DE2232541C3 - Monoazo-Reaktivfarbstoffe und ihre Verwendung zum Färben und Bedrucken hydroxyl- oder amidgruppenhaltiger Textilmaterialien - Google Patents
Monoazo-Reaktivfarbstoffe und ihre Verwendung zum Färben und Bedrucken hydroxyl- oder amidgruppenhaltiger TextilmaterialienInfo
- Publication number
- DE2232541C3 DE2232541C3 DE2232541A DE2232541A DE2232541C3 DE 2232541 C3 DE2232541 C3 DE 2232541C3 DE 2232541 A DE2232541 A DE 2232541A DE 2232541 A DE2232541 A DE 2232541A DE 2232541 C3 DE2232541 C3 DE 2232541C3
- Authority
- DE
- Germany
- Prior art keywords
- methyl
- chloro
- methylsulfonyl
- pyrimidinyl
- pyrimidine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000985 reactive dye Substances 0.000 title claims description 4
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 title claims 3
- 238000004043 dyeing Methods 0.000 title description 13
- 239000000463 material Substances 0.000 title description 10
- 125000002887 hydroxy group Chemical group [H]O* 0.000 title description 4
- 239000004753 textile Substances 0.000 title description 4
- 125000003368 amide group Chemical group 0.000 title description 3
- 239000002253 acid Substances 0.000 claims description 6
- -1 naphthyl radicals Chemical class 0.000 description 42
- 239000000975 dye Substances 0.000 description 41
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 23
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- 239000000460 chlorine Substances 0.000 description 12
- 229920000742 Cotton Polymers 0.000 description 11
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 10
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 10
- 235000011121 sodium hydroxide Nutrition 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 6
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- 238000006193 diazotization reaction Methods 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 5
- GVBHCMNXRKOJRH-UHFFFAOYSA-N 2,4,5,6-tetrachloropyrimidine Chemical compound ClC1=NC(Cl)=C(Cl)C(Cl)=N1 GVBHCMNXRKOJRH-UHFFFAOYSA-N 0.000 description 5
- GOYNRDSJTYLXBU-UHFFFAOYSA-N 5-chloro-2,4,6-trifluoropyrimidine Chemical compound FC1=NC(F)=C(Cl)C(F)=N1 GOYNRDSJTYLXBU-UHFFFAOYSA-N 0.000 description 5
- 230000008901 benefit Effects 0.000 description 5
- 238000001035 drying Methods 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 230000008569 process Effects 0.000 description 5
- 150000003254 radicals Chemical class 0.000 description 5
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 5
- KTVWISLTJPDQQX-UHFFFAOYSA-N 2-amino-5-(aminomethyl)naphthalene-1-sulfonic acid Chemical compound NC1=CC=C2C(CN)=CC=CC2=C1S(O)(=O)=O KTVWISLTJPDQQX-UHFFFAOYSA-N 0.000 description 4
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- MNSGOOCAMMSKGI-UHFFFAOYSA-N N-(hydroxymethyl)phthalimide Chemical compound C1=CC=C2C(=O)N(CO)C(=O)C2=C1 MNSGOOCAMMSKGI-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 230000010933 acylation Effects 0.000 description 4
- 238000005917 acylation reaction Methods 0.000 description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 230000008878 coupling Effects 0.000 description 4
- 238000010168 coupling process Methods 0.000 description 4
- 238000005859 coupling reaction Methods 0.000 description 4
- 125000000623 heterocyclic group Chemical group 0.000 description 4
- UOUBPDZUBVJZOQ-UHFFFAOYSA-N n-(hydroxymethyl)benzamide Chemical compound OCNC(=O)C1=CC=CC=C1 UOUBPDZUBVJZOQ-UHFFFAOYSA-N 0.000 description 4
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 4
- NGCRLFIYVFOUMZ-UHFFFAOYSA-N 2,3-dichloroquinoxaline-6-carbonyl chloride Chemical compound N1=C(Cl)C(Cl)=NC2=CC(C(=O)Cl)=CC=C21 NGCRLFIYVFOUMZ-UHFFFAOYSA-N 0.000 description 3
- FFRBMBIXVSCUFS-UHFFFAOYSA-N 2,4-dinitro-1-naphthol Chemical compound C1=CC=C2C(O)=C([N+]([O-])=O)C=C([N+]([O-])=O)C2=C1 FFRBMBIXVSCUFS-UHFFFAOYSA-N 0.000 description 3
- TXNSZCSYBXHETP-UHFFFAOYSA-N 2-chloro-n-(hydroxymethyl)acetamide Chemical compound OCNC(=O)CCl TXNSZCSYBXHETP-UHFFFAOYSA-N 0.000 description 3
- CHSHPICPNSLONM-UHFFFAOYSA-N 2-chloroquinoxaline-6-carboxylic acid Chemical compound N1=C(Cl)C=NC2=CC(C(=O)O)=CC=C21 CHSHPICPNSLONM-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 125000002252 acyl group Chemical group 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- XMYQHJDBLRZMLW-UHFFFAOYSA-N methanolamine Chemical class NCO XMYQHJDBLRZMLW-UHFFFAOYSA-N 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 150000003252 quinoxalines Chemical class 0.000 description 3
- 238000007127 saponification reaction Methods 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 238000010186 staining Methods 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- YXYCPKOAGWDZKX-UHFFFAOYSA-N 2,4-difluoro-5-(trifluoromethyl)pyrimidine Chemical compound FC1=NC=C(C(F)(F)F)C(F)=N1 YXYCPKOAGWDZKX-UHFFFAOYSA-N 0.000 description 2
- FYTLHYRDGXRYEY-UHFFFAOYSA-N 5-Methyl-3-pyrazolamine Chemical compound CC=1C=C(N)NN=1 FYTLHYRDGXRYEY-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- 206010039587 Scarlet Fever Diseases 0.000 description 2
- 150000001408 amides Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 125000005521 carbonamide group Chemical group 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 238000000227 grinding Methods 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical compound Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- HYFMZOAPNQAXHU-UHFFFAOYSA-N naphthalene-1,7-disulfonic acid Chemical compound C1=CC=C(S(O)(=O)=O)C2=CC(S(=O)(=O)O)=CC=C21 HYFMZOAPNQAXHU-UHFFFAOYSA-N 0.000 description 2
- 238000006053 organic reaction Methods 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- RPACBEVZENYWOL-XFULWGLBSA-M sodium;(2r)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate Chemical compound [Na+].C=1C=C(Cl)C=CC=1OCCCCCC[C@]1(C(=O)[O-])CO1 RPACBEVZENYWOL-XFULWGLBSA-M 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- QQOWHRYOXYEMTL-UHFFFAOYSA-N triazin-4-amine Chemical compound N=C1C=CN=NN1 QQOWHRYOXYEMTL-UHFFFAOYSA-N 0.000 description 2
- 210000002268 wool Anatomy 0.000 description 2
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- BYVKICLDZSJHAA-UHFFFAOYSA-N 2,3-dibromoquinoxaline-6-carbonyl bromide Chemical compound N1=C(Br)C(Br)=NC2=CC(C(=O)Br)=CC=C21 BYVKICLDZSJHAA-UHFFFAOYSA-N 0.000 description 1
- ZGQQEHVULTVXQD-UHFFFAOYSA-N 2,3-dichloroquinoxaline-6-carboxylic acid Chemical compound N1=C(Cl)C(Cl)=NC2=CC(C(=O)O)=CC=C21 ZGQQEHVULTVXQD-UHFFFAOYSA-N 0.000 description 1
- FYSHPROTETTWKB-UHFFFAOYSA-N 2,4,5,6-tetrabromopyrimidine Chemical compound BrC1=NC(Br)=C(Br)C(Br)=N1 FYSHPROTETTWKB-UHFFFAOYSA-N 0.000 description 1
- KZMWBUVUQLGBBP-UHFFFAOYSA-N 2,4,5,6-tetrafluoropyrimidine Chemical compound FC1=NC(F)=C(F)C(F)=N1 KZMWBUVUQLGBBP-UHFFFAOYSA-N 0.000 description 1
- BIMGULMREAFXSC-UHFFFAOYSA-N 2,4,5-trifluoro-6-methylpyrimidine Chemical compound CC1=NC(F)=NC(F)=C1F BIMGULMREAFXSC-UHFFFAOYSA-N 0.000 description 1
- VHYBUUMUUNCHCK-UHFFFAOYSA-N 2,4,6-tribromo-1,3,5-triazine Chemical compound BrC1=NC(Br)=NC(Br)=N1 VHYBUUMUUNCHCK-UHFFFAOYSA-N 0.000 description 1
- XJNDXSGINZSFDF-UHFFFAOYSA-N 2,4,6-trichloropyrimidine-5-carbonyl chloride Chemical compound ClC(=O)C1=C(Cl)N=C(Cl)N=C1Cl XJNDXSGINZSFDF-UHFFFAOYSA-N 0.000 description 1
- AZVALKSFVWAVOL-UHFFFAOYSA-N 2,4,6-trifluoro-5-methylpyrimidine Chemical compound CC1=C(F)N=C(F)N=C1F AZVALKSFVWAVOL-UHFFFAOYSA-N 0.000 description 1
- CZHWBISSOIPPNL-UHFFFAOYSA-N 2,4,6-trifluoro-5-methylsulfonylpyrimidine Chemical compound CS(=O)(=O)C1=C(F)N=C(F)N=C1F CZHWBISSOIPPNL-UHFFFAOYSA-N 0.000 description 1
- MLLSXQLOUGEEGV-UHFFFAOYSA-N 2,4,6-trifluoro-5-nitropyrimidine Chemical compound [O-][N+](=O)C1=C(F)N=C(F)N=C1F MLLSXQLOUGEEGV-UHFFFAOYSA-N 0.000 description 1
- JOYWMWSTASJQHZ-UHFFFAOYSA-N 2,4,6-trifluoropyrimidine-5-carbonitrile Chemical compound FC1=NC(F)=C(C#N)C(F)=N1 JOYWMWSTASJQHZ-UHFFFAOYSA-N 0.000 description 1
- VFIWQBCLEGAHDR-UHFFFAOYSA-N 2,4,6-tris(benzenesulfonyl)-1,3,5-triazine Chemical compound N=1C(S(=O)(=O)C=2C=CC=CC=2)=NC(S(=O)(=O)C=2C=CC=CC=2)=NC=1S(=O)(=O)C1=CC=CC=C1 VFIWQBCLEGAHDR-UHFFFAOYSA-N 0.000 description 1
- VAOWDUICNHWGRL-UHFFFAOYSA-N 2,4,6-tris(methylsulfonyl)pyrimidine Chemical compound CS(=O)(=O)C1=CC(S(C)(=O)=O)=NC(S(C)(=O)=O)=N1 VAOWDUICNHWGRL-UHFFFAOYSA-N 0.000 description 1
- MIVVPUZFDSCZJE-UHFFFAOYSA-N 2,4-bis(methylsulfonyl)-1,3,5-triazine Chemical compound CS(=O)(=O)C1=NC=NC(S(C)(=O)=O)=N1 MIVVPUZFDSCZJE-UHFFFAOYSA-N 0.000 description 1
- FNSNECVCDMIFBA-UHFFFAOYSA-N 2,4-bis(methylsulfonyl)-6-phenoxy-1,3,5-triazine Chemical compound CS(=O)(=O)C1=NC(S(=O)(=O)C)=NC(OC=2C=CC=CC=2)=N1 FNSNECVCDMIFBA-UHFFFAOYSA-N 0.000 description 1
- CVXWQOAPKWGRTD-UHFFFAOYSA-N 2,4-bis(methylsulfonyl)pyrimidine-5-sulfonyl chloride Chemical compound CS(=O)(=O)C1=NC=C(S(Cl)(=O)=O)C(S(C)(=O)=O)=N1 CVXWQOAPKWGRTD-UHFFFAOYSA-N 0.000 description 1
- NIAMELKDNLLWRH-UHFFFAOYSA-N 2,4-difluoro-5-methylpyrimidine Chemical compound CC1=CN=C(F)N=C1F NIAMELKDNLLWRH-UHFFFAOYSA-N 0.000 description 1
- GJOGRJUICNPNSV-UHFFFAOYSA-N 2,4-difluoro-5-phenylpyrimidine Chemical compound FC1=NC(F)=NC=C1C1=CC=CC=C1 GJOGRJUICNPNSV-UHFFFAOYSA-N 0.000 description 1
- FKSSZHRRUUZKCM-UHFFFAOYSA-N 2,4-difluoro-6-(trifluoromethyl)pyrimidine Chemical compound FC1=CC(C(F)(F)F)=NC(F)=N1 FKSSZHRRUUZKCM-UHFFFAOYSA-N 0.000 description 1
- YKLOPWRWWFKUBX-UHFFFAOYSA-N 2,4-difluoro-6-methylpyrimidine Chemical compound CC1=CC(F)=NC(F)=N1 YKLOPWRWWFKUBX-UHFFFAOYSA-N 0.000 description 1
- ZCHHTEOFXSGDMW-UHFFFAOYSA-N 2,4-difluoro-6-phenylpyrimidine Chemical compound FC1=NC(F)=CC(C=2C=CC=CC=2)=N1 ZCHHTEOFXSGDMW-UHFFFAOYSA-N 0.000 description 1
- AOSHQVWIJNXEMB-UHFFFAOYSA-N 2,4-difluoropyrimidine-5-carbonitrile Chemical compound FC1=NC=C(C#N)C(F)=N1 AOSHQVWIJNXEMB-UHFFFAOYSA-N 0.000 description 1
- YZRMBOOBRWRVJU-UHFFFAOYSA-N 2,6-bis(methylsulfonyl)pyrimidine-4-carbonyl chloride Chemical compound CS(=O)(=O)C1=CC(C(Cl)=O)=NC(S(C)(=O)=O)=N1 YZRMBOOBRWRVJU-UHFFFAOYSA-N 0.000 description 1
- PLVFHLAXDQSLCL-UHFFFAOYSA-N 2,6-dichloro-1h-triazin-4-amine Chemical compound NC1=NN(Cl)NC(Cl)=C1 PLVFHLAXDQSLCL-UHFFFAOYSA-N 0.000 description 1
- VYLHZPZYNPDQBR-UHFFFAOYSA-N 2,6-dichloro-4-(4-methylphenyl)-1h-triazine-5-thiol Chemical compound C1=CC(C)=CC=C1C1=NN(Cl)NC(Cl)=C1S VYLHZPZYNPDQBR-UHFFFAOYSA-N 0.000 description 1
- AMBBZHXGKGNTMI-UHFFFAOYSA-N 2,6-dichloro-4-ethoxy-1h-triazine Chemical compound CCOC1=NN(Cl)NC(Cl)=C1 AMBBZHXGKGNTMI-UHFFFAOYSA-N 0.000 description 1
- IOXIFBCDVPDGJV-UHFFFAOYSA-N 2,6-dichloro-4-methoxy-1h-triazine Chemical compound COC1=NN(Cl)NC(Cl)=C1 IOXIFBCDVPDGJV-UHFFFAOYSA-N 0.000 description 1
- DLMSWGCJMRVWCD-UHFFFAOYSA-N 2,6-dichloro-4-phenoxy-1h-triazine Chemical compound ClN1NC(Cl)=CC(OC=2C=CC=CC=2)=N1 DLMSWGCJMRVWCD-UHFFFAOYSA-N 0.000 description 1
- BHAFVZAFEVCQGJ-UHFFFAOYSA-N 2,6-dichloro-4-phenylsulfanyl-1h-triazine Chemical compound ClN1NC(Cl)=CC(SC=2C=CC=CC=2)=N1 BHAFVZAFEVCQGJ-UHFFFAOYSA-N 0.000 description 1
- JOHYJBDEGASSCP-UHFFFAOYSA-N 2,6-dichloro-n-ethyl-1h-triazin-4-amine Chemical compound CCNC1=NN(Cl)NC(Cl)=C1 JOHYJBDEGASSCP-UHFFFAOYSA-N 0.000 description 1
- CTSJEGLSMYPRJK-UHFFFAOYSA-N 2,6-dichloro-n-methyl-1h-triazin-4-amine Chemical compound CNC1=NN(Cl)NC(Cl)=C1 CTSJEGLSMYPRJK-UHFFFAOYSA-N 0.000 description 1
- WULMCOUFBKKFQE-UHFFFAOYSA-N 2,6-dichloro-n-phenyl-1h-triazin-4-amine Chemical compound ClN1NC(Cl)=CC(NC=2C=CC=CC=2)=N1 WULMCOUFBKKFQE-UHFFFAOYSA-N 0.000 description 1
- NUYJCMGJLNVOML-UHFFFAOYSA-N 2,6-dichloropyrimidine-4-carbonyl chloride Chemical compound ClC(=O)C1=CC(Cl)=NC(Cl)=N1 NUYJCMGJLNVOML-UHFFFAOYSA-N 0.000 description 1
- WFJGZGDYFGUMCA-UHFFFAOYSA-N 2,6-difluoropyrimidine-4-carbonitrile Chemical compound FC1=CC(C#N)=NC(F)=N1 WFJGZGDYFGUMCA-UHFFFAOYSA-N 0.000 description 1
- IJXOQDQYOMRDSO-UHFFFAOYSA-N 2-(benzenesulfonyl)-4,5-dichloropyrimidine Chemical compound N1=C(Cl)C(Cl)=CN=C1S(=O)(=O)C1=CC=CC=C1 IJXOQDQYOMRDSO-UHFFFAOYSA-N 0.000 description 1
- JKGLRGGCGUQNEX-UHFFFAOYSA-N 2-(chloromethyl)isoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(CCl)C(=O)C2=C1 JKGLRGGCGUQNEX-UHFFFAOYSA-N 0.000 description 1
- FTTQEGRVQCXCSZ-UHFFFAOYSA-N 2-amino-3-methyl-5-[[2-(methylamino)acetyl]amino]naphthalene-1-sulfonic acid Chemical compound NC1=C(C)C=C2C(NC(=O)CNC)=CC=CC2=C1S(O)(=O)=O FTTQEGRVQCXCSZ-UHFFFAOYSA-N 0.000 description 1
- JYUAZYQCKQWDHM-UHFFFAOYSA-N 2-amino-5-(benzamidomethyl)naphthalene-1-sulfonic acid Chemical compound C=1C=CC2=C(S(O)(=O)=O)C(N)=CC=C2C=1CNC(=O)C1=CC=CC=C1 JYUAZYQCKQWDHM-UHFFFAOYSA-N 0.000 description 1
- VADDRXYFHXAKIG-UHFFFAOYSA-N 2-amino-5-[(2-chloroacetyl)amino]-3-methylnaphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(O)(=O)=O)=C(N)C(C)=CC2=C1NC(=O)CCl VADDRXYFHXAKIG-UHFFFAOYSA-N 0.000 description 1
- GWIAAIUASRVOIA-UHFFFAOYSA-N 2-aminonaphthalene-1-sulfonic acid Chemical compound C1=CC=CC2=C(S(O)(=O)=O)C(N)=CC=C21 GWIAAIUASRVOIA-UHFFFAOYSA-N 0.000 description 1
- JUYQWJULYXCBAV-UHFFFAOYSA-N 2-chloropyrimidine-5-carbonyl chloride Chemical compound ClC(=O)C1=CN=C(Cl)N=C1 JUYQWJULYXCBAV-UHFFFAOYSA-N 0.000 description 1
- LVSMGNXVKQOJGO-UHFFFAOYSA-N 3-(5-amino-3-methylpyrazol-1-yl)-4-chlorobenzenesulfonic acid Chemical compound N1=C(C)C=C(N)N1C1=CC(S(O)(=O)=O)=CC=C1Cl LVSMGNXVKQOJGO-UHFFFAOYSA-N 0.000 description 1
- USABLKDPCXBPRX-UHFFFAOYSA-N 3-[[4,6-bis(methylsulfonyl)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid Chemical compound CS(=O)(=O)C1=NC(S(=O)(=O)C)=NC(NC=2C=C(C=CC=2)S(O)(=O)=O)=N1 USABLKDPCXBPRX-UHFFFAOYSA-N 0.000 description 1
- QIMCIIVGSIZXFU-UHFFFAOYSA-N 3-chloroquinoxaline-2-carbonyl chloride Chemical compound C1=CC=C2N=C(Cl)C(C(=O)Cl)=NC2=C1 QIMCIIVGSIZXFU-UHFFFAOYSA-N 0.000 description 1
- CGIHHZTTZZMCRK-UHFFFAOYSA-N 3-chloroquinoxaline-6-carbonyl chloride Chemical compound N1=CC(Cl)=NC2=CC(C(=O)Cl)=CC=C21 CGIHHZTTZZMCRK-UHFFFAOYSA-N 0.000 description 1
- USWINTIHFQKJTR-UHFFFAOYSA-N 3-hydroxynaphthalene-2,7-disulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C=C(S(O)(=O)=O)C(O)=CC2=C1 USWINTIHFQKJTR-UHFFFAOYSA-N 0.000 description 1
- AIRRELHUAAZTTL-UHFFFAOYSA-N 3-nitrobenzenesulfonic acid;sodium Chemical compound [Na].OS(=O)(=O)C1=CC=CC([N+]([O-])=O)=C1 AIRRELHUAAZTTL-UHFFFAOYSA-N 0.000 description 1
- TVFFVYDLWNCZBH-UHFFFAOYSA-N 4,5-dichloro-2-ethylsulfonyl-6-methylpyrimidine Chemical compound CCS(=O)(=O)C1=NC(C)=C(Cl)C(Cl)=N1 TVFFVYDLWNCZBH-UHFFFAOYSA-N 0.000 description 1
- YJPYVNMIARMZEK-UHFFFAOYSA-N 4,5-dichloro-6-(chloromethyl)-2-methylsulfonylpyrimidine Chemical compound CS(=O)(=O)C1=NC(Cl)=C(Cl)C(CCl)=N1 YJPYVNMIARMZEK-UHFFFAOYSA-N 0.000 description 1
- NZXOCWXWWQNPOF-UHFFFAOYSA-N 4,5-dichloro-6-methyl-2-methylsulfonylpyrimidine Chemical compound CC1=NC(S(C)(=O)=O)=NC(Cl)=C1Cl NZXOCWXWWQNPOF-UHFFFAOYSA-N 0.000 description 1
- FBDGJZXFKQZWLX-UHFFFAOYSA-N 4,6-bis(methylsulfonyl)pyrimidine Chemical compound CS(=O)(=O)C1=CC(S(C)(=O)=O)=NC=N1 FBDGJZXFKQZWLX-UHFFFAOYSA-N 0.000 description 1
- DROUVIKCNOHKBA-UHFFFAOYSA-N 4,6-dichloro-2-methylsulfonylpyrimidine Chemical compound CS(=O)(=O)C1=NC(Cl)=CC(Cl)=N1 DROUVIKCNOHKBA-UHFFFAOYSA-N 0.000 description 1
- SLCUSSPKUGKMGA-UHFFFAOYSA-N 4-bromo-2,6-difluoropyrimidine Chemical compound FC1=CC(Br)=NC(F)=N1 SLCUSSPKUGKMGA-UHFFFAOYSA-N 0.000 description 1
- ZRWALVBIVUPROW-UHFFFAOYSA-N 4-chloro-2,6-bis(methylsulfonyl)pyrimidine-5-carbonyl chloride Chemical compound CS(=O)(=O)C1=NC(Cl)=C(C(Cl)=O)C(S(C)(=O)=O)=N1 ZRWALVBIVUPROW-UHFFFAOYSA-N 0.000 description 1
- VJMKIDUNVPFBOB-UHFFFAOYSA-N 4-chloro-2,6-difluoro-5-methylpyrimidine Chemical compound CC1=C(F)N=C(F)N=C1Cl VJMKIDUNVPFBOB-UHFFFAOYSA-N 0.000 description 1
- WOQIMJVYLVUMGO-UHFFFAOYSA-N 4-chloro-2,6-difluoro-5-nitropyrimidine Chemical compound [O-][N+](=O)C1=C(F)N=C(F)N=C1Cl WOQIMJVYLVUMGO-UHFFFAOYSA-N 0.000 description 1
- ACYSJALOFWHUEX-UHFFFAOYSA-N 4-chloro-2,6-difluoropyrimidine Chemical compound FC1=CC(Cl)=NC(F)=N1 ACYSJALOFWHUEX-UHFFFAOYSA-N 0.000 description 1
- POWFLCAWHSPOHP-UHFFFAOYSA-N 4-chloro-2-methylpyrimidine-5-carbonyl chloride Chemical compound CC1=NC=C(C(Cl)=O)C(Cl)=N1 POWFLCAWHSPOHP-UHFFFAOYSA-N 0.000 description 1
- WGNKUINKIVFGBC-UHFFFAOYSA-N 4-chloro-6-methyl-2-methylsulfonyl-5-nitropyrimidine Chemical compound CC1=NC(S(C)(=O)=O)=NC(Cl)=C1[N+]([O-])=O WGNKUINKIVFGBC-UHFFFAOYSA-N 0.000 description 1
- OLOLDTJCNAOMQJ-UHFFFAOYSA-N 4-chloro-6-methyl-2-methylsulfonylpyrimidine Chemical compound CC1=CC(Cl)=NC(S(C)(=O)=O)=N1 OLOLDTJCNAOMQJ-UHFFFAOYSA-N 0.000 description 1
- BYJUMOSWVALFCO-UHFFFAOYSA-N 4-chloro-6-methyl-2-methylsulfonylpyrimidine-5-sulfonyl chloride Chemical compound CC1=NC(S(C)(=O)=O)=NC(Cl)=C1S(Cl)(=O)=O BYJUMOSWVALFCO-UHFFFAOYSA-N 0.000 description 1
- LNJVTFNEAPYZIU-UHFFFAOYSA-N 4-chloro-6-methylsulfonylpyrimidine Chemical compound CS(=O)(=O)C1=CC(Cl)=NC=N1 LNJVTFNEAPYZIU-UHFFFAOYSA-N 0.000 description 1
- SXCSXKQTOUHQIY-UHFFFAOYSA-N 4-hydroxynaphthalene-1,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC=C2C(O)=CC=C(S(O)(=O)=O)C2=C1 SXCSXKQTOUHQIY-UHFFFAOYSA-N 0.000 description 1
- LVILGAOSPDLNRM-UHFFFAOYSA-N 4-methylpyrimidine Chemical compound CC1=CC=NC=N1 LVILGAOSPDLNRM-UHFFFAOYSA-N 0.000 description 1
- FRSCGYMSBBDAKE-UHFFFAOYSA-N 5-(chloromethyl)-2,4,6-trifluoropyrimidine Chemical compound FC1=NC(F)=C(CCl)C(F)=N1 FRSCGYMSBBDAKE-UHFFFAOYSA-N 0.000 description 1
- BOLIYMRNXVAWIJ-UHFFFAOYSA-N 5-bromo-2,4,6-trifluoropyrimidine Chemical compound FC1=NC(F)=C(Br)C(F)=N1 BOLIYMRNXVAWIJ-UHFFFAOYSA-N 0.000 description 1
- ZBTCTILYGQNVOJ-UHFFFAOYSA-N 5-bromo-2,4-difluoro-6-methylpyrimidine Chemical compound CC1=NC(F)=NC(F)=C1Br ZBTCTILYGQNVOJ-UHFFFAOYSA-N 0.000 description 1
- XKHYTPKPHOHPIJ-UHFFFAOYSA-N 5-bromo-4-chloro-6-methyl-2-methylsulfonylpyrimidine Chemical compound CC1=NC(S(C)(=O)=O)=NC(Cl)=C1Br XKHYTPKPHOHPIJ-UHFFFAOYSA-N 0.000 description 1
- GNDKYGCYDWCLHH-UHFFFAOYSA-N 5-chloro-2,4-bis(methylsulfonyl)pyrimidine Chemical compound CS(=O)(=O)C1=NC=C(Cl)C(S(C)(=O)=O)=N1 GNDKYGCYDWCLHH-UHFFFAOYSA-N 0.000 description 1
- RMULVUFPLMJWOK-UHFFFAOYSA-N 5-chloro-2,4-difluoro-6-methylpyrimidine Chemical compound CC1=NC(F)=NC(F)=C1Cl RMULVUFPLMJWOK-UHFFFAOYSA-N 0.000 description 1
- XZSZSTCLQANXKU-UHFFFAOYSA-N 5-chloro-2,4-difluoropyrimidine Chemical compound FC1=NC=C(Cl)C(F)=N1 XZSZSTCLQANXKU-UHFFFAOYSA-N 0.000 description 1
- FCMIDLUGAKOJNR-UHFFFAOYSA-N 5-chloro-4-methyl-2,6-bis(methylsulfonyl)pyrimidine Chemical compound CC1=NC(S(C)(=O)=O)=NC(S(C)(=O)=O)=C1Cl FCMIDLUGAKOJNR-UHFFFAOYSA-N 0.000 description 1
- YLKCHWCYYNKADS-UHFFFAOYSA-N 5-hydroxynaphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(O)=CC=CC2=C1S(O)(=O)=O YLKCHWCYYNKADS-UHFFFAOYSA-N 0.000 description 1
- CNNNFDGIKSGUIS-UHFFFAOYSA-N 6-amino-4-benzoyl-5-hydroxynaphthalene-1,7-disulfonic acid Chemical compound C1=CC(S(O)(=O)=O)=C2C=C(S(O)(=O)=O)C(N)=C(O)C2=C1C(=O)C1=CC=CC=C1 CNNNFDGIKSGUIS-UHFFFAOYSA-N 0.000 description 1
- OZDPATQEBXWLPZ-UHFFFAOYSA-N 6-chloro-2-methylsulfonylpyrimidine-4-carboxylic acid Chemical compound CS(=O)(=O)C1=NC(Cl)=CC(C(O)=O)=N1 OZDPATQEBXWLPZ-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- XJKHHGWQULDTQA-UHFFFAOYSA-N ClN1NC(=CC(=N1)Cl)N Chemical compound ClN1NC(=CC(=N1)Cl)N XJKHHGWQULDTQA-UHFFFAOYSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- 102100022404 E3 ubiquitin-protein ligase Midline-1 Human genes 0.000 description 1
- 101710102210 E3 ubiquitin-protein ligase Midline-1 Proteins 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 125000001769 aryl amino group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 description 1
- 239000000987 azo dye Substances 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 235000019646 color tone Nutrition 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000002996 emotional effect Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 235000019233 fast yellow AB Nutrition 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000001153 fluoro group Chemical class F* 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- OAKJQQAXSVQMHS-UHFFFAOYSA-O hydrazinium(1+) Chemical compound [NH3+]N OAKJQQAXSVQMHS-UHFFFAOYSA-O 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- USPGWRYCHDAJCB-UHFFFAOYSA-N methyl 2,4-difluoropyrimidine-5-carboxylate Chemical compound COC(=O)C1=CN=C(F)N=C1F USPGWRYCHDAJCB-UHFFFAOYSA-N 0.000 description 1
- YSEQKGHEMQCJCC-UHFFFAOYSA-N methyl 2,6-difluoropyrimidine-4-carboxylate Chemical compound COC(=O)C1=CC(F)=NC(F)=N1 YSEQKGHEMQCJCC-UHFFFAOYSA-N 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- AJDUTMFFZHIJEM-UHFFFAOYSA-N n-(9,10-dioxoanthracen-1-yl)-4-[4-[[4-[4-[(9,10-dioxoanthracen-1-yl)carbamoyl]phenyl]phenyl]diazenyl]phenyl]benzamide Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC(=O)C(C=C1)=CC=C1C(C=C1)=CC=C1N=NC(C=C1)=CC=C1C(C=C1)=CC=C1C(=O)NC1=CC=CC2=C1C(=O)C1=CC=CC=C1C2=O AJDUTMFFZHIJEM-UHFFFAOYSA-N 0.000 description 1
- CIUJQWLLGXKZQD-UHFFFAOYSA-N n-(chloromethyl)benzamide Chemical compound ClCNC(=O)C1=CC=CC=C1 CIUJQWLLGXKZQD-UHFFFAOYSA-N 0.000 description 1
- LDHTUNVLBUNXKK-UHFFFAOYSA-N n-(hydroxymethyl)-n-methylacetamide Chemical compound OCN(C)C(C)=O LDHTUNVLBUNXKK-UHFFFAOYSA-N 0.000 description 1
- HWJHZLJIIWOTGZ-UHFFFAOYSA-N n-(hydroxymethyl)acetamide Chemical compound CC(=O)NCO HWJHZLJIIWOTGZ-UHFFFAOYSA-N 0.000 description 1
- HLGWPTPAYKLATN-UHFFFAOYSA-N n-(methoxymethyl)benzamide Chemical compound COCNC(=O)C1=CC=CC=C1 HLGWPTPAYKLATN-UHFFFAOYSA-N 0.000 description 1
- DIEOESIZLAHURK-UHFFFAOYSA-N n-naphthalen-2-ylacetamide Chemical compound C1=CC=CC2=CC(NC(=O)C)=CC=C21 DIEOESIZLAHURK-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 125000001557 phthalyl group Chemical group C(=O)(O)C1=C(C(=O)*)C=CC=C1 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920006306 polyurethane fiber Polymers 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 239000004627 regenerated cellulose Substances 0.000 description 1
- 238000005185 salting out Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- BUUPQKDIAURBJP-UHFFFAOYSA-N sulfinic acid Chemical compound OS=O BUUPQKDIAURBJP-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-O sulfonium Chemical compound [SH3+] RWSOTUBLDIXVET-UHFFFAOYSA-O 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 230000004580 weight loss Effects 0.000 description 1
- 239000001043 yellow dye Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/002—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the linkage of the reactive group being alternatively specified
- C09B62/006—Azodyes
- C09B62/008—Monoazo dyes
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/002—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the linkage of the reactive group being alternatively specified
- C09B62/006—Azodyes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (19)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2232541A DE2232541C3 (de) | 1972-07-03 | 1972-07-03 | Monoazo-Reaktivfarbstoffe und ihre Verwendung zum Färben und Bedrucken hydroxyl- oder amidgruppenhaltiger Textilmaterialien |
| IT26026/73A IT990815B (it) | 1972-07-03 | 1973-06-28 | Coloranti azoici reattivi |
| CH953973A CH572546B5 (cg-RX-API-DMAC10.html) | 1972-07-03 | 1973-06-29 | |
| CA175,278A CA994330A (en) | 1972-07-03 | 1973-06-29 | Azo reactive dyestuffs |
| JP7300973A JPS5543025B2 (cg-RX-API-DMAC10.html) | 1972-07-03 | 1973-06-29 | |
| CH953973D CH953973A4 (cg-RX-API-DMAC10.html) | 1972-07-03 | 1973-06-29 | |
| CH1547675A CH582739A5 (cg-RX-API-DMAC10.html) | 1972-07-03 | 1973-06-29 | |
| BE132901A BE801661A (fr) | 1972-07-03 | 1973-06-29 | Colorants azoiques reactifs |
| GB3975975A GB1431323A (en) | 1972-07-03 | 1973-07-02 | Aminonaphthalenesulphonic acids |
| DD171990A DD107302A5 (cg-RX-API-DMAC10.html) | 1972-07-03 | 1973-07-02 | |
| GB3142073A GB1431322A (en) | 1972-07-03 | 1973-07-02 | Reactive azo dyestuffs |
| ES416498A ES416498A1 (es) | 1972-07-03 | 1973-07-02 | Procedimiento para la obtencion de colorantes azoicos reac-tivos. |
| NL7309200A NL7309200A (cg-RX-API-DMAC10.html) | 1972-07-03 | 1973-07-02 | |
| FR7324415A FR2236905B1 (cg-RX-API-DMAC10.html) | 1972-07-03 | 1973-07-03 | |
| US05/376,184 US4126609A (en) | 1972-07-03 | 1973-07-03 | Azo dyestuff with a fiber-reactive group attached to a naphthalene sulphonic acid component |
| AT584573A AT320100B (de) | 1972-07-03 | 1973-07-03 | Verfahren zur Herstellung von neuen Azoreaktivfarbstoffen |
| AT17974A AT334313B (de) | 1972-07-03 | 1974-01-10 | Verfahren zum farben und bedrucken von hydroxyl- oder amidgruppenhaltigen materialien |
| JP51011493A JPS5263488A (en) | 1972-07-03 | 1976-02-06 | Dyeing and printing method |
| US05/656,251 US4049704A (en) | 1972-07-03 | 1976-02-09 | 2-Amino-1-sulfonaphthalene containing acylaminomethyl substituent |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2232541A DE2232541C3 (de) | 1972-07-03 | 1972-07-03 | Monoazo-Reaktivfarbstoffe und ihre Verwendung zum Färben und Bedrucken hydroxyl- oder amidgruppenhaltiger Textilmaterialien |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2232541A1 DE2232541A1 (de) | 1974-01-17 |
| DE2232541B2 DE2232541B2 (de) | 1977-10-27 |
| DE2232541C3 true DE2232541C3 (de) | 1978-06-15 |
Family
ID=5849522
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2232541A Expired DE2232541C3 (de) | 1972-07-03 | 1972-07-03 | Monoazo-Reaktivfarbstoffe und ihre Verwendung zum Färben und Bedrucken hydroxyl- oder amidgruppenhaltiger Textilmaterialien |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4126609A (cg-RX-API-DMAC10.html) |
| JP (2) | JPS5543025B2 (cg-RX-API-DMAC10.html) |
| AT (1) | AT320100B (cg-RX-API-DMAC10.html) |
| BE (1) | BE801661A (cg-RX-API-DMAC10.html) |
| CA (1) | CA994330A (cg-RX-API-DMAC10.html) |
| CH (3) | CH582739A5 (cg-RX-API-DMAC10.html) |
| DD (1) | DD107302A5 (cg-RX-API-DMAC10.html) |
| DE (1) | DE2232541C3 (cg-RX-API-DMAC10.html) |
| ES (1) | ES416498A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2236905B1 (cg-RX-API-DMAC10.html) |
| GB (2) | GB1431322A (cg-RX-API-DMAC10.html) |
| IT (1) | IT990815B (cg-RX-API-DMAC10.html) |
| NL (1) | NL7309200A (cg-RX-API-DMAC10.html) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4299764A (en) | 1978-07-20 | 1981-11-10 | Bayer Aktiengesellschaft | Azo reactive dyestuffs |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2549570C2 (de) * | 1975-11-05 | 1983-05-19 | Bayer Ag, 5090 Leverkusen | Azo-Reaktivfarbstoffe |
| LU77430A1 (cg-RX-API-DMAC10.html) * | 1977-05-27 | 1979-01-19 | ||
| LU78420A1 (de) * | 1977-10-31 | 1979-06-01 | Ciba Geigy Ag | Farbstoffe,deren herstellung und verwendung |
| CH636080A5 (de) * | 1978-04-03 | 1983-05-13 | Ciba Geigy Ag | Farbstoffzwischenprodukte und deren herstellung. |
| DE2825594A1 (de) * | 1978-06-10 | 1979-12-20 | Bayer Ag | Azo-reaktivfarbstoffe |
| DE2829711C2 (de) * | 1978-07-06 | 1986-04-03 | Bayer Ag, 5090 Leverkusen | Azoreaktivfarbstoff |
| DE2903021A1 (de) * | 1979-01-26 | 1980-07-31 | Bayer Ag | Azoreaktivfarbstoffe |
| NO810202L (no) * | 1980-01-29 | 1981-07-30 | Fosroc International Ltd | Kapsel inneholdende sementholdig materiale. |
| DE3025244A1 (de) * | 1980-07-03 | 1982-01-28 | Bayer Ag, 5090 Leverkusen | Dis-azoreaktivfarbstoffe, verfahren zu ihrer herstellung und ihre verwendung zum faerben und bedrucken von stickstoff-und/oder hydroxylgruppenhaltigen materialien |
| DE3048694A1 (de) * | 1980-12-23 | 1982-07-08 | Bayer Ag, 5090 Leverkusen | Naphthalin-derivate, ihre herstellung und ihre verwendung |
| EP0208331B1 (de) * | 1983-07-29 | 1989-12-20 | Ciba-Geigy Ag | Reaktivfarbstoffe, deren Herstellung und Verwendung |
| EP0141776B1 (de) * | 1983-08-30 | 1987-07-08 | Ciba-Geigy Ag | Reaktivfarbstoffe, deren Herstellung und Verwendung |
| DE4100513A1 (de) * | 1991-01-10 | 1992-07-16 | Bayer Ag | Verbessertes verfahren zur herstellung eines substituierten 1-amino-2-sulfonaphthalins |
| DE19525608A1 (de) * | 1995-07-14 | 1997-01-16 | Bayer Ag | Substantive Disazofarbstoffe |
| EP1469039A1 (de) * | 2003-04-17 | 2004-10-20 | Clariant International Ltd. | Faserreaktive Azofarbstoffe |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB837953A (en) * | 1957-08-23 | 1960-06-15 | Ici Ltd | New monoazo triazine dyestuffs |
| CH420414A (de) * | 1959-04-29 | 1966-09-15 | Sandoz Ag | Verfahren zur Herstellung von Pyrimidinfarbstoffen |
| CH370504A (de) * | 1958-10-13 | 1963-07-15 | Ciba Geigy | Verfahren zur Herstellung neuer Monoazofarbstoffe |
| US2951072A (en) * | 1959-02-27 | 1960-08-30 | Ici Ltd | Monoazo dyestuffs of the azo naphthalene series containing a monohalogeno-s-triazinenucleus |
| CH406480A (de) * | 1960-01-29 | 1966-01-31 | Sandoz Ag | Verfahren zur Herstellung von Reaktivfarbstoffen |
| BE618604A (cg-RX-API-DMAC10.html) * | 1960-06-24 | |||
| CH467324A (de) * | 1960-10-06 | 1969-01-15 | Sandoz Ag | Verfahren zur Herstellung von Farbstoffen |
| GB977814A (en) * | 1961-11-17 | 1964-12-16 | Ciba Ltd | New monoazo dyestuffs containing halopyrimidylamino or halotriazinylamino groups and processes for their manufacture and use |
| US3277075A (en) * | 1963-10-21 | 1966-10-04 | Gen Aniline & Film Corp | Dyestuffs containing hydroxyethyl-sulfonylmethyl groups |
| CH472481A (de) * | 1964-12-01 | 1969-05-15 | Ciba Geigy | Verfahren zur Herstellung neuer Azofarbstoffe |
| DE1544528A1 (de) * | 1965-07-15 | 1970-04-02 | Bayer Ag | Azofarbstoffe,deren Metallkomplexverbindungen und Verfahren zu deren Herstellung |
| CH476084A (de) * | 1965-11-16 | 1969-07-31 | Ciba Geigy | Verfahren zur Herstellung neuer Azofarbstoffe |
-
1972
- 1972-07-03 DE DE2232541A patent/DE2232541C3/de not_active Expired
-
1973
- 1973-06-28 IT IT26026/73A patent/IT990815B/it active
- 1973-06-29 CA CA175,278A patent/CA994330A/en not_active Expired
- 1973-06-29 JP JP7300973A patent/JPS5543025B2/ja not_active Expired
- 1973-06-29 BE BE132901A patent/BE801661A/xx not_active IP Right Cessation
- 1973-06-29 CH CH1547675A patent/CH582739A5/xx not_active IP Right Cessation
- 1973-06-29 CH CH953973D patent/CH953973A4/xx unknown
- 1973-06-29 CH CH953973A patent/CH572546B5/xx not_active IP Right Cessation
- 1973-07-02 GB GB3142073A patent/GB1431322A/en not_active Expired
- 1973-07-02 DD DD171990A patent/DD107302A5/xx unknown
- 1973-07-02 GB GB3975975A patent/GB1431323A/en not_active Expired
- 1973-07-02 ES ES416498A patent/ES416498A1/es not_active Expired
- 1973-07-02 NL NL7309200A patent/NL7309200A/xx unknown
- 1973-07-03 AT AT584573A patent/AT320100B/de not_active IP Right Cessation
- 1973-07-03 US US05/376,184 patent/US4126609A/en not_active Expired - Lifetime
- 1973-07-03 FR FR7324415A patent/FR2236905B1/fr not_active Expired
-
1976
- 1976-02-06 JP JP51011493A patent/JPS5263488A/ja active Granted
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4299764A (en) | 1978-07-20 | 1981-11-10 | Bayer Aktiengesellschaft | Azo reactive dyestuffs |
Also Published As
| Publication number | Publication date |
|---|---|
| ES416498A1 (es) | 1976-03-01 |
| IT990815B (it) | 1975-07-10 |
| FR2236905B1 (cg-RX-API-DMAC10.html) | 1977-02-18 |
| JPS4952828A (cg-RX-API-DMAC10.html) | 1974-05-22 |
| JPS5263488A (en) | 1977-05-25 |
| JPS5729592B2 (cg-RX-API-DMAC10.html) | 1982-06-23 |
| GB1431322A (en) | 1976-04-07 |
| JPS5543025B2 (cg-RX-API-DMAC10.html) | 1980-11-04 |
| DE2232541A1 (de) | 1974-01-17 |
| CH572546B5 (cg-RX-API-DMAC10.html) | 1976-02-13 |
| US4126609A (en) | 1978-11-21 |
| DD107302A5 (cg-RX-API-DMAC10.html) | 1974-07-20 |
| CH953973A4 (cg-RX-API-DMAC10.html) | 1975-05-30 |
| DE2232541B2 (de) | 1977-10-27 |
| CA994330A (en) | 1976-08-03 |
| CH582739A5 (cg-RX-API-DMAC10.html) | 1976-12-15 |
| GB1431323A (en) | 1976-04-07 |
| NL7309200A (cg-RX-API-DMAC10.html) | 1974-01-07 |
| FR2236905A1 (cg-RX-API-DMAC10.html) | 1975-02-07 |
| AT320100B (de) | 1975-01-27 |
| BE801661A (fr) | 1974-01-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2232541C3 (de) | Monoazo-Reaktivfarbstoffe und ihre Verwendung zum Färben und Bedrucken hydroxyl- oder amidgruppenhaltiger Textilmaterialien | |
| DE1644204B2 (de) | Reaktivfarbstoffe und deren verwendung | |
| DE1644203C3 (cg-RX-API-DMAC10.html) | ||
| DE1644616A1 (de) | Anthrachinon-Reaktivfarbstoffe | |
| DE2729011C2 (de) | Reaktivfarbstoffe | |
| DE2114158A1 (de) | Reaktivfarbstoffe | |
| DE2318412C2 (de) | Azo-Reaktivfarbstoffe | |
| DE2315638C2 (de) | Metallfreie Monoazo-Reaktivfarbstoffe | |
| DE2549570C2 (de) | Azo-Reaktivfarbstoffe | |
| DE2364764A1 (de) | Neue faserreaktive farbstoffe, deren herstellung und verwendung | |
| DE2728094C2 (cg-RX-API-DMAC10.html) | ||
| DE3318146A1 (de) | Disazoreaktivfarbstoffe mit mehreren reaktivresten | |
| DE1904112C3 (de) | Faserreaktive, schwermetallhaltige Formazanfarbstoffe, Verfahren zu ihrer Herstellung und deren Verwendung zum Färben oder Bedrucken von Textilmaterial | |
| EP0013936B1 (de) | Azoreaktivfarbstoffe sowie deren Herstellung und Verwendung zum Färben von Hydroxyl- und Amidgruppen enthaltenden Materialien | |
| DE2520123A1 (de) | Verfahren zur herstellung von formazanmetallkomplexfarbstoffen | |
| DE2632812A1 (de) | Reaktivfarbstoffe | |
| DE2515137A1 (de) | Azofarbstoffe, deren herstellung und verwendung | |
| DE2655625C2 (de) | Metallkomplexfarbstoffe | |
| DE2113298C3 (de) | Reaktivfarbstoffe und deren Verwendung zum Färben und Bedrucken hydroxyl- oder amidgruppenhaltiger Fasermaterialien | |
| EP0037986B1 (de) | Verfahren zur Herstellung von Phthalocyaninfarbstoffen | |
| DE1112229B (de) | Verfahren zur Herstellung von reaktiven Azofarbstoffen | |
| DE2314946A1 (de) | Disazofarbstoffe | |
| DE1951409A1 (de) | Phthalocyaninfarbstoffe | |
| DE1283984B (de) | Verfahren zur Herstellung von faserreaktiven Schwermetallkomplexen von Monoazofarbstoffen | |
| DE1644611B2 (de) | Anthrachinon-Reaktivfarbstoffe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |