DE2242784C3 - Verfahren zur Herstellung von 2-Aryl-v-triazolen - Google Patents
Verfahren zur Herstellung von 2-Aryl-v-triazolenInfo
- Publication number
- DE2242784C3 DE2242784C3 DE19722242784 DE2242784A DE2242784C3 DE 2242784 C3 DE2242784 C3 DE 2242784C3 DE 19722242784 DE19722242784 DE 19722242784 DE 2242784 A DE2242784 A DE 2242784A DE 2242784 C3 DE2242784 C3 DE 2242784C3
- Authority
- DE
- Germany
- Prior art keywords
- water
- urea
- hours
- aryl
- solution
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 12
- 239000004202 carbamide Substances 0.000 description 12
- 239000000243 solution Substances 0.000 description 12
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 10
- 238000007363 ring formation reaction Methods 0.000 description 10
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- -1 imidazo ! Chemical compound 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 239000002253 acid Substances 0.000 description 5
- 235000002639 sodium chloride Nutrition 0.000 description 5
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- 159000000000 sodium salts Chemical class 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- QWENRTYMTSOGBR-UHFFFAOYSA-N 1H-1,2,3-Triazole Chemical compound C=1C=NNN=1 QWENRTYMTSOGBR-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- PJANXHGTPQOBST-VAWYXSNFSA-N Stilbene Natural products C=1C=CC=CC=1/C=C/C1=CC=CC=C1 PJANXHGTPQOBST-VAWYXSNFSA-N 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- PJANXHGTPQOBST-UHFFFAOYSA-N stilbene Chemical compound C=1C=CC=CC=1C=CC1=CC=CC=C1 PJANXHGTPQOBST-UHFFFAOYSA-N 0.000 description 3
- 235000021286 stilbenes Nutrition 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- GOLORTLGFDVFDW-UHFFFAOYSA-N 3-(1h-benzimidazol-2-yl)-7-(diethylamino)chromen-2-one Chemical compound C1=CC=C2NC(C3=CC4=CC=C(C=C4OC3=O)N(CC)CC)=NC2=C1 GOLORTLGFDVFDW-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- 239000006096 absorbing agent Substances 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- XJHABGPPCLHLLV-UHFFFAOYSA-N benzo[de]isoquinoline-1,3-dione Chemical compound C1=CC(C(=O)NC2=O)=C3C2=CC=CC3=C1 XJHABGPPCLHLLV-UHFFFAOYSA-N 0.000 description 2
- 238000005282 brightening Methods 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- IKJFYINYNJYDTA-UHFFFAOYSA-N dibenzothiophene sulfone Chemical compound C1=CC=C2S(=O)(=O)C3=CC=CC=C3C2=C1 IKJFYINYNJYDTA-UHFFFAOYSA-N 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 239000002798 polar solvent Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- LISFMEBWQUVKPJ-UHFFFAOYSA-N quinolin-2-ol Chemical compound C1=CC=C2NC(=O)C=CC2=C1 LISFMEBWQUVKPJ-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000005185 salting out Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 125000000542 sulfonic acid group Chemical group 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- MLNKXLRYCLKJSS-RMKNXTFCSA-N (2e)-2-hydroxyimino-1-phenylethanone Chemical compound O\N=C\C(=O)C1=CC=CC=C1 MLNKXLRYCLKJSS-RMKNXTFCSA-N 0.000 description 1
- BFSPAPKTIGPYOV-BQYQJAHWSA-N (e)-1-[4-(4-hydroxyphenyl)piperazin-1-yl]-3-thiophen-2-ylprop-2-en-1-one Chemical compound C1=CC(O)=CC=C1N1CCN(C(=O)\C=C\C=2SC=CC=2)CC1 BFSPAPKTIGPYOV-BQYQJAHWSA-N 0.000 description 1
- BSZXAFXFTLXUFV-UHFFFAOYSA-N 1-phenylethylbenzene Chemical compound C=1C=CC=CC=1C(C)C1=CC=CC=C1 BSZXAFXFTLXUFV-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- FECNOIODIVNEKI-UHFFFAOYSA-N 2-[(2-aminobenzoyl)amino]benzoic acid Chemical class NC1=CC=CC=C1C(=O)NC1=CC=CC=C1C(O)=O FECNOIODIVNEKI-UHFFFAOYSA-N 0.000 description 1
