymeren | |
| DE2739708C2 (de) | Verfahren zur Homo- oder Mischpolymerisation von Vinylhalogeniden in wäßriger Dispersion | |
| DE2911333A1 (de) | Verfahren zur polymerisation von vinylchlorid nach dem mikrosuspensionsverfahren | |
| DE1940475A1 (de) | Verfahren zur Suspensionspolymerisation von Vinylchlorid | |
| DE2437044C3 (de) | Verfahren zur Herstellung von Polymerisaten und Copolymerisaten des Vinylchlorids durch Suspensionspolymerisation | |
| DE10309858A1 (de) | Thermostabile Vinylchlorid-Mischpolymerisate | |
| DE3223262A1 (de) | Verfahren zur herstellung von vinylchoridharz | |
| DE2916556C2 (enExample) | ||
| EP3784702B2 (de) | Verfahren zur reinigung eines polymerisationsreaktors | |
| DE2208696A1 (de) | Verfahren zur Herstellung von Athy lenpolymertelomerwachsen | |
| EP0081777B1 (de) | Verfahren zur Herstellung von Vinylchlorid-Polymerisaten | |
| DE2635487C3 (de) | Verfahren zur Polymerisation von Vinylchlorid in wäßriger Suspension | |
| DE2832628C2 (de) | Vorrichtung zur Polymerisation von Vinylchlorid in Suspension | |
| EP0010306B1 (de) | Verfahren zur Herstellung von Vinylhalogenidhomo- und -copolymerisaten | |
| DE2912571A1 (de) | Verfahren zur polymerisation von vinylchlorid | |
| DE2263181C3 (de) | Verfahren zur Polymerisation von Vinylchlorid | |
| DE2500765A1 (de) | Verfahren zur verringerung des gehaltes an monomerem vinylchlorid in durch massepolymerisation hergestelltem polyvinylchlorid |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8235 | Patent refused |