DE2241408C2 - 2,6-Dinitroaniline, Verfahren zu ihrer Herstellung und diese enthaltende herbizide Vorauflaufmittel - Google Patents
2,6-Dinitroaniline, Verfahren zu ihrer Herstellung und diese enthaltende herbizide VorauflaufmittelInfo
- Publication number
- DE2241408C2 DE2241408C2 DE2241408A DE2241408A DE2241408C2 DE 2241408 C2 DE2241408 C2 DE 2241408C2 DE 2241408 A DE2241408 A DE 2241408A DE 2241408 A DE2241408 A DE 2241408A DE 2241408 C2 DE2241408 C2 DE 2241408C2
- Authority
- DE
- Germany
- Prior art keywords
- dinitro
- compounds
- chj
- mixture
- sec
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000002363 herbicidal effect Effects 0.000 title claims description 20
- QFUSCYRJMXLNRB-UHFFFAOYSA-N 2,6-dinitroaniline Chemical class NC1=C([N+]([O-])=O)C=CC=C1[N+]([O-])=O QFUSCYRJMXLNRB-UHFFFAOYSA-N 0.000 title claims description 9
- 238000000034 method Methods 0.000 title description 18
- 238000002360 preparation method Methods 0.000 title description 14
- 230000000694 effects Effects 0.000 claims description 11
- 231100000419 toxicity Toxicity 0.000 claims description 5
- 230000001988 toxicity Effects 0.000 claims description 5
- CDULGHZNHURECF-UHFFFAOYSA-N 2,3-dimethylaniline 2,4-dimethylaniline 2,5-dimethylaniline 2,6-dimethylaniline 3,4-dimethylaniline 3,5-dimethylaniline Chemical group CC1=CC=C(N)C(C)=C1.CC1=CC=C(C)C(N)=C1.CC1=CC(C)=CC(N)=C1.CC1=CC=C(N)C=C1C.CC1=CC=CC(N)=C1C.CC1=CC=CC(C)=C1N CDULGHZNHURECF-UHFFFAOYSA-N 0.000 claims description 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 63
- 150000001875 compounds Chemical class 0.000 description 46
- -1 alkynyl radical Chemical class 0.000 description 30
- 239000000203 mixture Substances 0.000 description 28
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 27
- 239000007787 solid Substances 0.000 description 23
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 22
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- 238000002844 melting Methods 0.000 description 18
- 230000008018 melting Effects 0.000 description 18
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 16
- 150000001412 amines Chemical class 0.000 description 16
- 238000004519 manufacturing process Methods 0.000 description 16
- 239000000047 product Substances 0.000 description 16
- 239000000243 solution Substances 0.000 description 15
- 239000004480 active ingredient Substances 0.000 description 14
- 239000000126 substance Substances 0.000 description 13
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 12
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 12
- 239000002689 soil Substances 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 11
- 235000010469 Glycine max Nutrition 0.000 description 11
- 238000006243 chemical reaction Methods 0.000 description 11
- 241000196324 Embryophyta Species 0.000 description 10
- 125000001424 substituent group Chemical group 0.000 description 9
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 8
- 101150065749 Churc1 gene Proteins 0.000 description 8
- 102100038239 Protein Churchill Human genes 0.000 description 8
- 239000003795 chemical substances by application Substances 0.000 description 8
- 125000001309 chloro group Chemical group Cl* 0.000 description 8
- 238000010992 reflux Methods 0.000 description 8
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 7