- NSMMFSKPGXCMOE-UHFFFAOYSA-N 2-[2-(2-sulfophenyl)ethenyl]benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1C=CC1=CC=CC=C1S(O)(=O)=O NSMMFSKPGXCMOE-UHFFFAOYSA-N 0.000 description 1
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical class C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical class CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 150000001346 alkyl aryl ethers Chemical class 0.000 description 1
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- JRXXLCKWQFKACW-UHFFFAOYSA-N biphenylacetylene Chemical compound C1=CC=CC=C1C#CC1=CC=CC=C1 JRXXLCKWQFKACW-UHFFFAOYSA-N 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000010411 cooking Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- CZZYITDELCSZES-UHFFFAOYSA-N diphenylmethane Chemical compound C=1C=CC=CC=1CC1=CC=CC=C1 CZZYITDELCSZES-UHFFFAOYSA-N 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- 230000002485 urinary effect Effects 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/04—1,2,3-Triazoles; Hydrogenated 1,2,3-triazoles
- C07D249/06—1,2,3-Triazoles; Hydrogenated 1,2,3-triazoles with aryl radicals directly attached to ring atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
Priority Applications (12)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19722242784 DE2242784C3 (de) | 1972-08-31 | 1972-08-31 | Verfahren zur Herstellung von 2-Aryl-v-triazolen |
| JP9628773A JPS5231208B2 (enrdf_load_stackoverflow) | 1972-08-31 | 1973-08-29 | |
| IT2832373A IT998491B (it) | 1972-08-31 | 1973-08-29 | Processo per la produzione di 2 aril v triazoli |
| NL7311879A NL7311879A (enrdf_load_stackoverflow) | 1972-08-31 | 1973-08-29 | |
| BE135058A BE804159A (fr) | 1972-08-31 | 1973-08-29 | Procede de production de 2-aryl-triazoles vicinaux |
| CH1239273A CH587832A5 (enrdf_load_stackoverflow) | 1972-08-31 | 1973-08-29 | |
| CA179,901A CA979445A (en) | 1972-08-31 | 1973-08-29 | Process for the manufacture of 2-aryl-v-triazoles |
| BR669873A BR7306698D0 (pt) | 1972-08-31 | 1973-08-30 | Processo para a preparacao de 2-aril-v-triazois |
| DD17318373A DD109633A5 (enrdf_load_stackoverflow) | 1972-08-31 | 1973-08-30 | |
| GB4084673A GB1405218A (en) | 1972-08-31 | 1973-08-30 | Process for the manufacture of 2-aryl-v-triazoles |
| ES418338A ES418338A1 (es) | 1972-08-31 | 1973-08-30 | Procedimiento para la obtencion de 2-aril-v-triazoles. |
| FR7331529A FR2197879B1 (enrdf_load_stackoverflow) | 1972-08-31 | 1973-08-31 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19722242784 DE2242784C3 (de) | 1972-08-31 | 1972-08-31 | Verfahren zur Herstellung von 2-Aryl-v-triazolen |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2242784A1 DE2242784A1 (de) | 1974-03-14 |
| DE2242784B2 DE2242784B2 (de) | 1978-01-19 |
| DE2242784C3 true DE2242784C3 (de) | 1978-09-28 |
Family
ID=5855062
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19722242784 Expired DE2242784C3 (de) | 1972-08-31 | 1972-08-31 | Verfahren zur Herstellung von 2-Aryl-v-triazolen |
Country Status (12)
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2746000C2 (de) * | 1977-10-13 | 1979-03-15 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Bis-triazolylstilbenen |
| DE3018963A1 (de) * | 1980-05-17 | 1981-11-26 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von v-triazolyl-(2)-phenolen |
| DE3019521A1 (de) * | 1980-05-22 | 1981-11-26 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von v-triazolverbindungen |
-
1972
- 1972-08-31 DE DE19722242784 patent/DE2242784C3/de not_active Expired
-
1973
- 1973-08-29 BE BE135058A patent/BE804159A/xx unknown
- 1973-08-29 JP JP9628773A patent/JPS5231208B2/ja not_active Expired
- 1973-08-29 IT IT2832373A patent/IT998491B/it active
- 1973-08-29 NL NL7311879A patent/NL7311879A/xx unknown
- 1973-08-29 CA CA179,901A patent/CA979445A/en not_active Expired
- 1973-08-29 CH CH1239273A patent/CH587832A5/xx not_active IP Right Cessation
- 1973-08-30 DD DD17318373A patent/DD109633A5/xx unknown
- 1973-08-30 BR BR669873A patent/BR7306698D0/pt unknown
- 1973-08-30 GB GB4084673A patent/GB1405218A/en not_active Expired
- 1973-08-30 ES ES418338A patent/ES418338A1/es not_active Expired
- 1973-08-31 FR FR7331529A patent/FR2197879B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2197879A1 (enrdf_load_stackoverflow) | 1974-03-29 |
| CH587832A5 (enrdf_load_stackoverflow) | 1977-05-13 |
| BR7306698D0 (pt) | 1974-07-18 |
| BE804159A (fr) | 1974-02-28 |
| JPS4964629A (enrdf_load_stackoverflow) | 1974-06-22 |
| IT998491B (it) | 1976-01-20 |
| JPS5231208B2 (enrdf_load_stackoverflow) | 1977-08-13 |
| GB1405218A (en) | 1975-09-10 |
| DD109633A5 (enrdf_load_stackoverflow) | 1974-11-12 |
| DE2242784A1 (de) | 1974-03-14 |
| CA979445A (en) | 1975-12-09 |
| ES418338A1 (es) | 1976-03-16 |
| DE2242784B2 (de) | 1978-01-19 |
| FR2197879B1 (enrdf_load_stackoverflow) | 1977-02-25 |
| NL7311879A (enrdf_load_stackoverflow) | 1974-03-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0252406A2 (de) | Verfahren zur Herstellung polycyclischer Verbindungen | |
| EP0014344A1 (de) | Cumarinverbindungen, Verfahren zu ihrer Herstellung und deren Verwendung als Weisstöner und Laserfarbstoffe | |
| DE2242784C3 (de) | Verfahren zur Herstellung von 2-Aryl-v-triazolen | |
| DE2130919B2 (de) | Substituierte diphenylaether, verfahren zu ihrer herstellung und ihre verwendung als herbizide | |
| DE2210261C3 (de) | Verfahren zur Herstellung von 2-Aryl-v-triazolen | |
| EP0184981B1 (de) | Neue Pyrrolinone und deren Zwischenprodukte | |
| EP0115295B1 (de) | Verbessertes Verfahren zur Herstellung von Riboflavin | |
| DE1670478A1 (de) | Verfahren zur Herstellung von Derivaten des alpha-Piperazino-phenylacetonitrils | |
| EP0005172B1 (de) | Cumarin-Verbindungen und ihre Verwendung als Aufheller für organische hochmolekulare Materialien | |
| DE936071C (de) | Verfahren zur Sensibilisierung von Halogensilberemulsionen, insbesondere Chlor- und Chlorbromsilberemulsionen | |
| DE2607966C3 (de) | Benzothioxanthene, Verfahren zu ihrer Herstellung und ihre Verwendung als Fluoreszenzfarbstoffe | |
| DE1077222B (de) | Verfahren zur Herstellung von Benzimidazolylidenverbindungen | |
| DE1904653A1 (de) | Substituierte Benzthiazol-N-oxide | |
| CH559739A5 (en) | Tricyclic cpd contg hydroxy cyclic amino - cns depressant, anti-histamic and antiemetic | |
| AT216506B (de) | Verfahren zur Herstellung von neuen 2-(2'-Aminoaryl)-4,5-arylen-1,2,3-triazol-1-oxyden | |
| AT215993B (de) | Verfahren zur Herstellung von neuen 4-Oxo-2-(halogenalkyl)-2,3-dihydro-[benzo-1,3-oxazinen] | |
| EP0010607B1 (de) | Triazolylstyryl-Verbindungen sowie deren Verwendung zum Weisstönen organischer Materialien | |
| DE1901291A1 (de) | Verfahren zur Herstellung von substituierten 3-Amino-benzthiophenen | |
| AT203489B (de) | Verfahren zur Herstellung von 4-Nitrostyryl-2-sulfonsäure-Verbindungen | |
| DE964861C (de) | Verfahren zur Herstellung von (Bz)-Oxy-chinolonen-(4) | |
| DE1951708A1 (de) | Verfahren zur Herstellung von Pyranthronen | |
| DE1670841C3 (de) | Verfahren zur Herstellung von 2-Styryl-benzotriazolen | |
| CH562814A5 (enrdf_load_stackoverflow) | ||
| DE1670841B2 (de) | Verfahren zur Herstellung von 2-Styrylbenzotriazolen | |
| DE1240604B (de) | Verfahren zur Herstellung von Phthaloylpyrrocolinen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |