DE2230792A1 - 3-amino-pyrazolone-(5), verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel - Google Patents
3-amino-pyrazolone-(5), verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittelInfo
- Publication number
- DE2230792A1 DE2230792A1 DE2230792A DE2230792A DE2230792A1 DE 2230792 A1 DE2230792 A1 DE 2230792A1 DE 2230792 A DE2230792 A DE 2230792A DE 2230792 A DE2230792 A DE 2230792A DE 2230792 A1 DE2230792 A1 DE 2230792A1
- Authority
- DE
- Germany
- Prior art keywords
- amino
- radical
- substituted
- pyrazolone
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims description 20
- 238000004519 manufacturing process Methods 0.000 title claims 2
- 229940126601 medicinal product Drugs 0.000 title 1
- -1 Carbonamido Chemical group 0.000 claims description 47
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 23
- 125000000217 alkyl group Chemical group 0.000 claims description 21
- 125000003545 alkoxy group Chemical group 0.000 claims description 19
- 125000001424 substituent group Chemical group 0.000 claims description 16
- 239000002253 acid Substances 0.000 claims description 14
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 10
- 125000003342 alkenyl group Chemical group 0.000 claims description 8
- 125000003282 alkyl amino group Chemical group 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 8
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 8
- 150000001411 amidrazones Chemical class 0.000 claims description 7
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 7
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 7
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims description 7
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 6
- 229910052794 bromium Inorganic materials 0.000 claims description 6
- 239000003814 drug Substances 0.000 claims description 6
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 5
- 230000002378 acidificating effect Effects 0.000 claims description 5
- 239000002934 diuretic Substances 0.000 claims description 5
- 230000001882 diuretic effect Effects 0.000 claims description 5
- 239000011737 fluorine Substances 0.000 claims description 5
- 229910052731 fluorine Inorganic materials 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 125000005420 sulfonamido group Chemical group S(=O)(=O)(N*)* 0.000 claims description 5
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 4
- 150000001242 acetic acid derivatives Chemical class 0.000 claims description 4
- 239000003054 catalyst Substances 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- 125000000623 heterocyclic group Chemical group 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 239000000543 intermediate Substances 0.000 claims description 4
- 239000011630 iodine Substances 0.000 claims description 4
- 229910052740 iodine Inorganic materials 0.000 claims description 4
- 231100000252 nontoxic Toxicity 0.000 claims description 4
- 230000003000 nontoxic effect Effects 0.000 claims description 4
- 229920006395 saturated elastomer Polymers 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 150000007513 acids Chemical class 0.000 claims description 3
- 229910001854 alkali hydroxide Inorganic materials 0.000 claims description 3
- 125000004414 alkyl thio group Chemical group 0.000 claims description 3
- 239000002220 antihypertensive agent Substances 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 150000002429 hydrazines Chemical class 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 150000002825 nitriles Chemical class 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 3
- 150000003460 sulfonic acids Chemical class 0.000 claims description 3
- 125000004434 sulfur atom Chemical group 0.000 claims description 3
- 239000003513 alkali Substances 0.000 claims description 2
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 claims description 2
- 125000003277 amino group Chemical group 0.000 claims description 2
- 229940030600 antihypertensive agent Drugs 0.000 claims description 2
- 125000004104 aryloxy group Chemical group 0.000 claims description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 claims description 2
- 239000012442 inert solvent Substances 0.000 claims description 2
- 238000002955 isolation Methods 0.000 claims description 2
- 229940124530 sulfonamide Drugs 0.000 claims description 2
- 150000003456 sulfonamides Chemical class 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 179
- 235000019441 ethanol Nutrition 0.000 description 66
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 42
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 38
- 239000000243 solution Substances 0.000 description 36
- XLTPBSBNLKQLHB-UHFFFAOYSA-N ethyl 3-amino-3-ethoxyprop-2-enoate Chemical compound CCOC(N)=CC(=O)OCC XLTPBSBNLKQLHB-UHFFFAOYSA-N 0.000 description 29