- 229910052801 chlorine Inorganic materials 0.000 description 7
- 239000008096 xylene Substances 0.000 description 7
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N N-phenyl amine Natural products NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 5
- 240000003461 Setaria viridis Species 0.000 description 5
- 235000002248 Setaria viridis Nutrition 0.000 description 5
- CHIFOSRWCNZCFN-UHFFFAOYSA-N pendimethalin Chemical group CCC(CC)NC1=C([N+]([O-])=O)C=C(C)C(C)=C1[N+]([O-])=O CHIFOSRWCNZCFN-UHFFFAOYSA-N 0.000 description 5
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 4
- 229910021529 ammonia Inorganic materials 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 239000002274 desiccant Substances 0.000 description 4
- 239000000428 dust Substances 0.000 description 4
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical compound C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 description 4
- 239000008187 granular material Substances 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- 239000003208 petroleum Substances 0.000 description 4
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 4
- BHRZNVHARXXAHW-UHFFFAOYSA-N sec-butylamine Chemical compound CCC(C)N BHRZNVHARXXAHW-UHFFFAOYSA-N 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- WFRSYJQULKMSGG-UHFFFAOYSA-N 4-chloro-1,2-dimethyl-3,5-dinitrobenzene Chemical compound CC1=CC([N+]([O-])=O)=C(Cl)C([N+]([O-])=O)=C1C WFRSYJQULKMSGG-UHFFFAOYSA-N 0.000 description 3
- 244000025254 Cannabis sativa Species 0.000 description 3
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 3
- 241000287828 Gallus gallus Species 0.000 description 3
- 244000292697 Polygonum aviculare Species 0.000 description 3
- 235000006386 Polygonum aviculare Nutrition 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- 235000010086 Setaria viridis var. viridis Nutrition 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 244000062793 Sorghum vulgare Species 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 239000012065 filter cake Substances 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 239000004009 herbicide Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 235000019713 millet Nutrition 0.000 description 3
- NKPDMJBXCFNGSC-UHFFFAOYSA-N n-butan-2-yl-3,4-dimethyl-2,6-dinitroaniline Chemical compound CCC(C)NC1=C([N+]([O-])=O)C=C(C)C(C)=C1[N+]([O-])=O NKPDMJBXCFNGSC-UHFFFAOYSA-N 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- HIFJUMGIHIZEPX-UHFFFAOYSA-N sulfuric acid;sulfur trioxide Chemical compound O=S(=O)=O.OS(O)(=O)=O HIFJUMGIHIZEPX-UHFFFAOYSA-N 0.000 description 3
- OSOUNOBYRMOXQQ-UHFFFAOYSA-N 1-chloro-3-methylbenzene Chemical compound CC1=CC=CC(Cl)=C1 OSOUNOBYRMOXQQ-UHFFFAOYSA-N 0.000 description 2
- NFKAWBGFIMBUMB-UHFFFAOYSA-N 1-phenylpentan-2-one Chemical compound CCCC(=O)CC1=CC=CC=C1 NFKAWBGFIMBUMB-UHFFFAOYSA-N 0.000 description 2
- HDECRAPHCDXMIJ-UHFFFAOYSA-N 2-methylbenzenesulfonyl chloride Chemical compound CC1=CC=CC=C1S(Cl)(=O)=O HDECRAPHCDXMIJ-UHFFFAOYSA-N 0.000 description 2
- OCQYZOYEPMEMHG-UHFFFAOYSA-N 3-chloro-6-methyl-2,4-dinitrobenzamide Chemical compound CC1=CC([N+]([O-])=O)=C(Cl)C([N+]([O-])=O)=C1C(N)=O OCQYZOYEPMEMHG-UHFFFAOYSA-N 0.000 description 2
- OUMMPLINCIOYTJ-UHFFFAOYSA-N 3-chloro-6-methyl-2,4-dinitrobenzenesulfonyl chloride Chemical compound CC1=CC([N+]([O-])=O)=C(Cl)C([N+]([O-])=O)=C1S(Cl)(=O)=O OUMMPLINCIOYTJ-UHFFFAOYSA-N 0.000 description 2
- HNQLMBJUMVLFCF-UHFFFAOYSA-N 4-chloro-1,2-dimethylbenzene Chemical group CC1=CC=C(Cl)C=C1C HNQLMBJUMVLFCF-UHFFFAOYSA-N 0.000 description 2
- 239000005995 Aluminium silicate Substances 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- 244000152970 Digitaria sanguinalis Species 0.000 description 2
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 2
- 241000244743 Echinochloa muricata Species 0.000 description 2
- 244000088461 Panicum crus-galli Species 0.000 description 2
- 235000011999 Panicum crusgalli Nutrition 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- YUDRVAHLXDBKSR-UHFFFAOYSA-N [CH]1CCCCC1 Chemical compound [CH]1CCCCC1 YUDRVAHLXDBKSR-UHFFFAOYSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- 229960000892 attapulgite Drugs 0.000 description 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000004927 clay Substances 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 2
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 231100001225 mammalian toxicity Toxicity 0.000 description 2
- JOCIBTOQHZBCTH-UHFFFAOYSA-N n-butan-2-yl-3-methyl-2,6-dinitro-4-(trifluoromethyl)aniline Chemical compound CCC(C)NC1=C([N+]([O-])=O)C=C(C(F)(F)F)C(C)=C1[N+]([O-])=O JOCIBTOQHZBCTH-UHFFFAOYSA-N 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 2
- 229910052625 palygorskite Inorganic materials 0.000 description 2
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 2
- 239000004323 potassium nitrate Substances 0.000 description 2
- 235000010333 potassium nitrate Nutrition 0.000 description 2
- 238000004382 potting Methods 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 229920005552 sodium lignosulfonate Polymers 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 238000010998 test method Methods 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 150000004992 toluidines Chemical class 0.000 description 2
- QNQAQJKKFMNYBI-UHFFFAOYSA-N 1,3-dinitro-2-(sulfamoylamino)benzene Chemical class NS(=O)(=O)NC1=C([N+]([O-])=O)C=CC=C1[N+]([O-])=O QNQAQJKKFMNYBI-UHFFFAOYSA-N 0.000 description 1
- JGJOMEXMIOSTOS-UHFFFAOYSA-N 1,4-dichloro-2-methyl-3,5-dinitrobenzene Chemical compound CC1=C(Cl)C=C([N+]([O-])=O)C(Cl)=C1[N+]([O-])=O JGJOMEXMIOSTOS-UHFFFAOYSA-N 0.000 description 1
- NDIPRKPRNDWJIP-UHFFFAOYSA-N 1,6-dinitrocyclohexa-2,4-dien-1-amine Chemical compound [O-][N+](=O)C1(N)C=CC=CC1[N+]([O-])=O NDIPRKPRNDWJIP-UHFFFAOYSA-N 0.000 description 1
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000004972 1-butynyl group Chemical group [H]C([H])([H])C([H])([H])C#C* 0.000 description 1
- LRLRAYMYEXQKID-UHFFFAOYSA-N 1-methyl-4-(trifluoromethyl)benzene Chemical compound CC1=CC=C(C(F)(F)F)C=C1 LRLRAYMYEXQKID-UHFFFAOYSA-N 0.000 description 1
- 125000006023 1-pentenyl group Chemical group 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- 125000000530 1-propynyl group Chemical group [H]C([H])([H])C#C* 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- BPPMIQPXQVIZNJ-UHFFFAOYSA-N 2-chloro-1,3-dinitrobenzene Chemical class [O-][N+](=O)C1=CC=CC([N+]([O-])=O)=C1Cl BPPMIQPXQVIZNJ-UHFFFAOYSA-N 0.000 description 1
- SORZQNUNONRKQU-UHFFFAOYSA-N 2-chloro-4-methyl-1,3-dinitro-5-(trifluoromethyl)benzene Chemical compound CC1=C(C(F)(F)F)C=C([N+]([O-])=O)C(Cl)=C1[N+]([O-])=O SORZQNUNONRKQU-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- OYUBPCNMZPYCJP-UHFFFAOYSA-N 3,4-dimethyl-2,6-dinitro-n-propan-2-ylaniline Chemical compound CC(C)NC1=C([N+]([O-])=O)C=C(C)C(C)=C1[N+]([O-])=O OYUBPCNMZPYCJP-UHFFFAOYSA-N 0.000 description 1
- MHTNLJYRURGLAC-UHFFFAOYSA-N 3,4-dimethyl-2,6-dinitroaniline Chemical compound CC1=CC([N+]([O-])=O)=C(N)C([N+]([O-])=O)=C1C MHTNLJYRURGLAC-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- 125000000474 3-butynyl group Chemical group [H]C#CC([H])([H])C([H])([H])* 0.000 description 1
- SLQKXOXIRFRFMB-UHFFFAOYSA-N 3-chloro-6-methyl-2,4-dinitrobenzenesulfonamide Chemical compound CC1=CC([N+]([O-])=O)=C(Cl)C([N+]([O-])=O)=C1S(N)(=O)=O SLQKXOXIRFRFMB-UHFFFAOYSA-N 0.000 description 1
- XIDVRCFJEQZVEM-UHFFFAOYSA-N 3-chloro-6-methyl-2,4-dinitrobenzoyl chloride Chemical compound CC1=CC([N+]([O-])=O)=C(Cl)C([N+]([O-])=O)=C1C(Cl)=O XIDVRCFJEQZVEM-UHFFFAOYSA-N 0.000 description 1
- DSAHJVCZRSZMLG-UHFFFAOYSA-N 4-chloro-2-methyl-1-(trichloromethyl)benzene Chemical compound CC1=CC(Cl)=CC=C1C(Cl)(Cl)Cl DSAHJVCZRSZMLG-UHFFFAOYSA-N 0.000 description 1
- RWXLVNJPMZXECS-UHFFFAOYSA-N 4-chloro-2-methyl-1-(trifluoromethyl)benzene Chemical compound CC1=CC(Cl)=CC=C1C(F)(F)F RWXLVNJPMZXECS-UHFFFAOYSA-N 0.000 description 1
- MOOOPNRPJGZXPE-UHFFFAOYSA-N 4-methyl-2,6-dinitroaniline Chemical class CC1=CC([N+]([O-])=O)=C(N)C([N+]([O-])=O)=C1 MOOOPNRPJGZXPE-UHFFFAOYSA-N 0.000 description 1
- QSIBCSKTTTZYJM-UHFFFAOYSA-N 5-chloro-3-methyl-5,6-dinitro-2-(trifluoromethyl)cyclohexa-1,3-diene Chemical compound CC1=CC(Cl)([N+]([O-])=O)C([N+]([O-])=O)C=C1C(F)(F)F QSIBCSKTTTZYJM-UHFFFAOYSA-N 0.000 description 1
- 240000002245 Acer pensylvanicum Species 0.000 description 1
- 235000006760 Acer pensylvanicum Nutrition 0.000 description 1
- 241000743987 Alopecurus pratensis Species 0.000 description 1
- 235000007320 Avena fatua Nutrition 0.000 description 1
- 244000075850 Avena orientalis Species 0.000 description 1
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 1
- 241000217446 Calystegia sepium Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical class OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- WZKSXHQDXQKIQJ-UHFFFAOYSA-N F[C](F)F Chemical compound F[C](F)F WZKSXHQDXQKIQJ-UHFFFAOYSA-N 0.000 description 1
- 240000005702 Galium aparine Species 0.000 description 1
- 235000014820 Galium aparine Nutrition 0.000 description 1
- 244000068988 Glycine max Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241000209510 Liliopsida Species 0.000 description 1
- 235000019738 Limestone Nutrition 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 235000008515 Setaria glauca Nutrition 0.000 description 1
- 244000010062 Setaria pumila Species 0.000 description 1
- 235000021536 Sugar beet Nutrition 0.000 description 1
- 235000005373 Uvularia sessilifolia Nutrition 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- YROCQSUFZJGPQR-UHFFFAOYSA-N [N+](=O)([O-])N(S(=O)=O)[N+](=O)[O-] Chemical compound [N+](=O)([O-])N(S(=O)=O)[N+](=O)[O-] YROCQSUFZJGPQR-UHFFFAOYSA-N 0.000 description 1
- 230000002159 abnormal effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 231100000460 acute oral toxicity Toxicity 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- 229960003280 cupric chloride Drugs 0.000 description 1
- WGHKKEJHRMUKDK-UHFFFAOYSA-N cyclohexa-2,5-dien-1-one Chemical compound O=C1C=CCC=C1 WGHKKEJHRMUKDK-UHFFFAOYSA-N 0.000 description 1
- 210000003298 dental enamel Anatomy 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- WEHWNAOGRSTTBQ-UHFFFAOYSA-N dipropylamine Chemical compound CCCNCCC WEHWNAOGRSTTBQ-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- LBKPGNUOUPTQKA-UHFFFAOYSA-N ethyl n-phenylcarbamate Chemical class CCOC(=O)NC1=CC=CC=C1 LBKPGNUOUPTQKA-UHFFFAOYSA-N 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 241001233957 eudicotyledons Species 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- HQLZFBUAULNEGP-UHFFFAOYSA-N hexan-3-amine Chemical compound CCCC(N)CC HQLZFBUAULNEGP-UHFFFAOYSA-N 0.000 description 1
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical compound [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 description 1
- MOFVSTNWEDAEEK-UHFFFAOYSA-M indocyanine green Chemical compound [Na+].[O-]S(=O)(=O)CCCCN1C2=CC=C3C=CC=CC3=C2C(C)(C)C1=CC=CC=CC=CC1=[N+](CCCCS([O-])(=O)=O)C2=CC=C(C=CC=C3)C3=C2C1(C)C MOFVSTNWEDAEEK-UHFFFAOYSA-M 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 239000006028 limestone Substances 0.000 description 1
- 239000006193 liquid solution Substances 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- SXECHKTXVGHOTN-UHFFFAOYSA-N n-butyl-3,4-dimethyl-2,6-dinitroaniline Chemical compound CCCCNC1=C([N+]([O-])=O)C=C(C)C(C)=C1[N+]([O-])=O SXECHKTXVGHOTN-UHFFFAOYSA-N 0.000 description 1
- UCJXRZGFMPWKSJ-UHFFFAOYSA-N n-ethyl-4-methyl-2,6-dinitro-3-propan-2-ylaniline Chemical compound CCNC1=C([N+]([O-])=O)C=C(C)C(C(C)C)=C1[N+]([O-])=O UCJXRZGFMPWKSJ-UHFFFAOYSA-N 0.000 description 1
- SBVMUAYNHDSLSI-UHFFFAOYSA-N n-hexan-3-yl-3,4-dimethyl-2,6-dinitroaniline Chemical group CCCC(CC)NC1=C([N+]([O-])=O)C=C(C)C(C)=C1[N+]([O-])=O SBVMUAYNHDSLSI-UHFFFAOYSA-N 0.000 description 1
- LZGUHMNOBNWABZ-UHFFFAOYSA-N n-nitro-n-phenylnitramide Chemical compound [O-][N+](=O)N([N+]([O-])=O)C1=CC=CC=C1 LZGUHMNOBNWABZ-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 238000010534 nucleophilic substitution reaction Methods 0.000 description 1
- 238000005580 one pot reaction Methods 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 239000008262 pumice Substances 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 1
- 239000004296 sodium metabisulphite Substances 0.000 description 1
- 235000010262 sodium metabisulphite Nutrition 0.000 description 1
- IZWPGJFSBABFGL-GMFCBQQYSA-M sodium;2-[methyl-[(z)-octadec-9-enoyl]amino]ethanesulfonate Chemical compound [Na+].CCCCCCCC\C=C/CCCCCCCC(=O)N(C)CCS([O-])(=O)=O IZWPGJFSBABFGL-GMFCBQQYSA-M 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000012085 test solution Substances 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000004563 wettable powder Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/30—Sulfonamides, the carbon skeleton of the acid part being further substituted by singly-bound nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/37—Sulfonamides, the carbon skeleton of the acid part being further substituted by singly-bound nitrogen atoms, not being part of nitro or nitroso groups having the sulfur atom of at least one of the sulfonamide groups bound to a carbon atom of a six-membered aromatic ring
- C07C311/38—Sulfonamides, the carbon skeleton of the acid part being further substituted by singly-bound nitrogen atoms, not being part of nitro or nitroso groups having the sulfur atom of at least one of the sulfonamide groups bound to a carbon atom of a six-membered aromatic ring having sulfur atoms of sulfonamide groups and amino groups bound to carbon atoms of six-membered rings of the same carbon skeleton
- C07C311/39—Sulfonamides, the carbon skeleton of the acid part being further substituted by singly-bound nitrogen atoms, not being part of nitro or nitroso groups having the sulfur atom of at least one of the sulfonamide groups bound to a carbon atom of a six-membered aromatic ring having sulfur atoms of sulfonamide groups and amino groups bound to carbon atoms of six-membered rings of the same carbon skeleton having the nitrogen atom of at least one of the sulfonamide groups bound to hydrogen atoms or to an acyclic carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C209/00—Preparation of compounds containing amino groups bound to a carbon skeleton
- C07C209/60—Preparation of compounds containing amino groups bound to a carbon skeleton by condensation or addition reactions, e.g. Mannich reaction, addition of ammonia or amines to alkenes or to alkynes or addition of compounds containing an active hydrogen atom to Schiff's bases, quinone imines, or aziranes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/07—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by halogen atoms
- C07C205/11—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by halogen atoms having nitro groups bound to carbon atoms of six-membered aromatic rings
- C07C205/12—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by halogen atoms having nitro groups bound to carbon atoms of six-membered aromatic rings the six-membered aromatic ring or a condensed ring system containing that ring being substituted by halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/49—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups
- C07C205/57—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/58—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton the carbon skeleton being further substituted by halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
- C07C211/43—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C211/44—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton having amino groups bound to only one six-membered aromatic ring
- C07C211/52—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton having amino groups bound to only one six-membered aromatic ring the carbon skeleton being further substituted by halogen atoms or by nitro or nitroso groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US17493871A | 1971-08-25 | 1971-08-25 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2241408A1 DE2241408A1 (de) | 1973-03-01 |
| DE2241408C2 true DE2241408C2 (de) | 1984-01-12 |
Family
ID=22638140
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2241408A Expired DE2241408C2 (de) | 1971-08-25 | 1972-08-23 | 2,6-Dinitroaniline, Verfahren zu ihrer Herstellung und diese enthaltende herbizide Vorauflaufmittel |
Country Status (25)
| Country | Link |
|---|---|
| JP (1) | JPS5842844B2 (en:Method) |
| KR (1) | KR780000132B1 (en:Method) |
| AR (1) | AR194492A1 (en:Method) |
| AU (1) | AU472953B2 (en:Method) |
| BE (1) | BE787939A (en:Method) |
