DE2223350A1 - Tabakzusammensetzungen und Verfahren zu deren Herstellung - Google Patents
Tabakzusammensetzungen und Verfahren zu deren HerstellungInfo
- Publication number
- DE2223350A1 DE2223350A1 DE19722223350 DE2223350A DE2223350A1 DE 2223350 A1 DE2223350 A1 DE 2223350A1 DE 19722223350 DE19722223350 DE 19722223350 DE 2223350 A DE2223350 A DE 2223350A DE 2223350 A1 DE2223350 A1 DE 2223350A1
- Authority
- DE
- Germany
- Prior art keywords
- tobacco
- compositions
- ammonium polyphosphate
- molecular weight
- binder
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 235000002637 Nicotiana tabacum Nutrition 0.000 title claims description 106
- 239000000203 mixture Substances 0.000 title claims description 95
- 238000000034 method Methods 0.000 title claims description 17
- 238000004519 manufacturing process Methods 0.000 title claims description 7
- 244000061176 Nicotiana tabacum Species 0.000 title description 2
- 241000208125 Nicotiana Species 0.000 claims description 104
- 235000019826 ammonium polyphosphate Nutrition 0.000 claims description 48
- 229920001276 ammonium polyphosphate Polymers 0.000 claims description 48
- 239000004114 Ammonium polyphosphate Substances 0.000 claims description 42
- 239000000463 material Substances 0.000 claims description 37
- 239000011230 binding agent Substances 0.000 claims description 26
- 239000011347 resin Substances 0.000 claims description 15
- 229920005989 resin Polymers 0.000 claims description 15
- 229920002678 cellulose Polymers 0.000 claims description 9
- 239000003380 propellant Substances 0.000 claims description 9
- 238000003756 stirring Methods 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 239000001913 cellulose Substances 0.000 claims description 5
- 241000196324 Embryophyta Species 0.000 claims description 4
- 238000000354 decomposition reaction Methods 0.000 claims description 4
- 239000006260 foam Substances 0.000 claims description 4
- 229920000388 Polyphosphate Polymers 0.000 claims description 3
- 238000007710 freezing Methods 0.000 claims description 3
- 230000008014 freezing Effects 0.000 claims description 3
- 239000001205 polyphosphate Substances 0.000 claims description 3
- 235000011176 polyphosphates Nutrition 0.000 claims description 3
- 239000000080 wetting agent Substances 0.000 claims description 3
- 239000004604 Blowing Agent Substances 0.000 claims description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 2
- 238000002156 mixing Methods 0.000 claims description 2
- 229920003002 synthetic resin Polymers 0.000 claims 3
- 239000000057 synthetic resin Substances 0.000 claims 3
- 239000000025 natural resin Substances 0.000 claims 2
- 239000002245 particle Substances 0.000 claims 2
- 238000002360 preparation method Methods 0.000 claims 2
- 239000000047 product Substances 0.000 description 20
- 239000002956 ash Substances 0.000 description 19
- 239000002002 slurry Substances 0.000 description 17
- 235000019504 cigarettes Nutrition 0.000 description 15
- 239000006185 dispersion Substances 0.000 description 12
- 239000011888 foil Substances 0.000 description 10
- 239000004615 ingredient Substances 0.000 description 9
- 238000006467 substitution reaction Methods 0.000 description 7
- 235000010980 cellulose Nutrition 0.000 description 6
- 230000001427 coherent effect Effects 0.000 description 6
- 235000019326 ethyl hydroxyethyl cellulose Nutrition 0.000 description 6
- 229920000896 Ethulose Polymers 0.000 description 5
- 239000001859 Ethyl hydroxyethyl cellulose Substances 0.000 description 5
- 230000000052 comparative effect Effects 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 235000002918 Fraxinus excelsior Nutrition 0.000 description 4
- 241000565357 Fraxinus nigra Species 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- 239000000853 adhesive Substances 0.000 description 4
- 230000001070 adhesive effect Effects 0.000 description 4
- 235000019506 cigar Nutrition 0.000 description 4
- 229920000609 methyl cellulose Polymers 0.000 description 4
- 239000001923 methylcellulose Substances 0.000 description 4
- 235000010981 methylcellulose Nutrition 0.000 description 4
- 235000018102 proteins Nutrition 0.000 description 4
- 108090000623 proteins and genes Proteins 0.000 description 4
- 102000004169 proteins and genes Human genes 0.000 description 4
- 235000019505 tobacco product Nutrition 0.000 description 4
- 235000013311 vegetables Nutrition 0.000 description 4
- 229920002201 Oxidized cellulose Polymers 0.000 description 3
- 229920002472 Starch Polymers 0.000 description 3
- 240000008042 Zea mays Species 0.000 description 3
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 3
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 235000005822 corn Nutrition 0.000 description 3
- MNNHAPBLZZVQHP-UHFFFAOYSA-N diammonium hydrogen phosphate Chemical compound [NH4+].[NH4+].OP([O-])([O-])=O MNNHAPBLZZVQHP-UHFFFAOYSA-N 0.000 description 3
- 125000005113 hydroxyalkoxy group Chemical group 0.000 description 3
- 230000000813 microbial effect Effects 0.000 description 3
- 229940107304 oxidized cellulose Drugs 0.000 description 3
- 229920003023 plastic Polymers 0.000 description 3
- 239000004033 plastic Substances 0.000 description 3
- 235000019698 starch Nutrition 0.000 description 3
- -1 wherein However Substances 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- LFVGISIMTYGQHF-UHFFFAOYSA-N ammonium dihydrogen phosphate Chemical compound [NH4+].OP(O)([O-])=O LFVGISIMTYGQHF-UHFFFAOYSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 235000014633 carbohydrates Nutrition 0.000 description 2
- 150000001720 carbohydrates Chemical class 0.000 description 2
- 239000012876 carrier material Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000002485 combustion reaction Methods 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 2
- 238000011049 filling Methods 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 238000001879 gelation Methods 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 235000021317 phosphate Nutrition 0.000 description 2
- 230000000717 retained effect Effects 0.000 description 2
- 230000000391 smoking effect Effects 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 244000215068 Acacia senegal Species 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 239000004254 Ammonium phosphate Substances 0.000 description 1
- 229920000945 Amylopectin Polymers 0.000 description 1
- 229920000856 Amylose Polymers 0.000 description 1
- 241001474374 Blennius Species 0.000 description 1
- 239000004135 Bone phosphate Substances 0.000 description 1
- 240000008886 Ceratonia siliqua Species 0.000 description 1
- 235000013912 Ceratonia siliqua Nutrition 0.000 description 1
- 229920002101 Chitin Polymers 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- AEMOLEFTQBMNLQ-AQKNRBDQSA-N D-glucopyranuronic acid Chemical compound OC1O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]1O AEMOLEFTQBMNLQ-AQKNRBDQSA-N 0.000 description 1
- 101100422538 Escherichia coli sat-2 gene Proteins 0.000 description 1
- 108010058643 Fungal Proteins Proteins 0.000 description 1
- IAJILQKETJEXLJ-UHFFFAOYSA-N Galacturonsaeure Natural products O=CC(O)C(O)C(O)C(O)C(O)=O IAJILQKETJEXLJ-UHFFFAOYSA-N 0.000 description 1
- 108010068370 Glutens Proteins 0.000 description 1
- 229920002527 Glycogen Polymers 0.000 description 1
- 229920002907 Guar gum Polymers 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 1
- 102000011782 Keratins Human genes 0.000 description 1
- 108010076876 Keratins Proteins 0.000 description 1
- 241000283986 Lepus Species 0.000 description 1
- 240000004658 Medicago sativa Species 0.000 description 1
- 235000017587 Medicago sativa ssp. sativa Nutrition 0.000 description 1
- 101100049740 Mus musculus Wrnip1 gene Proteins 0.000 description 1
- 108010058846 Ovalbumin Proteins 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 108010013381 Porins Proteins 0.000 description 1
- 241000220317 Rosa Species 0.000 description 1
- 108010073771 Soybean Proteins Proteins 0.000 description 1
- 241000006364 Torula Species 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 229910000387 ammonium dihydrogen phosphate Inorganic materials 0.000 description 1
- 229910000148 ammonium phosphate Inorganic materials 0.000 description 1
- 229940010556 ammonium phosphate Drugs 0.000 description 1
- 235000019289 ammonium phosphates Nutrition 0.000 description 1
- 238000000149 argon plasma sintering Methods 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GEHJBWKLJVFKPS-UHFFFAOYSA-N bromochloroacetic acid Chemical compound OC(=O)C(Cl)Br GEHJBWKLJVFKPS-UHFFFAOYSA-N 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229920001525 carrageenan Polymers 0.000 description 1
- 235000010418 carrageenan Nutrition 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- 239000012461 cellulose resin Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 229910000388 diammonium phosphate Inorganic materials 0.000 description 1
- 235000019838 diammonium phosphate Nutrition 0.000 description 1
- 229940116349 dibasic ammonium phosphate Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 229920003089 ethylhydroxy ethyl cellulose Polymers 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 239000004872 foam stabilizing agent Substances 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 239000004088 foaming agent Substances 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 229940097043 glucuronic acid Drugs 0.000 description 1
- 235000021312 gluten Nutrition 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 229940096919 glycogen Drugs 0.000 description 1
- 239000000665 guar gum Substances 0.000 description 1
- 235000010417 guar gum Nutrition 0.000 description 1
- 229960002154 guar gum Drugs 0.000 description 1
- 239000001863 hydroxypropyl cellulose Substances 0.000 description 1
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000002075 main ingredient Substances 0.000 description 1
- 235000019837 monoammonium phosphate Nutrition 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000003415 peat Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229920002401 polyacrylamide Polymers 0.000 description 1
- 229920000223 polyglycerol Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 102000007739 porin activity proteins Human genes 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000007962 solid dispersion Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 238000001248 thermal gelation Methods 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A24—TOBACCO; CIGARS; CIGARETTES; SIMULATED SMOKING DEVICES; SMOKERS' REQUISITES
- A24B—MANUFACTURE OR PREPARATION OF TOBACCO FOR SMOKING OR CHEWING; TOBACCO; SNUFF
- A24B15/00—Chemical features or treatment of tobacco; Tobacco substitutes, e.g. in liquid form
- A24B15/10—Chemical features of tobacco products or tobacco substitutes
- A24B15/12—Chemical features of tobacco products or tobacco substitutes of reconstituted tobacco