- 229910052757 nitrogen Inorganic materials 0.000 description 23
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- 239000002244 precipitate Substances 0.000 description 18
- 238000003756 stirring Methods 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 16
- 125000004432 carbon atom Chemical group C* 0.000 description 16
- 150000001875 compounds Chemical class 0.000 description 16
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 14
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- 239000000203 mixture Substances 0.000 description 12
- 241001465754 Metazoa Species 0.000 description 10
- 239000002904 solvent Substances 0.000 description 10
- 241000700159 Rattus Species 0.000 description 9
- 239000013078 crystal Substances 0.000 description 9
- 230000029142 excretion Effects 0.000 description 9
- 239000011734 sodium Substances 0.000 description 9
- KLSJWNVTNUYHDU-UHFFFAOYSA-N Amitrole Chemical compound NC1=NC=NN1 KLSJWNVTNUYHDU-UHFFFAOYSA-N 0.000 description 8
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 8
- MLIREBYILWEBDM-UHFFFAOYSA-N cyanoacetic acid Chemical class OC(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-N 0.000 description 8
- 150000003839 salts Chemical class 0.000 description 8
- 229910052708 sodium Inorganic materials 0.000 description 8
- 235000015424 sodium Nutrition 0.000 description 8
- 239000000047 product Substances 0.000 description 7
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 235000011121 sodium hydroxide Nutrition 0.000 description 6
- 241000282472 Canis lupus familiaris Species 0.000 description 5
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 5
- 239000004480 active ingredient Substances 0.000 description 5
- 239000003792 electrolyte Substances 0.000 description 5
- 125000004494 ethyl ester group Chemical group 0.000 description 5
- 239000011591 potassium Substances 0.000 description 5
- 229910052700 potassium Inorganic materials 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- YTLYLLTVENPWFT-UHFFFAOYSA-N 3-aminoprop-2-enoic acid Chemical class NC=CC(O)=O YTLYLLTVENPWFT-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 150000001408 amides Chemical class 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 230000008030 elimination Effects 0.000 description 4
- 238000003379 elimination reaction Methods 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 230000000894 saliuretic effect Effects 0.000 description 4
- 210000002700 urine Anatomy 0.000 description 4
- SABLROJJEJTWTE-UHFFFAOYSA-N (4-bromophenyl)methylhydrazine Chemical compound NNCC1=CC=C(Br)C=C1 SABLROJJEJTWTE-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 125000003580 L-valyl group Chemical group [H]N([H])[C@]([H])(C(=O)[*])C(C([H])([H])[H])(C([H])([H])[H])[H] 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000012670 alkaline solution Substances 0.000 description 3
- 230000003276 anti-hypertensive effect Effects 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 230000037396 body weight Effects 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 239000003610 charcoal Substances 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- ZIUSEGSNTOUIPT-UHFFFAOYSA-N ethyl 2-cyanoacetate Chemical compound CCOC(=O)CC#N ZIUSEGSNTOUIPT-UHFFFAOYSA-N 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 230000004526 pharmaceutical effect Effects 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 230000000630 rising effect Effects 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 239000003826 tablet Substances 0.000 description 3
- 239000000454 talc Substances 0.000 description 3
- 235000012222 talc Nutrition 0.000 description 3
- 229910052623 talc Inorganic materials 0.000 description 3
- QSARTMGKCJEEOA-UHFFFAOYSA-N (2,4,5-trichlorophenyl)methylhydrazine Chemical compound NNCC1=CC(Cl)=C(Cl)C=C1Cl QSARTMGKCJEEOA-UHFFFAOYSA-N 0.000 description 2
- QKUSRPMMOKELAO-UHFFFAOYSA-N (2,4-dimethylphenyl)methylhydrazine Chemical compound CC1=CC=C(CNN)C(C)=C1 QKUSRPMMOKELAO-UHFFFAOYSA-N 0.000 description 2
- KJOOVLJGVFOGOL-UHFFFAOYSA-N (2,5-dimethylphenyl)methylhydrazine Chemical compound CC1=CC=C(C)C(CNN)=C1 KJOOVLJGVFOGOL-UHFFFAOYSA-N 0.000 description 2
- OHOLTPDWHLBTJD-UHFFFAOYSA-N (2-bromophenyl)methylhydrazine Chemical compound NNCC1=CC=CC=C1Br OHOLTPDWHLBTJD-UHFFFAOYSA-N 0.000 description 2
- MYNJXMGVVBFZHF-UHFFFAOYSA-N (2-chloro-4-fluorophenyl)methylhydrazine Chemical compound NNCC1=CC=C(F)C=C1Cl MYNJXMGVVBFZHF-UHFFFAOYSA-N 0.000 description 2
- IXRQTCDPQZMNSN-UHFFFAOYSA-N (2-methylphenyl)methylhydrazine Chemical compound CC1=CC=CC=C1CNN IXRQTCDPQZMNSN-UHFFFAOYSA-N 0.000 description 2
- YKYYWSASOAPYST-UHFFFAOYSA-N (3,4-dimethylphenyl)methylhydrazine Chemical compound CC1=CC=C(CNN)C=C1C YKYYWSASOAPYST-UHFFFAOYSA-N 0.000 description 2
- ZUFKJOBIQWYVSA-UHFFFAOYSA-N (3-bromo-4-chlorophenyl)methylhydrazine Chemical compound NNCC1=CC=C(Cl)C(Br)=C1 ZUFKJOBIQWYVSA-UHFFFAOYSA-N 0.000 description 2
- VUJAAGDKMIUIFQ-UHFFFAOYSA-N (3-bromophenyl)methylhydrazine Chemical compound NNCC1=CC=CC(Br)=C1 VUJAAGDKMIUIFQ-UHFFFAOYSA-N 0.000 description 2
- VOCCPRCLJDTWEH-UHFFFAOYSA-N (3-chloro-4-methylphenyl)methylhydrazine Chemical compound CC1=CC=C(CNN)C=C1Cl VOCCPRCLJDTWEH-UHFFFAOYSA-N 0.000 description 2
- PUAGXICSGKDMTF-UHFFFAOYSA-N (3-iodophenyl)methylhydrazine Chemical compound NNCC1=CC=CC(I)=C1 PUAGXICSGKDMTF-UHFFFAOYSA-N 0.000 description 2
- LRDZBVAFUXSPGH-UHFFFAOYSA-N (3-methylphenyl)methylhydrazine Chemical compound CC1=CC=CC(CNN)=C1 LRDZBVAFUXSPGH-UHFFFAOYSA-N 0.000 description 2
- UVLKAHYGKLRXON-UHFFFAOYSA-N (3-nitrophenyl)methylhydrazine Chemical compound NNCC1=CC=CC([N+]([O-])=O)=C1 UVLKAHYGKLRXON-UHFFFAOYSA-N 0.000 description 2
- KWZJFFIYJILLRX-UHFFFAOYSA-N (4-bromo-3-chlorophenyl)methylhydrazine Chemical compound NNCC1=CC=C(Br)C(Cl)=C1 KWZJFFIYJILLRX-UHFFFAOYSA-N 0.000 description 2
- HNSMCIGVJAAADX-UHFFFAOYSA-N (4-chloro-3-methoxyphenyl)methylhydrazine Chemical compound COC1=CC(CNN)=CC=C1Cl HNSMCIGVJAAADX-UHFFFAOYSA-N 0.000 description 2
- TYDHJVQGBWGEPT-UHFFFAOYSA-N (4-chloro-3-methylphenyl)methylhydrazine Chemical compound CC1=CC(CNN)=CC=C1Cl TYDHJVQGBWGEPT-UHFFFAOYSA-N 0.000 description 2
- JRBYEYSVCBDBQO-UHFFFAOYSA-N (4-iodophenyl)methylhydrazine Chemical compound NNCC1=CC=C(I)C=C1 JRBYEYSVCBDBQO-UHFFFAOYSA-N 0.000 description 2
- XPBBLOVWHBLPMK-UHFFFAOYSA-N (4-methylphenyl)methylhydrazine Chemical compound CC1=CC=C(CNN)C=C1 XPBBLOVWHBLPMK-UHFFFAOYSA-N 0.000 description 2
- XUPNPQDJSZKHLN-UHFFFAOYSA-N (4-nitrophenyl)methylhydrazine Chemical compound NNCC1=CC=C([N+]([O-])=O)C=C1 XUPNPQDJSZKHLN-UHFFFAOYSA-N 0.000 description 2
- GCDLQAOATMBBDF-UHFFFAOYSA-N (4-phenylphenyl)methylhydrazine Chemical compound C1=CC(CNN)=CC=C1C1=CC=CC=C1 GCDLQAOATMBBDF-UHFFFAOYSA-N 0.000 description 2
- HWYNHHNNZIWSAA-UHFFFAOYSA-N (4-propan-2-ylphenyl)methylhydrazine Chemical compound CC(C)C1=CC=C(CNN)C=C1 HWYNHHNNZIWSAA-UHFFFAOYSA-N 0.000 description 2
- DXWPGWVZIREAMJ-UHFFFAOYSA-N (8-chloronaphthalen-2-yl)methylhydrazine Chemical compound C1=CC=C(Cl)C2=CC(CNN)=CC=C21 DXWPGWVZIREAMJ-UHFFFAOYSA-N 0.000 description 2
- SNBIXINOMWMLIV-UHFFFAOYSA-N 1,3-benzodioxol-5-ylmethylhydrazine Chemical compound NNCC1=CC=C2OCOC2=C1 SNBIXINOMWMLIV-UHFFFAOYSA-N 0.000 description 2
- DIWDIDLCINRQFW-UHFFFAOYSA-N 2,3-dihydro-1h-inden-5-ylmethylhydrazine Chemical compound NNCC1=CC=C2CCCC2=C1 DIWDIDLCINRQFW-UHFFFAOYSA-N 0.000 description 2
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 2
- 125000006281 4-bromobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Br)C([H])([H])* 0.000 description 2
- 241000416162 Astragalus gummifer Species 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 229920001615 Tragacanth Polymers 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 235000013312 flour Nutrition 0.000 description 2
- 238000003304 gavage Methods 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 210000003097 mucus Anatomy 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 230000001376 precipitating effect Effects 0.000 description 2
- 239000011435 rock Substances 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 239000000196 tragacanth Substances 0.000 description 2
- 235000010487 tragacanth Nutrition 0.000 description 2
- 229940116362 tragacanth Drugs 0.000 description 2
- OOMBRKGIWITBLL-UHFFFAOYSA-N (2-fluorophenyl)methylhydrazine Chemical compound NNCC1=CC=CC=C1F OOMBRKGIWITBLL-UHFFFAOYSA-N 0.000 description 1
- FSPHMABFSTZECX-UHFFFAOYSA-N (2-nitrophenyl)methylhydrazine Chemical compound NNCC1=CC=CC=C1[N+]([O-])=O FSPHMABFSTZECX-UHFFFAOYSA-N 0.000 description 1
- VGVVXPMCVIYNOR-UHFFFAOYSA-N (2-phenylphenyl)methylhydrazine Chemical compound NNCC1=CC=CC=C1C1=CC=CC=C1 VGVVXPMCVIYNOR-UHFFFAOYSA-N 0.000 description 1
- LDDMACCNBZAMSG-BDVNFPICSA-N (2r,3r,4s,5r)-3,4,5,6-tetrahydroxy-2-(methylamino)hexanal Chemical compound CN[C@@H](C=O)[C@@H](O)[C@H](O)[C@H](O)CO LDDMACCNBZAMSG-BDVNFPICSA-N 0.000 description 1
- LGYQGASEWMVLDF-UHFFFAOYSA-N (3,4-dibromophenyl)methylhydrazine Chemical compound NNCC1=CC=C(Br)C(Br)=C1 LGYQGASEWMVLDF-UHFFFAOYSA-N 0.000 description 1
- SHPDODKNJXUWPF-UHFFFAOYSA-N (3,4-dimethoxyphenyl)methylhydrazine Chemical compound COC1=CC=C(CNN)C=C1OC SHPDODKNJXUWPF-UHFFFAOYSA-N 0.000 description 1
- CYMHZIZPJZFOTR-UHFFFAOYSA-N (3,5-dimethoxyphenyl)methylhydrazine Chemical compound COC1=CC(CNN)=CC(OC)=C1 CYMHZIZPJZFOTR-UHFFFAOYSA-N 0.000 description 1
- MZXKPOZJHCLRMO-UHFFFAOYSA-N (3-butoxy-4-chlorophenyl)methylhydrazine Chemical compound CCCCOC1=CC(CNN)=CC=C1Cl MZXKPOZJHCLRMO-UHFFFAOYSA-N 0.000 description 1
- FQAZMGYQHZYAQR-UHFFFAOYSA-N (3-butoxyphenyl)methylhydrazine Chemical compound CCCCOC1=CC=CC(CNN)=C1 FQAZMGYQHZYAQR-UHFFFAOYSA-N 0.000 description 1
- ASENFBZXONPFCN-UHFFFAOYSA-N (3-ethoxyphenyl)methylhydrazine Chemical compound CCOC1=CC=CC(CNN)=C1 ASENFBZXONPFCN-UHFFFAOYSA-N 0.000 description 1
- NRAZPMKRDZYKGM-UHFFFAOYSA-N (3-ethylphenyl)methylhydrazine Chemical compound CCC1=CC=CC(CNN)=C1 NRAZPMKRDZYKGM-UHFFFAOYSA-N 0.000 description 1
- SAVAJKHGIQLPDD-UHFFFAOYSA-N (3-fluorophenyl)methylhydrazine Chemical compound NNCC1=CC=CC(F)=C1 SAVAJKHGIQLPDD-UHFFFAOYSA-N 0.000 description 1
- HSSFJJMCNKPKPA-UHFFFAOYSA-N (3-methyl-4-nitrophenyl)methylhydrazine Chemical compound CC1=CC(CNN)=CC=C1[N+]([O-])=O HSSFJJMCNKPKPA-UHFFFAOYSA-N 0.000 description 1
- XAORWJJKXUCVQP-UHFFFAOYSA-N (3-methyl-4-propylphenyl)methylhydrazine Chemical compound CCCC1=CC=C(CNN)C=C1C XAORWJJKXUCVQP-UHFFFAOYSA-N 0.000 description 1
- IZSXKLRDDQUEGY-UHFFFAOYSA-N (3-propylphenyl)methylhydrazine Chemical compound CCCC1=CC=CC(CNN)=C1 IZSXKLRDDQUEGY-UHFFFAOYSA-N 0.000 description 1
- IAFCITUSAGIDIH-UHFFFAOYSA-N (4-butoxyphenyl)methylhydrazine Chemical compound CCCCOC1=CC=C(CNN)C=C1 IAFCITUSAGIDIH-UHFFFAOYSA-N 0.000 description 1
- PTFHUJCUFFSGIA-UHFFFAOYSA-N (4-butylphenyl)methylhydrazine Chemical compound CCCCC1=CC=C(CNN)C=C1 PTFHUJCUFFSGIA-UHFFFAOYSA-N 0.000 description 1
- UJNAKSGWJUMFGS-UHFFFAOYSA-N (4-cyclohexylphenyl)methylhydrazine Chemical compound C1=CC(CNN)=CC=C1C1CCCCC1 UJNAKSGWJUMFGS-UHFFFAOYSA-N 0.000 description 1
- KYPDQHKRVGZWIW-UHFFFAOYSA-N (4-cyclopentylphenyl)methylhydrazine Chemical compound C1=CC(CNN)=CC=C1C1CCCC1 KYPDQHKRVGZWIW-UHFFFAOYSA-N 0.000 description 1
- IMFPJNQRKQGLCV-UHFFFAOYSA-N (4-ethenylphenyl)methylhydrazine Chemical compound NNCC1=CC=C(C=C)C=C1 IMFPJNQRKQGLCV-UHFFFAOYSA-N 0.000 description 1
- YUBWRJFBZNBNKZ-UHFFFAOYSA-N (4-ethylphenyl)methylhydrazine Chemical compound CCC1=CC=C(CNN)C=C1 YUBWRJFBZNBNKZ-UHFFFAOYSA-N 0.000 description 1
- NJYCYWYPGDTHCV-UHFFFAOYSA-N (4-ethylsulfonylphenyl)methylhydrazine Chemical compound CCS(=O)(=O)C1=CC=C(CNN)C=C1 NJYCYWYPGDTHCV-UHFFFAOYSA-N 0.000 description 1
- YMMCBGIHBVKZGD-UHFFFAOYSA-N (4-fluorophenyl)methylhydrazine Chemical compound NNCC1=CC=C(F)C=C1 YMMCBGIHBVKZGD-UHFFFAOYSA-N 0.000 description 1
- BOEOTSIOHJVDKI-UHFFFAOYSA-N (4-methylsulfanylphenyl)methylhydrazine Chemical compound CSC1=CC=C(CNN)C=C1 BOEOTSIOHJVDKI-UHFFFAOYSA-N 0.000 description 1
- FHCLSOWEUAPQHY-UHFFFAOYSA-N (4-propylphenyl)methylhydrazine Chemical compound CCCC1=CC=C(CNN)C=C1 FHCLSOWEUAPQHY-UHFFFAOYSA-N 0.000 description 1
- GJTGRQOXODWYEA-UHFFFAOYSA-N (4-tert-butylphenyl)methylhydrazine Chemical compound CC(C)(C)C1=CC=C(CNN)C=C1 GJTGRQOXODWYEA-UHFFFAOYSA-N 0.000 description 1
- XVIBUTVRALYGDZ-UHFFFAOYSA-N (5-chloro-2-fluorophenyl)methylhydrazine Chemical compound NNCC1=CC(Cl)=CC=C1F XVIBUTVRALYGDZ-UHFFFAOYSA-N 0.000 description 1
- RZMPENJSZQTSJY-UHFFFAOYSA-N (5-chloronaphthalen-2-yl)methylhydrazine Chemical compound ClC1=CC=CC2=CC(CNN)=CC=C21 RZMPENJSZQTSJY-UHFFFAOYSA-N 0.000 description 1
- BHVZGVVAWDHRRI-UHFFFAOYSA-N (5-methylnaphthalen-2-yl)methylhydrazine Chemical compound NNCC1=CC=C2C(C)=CC=CC2=C1 BHVZGVVAWDHRRI-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- 125000006184 2,5-dimethyl benzyl group Chemical group [H]C1=C(C([H])=C(C(=C1[H])C([H])([H])[H])C([H])([H])*)C([H])([H])[H] 0.000 description 1
- MSWZFWKMSRAUBD-IVMDWMLBSA-N 2-amino-2-deoxy-D-glucopyranose Chemical compound N[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O MSWZFWKMSRAUBD-IVMDWMLBSA-N 0.000 description 1
- LIHUTSFYFGCWQP-UHFFFAOYSA-N 2-cyano-n-methylacetamide Chemical compound CNC(=O)CC#N LIHUTSFYFGCWQP-UHFFFAOYSA-N 0.000 description 1
- MLIREBYILWEBDM-UHFFFAOYSA-M 2-cyanoacetate Chemical compound [O-]C(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-M 0.000 description 1
- HRGQEKKNLHJZGZ-UHFFFAOYSA-N 2-methylpropyl 2-cyanoacetate Chemical compound CC(C)COC(=O)CC#N HRGQEKKNLHJZGZ-UHFFFAOYSA-N 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- 125000006186 3,5-dimethyl benzyl group Chemical group [H]C1=C(C([H])=C(C([H])=C1C([H])([H])[H])C([H])([H])*)C([H])([H])[H] 0.000 description 1
- DXDXOQIXPHKNSS-UHFFFAOYSA-N 3-(hydrazinylmethyl)benzonitrile Chemical compound NNCC1=CC=CC(C#N)=C1 DXDXOQIXPHKNSS-UHFFFAOYSA-N 0.000 description 1
- 125000006506 3-phenyl benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C1=C([H])C([H])=C([H])C(=C1[H])C([H])([H])* 0.000 description 1
- JHFFTOFJKVYZIN-UHFFFAOYSA-N 4-(hydrazinylmethyl)-n,n-dimethyl-3-nitroaniline Chemical compound CN(C)C1=CC=C(CNN)C([N+]([O-])=O)=C1 JHFFTOFJKVYZIN-UHFFFAOYSA-N 0.000 description 1
- IFFKJNUVHWQCCD-UHFFFAOYSA-N 4-(hydrazinylmethyl)benzonitrile Chemical compound NNCC1=CC=C(C#N)C=C1 IFFKJNUVHWQCCD-UHFFFAOYSA-N 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- 125000004176 4-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1F)C([H])([H])* 0.000 description 1
- 125000006181 4-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000006189 4-phenyl benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000000173 4-trifluoromethoxy benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC(F)(F)F)C([H])([H])* 0.000 description 1
- PCMKHXJELWVAJX-UHFFFAOYSA-N 5,6,7,8-tetrahydronaphthalen-2-ylmethylhydrazine Chemical compound C1CCCC2=CC(CNN)=CC=C21 PCMKHXJELWVAJX-UHFFFAOYSA-N 0.000 description 1
- NWFMLTDYTVORTE-UHFFFAOYSA-N 5-(hydrazinylmethyl)-2-methylbenzonitrile Chemical compound CC1=CC=C(CNN)C=C1C#N NWFMLTDYTVORTE-UHFFFAOYSA-N 0.000 description 1
- 125000003341 7 membered heterocyclic group Chemical group 0.000 description 1
- KNIUHBNRWZGIQQ-UHFFFAOYSA-N 7-diethoxyphosphinothioyloxy-4-methylchromen-2-one Chemical compound CC1=CC(=O)OC2=CC(OP(=S)(OCC)OCC)=CC=C21 KNIUHBNRWZGIQQ-UHFFFAOYSA-N 0.000 description 1
- 208000009304 Acute Kidney Injury Diseases 0.000 description 1
- 240000002470 Amphicarpaea bracteata Species 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 1
- 239000004097 EU approved flavor enhancer Substances 0.000 description 1
- 240000006927 Foeniculum vulgare Species 0.000 description 1
- 235000004204 Foeniculum vulgare Nutrition 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Chemical compound OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 208000029422 Hypernatremia Diseases 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Chemical compound OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- RYSHIRFTLKZVIH-UHFFFAOYSA-N N,N-diethylcyanoacetamide Chemical compound CCN(CC)C(=O)CC#N RYSHIRFTLKZVIH-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 208000004880 Polyuria Diseases 0.000 description 1
- 208000033626 Renal failure acute Diseases 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- WSVNAEBTPXQQIC-UHFFFAOYSA-N [3,4-bis(trifluoromethyl)phenyl]methylhydrazine Chemical compound NNCC1=CC=C(C(F)(F)F)C(C(F)(F)F)=C1 WSVNAEBTPXQQIC-UHFFFAOYSA-N 0.000 description 1
- QJRVPVVWFCVSNK-UHFFFAOYSA-N [3-(trifluoromethoxy)phenyl]methylhydrazine Chemical compound NNCC1=CC=CC(OC(F)(F)F)=C1 QJRVPVVWFCVSNK-UHFFFAOYSA-N 0.000 description 1
- YIEHYUWXQDSGJW-UHFFFAOYSA-N [3-chloro-4-(trifluoromethyl)phenyl]methylhydrazine Chemical compound NNCC1=CC=C(C(F)(F)F)C(Cl)=C1 YIEHYUWXQDSGJW-UHFFFAOYSA-N 0.000 description 1
- HPDPZIBXSGZASF-UHFFFAOYSA-N [3-methyl-4-(trifluoromethyl)phenyl]methylhydrazine Chemical compound CC1=CC(CNN)=CC=C1C(F)(F)F HPDPZIBXSGZASF-UHFFFAOYSA-N 0.000 description 1
- LMOJTOUJQZZTDN-UHFFFAOYSA-N [4-(2-methylpropyl)phenyl]methylhydrazine Chemical compound CC(C)CC1=CC=C(CNN)C=C1 LMOJTOUJQZZTDN-UHFFFAOYSA-N 0.000 description 1
- TVQQKOLNFGDRKY-UHFFFAOYSA-N [4-(trifluoromethoxy)phenyl]methylhydrazine Chemical compound NNCC1=CC=C(OC(F)(F)F)C=C1 TVQQKOLNFGDRKY-UHFFFAOYSA-N 0.000 description 1
- QYZCPOGLBTUVLP-UHFFFAOYSA-N [4-chloro-3-(trifluoromethyl)phenyl]methylhydrazine Chemical compound NNCC1=CC=C(Cl)C(C(F)(F)F)=C1 QYZCPOGLBTUVLP-UHFFFAOYSA-N 0.000 description 1
- YAHOLCQIHIHSRM-UHFFFAOYSA-N [4-methyl-3-(trifluoromethyl)phenyl]methylhydrazine Chemical compound CC1=CC=C(CNN)C=C1C(F)(F)F YAHOLCQIHIHSRM-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000008186 active pharmaceutical agent Substances 0.000 description 1
- 201000011040 acute kidney failure Diseases 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 229940051880 analgesics and antipyretics pyrazolones Drugs 0.000 description 1
- HOPRXXXSABQWAV-UHFFFAOYSA-N anhydrous collidine Natural products CC1=CC=NC(C)=C1C HOPRXXXSABQWAV-UHFFFAOYSA-N 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 229940127088 antihypertensive drug Drugs 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- RCUIWQWWDLZNMS-UHFFFAOYSA-N benzyl 2-cyanoacetate Chemical compound N#CCC(=O)OCC1=CC=CC=C1 RCUIWQWWDLZNMS-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- MSWZFWKMSRAUBD-UHFFFAOYSA-N beta-D-galactosamine Natural products NC1C(O)OC(CO)C(O)C1O MSWZFWKMSRAUBD-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- DJACTCNGCHPGOI-UHFFFAOYSA-N butyl 2-cyanoacetate Chemical compound CCCCOC(=O)CC#N DJACTCNGCHPGOI-UHFFFAOYSA-N 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 125000005521 carbonamide group Chemical group 0.000 description 1
- UTBIMNXEDGNJFE-UHFFFAOYSA-N collidine Natural products CC1=CC=C(C)C(C)=N1 UTBIMNXEDGNJFE-UHFFFAOYSA-N 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- DGJMPUGMZIKDRO-UHFFFAOYSA-N cyanoacetamide Chemical compound NC(=O)CC#N DGJMPUGMZIKDRO-UHFFFAOYSA-N 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 1
- 229940113088 dimethylacetamide Drugs 0.000 description 1
- HPYNZHMRTTWQTB-UHFFFAOYSA-N dimethylpyridine Natural products CC1=CC=CN=C1C HPYNZHMRTTWQTB-UHFFFAOYSA-N 0.000 description 1
- 230000035619 diuresis Effects 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 230000002497 edematous effect Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000005048 flame photometry Methods 0.000 description 1
- 235000019264 food flavour enhancer Nutrition 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 229960002442 glucosamine Drugs 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- PWKKBTPSCGLYBR-UHFFFAOYSA-N hexyl 2-cyanoacetate Chemical compound CCCCCCOC(=O)CC#N PWKKBTPSCGLYBR-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 159000000014 iron salts Chemical class 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- ANGDWNBGPBMQHW-UHFFFAOYSA-N methyl cyanoacetate Chemical compound COC(=O)CC#N ANGDWNBGPBMQHW-UHFFFAOYSA-N 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 230000027939 micturition Effects 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- MGZNARROBKPUST-UHFFFAOYSA-N n-butyl-2-cyanoacetamide Chemical compound CCCCNC(=O)CC#N MGZNARROBKPUST-UHFFFAOYSA-N 0.000 description 1
- VWAKMCBHVWHZAL-UHFFFAOYSA-N naphthalen-2-ylmethylhydrazine Chemical compound C1=CC=CC2=CC(CNN)=CC=C21 VWAKMCBHVWHZAL-UHFFFAOYSA-N 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- BUKHSQBUKZIMLB-UHFFFAOYSA-L potassium;sodium;dichloride Chemical compound [Na+].[Cl-].[Cl-].[K+] BUKHSQBUKZIMLB-UHFFFAOYSA-L 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical class CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- BESQLCCRQYTQQI-UHFFFAOYSA-N propan-2-yl 2-cyanoacetate Chemical compound CC(C)OC(=O)CC#N BESQLCCRQYTQQI-UHFFFAOYSA-N 0.000 description 1
- NLFIMXLLXGTDME-UHFFFAOYSA-N propyl 2-cyanoacetate Chemical compound CCCOC(=O)CC#N NLFIMXLLXGTDME-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001226 reprecipitation Methods 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 125000001174 sulfone group Chemical group 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- GFYHSKONPJXCDE-UHFFFAOYSA-N sym-collidine Natural products CC1=CN=C(C)C(C)=C1 GFYHSKONPJXCDE-UHFFFAOYSA-N 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D231/44—Oxygen and nitrogen or sulfur and nitrogen atoms
- C07D231/52—Oxygen atom in position 3 and nitrogen atom in position 5, or vice versa
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Priority Applications (33)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2230792A DE2230792A1 (de) | 1972-06-23 | 1972-06-23 | 3-amino-pyrazolone-(5), verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| RO7375048A RO71819A (ro) | 1972-06-23 | 1973-06-06 | Procedeu pentru prepararea de 3-amino-pirazolone-(5) |
| AU57051/73A AU478915B2 (en) | 1973-06-18 | 3-amino-pyrazolones-(5) processes for their manufacture and their use as medicines | |
| BG023919A BG22819A3 (bg) | 1972-06-23 | 1973-06-19 | Метод за получаване на 3--амино-пиразолони-(5) |
| NL7308575A NL7308575A (enExample) | 1972-06-23 | 1973-06-20 | |
| SE7308721A SE401181B (sv) | 1972-06-23 | 1973-06-20 | Sett att framstella nya 3-aminopyrazolon-(5)-er avsedda att anvendas som lekemedel |
| AT544673A AT323735B (de) | 1972-06-23 | 1973-06-20 | Verfahren zur herstellung von neuen 3-amino-pyrazolonen-(5) und ihren salzen |
| CH897973A CH592632A5 (enExample) | 1972-06-23 | 1973-06-20 | |
| IL42560A IL42560A (en) | 1972-06-23 | 1973-06-20 | 1 - ethylmethyl - 3 - amino - pyrazole - 5 - helium and their salts and process for their production |
| SU1938995A SU472503A3 (ru) | 1972-06-23 | 1973-06-20 | Способ получени производных 3аминопиразолона-5 |
| LU67854A LU67854A1 (enExample) | 1972-06-23 | 1973-06-21 | |
| EG235/73A EG11039A (en) | 1972-06-23 | 1973-06-21 | Method for preparation of 3-pyrazol-5-one bayer ag |
| DD171728A DD109874A5 (enExample) | 1972-06-23 | 1973-06-21 | |
| JP48069262A JPS4962463A (enExample) | 1972-06-23 | 1973-06-21 | |
| BE132533A BE801228A (fr) | 1972-06-23 | 1973-06-21 | Nouvelles 3-amino-pyrazolones-(5) leur procede de preparation et medicaments les contenant |
| OA54946A OA04432A (fr) | 1972-06-23 | 1973-06-22 | Procédé de préparation de 3-amino-pyrazolones-(5). |
| FR7322955A FR2189072B1 (enExample) | 1972-06-23 | 1973-06-22 | |
| ES416167A ES416167A1 (es) | 1972-06-23 | 1973-06-22 | Procedimiento para la produccion de 3-amino-pirazolonas- (5). |
| DK349573A DK133468C (da) | 1972-06-23 | 1973-06-22 | Analogifremgangsmade til fremstilling af 1-benzyl-3-amino-pyrazoloner-(5). |
| HUBA2942A HU168358B (enExample) | 1972-06-23 | 1973-06-22 | |
| CA174,778A CA1017752A (en) | 1972-06-23 | 1973-06-22 | 1-substituted-3-amino-pyrazol-5-ones |
| AR248701A AR205329A1 (es) | 1972-06-23 | 1973-06-22 | Procedimiento para la produccion de nuevas o-aminopirazolonas-(5) |
| ZA734244A ZA734244B (en) | 1972-06-23 | 1973-06-22 | 3-amino-pyrazol-5-ones,processes for their manufacture and their use as medicines |
| IE1035/73A IE37834B1 (en) | 1972-06-23 | 1973-06-22 | 3-amino-pyrazolones-(5),processes for their manufacture and their use as medicines |
| GB2978573A GB1391051A (en) | 1972-06-23 | 1973-06-22 | 3-amino-pyrazolones-5, processes for their manufacture and their use as medicines |
| NO2618/73A NO137196C (no) | 1972-06-23 | 1973-06-22 | Analogifremgangsm}te til fremstilling av terapeutisk aktive 1-benzyl-3-amino-pyrazoloner-(5) |
| PL1973163511A PL87665B1 (enExample) | 1972-06-23 | 1973-06-22 | |
| KR7301005A KR780000147B1 (en) | 1972-06-23 | 1973-06-23 | Processes for the manufacture of 3-amino-pyrazolones-(5) and their use as medicine |
| US05/515,448 US3950528A (en) | 1972-06-23 | 1974-10-17 | 1-Substituted-3-amino-pyrazol-5-ones |
| PH16674A PH11606A (en) | 1972-06-23 | 1975-01-03 | Method for treating oedematus,hypertonic conditions and acute renal failure using 1-substituted-3-amino pyrazol-5-ones |
| US05/637,861 US4061653A (en) | 1972-06-23 | 1975-12-04 | 1-Substituted-3-amino-pyrazol-5-ones |
| HK112/76*UA HK11276A (en) | 1972-06-23 | 1976-03-04 | 3-amino-pyrazolones-(5), processes for their manufacture and their use as medicines |
| US05/756,179 US4076943A (en) | 1972-06-23 | 1977-01-03 | 1-Substituted-3-amino-pyrazol-5-ones |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2230792A DE2230792A1 (de) | 1972-06-23 | 1972-06-23 | 3-amino-pyrazolone-(5), verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2230792A1 true DE2230792A1 (de) | 1974-01-17 |
Family
ID=5848604
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2230792A Withdrawn DE2230792A1 (de) | 1972-06-23 | 1972-06-23 | 3-amino-pyrazolone-(5), verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
Country Status (29)
| Country | Link |
|---|---|
| JP (1) | JPS4962463A (enExample) |
| KR (1) | KR780000147B1 (enExample) |
| AR (1) | AR205329A1 (enExample) |
| AT (1) | AT323735B (enExample) |
| BE (1) | BE801228A (enExample) |
| BG (1) | BG22819A3 (enExample) |
| CA (1) | CA1017752A (enExample) |
| CH (1) | CH592632A5 (enExample) |
| DD (1) | DD109874A5 (enExample) |
| DE (1) | DE2230792A1 (enExample) |
| DK (1) | DK133468C (enExample) |
| EG (1) | EG11039A (enExample) |
| ES (1) | ES416167A1 (enExample) |
| FR (1) | FR2189072B1 (enExample) |
| GB (1) | GB1391051A (enExample) |
| HK (1) | HK11276A (enExample) |
| HU (1) | HU168358B (enExample) |
| IE (1) | IE37834B1 (enExample) |
| IL (1) | IL42560A (enExample) |
| LU (1) | LU67854A1 (enExample) |
| NL (1) | NL7308575A (enExample) |
| NO (1) | NO137196C (enExample) |
| OA (1) | OA04432A (enExample) |
| PH (1) | PH11606A (enExample) |
| PL (1) | PL87665B1 (enExample) |
| RO (1) | RO71819A (enExample) |
| SE (1) | SE401181B (enExample) |
| SU (1) | SU472503A3 (enExample) |
| ZA (1) | ZA734244B (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USRE30420E (en) * | 1973-04-17 | 1980-10-21 | Bayer Aktiengesellschaft | Pyrazol-5-ones |
| US4288446A (en) * | 1973-04-17 | 1981-09-08 | Bayer Aktiengesellschaft | Pyrazol-5-ones |
| EP0180707A1 (de) * | 1984-10-04 | 1986-05-14 | Bayer Ag | Verfahren zur Herstellung von Muzolimin |
-
1972
- 1972-06-23 DE DE2230792A patent/DE2230792A1/de not_active Withdrawn
-
1973
- 1973-06-06 RO RO7375048A patent/RO71819A/ro unknown
- 1973-06-19 BG BG023919A patent/BG22819A3/xx unknown
- 1973-06-20 SE SE7308721A patent/SE401181B/xx unknown
- 1973-06-20 CH CH897973A patent/CH592632A5/xx not_active IP Right Cessation
- 1973-06-20 IL IL42560A patent/IL42560A/en unknown
- 1973-06-20 AT AT544673A patent/AT323735B/de not_active IP Right Cessation
- 1973-06-20 NL NL7308575A patent/NL7308575A/xx not_active Application Discontinuation
- 1973-06-20 SU SU1938995A patent/SU472503A3/ru active
- 1973-06-21 JP JP48069262A patent/JPS4962463A/ja active Pending
- 1973-06-21 DD DD171728A patent/DD109874A5/xx unknown
- 1973-06-21 LU LU67854A patent/LU67854A1/xx unknown
- 1973-06-21 BE BE132533A patent/BE801228A/xx unknown
- 1973-06-21 EG EG235/73A patent/EG11039A/xx active
- 1973-06-22 HU HUBA2942A patent/HU168358B/hu unknown
- 1973-06-22 AR AR248701A patent/AR205329A1/es active
- 1973-06-22 OA OA54946A patent/OA04432A/xx unknown
- 1973-06-22 GB GB2978573A patent/GB1391051A/en not_active Expired
- 1973-06-22 CA CA174,778A patent/CA1017752A/en not_active Expired
- 1973-06-22 FR FR7322955A patent/FR2189072B1/fr not_active Expired
- 1973-06-22 DK DK349573A patent/DK133468C/da active
- 1973-06-22 IE IE1035/73A patent/IE37834B1/xx unknown
- 1973-06-22 PL PL1973163511A patent/PL87665B1/pl unknown
- 1973-06-22 ZA ZA734244A patent/ZA734244B/xx unknown
- 1973-06-22 NO NO2618/73A patent/NO137196C/no unknown
- 1973-06-22 ES ES416167A patent/ES416167A1/es not_active Expired
- 1973-06-23 KR KR7301005A patent/KR780000147B1/ko not_active Expired
-
1975
- 1975-01-03 PH PH16674A patent/PH11606A/en unknown
-
1976
- 1976-03-04 HK HK112/76*UA patent/HK11276A/xx unknown
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USRE30420E (en) * | 1973-04-17 | 1980-10-21 | Bayer Aktiengesellschaft | Pyrazol-5-ones |
| US4288446A (en) * | 1973-04-17 | 1981-09-08 | Bayer Aktiengesellschaft | Pyrazol-5-ones |
| EP0180707A1 (de) * | 1984-10-04 | 1986-05-14 | Bayer Ag | Verfahren zur Herstellung von Muzolimin |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1391051A (en) | 1975-04-16 |
| IE37834L (en) | 1973-12-23 |
| NL7308575A (enExample) | 1973-12-27 |
| HU168358B (enExample) | 1976-04-28 |
| KR780000147B1 (en) | 1978-04-19 |
| SE401181B (sv) | 1978-04-24 |
| IL42560A0 (en) | 1973-08-29 |
| DK133468C (da) | 1976-10-18 |
| FR2189072B1 (enExample) | 1977-09-09 |
| AT323735B (de) | 1975-07-25 |
| IL42560A (en) | 1977-05-31 |
| ES416167A1 (es) | 1976-03-01 |
| DD109874A5 (enExample) | 1974-11-20 |
| AR205329A1 (es) | 1976-04-30 |
| CH592632A5 (enExample) | 1977-10-31 |
| DK133468B (da) | 1976-05-24 |
| ZA734244B (en) | 1974-06-26 |
| IE37834B1 (en) | 1977-10-26 |
| BG22819A3 (bg) | 1977-04-20 |
| FR2189072A1 (enExample) | 1974-01-25 |
| LU67854A1 (enExample) | 1973-08-30 |
| OA04432A (fr) | 1980-03-15 |
| SU472503A3 (ru) | 1975-05-30 |
| BE801228A (fr) | 1973-12-21 |
| AU5705173A (en) | 1974-12-19 |
| NO137196B (no) | 1977-10-10 |
| JPS4962463A (enExample) | 1974-06-17 |
| PH11606A (en) | 1978-04-12 |
| PL87665B1 (enExample) | 1976-07-31 |
| EG11039A (en) | 1977-01-31 |
| NO137196C (no) | 1978-01-18 |
| HK11276A (en) | 1976-03-12 |
| CA1017752A (en) | 1977-09-20 |
| RO71819A (ro) | 1981-01-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2928485A1 (de) | Verwendung von harnstoffderivaten als arzneimittel bei der behandlung von fettstoffwechselstoerungen | |
| EP0041215B1 (de) | Imidazoazolalkensäureamide, neue Zwischenprodukte zu ihrer Herstellung, ihre Herstellung und ihre Verwendung in Arzneimitteln | |
| EP0163260B1 (de) | Neue substituierte Pyrrolidinone, Verfahren zu ihrer Herstellung und Arzneimittel | |
| DE2319278C2 (de) | Pharmazeutisches Mittel | |
| CH646426A5 (en) | Process for the preparation of hydantoin derivatives | |
| EP0104423B1 (de) | 2-Nitro-1,1-ethendiamine, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel | |
| DE3105285A1 (de) | 2-amino-3-(hydroxy(phenyl)methyl)-phenylessigsaeure und ihre derivate, verfahren zur herstellung dieser verbindungen und therapeutische zubereitungen, welche diese verbindungen enthalten | |
| DE3309655A1 (de) | 1,2,5-thiadiazol-1-oxide und 1,1-dioxide, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel | |
| DE3532279A1 (de) | 1,4-benzoxathiin-derivate | |
| DE2230792A1 (de) | 3-amino-pyrazolone-(5), verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| EP0088323B1 (de) | Imidazothiadiazolalkencarbonsäureamide, neue Zwischenprodukte zu ihrer Herstellung, ihre Herstellung und ihre Verwendung in Arzneimitteln | |
| DE3124673A1 (de) | Subsituierte 2-amino-pyridinderivate, verfahren zu ihrer herstellung, ihre verwendung in arzneimitteln, sowie deren herstellung | |
| EP0030343B1 (de) | Substituierte 2-Amino-3,4-dihydropyridinderivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel | |
| DE2054142A1 (de) | Pyridinsulfonsauren | |
| DE2230675A1 (de) | Diuretisches und antihypertensives mittel | |
| DE3020421A1 (de) | Imidazoazolalkensaeureamide, neue zwischenprodukte zu ihrer herstellung, ihre herstellung und ihre verwendung in arzneimitteln | |
| DE3134945A1 (de) | Substituierte 2-amino-3,4-dihydropyridinderivate, verfahren zu ihrer herstellung und ihre verwendung in arzneimittel | |
| DE2427272B2 (de) | (5), Verfahren zur Herstellung sowie dieses enthaltende Arzneimittel | |
| DE2319281A1 (de) | Diuretisches und antihypertensives mittel | |
| DE2742708A1 (de) | 8-(1h-tetrazol-5-yl)-11h-pyrido eckige klammer auf 2,1-b eckige klammer zu chinazolin-11-one und verwendung derselben bei der bekaempfung von bronchialasthma | |
| DE2319280A1 (de) | 1-substituierte pyrazolone-(5), verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE2363786A1 (de) | Substituierte 5-sulfamylbenzoesaeuren, verfahren zu deren herstellung und dieselben enthaltende blutlipidspiegel senkende mittel | |
| DE3112164A1 (de) | Benzisothiazolyloxamate, verfahren zu ihrer herstellung und diese enthaltende therapeutische mittel | |
| DE2319279A1 (de) | Pyrazolone-(5), verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| AT339905B (de) | Verfahren zur herstellung von neuen piperidinderivaten und deren salzen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8130 | Withdrawal |