| BR (1) | BR7205530D0 (en:Method) |
| CA (1) | CA988944A (en:Method) |
| CH (1) | CH573704A5 (en:Method) |
| CS (1) | CS180602B2 (en:Method) |
| DD (1) | DD104289A5 (en:Method) |
| DE (1) | DE2241408C2 (en:Method) |
| DK (1) | DK132402C (en:Method) |
| ES (1) | ES406098A1 (en:Method) |
| FR (1) | FR2151415A5 (en:Method) |
| GB (1) | GB1389479A (en:Method) |
| IL (1) | IL39841A (en:Method) |
| IT (1) | IT962214B (en:Method) |
| KE (1) | KE2706A (en:Method) |
| MY (1) | MY7700250A (en:Method) |
| NL (1) | NL177561C (en:Method) |
| PH (1) | PH9657A (en:Method) |
| SE (1) | SE393372B (en:Method) |
| SU (1) | SU724073A3 (en:Method) |
| TR (1) | TR17956A (en:Method) |
| ZA (1) | ZA724608B (en:Method) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IN145613B (en:Method) * | 1975-12-22 | 1978-11-18 | American Cyanamid Co | |
| DE2837499A1 (de) * | 1978-08-28 | 1980-03-20 | Bayer Ag | Verfahren zur herstellung von substituierten benzotrifluoriden und neue substituierte benzotrifluoride |
| DE2909158A1 (de) | 1979-03-08 | 1980-09-11 | Basf Ag | Herbizide mischungen |
| EP2052612A1 (de) | 2007-10-24 | 2009-04-29 | Bayer CropScience AG | Herbizid-Kombination |
| DE102008037629A1 (de) | 2008-08-14 | 2010-02-18 | Bayer Cropscience Ag | Herbizid-Kombination mit Dimethoxytriazinyl-substituierten Difluormethansulfonylaniliden |
| CN109320424B (zh) * | 2017-07-31 | 2021-12-21 | 江苏永安化工有限公司 | 一种二甲戊灵的纯化方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2013510C3 (de) * | 1969-04-01 | 1985-11-14 | United States Borax & Chemical Corp., Los Angeles, Calif. | Verwendung von 6-Trifluormethyl-2,4- dinitro-1,3-phenylendiaminen als Herbizide |
-
0
- BE BE787939D patent/BE787939A/xx not_active IP Right Cessation
-
1972
- 1972-07-05 ZA ZA724608A patent/ZA724608B/xx unknown
- 1972-07-05 CA CA146,411A patent/CA988944A/en not_active Expired
- 1972-07-06 GB GB3178472A patent/GB1389479A/en not_active Expired
- 1972-07-06 IL IL39841A patent/IL39841A/xx unknown
- 1972-07-06 AU AU44324/72A patent/AU472953B2/en not_active Expired
- 1972-07-13 AR AR243345A patent/AR194492A1/es active
- 1972-07-14 PH PH13722*UA patent/PH9657A/en unknown
- 1972-07-24 KR KR7201127A patent/KR780000132B1/ko not_active Expired
- 1972-07-27 SU SU721820551A patent/SU724073A3/ru active
- 1972-08-10 NL NLAANVRAGE7210935,A patent/NL177561C/xx not_active IP Right Cessation
- 1972-08-10 TR TR17956A patent/TR17956A/xx unknown
- 1972-08-14 BR BR5530/72A patent/BR7205530D0/pt unknown
- 1972-08-23 DE DE2241408A patent/DE2241408C2/de not_active Expired
- 1972-08-24 IT IT52339/72A patent/IT962214B/it active
- 1972-08-24 CS CS7200005844A patent/CS180602B2/cs unknown
- 1972-08-24 DK DK420672A patent/DK132402C/da not_active IP Right Cessation
- 1972-08-24 SE SE7211004A patent/SE393372B/xx unknown
- 1972-08-25 ES ES406098A patent/ES406098A1/es not_active Expired
- 1972-08-25 CH CH1263172A patent/CH573704A5/xx not_active IP Right Cessation
- 1972-08-25 JP JP47085195A patent/JPS5842844B2/ja not_active Expired
- 1972-08-25 FR FR7230426A patent/FR2151415A5/fr not_active Expired
- 1972-08-25 DD DD165256A patent/DD104289A5/xx unknown
-
1977
- 1977-02-15 KE KE2706A patent/KE2706A/xx unknown
- 1977-12-30 MY MY250/77A patent/MY7700250A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| KE2706A (en) | 1977-03-04 |
| DD104289A5 (en:Method) | 1974-03-05 |