-
- A—HUMAN NECESSITIES
- A24—TOBACCO; CIGARS; CIGARETTES; SIMULATED SMOKING DEVICES; SMOKERS' REQUISITES
- A24B—MANUFACTURE OR PREPARATION OF TOBACCO FOR SMOKING OR CHEWING; TOBACCO; SNUFF
- A24B15/00—Chemical features or treatment of tobacco; Tobacco substitutes, e.g. in liquid form
- A24B15/10—Chemical features of tobacco products or tobacco substitutes
- A24B15/12—Chemical features of tobacco products or tobacco substitutes of reconstituted tobacco
- A24B15/14—Chemical features of tobacco products or tobacco substitutes of reconstituted tobacco made of tobacco and a binding agent not derived from tobacco
-
- A—HUMAN NECESSITIES
- A24—TOBACCO; CIGARS; CIGARETTES; SIMULATED SMOKING DEVICES; SMOKERS' REQUISITES
- A24B—MANUFACTURE OR PREPARATION OF TOBACCO FOR SMOKING OR CHEWING; TOBACCO; SNUFF
- A24B15/00—Chemical features or treatment of tobacco; Tobacco substitutes, e.g. in liquid form
- A24B15/10—Chemical features of tobacco products or tobacco substitutes
- A24B15/16—Chemical features of tobacco products or tobacco substitutes of tobacco substitutes
Landscapes
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Manufacture Of Tobacco Products (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US14319371A | 1971-05-13 | 1971-05-13 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2223350A1 true DE2223350A1 (de) | 1972-11-23 |
Family
ID=22503001
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19722223350 Pending DE2223350A1 (de) | 1971-05-13 | 1972-05-12 | Tabakzusammensetzungen und Verfahren zu deren Herstellung |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3782392A (enExample) |
| CA (1) | CA959366A (enExample) |
| DE (1) | DE2223350A1 (enExample) |
| FR (1) | FR2139466A5 (enExample) |
| GB (1) | GB1341525A (enExample) |
| IT (1) | IT1050211B (enExample) |
| ZA (1) | ZA723210B (enExample) |
Families Citing this family (69)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU1871276A (en) * | 1975-11-11 | 1978-04-20 | Brown & Williamson Tobacco Corp | Tobacco |
| US5115823A (en) * | 1990-12-20 | 1992-05-26 | Philip Morris Incorporated | Flavor-enhancing smoking filter |
| US5377698A (en) * | 1993-04-30 | 1995-01-03 | Brown & Williamson Tobacco Corporation | Reconstituted tobacco product |
| US7308898B2 (en) * | 2002-11-19 | 2007-12-18 | R.J. Reynolds Tobacco Company | Process for making a bandcast tobacco sheet and smoking article therefrom |
| US20050039767A1 (en) * | 2002-11-19 | 2005-02-24 | John-Paul Mua | Reconstituted tobacco sheet and smoking article therefrom |
| US7661433B2 (en) * | 2002-12-31 | 2010-02-16 | Smokey Mountain Chew, Inc. | Smokeless non-tobacco composition and method for making same |
| US7913700B2 (en) * | 2002-12-31 | 2011-03-29 | Smokey Mountain Chew, Inc. | Nontobacco moist snuff composition |
| RU2290021C1 (ru) * | 2005-06-27 | 2006-12-27 | Олег Иванович Квасенков | Способ производства ароматизированной взорванной табачной жилки |
| RU2290026C1 (ru) * | 2005-06-27 | 2006-12-27 | Олег Иванович Квасенков | Способ получения ароматизированной вспученной табачной жилки |
| RU2290042C1 (ru) * | 2005-06-27 | 2006-12-27 | Олег Иванович Квасенков | Способ производства курительного табачного изделия с пониженным содержанием смолы и никотина |
| RU2290024C1 (ru) * | 2005-06-27 | 2006-12-27 | Олег Иванович Квасенков | Способ получения ароматизированной экспандированной табачной жилки |
| RU2290027C1 (ru) * | 2005-06-27 | 2006-12-27 | Олег Иванович Квасенков | Способ производства ароматизированной расширенной табачной жилки |
| RU2290020C1 (ru) * | 2005-06-27 | 2006-12-27 | Олег Иванович Квасенков | Способ обработки табачной жилки |
| RU2290022C1 (ru) * | 2005-06-27 | 2006-12-27 | Олег Иванович Квасенков | Способ получения ароматизированной взорванной табачной жилки |
| RU2290023C1 (ru) * | 2005-06-27 | 2006-12-27 | Олег Иванович Квасенков | Способ производства ароматизированной экспандированной табачной жилки |
| RU2290025C1 (ru) * | 2005-06-27 | 2006-12-27 | Олег Иванович Квасенков | Способ производства ароматизированной вспученной табачной жилки |
| RU2290032C1 (ru) * | 2005-06-28 | 2006-12-27 | Олег Иванович Квасенков | Способ производства ароматизированной экспандированной табачной жилки |
| RU2290030C1 (ru) * | 2005-06-28 | 2006-12-27 | Олег Иванович Квасенков | Способ получения ароматизированной экспандированной табачной жилки |
| RU2290028C1 (ru) * | 2005-06-28 | 2006-12-27 | Олег Иванович Квасенков | Способ получения ароматизированной вспученной табачной жилки |
| RU2290029C1 (ru) * | 2005-06-28 | 2006-12-27 | Олег Иванович Квасенков | Способ получения ароматизированной вспученной табачной жилки |
| RU2290031C1 (ru) * | 2005-06-28 | 2006-12-27 | Олег Иванович Квасенков | Способ получения ароматизированной расширенной табачной жилки |
| RU2290035C1 (ru) * | 2005-07-04 | 2006-12-27 | Олег Иванович Квасенков | Способ получения ароматизированной экспандированной табачной жилки |
| RU2290039C1 (ru) * | 2005-07-04 | 2006-12-27 | Олег Иванович Квасенков | Способ производства ароматизированной взорванной табачной жилки |
| RU2290038C1 (ru) * | 2005-07-04 | 2006-12-27 | Олег Иванович Квасенков | Способ получения ароматизированной взорванной табачной жилки |
| RU2290037C1 (ru) * | 2005-07-04 | 2006-12-27 | Олег Иванович Квасенков | Способ производства ароматизированной расширенной табачной жилки |
| RU2290034C1 (ru) * | 2005-07-04 | 2006-12-27 | Олег Иванович Квасенков | Способ получения ароматизированной вспученной табачной жилки |
| RU2290043C1 (ru) * | 2005-07-04 | 2006-12-27 | Олег Иванович Квасенков | Способ получения курительного табачного изделия с пониженным содержанием смолы и никотина |
| RU2290045C1 (ru) * | 2005-07-04 | 2006-12-27 | Олег Иванович Квасенков | Способ производства курительного табачного изделия с пониженным содержанием смолы и никотина |
| RU2290033C1 (ru) * | 2005-07-04 | 2006-12-27 | Олег Иванович Квасенков | Способ производства ароматизированной вспученной табачной жилки |
| RU2290036C1 (ru) * | 2005-07-04 | 2006-12-27 | Олег Иванович Квасенков | Способ производства ароматизированной экспандированной табачной жилки |
| RU2290040C1 (ru) * | 2005-07-08 | 2006-12-27 | Олег Иванович Квасенков | Способ производства ароматизированной экспандированной табачной жилки |
| RU2290041C1 (ru) * | 2005-07-08 | 2006-12-27 | Олег Иванович Квасенков | Способ получения ароматизированной вспученной табачной жилки |
| RU2290044C1 (ru) * | 2005-07-08 | 2006-12-27 | Олег Иванович Квасенков | Способ производства курительного табачного изделия с пониженным содержанием смолы и никотина |
| RU2290046C1 (ru) * | 2005-07-12 | 2006-12-27 | Олег Иванович Квасенков | Способ производства курительного табачного изделия с пониженным содержанием смолы и никотина |
| RU2306815C1 (ru) * | 2006-03-10 | 2007-09-27 | Олег Иванович Квасенков | Способ получения ароматизированной экспандированной табачной жилки |
| RU2304905C1 (ru) * | 2006-03-10 | 2007-08-27 | Олег Иванович Квасенков | Способ изготовления ароматизированной взорванной табачной жилки |
| RU2304912C1 (ru) * | 2006-03-13 | 2007-08-27 | Олег Иванович Квасенков | Способ изготовления ароматизированной табачной жилки |
| RU2306816C1 (ru) * | 2006-03-14 | 2007-09-27 | Олег Иванович Квасенков | Способ производства расширенной табачной жилки |
| RU2304910C1 (ru) * | 2006-03-15 | 2007-08-27 | Олег Иванович Квасенков | Способ изготовления ароматизированной расширенной табачной жилки |
| RU2306830C1 (ru) * | 2006-03-15 | 2007-09-27 | Олег Иванович Квасенков | Способ получения ароматизированной экспандированной табачной жилки |
| RU2304907C1 (ru) * | 2006-03-15 | 2007-08-27 | Олег Иванович Квасенков | Способ обработки табачной жилки |
| RU2304906C1 (ru) * | 2006-03-15 | 2007-08-27 | Олег Иванович Квасенков | Способ выработки ароматизированной вспученной табачной жилки |
| RU2306829C1 (ru) * | 2006-03-15 | 2007-09-27 | Олег Иванович Квасенков | Способ изготовления ароматизированной экспандированной табачной жилки |
| RU2306817C1 (ru) * | 2006-03-15 | 2007-09-27 | Олег Иванович Квасенков | Способ получения ароматизированной табачной жилки |
| RU2306831C1 (ru) * | 2006-03-16 | 2007-09-27 | Олег Иванович Квасенков | Способ изготовления ароматизированной взорванной табачной жилки |
| RU2307545C1 (ru) * | 2006-03-16 | 2007-10-10 | Олег Иванович Квасенков | Способ производства экспандированной табачной жилки |
| RU2304908C1 (ru) * | 2006-03-16 | 2007-08-27 | Олег Иванович Квасенков | Способ получения вспученной табачной жилки |
| RU2304904C1 (ru) * | 2006-03-16 | 2007-08-27 | Олег Иванович Квасенков | Способ получения ароматизированной табачной жилки |
| RU2305478C1 (ru) * | 2006-03-17 | 2007-09-10 | Олег Иванович Квасенков | Способ производства расширенной табачной жилки |
| RU2304909C1 (ru) * | 2006-03-17 | 2007-08-27 | Олег Иванович Квасенков | Способ увеличения объема табачной жилки |
| RU2306803C1 (ru) * | 2006-03-17 | 2007-09-27 | Олег Иванович Квасенков | Способ изготовления ароматизированной вспученной табачной жилки |
| RU2306832C1 (ru) * | 2006-03-22 | 2007-09-27 | Олег Иванович Квасенков | Способ изготовления расширенной табачной жилки |
| RU2308858C1 (ru) * | 2006-03-22 | 2007-10-27 | Олег Иванович Квасенков | Способ изготовления ароматизированной табачной жилки |
| RU2306054C1 (ru) * | 2006-03-23 | 2007-09-20 | Олег Иванович Квасенков | Способ изготовления ароматизированной вспученной табачной жилки |
| RU2328178C1 (ru) * | 2006-12-11 | 2008-07-10 | Олег Иванович Квасенков | Способ получения кретека |
| RU2327394C1 (ru) * | 2006-12-11 | 2008-06-27 | Олег Иванович Квасенков | Способ получения кретека с пониженным содержанием смолы и никотина |
| RU2326561C1 (ru) * | 2006-12-11 | 2008-06-20 | Олег Иванович Квасенков | Способ изготовления кретека легкого типа |
| RU2327392C1 (ru) * | 2006-12-11 | 2008-06-27 | Олег Иванович Квасенков | Способ изготовления кретека |
| RU2326558C1 (ru) * | 2006-12-11 | 2008-06-20 | Олег Иванович Квасенков | Способ производства легкого кретека |
| RU2326565C1 (ru) * | 2006-12-12 | 2008-06-20 | Олег Иванович Квасенков | Способ получения кретека с пониженным содержанием смолы и никотина |
| RU2326566C1 (ru) * | 2006-12-12 | 2008-06-20 | Олег Иванович Квасенков | Способ производства кретека с пониженным содержанием смолы и никотина |
| RU2326571C1 (ru) * | 2006-12-12 | 2008-06-20 | Олег Иванович Квасенков | Способ изготовления кретека |
| RU2326563C1 (ru) * | 2006-12-12 | 2008-06-20 | Олег Иванович Квасенков | Способ производства кретека легкого типа |
| RU2326564C1 (ru) * | 2006-12-12 | 2008-06-20 | Олег Иванович Квасенков | Способ выработки кретека с пониженным содержанием смолы и никотина |
| RU2326562C1 (ru) * | 2006-12-12 | 2008-06-20 | Олег Иванович Квасенков | Способ выработки кретека легкого типа |
| RU2326567C1 (ru) * | 2006-12-12 | 2008-06-20 | Олег Иванович Квасенков | Способ изготовления легкого кретека |
| RU2326568C1 (ru) * | 2006-12-12 | 2008-06-20 | Олег Иванович Квасенков | Способ производства легкого кретека |
| US9131732B1 (en) * | 2012-05-18 | 2015-09-15 | Gerald Hoffius | Non-addictive smoking composition and corn-cob pipe kit |
| KR20250122506A (ko) * | 2023-01-16 | 2025-08-13 | 제이티 인터내셔널 소시에떼 아노님 | 담배 제품 및 이의 제조 방법 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1879128A (en) * | 1929-10-16 | 1932-09-27 | Ernest W Desper | Cigarette |
| US3364935A (en) * | 1961-08-11 | 1968-01-23 | American Mach & Foundry | Tobacco product and process for making same |
| US3459195A (en) * | 1966-06-16 | 1969-08-05 | Philip Morris Inc | Reinforced reconstituted tobacco sheet |
| US3528434A (en) * | 1968-04-12 | 1970-09-15 | American Mach & Foundry | Method of making reconstituted tobacco |
-
1971
- 1971-05-13 US US00143193A patent/US3782392A/en not_active Expired - Lifetime
-
1972
- 1972-05-09 GB GB2162072A patent/GB1341525A/en not_active Expired
- 1972-05-09 CA CA141,733A patent/CA959366A/en not_active Expired
- 1972-05-10 ZA ZA723210A patent/ZA723210B/xx unknown
- 1972-05-12 IT IT50207/72A patent/IT1050211B/it active
- 1972-05-12 DE DE19722223350 patent/DE2223350A1/de active Pending
- 1972-05-12 FR FR7216983A patent/FR2139466A5/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2139466A5 (enExample) | 1973-01-05 |
| CA959366A (en) | 1974-12-17 |
| US3782392A (en) | 1974-01-01 |
| GB1341525A (enExample) | 1973-12-25 |
| ZA723210B (en) | 1973-02-28 |
| IT1050211B (it) | 1981-03-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2223350A1 (de) | Tabakzusammensetzungen und Verfahren zu deren Herstellung | |
| DE69728970T2 (de) | Rauchbares füllmaterial für rauchwaren | |
| DE69520708T2 (de) | Rauchartikel | |
| DE69726026T2 (de) | Rauchbares füllmaterial für rauchwaren | |
| DE2727018C3 (de) | Verfahren zur Behandlung von Rauchmaterial | |
| DE1792740C3 (de) | Verfahren zur Herstellung eines brennbaren Materials | |
| DE2358657C3 (de) | Rauchtabakersatz oder -regenerat | |
| DE2651538A1 (de) | Tabakersatz mit verbesserten ascheeigenschaften | |
| DE2430173A1 (de) | Rauchgemische | |
| DE2828415A1 (de) | Rekonstituierte tabakzusammensetzung und verfahren zu ihrer herstellung | |
| DE2931088A1 (de) | Modifiziertes cellulose-rauchmaterial und verfahren zu seiner herstellung | |
| DE2114084A1 (de) | Raucherzeugendes Gemisch und Verfahren zu dessen Herstellung | |
| DE1692933A1 (de) | Verfahren zur Herstellung einer kuenstlich zusammengesetzten Tabakfolie | |
| DE2244030A1 (de) | Rauchgemisch | |
| CH643120A5 (de) | Verfahren zur herstellung eines rauchbaren materials. | |
| DE2246221A1 (de) | Rauchmaterial, verfahren zu dessen herstellung und daraus hergestellte raucherzeugnisse | |
| DE2032377C3 (de) | Verfahren zur Herstellung eines rauchbaren Produktes | |
| DE2356706A1 (de) | Rauchgemische | |
| DE2206859A1 (de) | Tabakwaren mit verbessertem Geschmack und Verfahren zu ihrer Herstellung | |
| DE2552152A1 (de) | Boroxid, boroxysaeuren und ammonium-, alkalimetall- oder erdalkalimetallsalze von boroxysaeuren enthaltender tabakersatz | |
| DE1517246A1 (de) | Verfahren zur Herstellung von Tabakprodukten | |
| DE69805725T2 (de) | Verfahren zur Herstellung einer irrevesiblen hitzekoagulierten Blattabakprotein enthaltenden Glucan Folie und Verfahren zur Herstellung eines Tabakaromaerzeugenden Mediums mittels eines irrevesiblen hitzekoagulierten Glucan Folie | |
| DE2429783A1 (de) | Tabakerzeugnis | |
| DE2532102B2 (de) | Verwendung eines thermisch gelierbaren polysaccharids vom typ des beta- 1,3-glucans zur herstellung von tabak- und tabakfreien rauchprodukten | |
| DE2113971A1 (de) | Raucherzeugendes Gemisch |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHA | Expiration of time for request for examination |