| NL177561B (nl) | 1985-05-17 |
| ZA724608B (en) | 1973-03-28 |
| AR194492A1 (es) | 1973-07-23 |
| NL7210935A (en:Method) | 1973-02-27 |
| JPS5842844B2 (ja) | 1983-09-22 |
| SU724073A3 (ru) | 1980-03-25 |
| MY7700250A (en) | 1977-12-31 |
| AU4432472A (en) | 1974-01-10 |
| KR780000132B1 (en) | 1978-04-25 |
| CA988944A (en) | 1976-05-11 |
| AU472953B2 (en) | 1976-06-10 |
| DK132402B (da) | 1975-12-01 |
| JPS4828641A (en:Method) | 1973-04-16 |
| CH573704A5 (en:Method) | 1976-03-31 |
| NL177561C (nl) | 1985-10-16 |
| BR7205530D0 (pt) | 1973-01-16 |
| ES406098A1 (es) | 1976-03-01 |
| GB1389479A (en) | 1975-04-03 |
| IT962214B (it) | 1973-12-20 |
| BE787939A (fr) | 1973-02-26 |
| SE393372B (sv) | 1977-05-09 |
| FR2151415A5 (en:Method) | 1973-04-13 |
| IL39841A (en) | 1975-10-15 |
| DE2241408A1 (de) | 1973-03-01 |
| DK132402C (da) | 1976-05-03 |
| TR17956A (tr) | 1976-07-23 |
| PH9657A (en) | 1976-01-27 |
| CS180602B2 (en) | 1978-01-31 |
| IL39841A0 (en) | 1972-09-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE68920963T2 (de) | Aralkylamin-Derivate, deren Herstellung und diese enthaltende fungizide Mittel. | |
| DE2135140B2 (de) | Alkoxydinitroaniline und ihre Verwendung | |
| DE112020001084T5 (de) | Arylsulfid mit Benzylaminstruktur und dessen Syntheseverfahren und Anwendung | |
| DD211557A5 (de) | Verfahren zur herstellung neuer n-phenylpyrazol-abkoemmlinge | |
| DE2744137C2 (de) | N,N-Disubstituierte Benzolsulfonamid-Derivate, Verfahren zu deren Herstellung und diese Verbindungen enthaltende herbizide Zusammensetzung | |
| DD232184A5 (de) | Pestizide zusammensetzung | |
| DE2700270A1 (de) | Imidazoisoindoldione und verfahren zu ihrer herstellung | |
| DE2833274C2 (en:Method) | ||
| DE2637886C2 (en:Method) | ||
| DE2110217A1 (de) | Substituierte Phenylharnstoffverbindungen, ihre Herstellung und Verwendung | |
| DE2740887A1 (de) | Mittel zur bekaempfung von pflanzenbakteriosen | |
| DE2232263A1 (de) | Verfahren und mittel zur hemmung von pflanzenknospenwachstum | |
| DE2241408A1 (de) | Herbicide 2,6-dinitroaniline | |
| DD202090A5 (de) | Herbizides mittel | |
| DE3303388C2 (de) | Chloracetamide, Verfahren zu ihrer Herstellung und diese enthaltende herbizide Mittel | |
| DE2810267A1 (de) | Verfahren zur herstellung von phenylpyridazinonderivaten | |
| DD156890A5 (de) | Herbizide zusammensetzungen | |
| DE2013508C3 (de) | 6-Halo-2,4-dinitro-,3-phenylendiamine | |
| DE2831770A1 (de) | Neue ungesaettigte lactame | |
| DE2363602C2 (de) | Diphenylaminderivate, Verfahren zu ihrer Herstellung und diese enthaltende Schädlingsbekämpfungsmittel | |
| DD244550A5 (de) | Alkanoylaniliden | |
| DE2646628A1 (de) | Cycloalkanpyrazole, verfahren zu ihrer herstellung und herbizide mittel | |
| DE2454795A1 (de) | Heterocyclische verbindungen und ihre verwendung als schaedlingsbekaempfungsmittel | |
| DE1000819C2 (de) | Verfahren zur Herstellung von Oxazolinderivaten mit acariciden und fungiciden Eigenschaften | |
| DE2136616A1 (de) | 2,4 Dinitro 1,3 phenylendiamine und ihre Verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8136 | Disposal/non-payment of the fee for publication/grant | ||
| 8128 | New person/name/address of the agent |
Representative=s name: SPOTT, G., DIPL.-CHEM. DR.RER.NAT. PUSCHMANN, H., |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |